select all names that correspond to an isomer of 4-isopropylheptane. question options: 3,4-diethylhexane 4-(methylethyl)heptane decane 2,2,3-trimethyloctane 2-methylnonane

Answers

Answer 1

All four compounds are isomers of 4-isopropylheptane, and each isomer has its own unique properties, such as boiling point, melting point, solubility, and other physical properties.

The names of the isomers of 4-isopropylheptane are 3,4-diethylhexane, 4-(methylethyl)heptane, 2,2,3-trimethyloctane, and 2-methylnonane. 3,4-diethylhexane and 4-(methylethyl)heptane are structural isomers, which means that the molecules have different structural formulas and connectivities. 3,4-diethylhexane has two ethyl groups attached to the fourth carbon, while 4-(methylethyl)heptane has one methyl and one ethyl group attached to the fourth carbon. 2,2,3-trimethyloctane and 2-methylnonane are both positional isomers, meaning that the molecules have the same structural formula but the groups attached to the carbon chain are arranged differently. 2,2,3-trimethyloctane has three methyl groups attached to the second, third, and fourth carbons, while 2-methylnonane has two methyl groups attached to the second and ninth carbons.

Learn more about 4-isopropylheptane here:

https://brainly.com/question/30333697

#SPJ4


Related Questions

the smallest whole number ratio of elects in a compound

Answers

Answer: The smallest whole-number ratio of the atoms in a compound represents the molar ratio of the elements in which they are combined. For example, Water is a compound. The chemical formula of water is H2O H 2 O . In water, H and O elements are combined in the molar ratio of 2:1.Explanation:

Answer:

empericalformula

The energy required to dissociate the Cl2 molecule to Cl atoms is 239 kJ/mol Cl2. If the dissociation of a Cl2 molecule were accomplished by the absorption of a single photon whose energy was exactly the quantity required, what would be its wavelength (in meters)?​

Answers

Explanation:

The energy of a single photon can be calculated using the equation E = hc/λ, where E is the energy of the photon, h is Planck's constant (6.626 x 10^-34 J.s), c is the speed of light (2.998 x 10^8 m/s), and λ is the wavelength of the photon.

To dissociate one mole of Cl2 molecules, we need 239 kJ of energy. This corresponds to 239,000 J/mol of Cl2.

Now we can use the relationship between energy and the number of photons absorbed: E = Nhf, where N is the number of photons absorbed, h is Planck's constant, and f is the frequency of the absorbed photons.

We can relate the frequency of the absorbed photon to its wavelength using c = λf. Solving for f gives f = c/λ.

Combining these equations, we get E = Nh(c/λ), or N = E/(hc/λ). Substituting the value of E for the energy required to dissociate one mole of Cl2, we get:

N = (239,000 J/mol) / [(6.626 x 10^-34 J.s) x (2.998 x 10^8 m/s) / λ]

Solving for λ, we get:

λ = hc / (239,000 J/mol) = (6.626 x 10^-34 J.s x 2.998 x 10^8 m/s) / 239,000 J/mol

λ = 8.44 x 10^-7 m

Therefore, the wavelength of the photon required to dissociate one Cl2 molecule is approximately 8.44 x 10^-7 meters (or 844 nanometers).

The radioactivity due to carbon-14 measured in a piece of a wood from an ancient site was found to produce 20 counts per minute from a given sample, whereas the same amount of carbon from a piece of living wood produced 160 counts per minute. The half-life of carbon-14, a beta emitter, is 5730 y. The age of the artifact is closest to

Answers

Answer:

The answer is "17200 years".

Explanation:

Given:

A=20 countsminuteAo=160 countsminute

Let the half-life of carbon-14, is beta emitter, is T=5730 years

Constant decay  w=0.693T

=1.209×104 1year

The artifact age t=?

A=Aoewtewt=AAowt=lnAAo=2.079t=1.7199×104 years 17200 years

Which of the following mixtures is best separated by the use of a separating funnel?
methane and water
ethyl ethanoate and water
ethanol and water
ethanoic acid and water

Answers

Answer:

ethyl ethanoate and water

Explanation:

At the point when one fluid doesn't blend in with another yet glides on top of it, an isolating pipe can be utilized to isolate the two fluids. Oil glides on water. This combination can be isolated utilizing an isolating channel as demonstrated on the following page.  

Ethyl liquor and water are two miscible fluids.   Refining is a cycle that can be utilized to isolate an unadulterated fluid from a combination of fluids. An isolating channel can be utilized to isolate the parts of the combination of immiscible fluids.

The answer is ethyl ethanoate and water. Hope this helps you!

How is heat involved in chemical reactions and processes

Answers

Most chemical reactions involve the breaking and formation of chemical bonds. It takes energy to break a chemical bond but energy is released when chemical bonds are formed. If more energy is released than consumed, then the chemical reaction evolves heat and is said to be exothermic.

(Have a good day!)

Answer:

Most chemical reactions involve the breaking and formation of chemical bonds. It takes energy to break a chemical bond but energy is released when chemical bonds are formed. If more energy is released than consumed, then the chemical reaction evolves heat and it called exothermic.

1. Mass of the empty Dish 167.0 g
2. Mass of the dish plus kernel before heating 169.0 g
3. Mass of the kernels before heating 2.0 g
4. Mass of the dish plus popped corn 168.8 g
5. Mass of the popped corn 1.8 g
6. Mass of the water driven 0.2 g
7. Mass percent of water in the popcorn 10%

Given that a sample of unpopped popcorn weighed 58.2 grams and after popping the popped kernels weighed 51.1 grams, calculate the percent water in the unpopped popcorn.

Answers

The mass of water driven off during popping can be calculated by subtracting the mass of the popped corn and the dish from the mass of the dish and kernel before heating.

What is  heating ?

Heating is the process of increasing the temperature of a substance or object, typically using an external energy source such as heat, radiation, or electrical current. The heat energy is transferred to the object or substance, causing its particles to vibrate and move faster, which results in an increase in temperature. Heating is commonly used in a wide range of applications, including cooking, chemical reactions, industrial processes, and space heating.

What is  cooking?

Cooking is the process of preparing food by applying heat, typically using methods such as baking, roasting, grilling, frying, boiling, simmering, steaming, or microwaving. The aim of cooking is to make food more palatable and easier to digest, as well as to kill harmful bacteria and other microorganisms that may be present in raw food. Cooking can also enhance the nutritional value of some foods by making certain nutrients more bioavailable.

To know more  about heating visit :

https://brainly.com/question/1429452

#SPJ1

The following are placed in a beaker weighing 39.457 g:
2.689 g of NaCl, 1.26 g of sand and 5.0 g water
What is the final mass of the beaker?

Answers

Answer:

48.4 g

Explanation:

Element A has two isotopes. The first isotope is present 18.18% of the time and has a mass of
147.99. The second isotope has a mass of 127.76. Calculate the atomic mass of element A. (To two
decimals places)

Answers

The atomic mass of element A, given that the first isotope has abundance of 18.18% and a mass of 147.99, is 131.43 amu

How do i determine the atomic mass of element A?

From the question given above, the following data were obtained:

Abundance of 1st isotope (1st%) = 18.18%Mass of 1st isotope = 147.99Mass of 2nd isotope = 127.76 Abundance of 2nd isotope (2nd%) = 100 - 18.18 = 81.82%Atomic mass of element A=?

The atomic mass of the element A can be obtain as illustrated below:

Atomic mass = [(Mass of 1st × 1st%) / 100] + [(Mass of 2nd × 2nd%) / 100]

Inputting the given parameters, we have:

Atomic mass = [(147.99 × 18.18) / 100] + [(127.76 × 81.82) / 100]

Atomic mass = 26.90 + 104.53

Atomic mass = 131.43 amu

Thus, the atomic mass of element A obtained from the above calaculation is 131.43 amu

Learn more about average atomic mass:

https://brainly.com/question/24185848

#SPJ1

The observation that 20g of hydrogen gas always combines with 160g of oxygen gas to form 180g of water, even when there is more than 160g of oxygen present in the reaction container it illustrates the law of?
A. Definite proportions
B. Ideal Gasses
C. Multiple proportions
D. Excess reactants

Answers

Answer:

The answer is most likely A. Definite proportions

Explanation:

The Law of Definite proportions states that a given chemical compound always contains its component elements in fixed ratio (by mass) and does not depend on its source and method of preparation.

1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5​

Answers

1. The IUPAC name of N is nitrogen.

2. Nitrogen dioxide

3.The IUPAC name of O is oxygen

4.The IUPAC name of OH is hydroxyl.

The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.

IUPAC names for the given compounds are:1.1. N: Nitrogen

The IUPAC name of N is nitrogen.

It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide

Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.

The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen

Explanation: The IUPAC name of O is oxygen.

It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.

X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.

Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.

It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.

for more question on electronic configuration

https://brainly.com/question/26084288

#SPJ8

Note: The complete question is given below

Provide the IUPAC names for the following compounds:

CH3CH2CH(CH3)CH2CH2CH2CH3

C6H5CH(CH3)2

H2NCH2CH2CH2CH2CH2NH2

CH3CH2CH2CH2CH2OH

CH3CH2CH2CHOHCH3

What is the molarity of a 3.00 L solution that contains 0.400 mol FeCl3?

1.20 M

0.266 M

7.50 M

0.133 M

Answers

Answer: 0.133 mol/l

Explanation: molality = concentration = 0.400 mol/3.0 l

8. Making soap is what type of reaction is it
Chemical
Physical
Phase change
all of the above

Answers

Answer:

chemical reaction

Explanation:

Answer:

Making soap can be considered a chemical reaction.

Explanation:

In the process of making soap, a reaction takes place between a fat or oil and an alkali, such as lye (sodium hydroxide), which results in the formation of soap molecules and glycerol. This reaction is known as saponification. The change in the composition of the reactants to form a new substance is a chemical change, not a physical change or a phase change.

about how much of the visible side of the moon is lit up during a full moon?
A. Three fourths
B. One fourth
C. None of it
D. All of it

Answers

Answer:

D

Explanation:

i learned this in elementary

Write the equation for the equilibrium constant (K) of the reaction studied in this exercise.

2C04 2- (ag) + 2Ht (ag) = CI20, 2- (ag) + H20(1)

Answers

The equation for the equilibrium constant (K) of the reaction studied in this exercise can be written as follows: K = ([CI20, 2-] * [H20(1)]) / ([C042-] * [Ht])

In this equation, the concentrations of the species involved in the reaction are represented by the square brackets [ ]. The subscripts indicate the stoichiometric coefficients of each species in the balanced chemical equation.

The reaction being studied involves the following species:

C042- (ag) + 2Ht (ag) = CI20, 2- (ag) + H20(1)

In the equilibrium constant expression, the concentration of CI20, 2- is multiplied by the concentration of H20(1) and divided by the product of the concentrations of C042- and Ht. The stoichiometric coefficients in the balanced equation are used as exponents for the concentrations of the respective species.

It is important to note that the concentrations used in the equilibrium constant expression should be in molar units (mol/L) or expressed as partial pressures for gases.

Additionally, the equilibrium constant is specific to a given temperature, and its value provides information about the relative amounts of reactants and products at equilibrium.

For more such question on  equilibrium constant visit:

https://brainly.com/question/3159758

#SPJ8

What is the compound name for MgCO ?

Answers

Magnesium carbonate

The meaning of the word symptom:​

Answers

The word "symptom" refers to a specific manifestation or indication of a condition, disease, or disorder that is experienced or observed by an individual.

Symptoms are subjective or objective changes in the body's normal functioning that may be recognized as abnormal, uncomfortable, or problematic. Symptoms can manifest in various ways depending on the nature of the underlying condition. They can be physical, such as pain, rash, cough, fever, or fatigue, indicating an illness or injury affecting the body. Symptoms can also be psychological, such as anxiety, depression, or confusion, reflecting disturbances in mental health.

Symptoms serve as important clues for medical professionals to identify and diagnose diseases or disorders. They provide valuable information about the nature, severity, and progression of an illness, helping healthcare providers formulate appropriate treatment plans. Additionally, symptoms may also be important for individuals to self-assess their own health status and seek appropriate medical attention.

It is essential to note that symptoms alone may not provide a definitive diagnosis, as they can overlap across different conditions. Further evaluation, including medical tests and examinations, is often necessary to confirm a diagnosis and determine the appropriate course of action.

for more such questions on symptom

https://brainly.com/question/21078887

#SPJ8

In a reaction between vinegar and antacid tablets, the antacid is the limiting reagent. cm of gas. At constant pressure and temperature, three tablets produce 600 cm³ What volume will four tablets produce? 300 cm³ 600 cm³ 800 cm³ 3 1,200 cm³ 3​

Answers

If in a reaction between vinegar and antacid tablets, the antacid is the limiting reagent. cm of gas. At constant pressure and temperature, three tablets produce 600 cm³ . The  volume that four tablets will produce is: C. 800 cm³.

What volume will four tablets produce?

Since the antacid is the limiting reagent, the amount of gas produced will be directly proportional to the number of tablets used.

We know that three tablets produced 600 cm³ of gas. Therefore, we can set up a proportion:

3 tablets produce 600 cm³ of gas

4 tablets produce x cm³ of gas

To solve for x, we can use cross-multiplication:

3 tablets × x cm³ of gas = 4 tablets × 600 cm³ of gas

3x = 2400

x = 800 cm³

Therefore the answer is C. 800 cm³.

Learn more about volume here:https://brainly.com/question/463363

#SPJ1

8.0g of certain gas occupies 5.6 L at STP.
A) How many moles of gas are present?
B) What is the molar mass of the gas?
C) What is the common atmospheric gas was collected?

Answers

Answer:

A) Using the ideal gas law, we can calculate the number of moles of gas present:

```

PV = nRT

```

where:

* P = pressure (atm) = 1 atm

* V = volume (L) = 5.6 L

* n = number of moles of gas

* R = ideal gas constant = 0.08206 L atm / mol K

* T = temperature (K) = 273.15 K

Solving for n, we get:

```

n = (P * V) / RT

```

```

n = (1 atm * 5.6 L) / (0.08206 L atm / mol K * 273.15 K)

```

```

n = 0.25 mol

```

Therefore, there are 0.25 moles of gas present.

B) The molar mass of the gas can be calculated by dividing the mass of the gas (8.0 g) by the number of moles of gas (0.25 mol):

```

Molar mass = Mass / n

```

```

Molar mass = 8.0 g / 0.25 mol

```

```

Molar mass = 32 g/mol

```

The molar mass of the gas is 32 g/mol.

C) The common atmospheric gas with a molar mass of 32 g/mol is oxygen (O2). Therefore, the gas that was collected is oxygen.

Explanation:

Please help:

I need a balance equation showing how acids react with metals ASAP

I hope you can help me

Answers

Answers:

Na+ HCl=NaCl+H2

Acids( HCl) reacts with Metal( Na) to give hydrogen gas(H2) and salt NaCL

Not sure how to solve this

Not sure how to solve this

Answers

Answer:

1, cof3  cobalt (lll) fluoride

2, cof2 cobalt (ll) fluoride

3,rbf   rubidium fluoride

4, srf2  strontium fluoride

Explanation:

i think it help u

4. The volume of a liquid sample is measured as 15.43 L. We need to know the volume in
mL.
3.
b.
What conversion factor would be used in the calculation?
Calculate the volume in mL.

Answers

Conversion factor used to convert volume is 1L = 1000 mL.

15.43L = 15430mL

The same attribute is expressed using a unit conversion but in a different unit of measurement. For instance, time can be expressed in minutes rather than hours, and distance can be expressed in kilometers, feet, or any other measurement unit instead of miles. Measurements are frequently offered in one set of units, like feet, but are required in another set, like chains. A conversion factor is a mathematical equation that facilitates an equal exchange of feet for chains.

A conversion factor is a number that is used to multiply or divide one set of units into another. If a conversion is required, it must be done using the correct conversion factor to get an identical value.

To learn more about the Conversion factors please visit-
https://brainly.com/question/28366871
#SPJ9

Acetylene (C2H2) gas and oxygen (02) gas react to form carbon dioxide (CO2) gas and water (H20) vapor. Suppose you have 2.0 mol of C,H, and 1.0 mol
of o, in a reactor
Calculate the largest amount of CO, that could be produced. Round your answer to the nearest 0.1 mol.

Answers

The largest amount of CO₂ produced when 2 moles of C₂H₂ reacted with 1 mole of O₂ is 0.8 mole

We'll begin by writing the balanced equation for the reaction. This is given below:

       2C₂H₂ + 5O₂ —> 4CO₂ + 2H₂O

            2     :   5

            2     :   1    

     

From the balanced equation above,

We can see that O₂ is the limiting reactant as lesser amount of it is available.

Finally, we shall determine the largest amount of CO₂ produced by using the limiting reactant as illustrated below:

From the balanced equation above,

5 moles of O₂ reacted to produce 4 moles of CO₂.

Therefore,

1 mole of O₂ will react to produce = 4/5 = 0.8 mole of CO₂.

Thus, the largest amount of CO₂ produced from the reaction is 0.8 mole

Learn more: https://brainly.com/question/25299182

The theoretical yield of a reaction is the amount of product obtained if the limiting reactant is completely
converted to product.
Consider the reaction:
H₂(g) + I₂(s) - 2 HI(g)
If 15.28 g H₂ is mixed with 18.82 g I₂, calculate the theoretical yield (g) of HI produced by the reaction.

The theoretical yield of a reaction is the amount of product obtained if the limiting reactant is completelyconverted

Answers

The theoretical yield (g) of HI produced by the reaction is 18.93 g.

The reaction is given as :

H₂(g) + I₂(s)   ---->   2 HI(g)

given that ;

mass of H₂ = 15.28 g

mass of I₂ = 18.82 g

moles of H₂ = mass / molar mass

                    = 15.28 / 2

                    = 7.64 mol

moles of  I₂ = mass / molar mass

                    = 18.82 / 253.80

                    = 0.074 mol

therefore the  I₂ is the limiting reactant. so, the amount of HI produced is depend upon the  I₂.

1 mole of  I₂ produce = 2 mole of HI

0.074 mole of  I₂ = 2 × 0.074 = 0.148 mol of HI

Theoretical yield of HI = 0.148 × 127.91

                                     = 18.93 g

Thus, The theoretical yield of a reaction is the amount of product obtained if the limiting reactant is completely converted to product. If 15.28 g H₂ is mixed with 18.82 g I₂,  the theoretical yield (g) of HI produced by the reaction is 18.93 g.

To learn more about theoretical yield here

https://brainly.com/question/14966377

#SPJ1

You are taking a scuba diving training course. The instructor is discussing
your scuba tanks, and tells you they have a volume of about 11 L and hold
enough gas for a one-hour dive. The instructor also tells you that you take in
about 2 L of gas with each breath. Which is the best explanation for why 11 L
of gas lets you breathe for one hour?
A Because of the high pressure of the water, the amount of gas
needed for each breath decreases.
B It is very cold underwater. This decreases the pressure inside the
tank and allows exhaled gases to be stored and breathed in
again.
© The gas is under pressure in the tank. As pressure increases,
volume decreases. A small tank can therefore hold a large
amount of gas.
Underwater the gas becomes cold enough for it to become a
solid. The solid vaporizes a little at a time to allow you to breathe
for longer

Answers

Ur answer would’ve u have too many questions

Answer:

C

Explanation:

The deeper you go into water, the greater pressure there is on everything. This compresses the air inside and causes the volume to shrink.

Sometimes air is measured in bars. Let's assume the Earth's surface pressure is 1. Let's also say that your lungs have 5.5L and the tank has 11L. That's only 2 breathes, but under 200 bars of pressure deep in the ocean? That's 200 x 11, which equals 2200L. That's about 400 breathes.

In addition, if making liters out of thin air doesn't make any sense, there's an alternative where you divide your liters per breath by the bar pressure. So instead of 200 x 11, you can take your 5.5 from your lungs and divide it by 200. That small number, in this case, 0.0275, can serve as how much air you breath deep in the ocean.

A wave like the one shown in the diagram below is called a transverse wave. Such a wave is typical of light waves and other types of electromagnetic waves. Every transverse wave has certain properties, including wavelength. One measure of wavelength is the distance from B to D.

Answers

Answer: transmits yellow light

Explanation:

O2 to C4H9OH mole ratio

Answers

Answer: 1:1

Explanation:

as the equation is balenced

Which of the following statements is true regarding soundwaves?
a. Soundwaves travel as longitudinal or transverse waves depending on the medium they’re traveling through.
b. Soundwaves travel as transverse waves only.
c. Soundwaves travel as longitudinal or transverse waves depending on the temperature of the medium.
d. Soundwaves travel as longitudinal waves only.

Answers

Answer:  Soundwaves travel as longitudinal or transverse waves depending on the temperature of the medium.

Explanation: i think its C

The skier is able to coast between points s and t even though it is uphill because of

A- gravity
B-centripetal force
C- cohesive force
D- Intertia

Answers

The skier is able to coast between points s and t even though it is uphill because of gravity. The correct answer is A.

Gravity is the force that pulls objects towards each other. In the case of a skier coasting uphill between points s and t, gravity is still acting on the skier, pulling them towards the Earth. This gravitational force is what allows the skier to maintain their speed and momentum, even as they move uphill.

While centripetal force, cohesive force, and inertia are all important concepts in physics, they are not directly relevant to the scenario described in the question.

Centripetal force refers to the force that keeps an object moving in a circular path, cohesive force refers to the force that holds molecules together in a substance, and inertia refers to an object's tendency to resist changes in motion.

For more question on gravity click on

https://brainly.com/question/30944702

#SPJ11

What is the molecular formula of each of the following
compounds?
(a) empirical formula CH₂, molar mass = 84 g/mol
(b) empirical formula NH₂Cl, molar mass = 51.5 g/mol

Answers

(a) the molecular formula of the compound is C₆H₁₂.

(b)  the molecular formula of the compound is NH₂Cl.

(a) Given the empirical formula CH₂ and a molar mass of 84 g/mol, we need to determine the molecular formula. To do so, we need to find the factor by which the empirical formula needs to be multiplied to achieve the given molar mass.

The empirical formula CH₂ has a molar mass of 14 g/mol (12 g/mol for carbon + 2 g/mol for hydrogen).

To find the factor, we divide the molar mass by the empirical formula mass:

Factor = (molar mass) / (empirical formula mass) = 84 g/mol / 14 g/mol = 6

Therefore, the molecular formula is obtained by multiplying the empirical formula by the factor:

CH₂ × 6 = C₆H₁₂

Thus, the molecular formula of the compound is C₆H₁₂.

(b) Given the empirical formula NH₂Cl and a molar mass of 51.5 g/mol, we follow a similar approach.

The empirical formula NH₂Cl has a molar mass of 51.5 g/mol (14 g/mol for nitrogen + 2 g/mol for each hydrogen + 35.5 g/mol for chlorine).

To find the factor, we divide the molar mass by the empirical formula mass:

Factor = (molar mass) / (empirical formula mass) = 51.5 g/mol / 51.5 g/mol = 1

Therefore, the molecular formula is the same as the empirical formula: NH₂Cl

Hence, the molecular formula of the compound is NH₂Cl.

for more questions on molecular
https://brainly.com/question/24191825
#SPJ8

Which are chemical properties?
flammability
ability to rust
reactivity
melting point

Answers

Chemical properties are flammability, ability to rust, reactivity

A chemical property is the characteristics of a particular substances that can be observed in a chemical reaction and some major chemical properties include flammability, toxicity, heat of combustion, pH value and rate of radioactive decay and chemical stability and can be measured only when matter undergoes to become entirely different kind of matter and in iron that is capable of combining with oxygen to form iron oxide

Know more about properties

https://brainly.com/question/10957551

#SPJ1

Other Questions
Melody has learned to play 298 songs on the piano. She plans to learn to play ten more songs by next week. If she meets her goal, how many songs will she be able to play by next week? g 1. To see why an MRI utilizes iron to increase the magnetic field created by a coil, calculate the current needed in a 400-loop-per-meter circular coil 0.660 m in radius to create a 1.20-T field (typical of an MRI instrument) at its center with no iron present. The magnetic field of a proton is approximately like that of a circular current loop in radius carrying . What is the field at the e-commerce refers to the use of any networking technologies to transact business. Document 5#The Elementary Education Act, 1870, is a statute which is calculated, more than any other of recent times to elevate the masses of the people and is the result of many years agitation by the various relicious denominationa arul political parties in the State, The object which it wilt acecanplishenay be stated in a very few words. It will place an elementary school wherever there is a child to be taught, whether of rich or poor parents: and it will compel every parent and guardian of a child to have itQuestions :How will the passage of this act change the workforce in Industrial Britain?From the information in the document, and your own knowledge, what does this source indicate about the progress of the Industrial Revolution? Please help and look at the image. (The table shows the transportation method of employees at a certain company. What percent of the employees walk to work?) Analyse the problem: Your team has been asked to design a steel beam bridge with 10 m length as a simple supported beam. The beam weight is 200 kN considered as a distributed load over the beam length. In addition, in the worst case, loaded trucks with an average mass of 20 tons each will pass the bridge, they can pass the bridge together or individually. You only need to take the self-weight and truck loads into account in your calculations. Hint: you can consider two loads on the beam for each truck or one load including the weight of both trucks. (a) Determine the scenario that will create the maximum bending moment and shear stress on the simply supported beam. (b) Draw the shear force diagram and bending moment diagram based on the loading condition and derive the equations for bending moment and shear force (e) Find the deflections of beam based on the worst-case scenario that you chose in part (a) above, and compare results. What is your judgement on the deflection? Is it acceptable or not? Which number line correctly represents the irrational numbers listed below?-\sqrt{6} 6 \sqrt{2} 2 -\sqrt{79} 79 -\sqrt{32} 32 \sqrt{57} 57 plzz helpp ill give brainlyest HELP!!! Will mark!!!! In the context of ONE of the texts (Mending Wall, Sadie and Maud and Self-Reliance), Why do people resist change? The East African rift is an example of a(n)a Ocean-continent convergent boundaryb Transform plate boundaryc. Continent-continent convergent boundaryd Divergent plate boundary Mia, Thomas, and Jasmine are competing in a barrel race. Thomas's time is 8 seconds more than Mia's time. Jasmine's time is times the quantity of 21 seconds more than Mia's time. The sum of all three times is 71 seconds. what represents this situation and what is the value of m You have $2000 to invest in an account and need to have $2500 in five years. What annual interest rate would you need to have in order to have this if the amount is compounded monthly?a 3.77%b4.47%c2%d5.5%please answer According to Grandfather, why did the avocado tree rarely grow fruit in its earlyyears?He had spent too much time working to take good care of the tree.His grandchildren had trampled on the tree and weakened it.Avocado trees only grow fruit in Mexico, not in California.O Pollution and tall buildings prevented pollen from reaching his yard Draw the correct Lewis structure of this molecule by placing atoms on the canvas and connecting them with bonds. Include all hydrogen atoms and lone pairs of electrons. An object is dropped from a tall building. Suppose the distance it travels is given by the formula d = 16t2, where d represents the distance in feet and t represents time in seconds. About how long does it take the object to fall 800 feet? 2 seconds 3 seconds 5 seconds 7 seconds alex often acts overly confident and daring. few people realize he is actually riddled with unconscious insecurity and self-doubt. which defense mechanism does alex demonstrate? compare and contrast Montag's path to enlightenment to the transition featured in "Allegory of the Cave." How was the situation of Pompeii different than most archaeological finds? How did that difference help archaeologist understand daily Roman life. immediately after concept testing, a firm would engage in the ________ stage. calculate the equilibrium constant for the reaction o2 - 2o at temperature of 298 k and 6000 k verify the result Simplify5 by 6 - 1 by 2 + 2 by 3