Sarah was thinking of a number. Sarah divides by 7, then adds 9 to get an answer of 3. What was the original number?

Answers

Answer 1

Answer:

-42

Step-by-step explanation:

x/7 = y

y + 9 = 3

3 - 9 = y

y = -6

-6 * 7 = x

x = -42

Answer 2

Answer:

-42

Step-by-step explanation:

Do it backwards

Start with 3

SUBTRACT 9 to get -6

MULTIPLY by 7 to get -42.

Check:

Start: -42

Divide by 7: -6

Add 9: 3

Ding Ding!


Related Questions

Please solve 4(x+1.5)=3x+9.2

Answers

Answer:

the answer is in the question

Step-by-step explanation:

4(x+1.5) = 3x+9.2

4x + 6 = 3x + 9.2

4x - 3x = 9.2 - 6

x = 3.2

Charlotte is driving at 53.1mi/h and receives a text message. She looks down at her phone and takes her eyes off the road for t.35 s. How far has Charlotte traveled in feet during this time?

Answers

During the time Charlotte takes her eyes off the road for 0.35 s, she continues to travel at a speed of 53.1 mi/h. To find the distance she has traveled in feet, we can use the formula: Distance = Speed × Time.

Distance = 53.1 mi/h × (0.35 s) × (5280 ft/mi) / (3600 s/h) ≈ 70.038 ft

To calculate the distance traveled by Charlotte in feet, we need to convert the speed from miles per hour to feet per second and multiply it by the time she takes her eyes off the road.

First, we convert the speed from miles per hour to feet per second. Since 1 mile is equal to 5280 feet and 1 hour is equal to 3600 seconds, we can convert the speed as follows: 53.1 mi/h × (5280 ft/mi) / (3600 s/h) ≈ 77.8 ft/s.

Next, we multiply the speed (77.8 ft/s) by the time Charlotte takes her eyes off the road, which is 0.35 seconds. By multiplying these values, we obtain the distance traveled in feet during that time.

Therefore, Charlotte has traveled approximately 70.038 feet while looking down at her phone for 0.35 seconds. It is important to note that distracted driving can be dangerous, and it is crucial to prioritize road safety by avoiding distractions and keeping one's attention on the road.

Learn more about speed here:

brainly.com/question/6280317

#SPJ11

Remove the largest possible common factor. Check your answer by multiplication. 9x^(4)+15x^(3)-12x
Factor out the greatest common factor.

Answers

Check 9,15,12 we can see the largest possible common factor is 3
Check x^4 , x^3 , x we can see the largest possible common factor is x
Therefore : the answer is
3x( 3x^3+ 5x^2 - 4)

Answer:

\bold3x(3x3+5x24)

Factor the following

9x4+15x312x

rewrite the following

33x3x+35x2x34x

factor out the common term 3(x)

3x(3x3+5x24)

check for answer through multiplication

3x(3x3+5x24)

Extra \left or missing \right

9x4+15x312x

pls help u guys im litterally about kahshoot myself bc of school I just wanna cry

pls help u guys im litterally about kahshoot myself bc of school I just wanna cry

Answers

Answer:

First blanks: 36 and 36

Second blanks: -7 or 7

Step-by-step explanation:

Simplify (x+6)^2 and you get x^2+12x+36. 36 is what’s missing in that blank, and it needs to be added to both sides. Next, the second set of blanks is what you get when you take the square root of both sides of the equation. Sqrt((x+6)^2)=x+6. Sqrt(49)= -7 or 7. So you have to put 7 and -7 in the second set of blanks.

Answer:

36,36,-7, 7

Step-by-step explanation:

"kahshoot" lol

By using sum or difference formulas, cos(-a) can be written as OA. - sin(x) B. - cos(x) Oc.cos(x) D. sin(x) OE. All of the above OF. None of the above By using sum or difference formulas, cos(-a) can be written as OA. - sin(x) B. - cos(x) Oc.cos(x) D. sin(x) OE. All of the above OF. None of the above By using sum or difference formulas, cos(-a) can be written as OA. - sin(x) B. - cos(x) Oc.cos(x) D. sin(x) OE. All of the above OF. None of the above

Answers

By using sum or difference formulas, cos(-a) can be written as - cos(a). Explanation: We know that cosine is an even function of x, therefore,cos(x)=cos(x) .Then, by using the identity cos(ab)=cos(a)cos(b)+sin(a)sin(b), we can say that:cos(aa)=cos²(a)+sin²(a).

This simplifies to:cos(0)=cos²(a)+sin²(a)cos(0)=1So,cos(a)²+sin(a)²=1Or,cos²(a)=1sin²(a)Similarly,cos(a)²=1sin²(a) Since cosine is an even function, cos(a)=cos(a) Therefore, cos(a)²=cos²(a)=1sin²(a)cos(a)=±sqrt(1sin²(a)).

This is the general formula for cos(-a), which can be written as a combination of sine and cosine. Since cosine is an even function, the negative sign can be written inside the square root: cos(a)=±sqrt(1sin²(a))=±sqrt(sin²(a)1)=cos.

To know more about sum visit:

https://brainly.com/question/31538098

#SPJ11

Plzzz help! Answer quick

Plzzz help! Answer quick

Answers

Answer:

The answer is 6

Step-by-step explanation:

Answer:

The Area of the given figure is 6 inch²

Step-by-step explanation:

For a given Trapezoid

side a = 1 ½ = 1.5 inch

side b = 2½ = 2.5 inch

height (h) = 3 inch

Now, Area of Trapezoid

Formula:

A = ½ (a + b) × h

A = ½ (1.5 + 2.5) × 3 inch

A = ½ × 4 × 3 inch

A = 2 × 3 inch

A = 6 inch²

Thus, The Area of the given figure is 6 inch²

-TheUnknownScientist

4 = 2 (-2 - a) + a

Find A and please explain how to do it

Answers

The required value of variable "a" would be -8 which is determined by the   distributive property of multiplication,

What is the equation?

The term "equation" refers to mathematical statements that have at least two terms with variables or integers that are equal.

The equation is below which is given in the question,

4 = 2(-2 - a) + a

Apply the distributive property of multiplication,

4 = 2 × -2 - a × 2 + a

4 = - 4 - 2a + a

Rearrange the likewise terms and apply the arithmetic operation,

- 2a + a = 4 + 4

- a = 8

Multiply by the (-) sign on both sides to get the answer,

a = -8

Hence, the required value of variable "a" is -8.

Learn more about the equations here:

brainly.com/question/10413253

#SPJ1

Choose the correct simplification of the expression (x?y)?
Ох^4у^3
Ox^6y^6
Ох^4у^2
Oxy^4

Choose the correct simplification of the expression (x?y)?^4^3Ox^6y^6^4^2Oxy^4

Answers

C, multiply the powers in the parentheses by 2

If 1 + 2k = k, then 2k=

Answers

Answer:

-2

Step-by-step explanation:

I am not sure but its ans may be -2

Probably -2 I thinkkkk

which of the following affect the width of a confidence interval? (select all that apply) group of answer choices mean standard deviation confidence level sample size

Answers

b) Decreasing the sample size

c) Increasing the standard deviation

a) Decreasing the confidence level will decrease the width of the confidence interval. A lower confidence level means we are less certain about capturing the true population mean, so we allow for a smaller margin of error, resulting in a narrower interval.

b) Decreasing the sample size will increase the width of the confidence interval. With a smaller sample size, there is less information available to estimate the population mean. This increased uncertainty leads to a wider confidence interval to accommodate a potentially larger margin of error.

c) Increasing the standard deviation will increase the width of the confidence interval. A larger standard deviation indicates more variability in the data. With greater variability, the estimated population mean could be further away from the true mean, requiring a wider interval to capture the potential range.

d) Decreasing the mean does not affect the width of the confidence interval. The width of the interval is primarily determined by factors such as confidence level, sample size, and standard deviation. The value of the population mean itself does not impact the width of the interval since it is the target value being estimated.

In summary, decreasing the confidence level and sample size, as well as increasing the standard deviation, will all increase the width of the confidence interval for a population mean, reflecting increased uncertainty and potential variability in the estimation. However, decreasing the mean does not directly impact the width of the interval.

Visit here to learn more about standard deviation:

brainly.com/question/29115611

#SPJ11

if you understand quadratics:

if you understand quadratics:

Answers

We may conclude after answering the presented question that expression Therefore, the blank should be filled with 36.

what is expression ?

An expression in mathematics is a collection of representations, numbers, and conglomerates that mimic a statistical correlation or regularity. A real number, a mutable, or a mix of the two can be used as an expression. Mathematical operators include addition, subtraction, fast spread, division, and exponentiation. Expressions are often used in arithmetic, mathematics, and form. They are employed in the depiction of mathematical formulas, the solving of equations, and the simplification of mathematical relationships.

To make the expression a perfect square, we need to add the square of half the coefficient of n.

Half of 12 is 6, and the square of 6 is 36.

So, n2+12n+36 is a perfect square.

Therefore, the blank should be filled with 36.

To know more about expression visit :-

https://brainly.com/question/14083225

#SPJ1

simplify- -126 x*2 y*7 z*3 w

Answers

the answer is 5 2 9 2

really all you have to do is multiply 126 * 2 * 7 * 3

then all that's next is to just put the letters in the order they were originally at the end of the answer

Visitors to a public library were asked how many miles they lived from the library. The table shows their responses.
Number of miles
1.5 2.3 3.5 2 1.8
1.8 1.9 0.5 2.5 2.4
4.8 3.7 0.6 2 2.4
2.5 1.5 0.5 1.8 0.8



Of these visitors, the first 10 people to check out books lived the following miles from the library.
Number of miles
0.5 1.8 0.8 1.8 3.5
4.8 0.6 2 1.5 0.5

What is the sample mean for the data?



Enter your answer in the box.
x¯ = __ mi

Answers

Answer:

The sample mean = 1.8

Step-by-step explanation:

I just completed the test and this was the correct answer

The sample mean for the data is 1.8 if the first 10 people to check out books lived out of 20 population.

What are population and sample?

It is defined as the group of data having the same entity which is related to some problems. The sample is a subset of the population, it is a part of the population.

We have:

Total number of population = 20

To calculate the sample mean:

Total number of samples N = 10

Sum of the sample values ∑x = 0.5+1.8+0.8+1.8+3.5+4.8+ 0.6+ 2+1.5+0.5

∑x = 17.8

Now the mean of the sample data =  ∑x/N = 17.8/10 = 1.78 ≈ 1.8

Thus, the sample mean for the data is 1.8 if the first 10 people to check out books lived out of 20 population.

Learn more about the population and sample here:

brainly.com/question/9295991

#SPJ2

The average 12-ounce container of raspberries contains 120 raspberries. Since the size of the raspberries can vary, the actual
quantity of raspberries in a container can range anywhere from 4 berries below average to 4 berries above average
The average 1-pound container of strawberries contains 20 strawberries. Since the size of the strawberries can vary, the actual
quantity of strawberries in a container can range anywhere from 2 berries below average to 2 berries above average
Write and solve an absolute value equation to calculate the minimum and maximum strawberry quantities in a 1-pound container
Enter your answers in the boxes below.
Minimum Quantity:
strawberries
Maximum Quantity:
strawberries

Answers

I put in the wrong answers cuz I couldn't find the answer anywhere so here ya go

Hopefully this helps

The average 12-ounce container of raspberries contains 120 raspberries. Since the size of the raspberries

Consider the PDE au(x, t) = 4 d²u(x, t) 2 Ət əx² For each of BCs and ICs, solve the initial value problem. du(π,t) a) BCs: u(0,t)=0 = = 0 and əx IC: u(x,0) = x ANSWER: f(x)= n=1 u(2,t) = 0 and u(0,t)=0 u(x,0)=sin x ANSWER: f(x)=¹1_sin(2 + nx) na n=1 1+ 2 X b) BCs: IC: 8 (2n-1) T n+1 (-1)041 -4(2n-1)²t sin(2-nπ) nπ 1- 2 e sin (2n-1) 2 na sin X 2 -(nn)²t x -X

Answers

the solution for the initial value problem is: u(x, t) = sin(sqrt(-λ² * (a / 4)) * x) * exp(-λ² * t) where λ = ± sqrt(-4n² / a), and n is a non-zero integer.

The given partial differential equation is:

au(x, t) = 4 * (d²u(x, t) / dt²) / (dx²)

a) BCs (Boundary Conditions):

We have u(0, t) = 0 and u(π, t) = 0.

IC (Initial Condition):

We have u(x, 0) = x.

To solve this initial value problem, we need to find a function f(x) that satisfies the given boundary conditions and initial condition.

The solution for f(x) can be found using the method of separation of variables. Assuming u(x, t) = X(x) * T(t), we can rewrite the equation as:

X(x) * T'(t) = 4 * X''(x) * T(t) / a

Dividing both sides by X(x) * T(t) gives:

T'(t) / T(t) = 4 * X''(x) / (a * X(x))

Since the left side only depends on t and the right side only depends on x, both sides must be equal to a constant value, which we'll call -λ².

T'(t) / T(t) = -λ²

X''(x) / X(x) = -λ² * (a / 4)

Solving the first equation gives T(t) = C1 * exp(-λ² * t), where C1 is a constant.

Solving the second equation gives X(x) = C2 * sin(sqrt(-λ² * (a / 4)) * x) + C3 * cos(sqrt(-λ² * (a / 4)) * x), where C2 and C3 are constants.

Now, applying the boundary conditions:

1) u(0, t) = 0:

Plugging in x = 0 into the solution X(x) gives C3 * cos(0) = 0, which implies C3 = 0.

2) u(π, t) = 0:

Plugging in x = π into the solution X(x) gives C2 * sin(sqrt(-λ² * (a / 4)) * π) = 0. To satisfy this condition, we need the sine term to be zero, which means sqrt(-λ² * (a / 4)) * π = n * π, where n is an integer. Solving for λ, we get λ = ± sqrt(-4n² / a), where n is a non-zero integer.

Now, let's find the expression for u(x, t) using the initial condition:

u(x, 0) = X(x) * T(0) = x

Plugging in t = 0 and X(x) = C2 * sin(sqrt(-λ² * (a / 4)) * x) into the equation above, we get:

C2 * sin(sqrt(-λ² * (a / 4)) * x) * C1 = x

This implies C2 * C1 = 1, so we can choose C1 = 1 and C2 = 1.

Therefore, the solution for the initial value problem is:

u(x, t) = sin(sqrt(-λ² * (a / 4)) * x) * exp(-λ² * t)

where λ = ± sqrt(-4n² / a), and n is a non-zero integer.

Note: Please double-check the provided equation and ensure the values of a and the given boundary conditions are correctly represented in the equation.

To know more about Equation related question visit:

https://brainly.com/question/29657983

#SPJ11

the ceo of a large company decides to survey the workers for their opinions about a new vacation policy. a sample of the population that gives each worker an equal chance of participating in the survey would be a(n): please choose the correct answer from the following choices, and then select the submit answer button. answer choices sample that includes half the workers. random sample. unrepresentative sample. sample that includes all the workers.

Answers

correct answer is random sample

A simple random sample, also known as an SRS, is a subset of people (also known as a sample) picked at random from a larger group of people (also known as a population) with an equal probability. It is a method of choosing a sample at random. Each subset of k people in SRS has the same chance of getting selected for the sample as any other subset of k people. [1] An objective sampling strategy is a straightforward random sample. Simple random sampling is a fundamental kind of sampling that may be used in combination with other, more sophisticated sampling techniques.

To know more about  simple random sample refer to https://brainly.com/question/14470673

#SPJ4

After arianna completed some work, she figured she still had 78 21/100 pictures to paint. if she completed another 34 23/25 pictures, how many pictures did arianna still have to paint
Plz be a long answer

Answers

Answer:

43 29/100

Step-by-step explanation:

Subtract 34 23/25 from 78 21/100.

To do this, you have to turn 23/25 to something over 100.

Multiply the numerator and denominator by 4, since that is how you get 25 to 100. This will give you 92/100. So now you have 32 92/100

You have to take away one from 78, which makes it 77 and then add 100 to 21, since 100 is equal to 1.

You now have 77 121/100 - 32 92/100.

77 121/100 - 32 92/100 = 43 29/100

Need Help!! What is the volume of the Sphere?

Need Help!! What is the volume of the Sphere?

Answers

Answer:

Use the formula: V = 4/3 x π xR^3

Step-by-step explanation:

R=18:2=9cm

=> V=4/3 x π x 9^3 = 972π = 3054cm^3

How can you use a table to determine whether the relationship between two quantities is proportional?

Answers

Answer:

no

Step-by-step explanation:

no

The radius of a circle measures 11 m. What is the circumference of the circle?
Use 3.14 and do not round your answer.

The radius of a circle measures 11 m. What is the circumference of the circle?Use 3.14 and do not round

Answers

Answer:

69.08 m

Step-by-step explanation:

Circumference=2 ×pi ×radius

=2×3.14×11m

=69.08m

Select the correct answer from each drop-down menu.
Aerial's grandmother gave her $5,500.00 to save for her college education. She went to the bank to open a savings account. The bank told her they had two options available.

Account A will pay 5.5% simple interest until the account is closed.

Account B will pay 4.5% simple interest and if the account is left open for longer than 3 years, then at the end of the third year a bonus account will be opened with $250 that also earns 4.5% for the remainder of the time the initial account is open. When the initial account is closed, the bonus account will be closed as well and the money from the two accounts will be combined.

If Aerial is planning on leaving the money in the account for 4 years and then withdrawing all funds, then account
is the better choice earning her
more.

Answers

If Aerial is planning on leaving the money in the account for 4 years and then withdrawing all funds, then account B is the better choice earning her $41.25 more.

100-3x6+5-4= 63? help me its GEMDAS

Answers

Answer:

it's 86

Step-by-step explanation:

100-3x6+5-4

100-15+5-4

85+5-4

90-4

86

3 − 3k + 7k = 5b33k+7k=5b

Answers

Answer:

k=-14

Step-by-step explanation:

Is 9/3 a repeating decimal? Please answer!!

Answers

Step-by-step explanation:

A repeating decimal is a recurring decimal. It has no end when divided.

9/3 is 3 so it is a terminating decimal.

it does not repeat

Answer:

The single repeating digit is 3.

Step-by-step explanation:

Angle K has a measure of 83 degrees and is reflected across the line y=2 to get angle K’.

What is the measure of angle K’?

Enter your answer as the correct value like this: 42

Answers

Answer:

k= 83 degrees

Step-by-step explanation:

Reflection:  y=2

Required

K'

The general rule is that, reflection does alter measurements (angles or lengths).

So, this means that K' will have the same measure as K.

i.e.

k’=K

K= 83 degrees

What is mZN?
N
P
(4x + 36)
(6x - 2)°
M

Answers

Answer:

2

Step-by-step explanation:

Julie wanted to match Lisa's obstacle course record of 74.6 seconds. She has already spent forty and one-fourth seconds on wall climbing and 10.56 seconds on the ropes. How much time did she have left to match the record?

23.79 seconds
29.69 seconds
34.35 seconds
64.04 seconds

Answers

Julie has only 23.79 seconds left to match the record.

How to calculate time left?

We know that times deals with a continued sequence of existence and events that occurs in an apparently irreversible succession from the past

From the question, the given times are:

Time to match Lisa's record = 74.6 seconds

Time to clin the wall = 10.56 seconds

Time already spent on climbing wall = 4.025 seconds

Time left is calculated thus

74.600 seconds =(40.025+10.56) seconds

=74.600-50.585

=23.79 seconds

Therefore time left is 23.79 seconds

Learn more about time on  https://brainly.com/question/28050940

#SPJ1

Find the particular solution determined by the given condition. ds/dt = 16t^2 + 9t - 6; s = 120 when t = 0 The particular solution that satisfies the given condition is s =

Answers

The particular solution that satisfies the given condition is s = (16/3)t³ + (9/2)t² - 6t + 120

To find the particular solution of the differential equation ds/dt = 16t² + 9t - 6 with the condition s = 120 when t = 0, we need to integrate the right-hand side of the equation with respect to t and then solve for the constant of integration using the given condition.

First, let's integrate the right-hand side of the equation:

∫(ds/dt) dt = ∫(16t² + 9t - 6) dt

Integrating term by term, we get:

s = (16/3)t³ + (9/2)t² - 6t + C

Now, we can use the given condition s = 120 when t = 0 to determine the value of the constant of integration C:

120 = (16/3)(0)³ + (9/2)(0)² - 6(0) + C

120 = C

Therefore, the particular solution that satisfies the given condition is:

s = (16/3)t³ + (9/2)t² - 6t + 120

To learn more about differential equation click on,

https://brainly.com/question/14507838

#SPJ4

write the equation with the least degree and integer coefficients that has the roots listed
3, 2 +-3i

Answers

The polynomial function is f(x) = (x - 3)((x - 2)² + 9)

How to determine the polynomial from the zeros?

From the question, we have the following parameters that can be used in our computation:

Zeros: x=3, 2 +-3i

The polynomial can be repesented as

f(x) = product of (x - zeros)

using the above as a guide, we have the following:

f(x) = (x - 3)(x - (2 - 3i))(x - (2 + 3i))

This can be expressed as

f(x) = (x - 3)((x - 2)² + 9)

hence, the polynomial is f(x) = (x - 3)((x - 2)² + 9)

Read more about polynomial at

brainly.com/question/7693326

#SPJ1

an exam consists of 8 multiple choice questions with 5 answer choices each. how many ways can the questions be answered?

Answers

The number of ways the questions can be answered is (5)⁸  Ways.

Number of question: 8

Choice given : 5

Each question has 5 choices

Each question can be answered in 5 ways

The techniques used to determine how many outcomes are conceivable in certain circumstances are permutation and combination. Combinations and permutations are referred to as selections and arrangements, respectively.

Formulas for permutation and combination are useful for determining the permutation and combination of r objects selected at random from n objects. Finding various arrangements and groups is done using the notion of permutations, while finding various groups is done using the concept of combinations. Permutations are consistently greater than combinations for the specified values of n and r.

So 8 questions can be answered in

⇒5×5×5×5........(8 times)

⇒(5)⁸  Ways

Therefore Number of ways =(5)⁸  Ways

Hence we get the required answer.

Learn more about Combinations here:

brainly.com/question/4658834

#SPJ4

Other Questions
4 poitWhy is acting lawfully and ethically important for journalists?0 It helps journalists remain credibleO It keeps people focused on the facts in the news0 It helps people stay safeOAll of the above IncorrectCorrecta. Latex was a natural polymerb. produced for rubber trees.c. It is collecting in pots thatd. is nailed to some of the trees. if a performance standard is found to be stable or consistent over time, it is said to be: Help please:)))))))))) how many times during the year will the sun cross the celestial equator? the conjunction, x-1, may be written -1 The wavelength of light determines its ____, and the amplitude of light determines its ____. 2.3 x 4.5 Please help! Im not sure if it did it right! how do you solve for x-3x-6y=0 A seais usually defined as A.A body of freshwater that is not connected to the ocean B. A body of freshwater that is connected to the ocean C. A body of salt water that is not connected to the ocean D. Body of salt water that is connected to the ocean The authors main claim is that a diet rich in vegetables, whole grains, and beans can help prevent cancer. Which two sentences from the passage best support this claim?A. We all know many of the benefits of eating different types of foods.B. Some phytochemicals, or chemical compounds that occur naturally in plants, may help fight cancer.C. Even the ancient Romans knew about the health benefits of beans and peas.D. Studies show that extra body fat can increase the risk of certain cancers.E. Their research shows that there are also cancer-fighting elements in dark chocolate, soy, green tea, and some spices. How do you ensure the passenger safety? ulture encompasses the ______ behavior patterns, beliefs, attitudes, and values of a particular period, class, community, or population. One of the goals of the best interest requirements for annuity sales is that the consumers interest will be placed behindA. A producers own financial interestB. The needs of the insurerC. The Terms of the annuity contract What type of line up do agencies use that involve two or more lineups, where one includes the suspect and the others do not? Imagine a hypothetical economy with a population of 100 people, 80 of which over sixteen. Forty eight of these people who are working and twelve people who are willing, able and looking for work cannot find jobs. The unemployment rate in this economy is____________ % (enter percentage as a whole number, not a decimal, no percentage sign). SSuppose that 10 of those unemployed people get discouraged and give up looking for work. Now, the unemployment rate is __________% (enter percentage as a whole number, not a decimal, no percentage sign). A tone i thrown downward with a peed of 5m, from the top of a building of height 180 m. Take point of projection a the origin and vertical downward direction a negative. Determinea. The velocity of tone at the end of 3. B. The diplacement of tone at the end of 3. C. The time taken by the tone to travel a ditance of 150 m solve (x+2 < 5) u ( x-7 > -6) Con qu caractersticas de un relato cosmognico se puede asociar la expresin "An no existan ni el cielo ni la tierra, tanto los hombres como los dioses an no haban nacido ,no haba vida. Personajes extraordinarios Paradigmticos Tiempo remoto Tradicin oral when framing a shot, cinematographers are limited by the aspect ratio, which is the _____.