Rubbing alcohol is 70.% v/v isopropanol. How many mL of rubbing alcohol contain 5.0 mL of isopropanol?

Answers

Answer 1

A 500mL rubbing alcohol contains 350mL of isopropyl alcohol.

How to Calculate for Solute

  1. Identify the given.

% v/v = 70% or 0.70

mL of solution = 500mL (rubbing alcohol)

 2. Identify which quantity is required.

mL of solute = ? (isopropyl alcohol)

 3. List down the equation to be used.

mL of Solute = (% v/v)(mL of solution)

 4. Then, substitute the given quantities in the equation.

mL of solute = (0.70)(500mL)

5. Simplify or solve the equation, and interpret the answer.

mL of solute = 350mL of isopropyl alcohol

Interpretation: There is 350mL of isopropyl alcohol in a 500mL rubbing alcohol solution.

To know more about the calculation of substance:

https://brainly.ph/question/13992190

 


Related Questions

Write the formula of the first five members in the series of alkynes

Answers

Yeah that’s my day lol I don’t have a time for you lol I don’t have a lot to go lol I don’t have a lot to can you text

What is The relationship between the electromotive force and the free enthalpy of reaction in a redox reaction?

Answers

Answer:

The EMF and free enthalpy (or Gibbs Free Energy) of a reaction are directly related.

If the free enthalpy of a redox reaction is negative, then the EMF will be negative, indicating that the reaction is spontaneous and will occur without the need for an external source of energy.

If the free enthalpy of the reaction is positive, then the EMF will be positive, indicating that the reaction is not spontaneous and will not occur without the input of energy.

The relationship between free enthalpy and EMF is shown in the following equation:

∆G = -nFE°(cell), where n is the number of electrons transferred, F is the Faraday constant, and E° is the EMF of a cell under standard conditions.

Most organisms, other than plants and animals, are made up of

A. only one cell.
B. about ten cells.
C. only two cells.
D. billions of cells.

Answers

The answer is A I’m pretty sure

When a sample of liquid is heated, its thermal energy _______.

Answers

Answer:

Entropy.

Explanation:

I really hope this is right! sorry if its wrong

When a sample of liquid is heated, its thermal energy: increases.

Thermal energy can be defined as the energy possessed by an object due to the movement of its particles.

Basically, the temperature of an object or system is highly dependent on thermal energy.

Hence, temperature is directly proportional to thermal energy.

Additionally, as the temperature of an object increases due to the application of heat, the thermal energy of the object increases.

In conclusion, thermal energy increases when a sample of liquid is heated.

Read more: https://brainly.com/question/22077574

Which of these represents the correctly balanced equation?

HCI + Na2S - H2S + NaCl

4HCI +2Na2S - 2H2S + 4NaCl

2HCI + Na2S - H2S + 2NaCl

2HCI + Na2S - H2S + NaCl

Answers

Answer:

2HCI + Na2S ----> H2S + 2NaCl

Explanation:

For a balanced chemical equation, the number of moles of atoms on the reaction side must equal the number of moles of atoms on the product side, in accordance with the law of conservation of mass.

The correct answer is:

2HCI + Na2S ----> H2S + 2NaCl

Since it has equal number of moles of each atom on both sides of the equation: 2 atoms each of hydrogen, chlorine, and sodium on both sides of the equation as well as 1 atom of sulphur on both sides of the equation.

When a strong acid or base is added to water it...

Answers

When a strong acid or base is added to water, the pH will change dramatically.

Strong Acid

A strong acid is one that is completely dissociated or ionized in an aqueous solution. This means it gives off the greatest number of hydrogen ions or protons when placed in a solution. Examples of strong acid are HCl, HBr, H2SO4, HNO4. These acids when placed in water, produces greatest amount of hydrogen ions. The pH value changes drastically. Any that has very high concentration of hydrogen and ion is acidic.

Also when base is added to water, the pH of water will increase above 7 and become basic. The pH of water is 7, but when base is added to it increases above 7.

Base is any solution that is slippery to touch in water solution, changes color, react with acid to form salt and change red litmus paper to blue.

Learn about acid and base in water solution here

https://brainly.com/question/27915098

#SPJ1

How many grams of NaCl

How many grams of NaCl

Answers

You would recover 36.525g of NaCl after evaporating all of the water.

How to find the how many grams of NaCl that would be recover when  all water is evaporated off of this solution?

To find the grams of NaCl that would be recovered after evaporating all the water, we can use the following formula:

mass = moles * molar mass

Where:

Moles = Molarity * Volume

Molarity = 0.250 M

Volume = 2500.0 mL = 2.5 L

Molar mass of NaCl = 58.44 g/mol

mass = 0.250 M * 2.5 L * 58.44 g/mol

mass = 36.525 g

Learn about evaporation here https://brainly.com/question/2013258

#SPJ1

Which molecule would have the strongest tendency to form hydrogen bonds with other identical molecules? HCl H2 HF CH4

Answers

Answer:

HF

Explanations:

A hydrogen bond is defined as an electrostatic force of attraction that exists between a hydrogen atom and a more electronegative atom with another electronegative atom having a lone pair of electrons.

From the given molecule, the molecule that would have the strongest tendency to form hydrogen bonds with other identical molecules is HF. This is due to the high electronegative nature of fluorine atoms.

Other elements that hydrogen bonds form with are nitrogen and oxygen

Also, HF has three lone pairs on the F atom but only one H atom can form only two bonds

Animal fats and vegetable oils are triacylglycerols, or triesters, formed from the reaction
of glycerol (1, 2, 3-propanetriol) with three long-chain fatty acids. One of the methods
used to characterize a fat or an oil is a determination of its saponification number. When
treated with boiling aqueous KOH, an ester is saponified into the parent alcohol and fatty
acids (as carboxylate ions). The saponification number is the number of milligrams of
KOH required to saponify 1.000 g of the fat or oil. In a typical analysis, a 2.085-g sample
of butter is added to 25.00 mL of 0.5131 M KOH. After saponification is complete, the
excess KOH is back titrated with 10.26 mL of 0.5000 M HCl. What is the saponification
number for this sample of butter?

Answers

Saponification number = (V × M × F × 56.1) / W

Where:

V = volume of HCl used in the back titration

M = molarity of HCl

F = factor of KOH (which is 1 for pure KOH)

W = weight of the butter sample used in grams

First, we need to calculate the amount of KOH used in the saponification reaction:

0.5131 M KOH = 0.5131 moles KOH / liter

25.00 mL KOH = 0.02500 L KOH

moles KOH used = 0.5131 moles/L × 0.02500 L = 0.0128 moles KOH

Since the saponification reaction is a 1:1 reaction between KOH and the triacylglycerol in the butter sample, the amount of butter used is also 0.0128 moles.

Next, we need to calculate the amount of HCl that reacted with the excess KOH:

0.5000 M HCl = 0.5000 moles HCl / liter

10.26 mL HCl = 0.01026 L HCl

moles HCl used = 0.5000 moles/L × 0.01026 L = 0.00513 moles HCl

Since the reaction between HCl and KOH is also a 1:1 reaction, the moles of KOH that were not used in the saponification reaction is equal to the moles of HCl used in the back titration:

moles KOH not used = moles HCl used = 0.00513 moles HCl

To find the saponification number,

Saponification number = (V × M × F × 56.1) / W

Saponification number = (0.01026 L × 0.5000 moles/L × 1 × 56.1) / 2.085 g

Saponification number = 6.50

Therefore, the saponification number for this sample of butter is 6.50.

To know more about Saponification:

https://brainly.com/question/2263502

#SPJ1

Which of the following is NOT part of STP?
O O Fahrenheit
O 1 Atmosphere
O 273 Kelvin
O 101.3 kiloPascals

Answers

Answer:

Farenheit

Explanation:

STP is used to measure standard temperature and pressure -- it uses Kelvin for temperature, not Farenheit.

Select the correct structure that
corresponds to the name.
1,1,1-trifluoroethane

Select the correct structure thatcorresponds to the name.1,1,1-trifluoroethane

Answers

The correct chemical structure that corresponds to 1,1,1-trifluoroethane is (a).

What is  1,1,1-trifluoroethane?

A chemical structure is a spatial arrangement of atoms in a molecule. It determines the molecular geometry and when necessary the electronic chemistry as well .1,1,1-Trifluoroethane or simply known as trifluoroethane is Hydrofluorocarbon (HFC) compound that is colourless and highly inflammable gas with ether like odour. One method of preparation of 1,1,1-Trifluoroethane is by fluorination of 1-chloro-1,1-difluoroethane in the presence of hydrofluoric acid.  The chemical formula for 1,1,1-Trifluoroethane is \(C__{2} } H_{3} F_{3}\). The high stability of it's chemical structure because of being heavier than air makes it a greenhouse gas with high infrared absorbent power. It can be used as a propellant or refrigerant and in cleaning of electrical equipments.

Learn more about 1,1,1-trifluoroethane here:

https://brainly.com/question/1390779

#SPJ1

Select the correct structure thatcorresponds to the name.1,1,1-trifluoroethane

How does the heat flow from the coffee to the part of the spoon in the coffee?

Answers

Answer:

Heat flows from the coffee to the spoon through conduction

Explanation:I did the lab assignment

Answer:

Heat can travel from one place to another in three ways: Conduction, Convection and Radiation. As the spoon is in direct contact with hot mug of coffee the heat will transfer to spoon this represent the process of conduction.

Seamus is conducting an experiment on electric force. He wants to get an approximate idea of how much force the charges will generate. Drag and drop the tiles to show the force of each situation in increasing order from lowest to highest (with repulsive forces being positive and attractive forces being negative).
=
One object with a charge of -4 × 10-5 C and another with a charge of 3 × 10-5 C placed 0.5
meters apart
One object with a charge of 3 x 10- C and another with a charge of -3 × 10-5 C placed 1
E
meter apart
= Two objects with a charge of 4 × 10-5 C placed 1 meter apart
= Two objects both with a charge of 3 × 10-5 C placed 0.5 meters apart
One object with a charge of 3 x 10- C and another with a charge of 4 x 10 C placed 1
E
meter apart

Seamus is conducting an experiment on electric force. He wants to get an approximate idea of how much

Answers

The highest electric force exerted by charges -4 ×10⁻⁵ C and 3 ×10⁻⁵ C  placed 0.5 m apart is equal to 43.15 N.

The lowest electric force exerted by charges 3 ×10⁻⁵ C and 3 ×10⁻⁵ C  placed 1 m apart is equal to 8.10 N.

What is coulomb's law?

According to Coulomb’s law, the force of attraction between two charges is equal to the product of their charges and is inversely proportional to the square of the distance. This electric force applies along the line joining the two charges.

The magnitude of the electric force can be written as follows:

\(\displaystyle F = k\frac{q_1q_2}{r^2}\)

where k is constant proportionality = 8.99 × 10⁹ N.m²/C².

Given the charge on one point charge, q₁ =  4 ×10⁻⁵ C

The charge on the other point charge, q₂ = - 3 × 10⁻⁵C

The distance between these two charges, r = 0.5 m

The magnitude of electric force between the charges  will be:

\(\displaystyle F = 8.99\times 10^{9}\times \frac{4\times 10^{-5}\times 3\times 10^{-5}}{(0.5)^2}\)

F = 43.15 N

Given the charge on one point charge, q₁ =  3 ×10⁻⁵ C

The charge on the other point charge, q₂ = 3 × 10⁻⁵C

The distance between these two charges, r = 1 m

The magnitude of force between the charges will be:

\(\displaystyle F = 8.99\times 10^{9}\times \frac{3\times 10^{-5}\times 3\times 10^{-5}}{(1)^2}\)

F = 8.1 N

Learn more about Coulomb's law, here:

brainly.com/question/506926

#SPJ1

Aeronautical engineers have to consider the weight, trust, life, and drag of an airplane to determine whether or not…

Answers

Answer:

the plane will crash, or if it is usable or not.

please help :(
i have no idea what this even means lol​

please help :( i have no idea what this even means lol

Answers

Here are the answers for A and B.

Answer:

(a) 80% are metals.

(b) (1.) Metals are malleable and ductile. (2.) Metals are dense.

Explanation:

(a) If you look at the picture, there are faint lines dividing the circle into ten parts. Metals take up 8 sections and non-metals take up 2. This means that the number of metals on the periodic table takes up 80% and non-metals take up 20%.

(b) There are many physical properties of metals, but two of them are that metals are malleable & ductile (these relate to how metal can be shaped) and that metals are dense (density = mass ÷ volume).

Arrange the following compounds in order of increasing solubility in

water and explain your sequence.

C7H15OH C6H13OH C6H6 C2H5OH​

Answers

Answer:

C6H6<C7H15OH<C6H13OH<C2H5OH​

Explanation:

Organic substances are ordinarily nonpolar. This means that they do not dissolve in water. However, certain homologous series of organic compounds actually dissolve in water because they possess certain functional groups that effectively interact with water via hydrogen bonding.

A typical example of this is alcohol family. All members of this homologous series contain the -OH functional group. This group can effectively interact with water via hydrogen bonding, leading to the dissolution of low molecular weight alcohols in water.

Low molecular weight alcohols are miscible with water in all proportions. This implies that they are highly soluble in water. However, as the size of the alkyl moiety in the alcohol increases, the solubility of the alcohol in water decreases due to less effective interaction of the -OH group with water via hydrogen bonding. This explains the fact that C2H5OH​ is the most soluble alcohol in the list.

C6H6 is insoluble in water since it is purely a hydrocarbon with no -OH group capable of interaction with water via hydrogen bonding.

What type of energy is the sun of an objects potential and kinetic energy

Answers

All of the energy from the Sun that reaches the Earth arrives as solar radiation, part of a large collection of energy called the electromagnetic radiation spectrum. Solar radiation includes visible light, ultraviolet light, infrared, radio waves, X-rays, and gamma rays. Radiation is one way to transfer heat.

Balance the equations by putting the necessary coefficients in the blanks. Normally we do not write 1s when balancing, but for this particular question you need to include them for full credit. __Na3N___ Na +__ N2 ___H3PO4 + __ KOH __K3PO4 + __ H2O __ N2 +__ H2 __ NH3 __H2O2 __ O2 + __ H2O __ Zn + __ HCl __ ZnCl2 + __H2 __ C2H6 + __ O2 __ CO2 + __H2O __ CuCl2 + __H2S __ CuS + __HCl

Balance the equations by putting the necessary coefficients in the blanks. Normally we do not write 1s

Answers

Balancing a chemical equation is the process of ensuring that the number of atoms of each element in the reactants is equal to the number of atoms of that same element in the products.

Balance the chemical eqations given in the problem?

Na3N → 3 Na + ½ N2H3PO4 + 3 KOH → K3PO4 + 3 H2ON2 + 3 H2 → 2 NH3H2O2 → O2 + 2 H2OZn + 2 HCl → ZnCl2 + H2C2H6 + 7/2 O2 → 2 CO2 + 3 H2OCuCl2 + H2S → CuS + 2 HCl

Chemical equations are used to describe the reactants and products in a chemical reaction. These equations are written using chemical formulas and symbols, indicating the types and numbers of atoms or molecules involved in the reaction. However, these equations must be balanced to obey the law of conservation of mass, which states that the total mass of the reactants must equal the total mass.

To learn more about chemical equation, visit: https://brainly.com/question/29886207

#SPJ1

What is a variable that is changed by the experimenter in an experiment?

Answers

Answer:

it depend on what is changed

Explanation:

A chemist combine did 3.50g of potassium level with chlorine gas to yield 6.6 7g of potassium for it. Assuming all the potassium was consumed, and that potassium chloride was the only product that formed, what mass of chlorine reacted?

Answers

Answer: mass of chlorine reacted is 3.18 g

Explanation:

2 K + Cl2 = 2KCl

no. of moles of K = mass / molar mass

= 3.50 / 39

= 0.0897

no. of moles of KCl = mass / molar mass

= 6.67 / 74.5

= 0.0895  

no. of moles of Cl2 required = number of moles of KCl / 2

= 0.0895 / 2

= 0.0448 moles  

mass of Cl2 required = no. of moles of Cl2 required x molar mass

= 0.0448 x 71

= 3.1808 g ≈ 3.18 g

Therefore mass of chlorine reacted is 3.18 g

what is the thing aroud the nucisel

Answers

Answer:

Electrons

Explanation:

Assuming you are talking about the nucleus of an atom, the particles surrounding the nucleus are electrons.

Atoms consist of three subatomic particles: protons, neutrons, and electrons. Protons and neutrons are located within the nucleus, whereas the electrons exist outside of it.

A balloon with volume 650 mL contains 0.10 mol of gas. If an additional 0.05 mol of gas are added to the ballon, what will be the new volume

Answers

Answer:

The volume of the balloon increases as you add moles of gas to the balloon by blowing it up. If the container holding the gas is rigid rather than flexible, pressure can be substituted for volume in Avogadro's Law. Adding gas to a rigid container makes the pressure increase

sodium chloride is made from sodium and chloride. would you expect the properties of sodium chloride to be simliar to sodium or cloride

Answers

Answer:

No

Its a chemical change so the characteristics or chemical properties always differs thereby the properties of sodium chloride isn't similar to sodium or chloride

What is the answer with the proper significant figures 7.6+2.401+0.68=

Answers

Answer:

10.7

Explanation:

The addition of 7.6 + 2.401 + 0.68 = is 10.681.

According to the addition of sig figs, you want your answer to have the same amount of places, after the decimal point, as the least sig-fig figure.

7.6

2.401

0.68

+

----------

10.681 - Draw a line straight down from the least sig-fig figure (7.6)

So the maximum figure after the decimal point is one. Since 8 is greater than 5, you have to round up from 10.6 to 10.7.

A rigid, 26-L steam cooker is arranged with a pressure relief valve set to release vapor and maintain the pressure once the pressure inside the cooker reaches 150 kPa. Initially, this cooker is filled with water at 175 kPa with a quality of 10 percent. Heat is now added until the quality inside the cooker is 40 percent. Determine the exergy.

Answers

The minimum entropy change of the heat-supplying source is -0.87 kJ/K.

Initial entropy of the system

In this case, given the initial conditions, we first use the 10-% quality to compute the initial entropy.

at initial pressure of 175 kPa

S₁ = 1.485  +  (0.1)(5.6865) = 2.0537 kJ/kg K

Final entropy

The entropy at the final state given the new 40-% quality:

pressure inside the cooker = 150 kPa

S₂ = 1.4337  +  (0.4)(5.7894) = 3.7495 kJ/kg K

Mass of the steam at specific volume

m₁ = 0.026/(0.001057   +  0.1 x 1.002643) = 0.257 kg

m₂ = 0.026/(0.001053   +  0.4 x 1.158347)  = 0.056 kg

minimum entropy change of the heat-supplying source

ΔS + S₁  - S₂  + S₂m₂  - S₁m₁  -  sfg(m₂  -  m₁)  > 0

ΔS + 2.0537 -  3.7495 + (3.7495 x 0.056)  -   (2.0537 x 0.257)  - 5.6865( 0.056 - 0.257)  >  0

ΔS > -0.87 kJ/K

Thus, the minimum entropy change of the heat-supplying source is -0.87 kJ/K.

Learn more about entropy here: brainly.com/question/6364271

#SPJ1

In a science demonstration, a teacher mixed zinc (Zn) with hydrogen chloride (HCl) in a flask and quickly attached a balloon over the mouth of the flask. Bubbles formed in the solution and the balloon inflated.
What most likely occurred during this demonstration?

a.The Zn and HCl both retained their identity.
b.Either Zn or HCl, but not both, retained its identity.
c.Evaporation of one of the substances occurred.
d.One or more new substances formed.

Answers

Answer:

a. The Zn and HCl both retained their identity.

Calculate the molality of a solution that contains 1.875 g of potassium chloride (KCl) in 175g water.

Answers

Molality = moles of solute / kg of solvent

(1.875g KCl) x (1 mole KCl/74.5513 g) = 0.02515047 moles KCl

(175 g water) x (1kg/1000g) = 0.175 kg water

0.02515047 / 0.175 = 0.144 m/kg = answer

the total pressure of gas collected over water is 650 mmHg and the temperature is 19.5c what is the pressure of hydrogen gas formed in mmHg?

Answers

The pressure of hydrogen gas formed in mmHg is 633.5mmHg.

About Pressure

In physics, pressure is the magnitude of the force acting per unit area of surface or area of pressure. This phenomenon arises as a result of the compressive force acting on an object per unit surface area in a perpendicular direction.

A pressure will depend on the magnitude of the force. The amount of pressure generated is in line with the amount of force exerted or directly proportional to the force. On the one hand, pressure is inversely proportional to surface area. If the surface area of the compressive field is enlarged, then the pressure will decrease.

The international unit of pressure is Newton per meter squared or N/m2. Meanwhile, the amount of pressure is symbolized by the letter P or p. Besides N/m2, pressure has another unit of measurement, namely Pascal (Pa), which is taken from the name of the French physicist, Blaise Pascal.

Based on question above, the calculation is:

Pressure of hydrogen gas = total pressure - vapor pressure of water

Vapor pressure of water at 19°C = 16.5 mmHg

Hydrogen gas pressure = 650.0mmHg to 16.5mmHg = 633.5mmHg

Learn more about pressure at https://brainly.com/question/22075375

#SPJ1

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Why do we monitor chinstrap penguins instead of krill?

Answers

Answer:Yes

Explanation:

Because Chinstrap penguins eat krills

Other Questions
HELPPPP 12 PONITS !!! PleaseeeeHow do you use context clues and word parts to clarify the meaningof challenging vocabulary? HELP ILL GIVE BRAINLIEST thucydides a. believed that the past had no lessons for understanding the present. b. believed that divine mythological beliefs explained the motives behind all human affairs. c. believed that human nature showed no signs of order. d. believed that historical writing should be subjective and promote divine forces. e. perceived the causes of war and political decisions in strictly rational, eathly terms. Can someone help me find the area of this thx 1 Among three consecutive odd numbers, the sum of the first and the last numbersis 26. What are the numbers? (4) On January 1, 1990, Emilio deposited $1650 into a savings account paying6.2% interest, compounded monthly. If he hasn't made any additionaldeposits or withdrawals since then, and if the interest rate has stayed thesame, in what year did his balance hit $3300, according to the rule of 72?OA. 2001B. 2003OC. 2000D. 2002 which of the following is an example of non-volatile storage? What grade level is Hank the Cowdog? Write your answers in simplified, rationalized form. DO NOT ROUND What represents a restriction on decision variable values for alinear programming problem?Group of answer choicesConstraintsSurplusesExtreme PointsOptimal Points FILL THE BLANK. The approach used to train artificial neural networks is similar to the process of _____.a.natural selectionb.learning to use softwarec.navigating a roomd.learning to ride a bicycle Subtract. Write your answer in simplest form.13/15 - 2/5and i put 7/15 is this correct how accurate were the pigeons at the quality control inspector task (the task of matching to sample) Ellen purchased a dishwasher, which cost $315 before the 9.22% sales tax. She used the machine an average of 10 times per week for the next six years, at which point she replaced it. Each time she ran the dishwasher it cost her $0.09 for water and $0.13 for electricity. What was the lifetime cost of Ellen's dishwasher? a. $1,030.44 b. $686.40 c. $1,093.73 d. $749.69 Please select the best answer from the choices provided. A B C D Hp ng 3 bi , 5 bi trng v 7 bi xanh ly ngu nhin 2 bi. Tnh xc sut? a, C 1 bi trong 2 bi ly ra b, C t nht 1 bi trong 2 bi ly ra What is a compound word that always has a hyphen? Federal orders imposing costs on state and local governments without reimbursement are known as? Which is a benefit of peer-to-peer networking? what is the technique of taking the same scene at several different ev values called? A researcher collects information from the subjects of a study about their criminal history. no one except the researcher and her team have access to the information. this helps ______.