Rewrite the equation of a straight line in a slope - intercept form x + 2y + 1 = 0

Answers

Answer 1

Answer:

y = -x/2 -1/2

Step-by-step explanation:

\(x + 2y + 1 = 0\\\)

Write in the y=mx+b form

\(2y =-x-1+0\\2y =-x-1\)

Divide both sides by 2

\(\frac{2y}{2} =\frac{-1x}{2} -\frac{1}{2} \\\\y = -\frac{x}{2} -\frac{1}{2}\)


Related Questions

Melissa sells 12 pizzas for $166.14. How much is each pizza?

Answers

Answer:

$13.845 per pizza

Step-by-step explanation:

166.14/12=13.845

Answer:

$13.845 per pizza

Step-by-step-explanation:

166.14/12=13.845

I hope this helps

The relationship between two quantities that increase or decrease together is called ______.

A.
indirect variation

B.
variation

C.
direct option

D.
indirect option

E.
direct variation

Answers

Answer:

the relationship between two quantities that increase or decrease together is called Direct variation or positive corrilation.

Answer:

indirect variation

Step-by-step explanation:

in thhe process of when one derease other will also increase .that means that the veraible change in same ratio

Zaire, Manny, Richard, Navid and Gregory found a rope that was 271.5 feet long. If they cut the rope into equal pieces, what was the length of each piece of rope?

helppppppppppppppppp

Answers

Answer:

43.5

Step-by-step explanation:

217.5/5

43.5

ABCD is a trapezium. P is a point along AC such that AP=4PC. DC=1/4AB.

a) express PB in terms of a and b in its simplest form

b) express DP in terms of a and b in its simplest form

c) does DPB form a straight line?

ABCD is a trapezium. P is a point along AC such that AP=4PC. DC=1/4AB.a) express PB in terms of a and

Answers

Answer:

a) We can use similar triangles to find PB in terms of a and b. Let x be the length of AD. Then, using the fact that AP = 4PC, we have:

PC = CP = x - b

AP = 4(x - b)

Also, using the fact that DC = (1/4)AB, we have:

AD = x

AB = 4DC = x/4

BC = AB - AD = x/4 - x = -3x/4

Now, consider the similar triangles PBC and ABD:

PB/AB = BC/AD

PB/(x/4) = (-3x/4)/x

PB = -3/4(x/4) = -3x/16

Finally, substituting x = a + b, we have:

PB = -3(a + b)/16

b) Using the same similar triangles as in part (a), we have:

DP/DC = PB/BC

DP/(1/4)AB = PB/(-3x/4)

DP = -3/4(PB)(DC/BC)AB

DP = -3/4(PB)(1/4)/(AB - AD)AB

Substituting the expressions for PB, AB, and AD from part (a), we get:

DP = -3(a + b)/16 * 1/4 / (-3(a + b)/4) * (a + b)/4

DP = -3/16 * 1/4 * 4/(3(a + b)) * (a + b)

DP = -3/16

So, DP = -3/16(a + b)

c) To check if DPB forms a straight line, we need to verify if the slopes of DP and PB are equal. Using the expressions we found in parts (a) and (b), we have:

Slope of PB = Δy/Δx = (-3/16(a+b) - 0)/(0 - (-3(a+b)/16)) = 3/16

Slope of DP = Δy/Δx = (-3(a+b)/16 - (-3/16(a+b)))/(1/4 - 0) = -3(a+b)/4

Since the slopes are not equal, DPB does not form a straight line.

A software development company is voting to elect a president, a secretary, a treasurer, and three directors. If a total of 11 qualified candidates applied for these positions, in how many ways can the positions be filled?

Answers

The ways to elect the candidates from the total is 462

How to determine the ways of selection?

From the question, we have

Total number of candidate, n = 11Numbers to selection, r = 6 i.e. the president, a secretary, a treasurer, and three directors

The number of ways of selection could be drawn is calculated using the following combination formula

Total = ⁿCᵣ

Where

n = 11 and r = 6

Substitute the known values in the above equation

Total = ¹¹C₆

Apply the combination formula

ⁿCᵣ = n!/(n - r)!r!

So, we have

Total = 11!/5!6!

Evaluate

Total = 462

Hence, the number of ways is 462

Read more about combination at

brainly.com/question/11732255

#SPJ1

Which of the following is the recursive function for the table below?

Which of the following is the recursive function for the table below?

Answers

We can test each of the options in order to see if we can discard the ones that doesn't represent the table shown in the relation.

We will test the first option for n=x=2:

\(\begin{gathered} f(n)=f(n-1)-2f(1) \\ n=2 \\ f(2)=f(1)-2f(1)=-2-2(-2)=-2+4=2\neq-2 \end{gathered}\)

That doesn't match the table result, so we can discard this option.

We test the second option the same way:

\(\begin{gathered} f(n)=f(n+1)-2f(1) \\ n=2 \\ f(2)=f(3)-2f(1)=-6-2(-2)=-6+4=-2 \end{gathered}\)

This match the result from the table, so it can be the answer. But we have to test the other functions to see if we can discard them:

The third option is:

\(\begin{gathered} f(n)=f(n-1)+2f(1) \\ n=2 \\ f(2)=f(1)+2f(1)=-2+2(-2)=-2-4=-6\neq-2 \end{gathered}\)

Discarded.

The fourth option is:

\(\begin{gathered} f(n)=f(n-1)\cdot2f(1) \\ n=2 \\ f(2)=f(1)\cdot2f(1)=-2\cdot2(-2)=-2\cdot(-4)=8\neq-2 \end{gathered}\)

Discarded too.

The only function that was not discarded was the second one, so it has to be the answer.

This is because at least one of the options has to be correct. If not, we should have test for each of the table values in order to be sure.

A line passes though two points A(-2, 2). B(-1, 2). What is the slope:

Answers

Answer:

The slope is 0

Step-by-step explanation:

Slope = (y2 - y1) / (x2 - x1)

Where the values of x and y are from the known points


Here the points are (-2,2) and (-1,2)

So we have (x1,y1) = (-2,2) and (x2,y2) = (-1,2)

This means, x1 = -2 , x2 = -1 , y1 = 2 and y2 = 2

We now plug these values into the slope formula

Recall slope = (y2 - y1) / (x2 - x1)

==> plug in x1 = -2 , x2 = -2 , y1 = 2,  y2 = 2

Slope = (2 - 2) / (-1 - (-2)

==> remove parenthesis

Slope = (2-2)  / (-1 + 2)

==> simplify addition and subtraction

Slope = 0 / 1 = 0

write vertically and add the following:
1. 123 + 245 = ____
2. 708 + 261 = ____
3. 754 + 657 = ____
4. 1897 + 394 = ____
5. 2456 + 649 + 1341 = ____

Answers

Answer:

Note: This is too basic and you should know how to do it by yourself

1. 123 + 245 -> 368

2. 708 + 261 -> 969

3. 754 + 657 -> 1711

4. 1897 + 394 -> 2291

5. 2456 + 649 + 1341 -> 4446

Eg: \(+123\\+ 245\) -> 5 + 3 is 8

              -> 2 + 4 is 6

              -> 1 + 2 is 3  so, 368

Which shows the correct method for solving the equation below? One-third (y minus 9) = 3 A 2-column table with 3 rows. Column 1 is labeled Solution step with entries one-third y minus 3 = 3, one-third y = 6, y = 18. Column 2 is labeled property used with entries distributive property, addition property of equality, multiplication property of equality. A 2-column table with 3 rows. Column 1 is labeled Solution step with entries one-third y minus 27 = 3, one-third y = 30, y = 10. Column 2 is labeled property used with entries distributive property, subtraction property of equality, division property of equality. A 2-column table with 3 rows. Column 1 is labeled Solution step with entries one-third y minus 3 = 1, one-third y = 4, y = 12. Column 2 is labeled property used with entries distributive property, addition property of equality, division property of equality. A 2-column table with 3 rows. Column 1 is labeled Solution step with entries one-third y minus 3 = 3, one-third y = 0, y = 0. Column 2 is labeled property used with entries distributive property, subtraction property of equality, division property of equality.

Answers

Answer:

It’s A took test

Step-by-step explanation:

Answer: I'm pretty sure it's A!

Step-by-step explanation: It's on Edge, hope this helped :)

4. Find the value of p if 2P=2^2 p-7

4. Find the value of p if 2P=2^2 p-7

Answers

Answer:

P = 7

Step-by-step explanation:

\({ \tt{ {2}^{p} = {2}^{2p - 7} }} \\ \)

- From the law of indices; If an index has same base, then the powers are equal.

\({ \boxed{ \rm{ \blue{ ({x}^{a} = {x}^{b}) \rightarrow{ \red{a = b}} }}}}\)

\({ \tt{p = 2p - 7}} \\ { \tt{p -2 p = - 7}} \\ { \tt{p = 7}}\)

OR:

Applying logarithms can also be borrowed;

\({ \tt{ log( {2}^{p} ) = log( {2}^{2p - 7} ) }} \\ \\ { \tt{p log(2) = (2p - 7) log(2) }} \\ \\ { \tt{ \frac{p log(2) }{ log(2) } = \frac{(2p - 7) log(2) }{ log(2) } }} \\ \\ { \tt{p = 2p - 7}} \\ \\ { \tt{p - 2p = - 7}} \\ \\ { \tt{p = 7}}\)

Nicole buys candy that costs $4 per pound. She will spend more than $28 on candy. What are the possible numbers of pounds she will buy?

Answers

hejewjssijwjjwjjdjsisjsjwjwjwjajrkekkakkakekrkrkeekkwwkkwakwkwwiwiwid

4 When Janelle was born, her grandmother put $200 into a college savings account for her.

Each month, her grandmother adds $50 to the account. Which inequality can be used to find

m, the number of months it will take for Janelle's savings account to have more than $1,250

in savings?

A 200m + 50 > 1,250

B 200 + 50m > 1,250

C 200 + 50m < 1,250

D 200m + 50 < 1,250

Answers

Answer:

B

Step-by-step explanation:

200+50m >1250

This means that for every month her grandmother gives 50 for an unknown amount of months along with the first 200 dollars.

The greater than 1250 shows that until she is greater than 1250 she'll keep getting money

Given sin a=−2/5 and cos b=1/3 with a and b both in the interval (3π/2,2π), find sin(a+b)

Answers

Answer:

\(-\frac{8\sqrt{2}+2}{15}.\)

Step-by-step explanation:

1) sin(a+b)=sin(a)cos(b)+sin(b)cos(a);

2) if sin(a)=-0.4, then cos(a)=0.8; if cos(b)=1/3, then sin(b)=-√8/3;

3) finally, sin(a+b)=-0.4*1/3-√8/3*0.8=

\(=-\frac{8\sqrt{2}+2}{15}.\)

Find all unknown measures in the triangle

Find all unknown measures in the triangle

Answers

The value of angle B is 68 degrees and the length of the segments b is 27.81 and c is 11.28.

What is Law of sines?

A triangle's sides and angles are related by the Law of Sines, a trigonometric formula. It specifically specifies that for all three sides and angles of the triangle, the ratio of the length of one side to the sine of the angle opposite that side is the same. This may be expressed as the following equation:

sin A/a = sin B/b = sin C/c

where a, b, and c are the lengths of the sides that are on each side of the triangle's three angles, A, B, and C.

For the give triangle we can use the Law of sines to find the missing values.

The law of sine is given as:

sin A/a = sin B/b = sin C/c

Given A = 90 degrees and C = 22 degrees,

sin 90 / 30 = sin 22 / c

c = 30 sin 22 / sin 90

c = 30 (0.37) / 1

c = 11.28

Now, Using the sum of triangles:

90 + 22 + B = 180

112 + b = 180

B = 68

Now,

sin A/a = sin B/b

Sin 90 / 30 = sin (68) / b

b = 30 sin (68)  sin 90

b = 27.81

Hence, the value of angle B is 68 degrees and the length of the segments b is 27.81 and c is 11.28.

Learn more about law of sines here:

https://brainly.com/question/17289163

#SPJ1


The graph on the left shows the parabola y=x2. What parabola does the graph on the right depict?
y-axis
0
2
x-axis
sixe-A
x-axis
Assessment

The graph on the left shows the parabola y=x2. What parabola does the graph on the right depict?y-axis02x-axissixe-Ax-axisAssessment

Answers

Answer:

y=x^2 + 1

Step-by-step explanation: the second parabola is only raised by 1 unit up, therefore the entire function shifts upwards by 1.

A house is infested with mice and to combat this the householder acquired four cats cyd, Greg, Ken, and Rom, The householder observes that only half of the creatures caught are mice. A fifth are voles and the rest are birds. 20% of the catches are made by Cyd, 45% by Greg, 10% by Ken and 25% by rom. a) What is the probability of a randomly selected catch being a mouse caught by Cyd? b) Bird not caught by Cyd? c) Greg's catches are equally likely to be a mouse, a bird or a vole. What is the probability of a randomly selected d) The probability of a randomly selected catch being a mouse caught by Ken is 0.05 . What is the probablity that a catch being a mouse caught by Greg? e) Given that the probability of a randomly selected catch is a mouse caught by Rom is 0.2 verify that the catch made by Ken is a mouse? probability of a randomly selected catch being a mouse is 0.5 . f) What is the probability that a catch which is a mouse was made by Cyd?

Answers

Note that the probabilities are given below.


What are the probabilities?

a) the probability of a randomly selected catch being a mouse caught by Cyd

p(Catching a mount) x p(Cyd made the catch)

= 0.5x .2

= 0.1

b) the   probability of a bird not caught by Cyd is 0.5 x 0.8 = 0.4.

Thus

P(that a catch is a bird) x p(the Cyd didn't make the catch)

= 0.3 x 0.8

=0.24

c) The probability of a randomly selected catch being caught by Greg is 0.45

To calculate, we say

(0.5   x0.45) + (0.3 x 0.45) + (0.2 x .45)

= 0.45.

d)

P (mouse caught by Greg) = (0.45 x 0.5) / 1

= 0.225.

e) P(catch is a mouse caught by Ken and catch is a mouse)

= P(catch is a mouse | catch is made by Ken) x P(catch is made by Ken)

= 0.05 x 0.1

= 0.005

f)

P (catch made by Cyd | catch is a mouse)

= 0.1    x 0.2 / 0.5

= 0.04

Learn more about probabilities  at:

https://brainly.com/question/3003478

#SPJ1

Express your answers in simplest form
How many 2/3

cup servings are in 9
1/3

cups of yogurt?
A) 10 servings
B) 12 servings
C) 14 servings
D) 16 servings

Answers

Answer:

14 servings

Step-by-step explanation:

\(\frac{9\ 1/3}{2/3} \\=\frac{28/3}{2/3}\\=\frac{28}{3} / \frac{2}{3} \\=\frac{28}{3} * \frac{3}{2} [Reciprocal]\\=28/2\\=14\ servings\)

Answer:

14 Servings so C

Simplify the expression 5x2+6x+4+x2+x
.

Thank You!

Simplify the expression 5x2+6x+4+x2+x .Thank You!

Answers

The simplified solution of the expression 5x²+6x+4+x²+x is 6x²+7x+4.

The given expression is 5x²+6x+4+x²+x

Simplifying the given expression

5x²+6x+4+x²+x

Firstly, put the similar terms together

5x²+x²+6x+x+4

Adding the similar terms

6x²+7x+4

∵ The expression cannot be solved further, 6x²+7x+4 is the final solution.

Therefore, the simplified solution of the expression 5x²+6x+4+x²+x is 6x²+7x+4.

To learn more about simplification of expressions,

https://brainly.com/question/31294154

3:Let f be a quadratic function such that
f(x) = ax² +bx+c = a (x-h)² + k
If k < 0, for what values of a will f(x) have no real zeros?
O a=0
O a<0
O azo
4.
O a>0
O aso
none of the answer choices

3:Let f be a quadratic function such thatf(x) = ax +bx+c = a (x-h) + kIf k &lt; 0, for what values of

Answers

Answer:

O a=0

Step-by-step explanation:

which graph represents y=^3√x

which graph represents y=^3x

Answers

The graph attached is the graph representing the cube root function y = ∛x.

The opposite of the cubic function is the cube root function. We are aware that the parent cubic function is growing, one-one, and onto, and that its form is f(x) = x³. It is a bijection as a result. As a result, its inverse function, the cube root function, is also a bijection and has the form f(x) = ∛x. The parent cubic function and parent cube root functions have the same graphs because we know that a function and its inverse function are symmetric about the line y = x.

In the question, we are asked to show the graph of y = ∛x.

Taking the function of the cube root function as y, we get f(x) = y = ∛x.

Thus, we can show the graph of the cube root function in the attached image.

Learn more about the cube root function at

https://brainly.com/question/14688604

#SPJ9

which graph represents y=^3x

What is the rental cost? Step by step.

What is the rental cost? Step by step.

Answers

The rental cost in dollars per square foot is $11,00

What is the rental cost in dollars per square foot?

Cost of renting 1.250 square feet = $13, 750 per month

Rental cost per square foot = Total renting cost / total renting area

= $13, 750 per month / 1.250 square feet

= $11,000

Hence, $11,000 is the rental cost in dollars per square foot.

Read more on rental cost:

https://brainly.com/question/11959610

#SPJ1

Kathleen ordered a box of different colored light bulbs to use for stage lighting at the concert. Of the 60 bulbs in the box, 20% were red, 30% were orange, 30% were green, and 20% were blue. Of the blue ones, approximately 10% were damaged. What is the closest estimate for the number of blue bulbs that were damaged?

Answers

Answer:

1 bulb

Step-by-step explanation:

First find the number of blue bulbs

60 * 20 %

60 * .2

12 blue bulbs

10 % of the blue were damaged

12 * 10%

12 * .10

1.2

Rounding to the nearest whole number

1 bulb

60 x 0.2 x 0.1 = 1.2
Therefore 1 damaged blue bulb.

find the exact value of each of the remaining trigonometric functions of 0. rationalize denominators when applicable.
sin 0 = v3/6 given that cos 0 = 0

Answers

Given that cos (0) = 0, we can use the Pythagorean identity sin^2(x) + cos^2(x) = 1 to find the value of sin (0).

sin^2(0) + cos^2(0) = 1

sin^2(0) = 1 - cos^2(0)

sin^2(0) = 1 - 0^2

sin^2(0) = 1

So, sin (0) = sqrt(sin^2(0)) = sqrt (1) = 1.

However, the given value is sin (0) = v3/6. This means that sin (0) = sqrt (3)/2, which is the value of sin (60). Therefore, the correct value of sin (0) is sqrt (3)/2, not 1.

trigonometry, the branch of mathematics deal with specific functions of angles and their application to calculations. There is total six functions of an angle commonly used in trigonometry.

To know more about Trigonometry:

https://brainly.com/question/22986150

#SPJ4

Solve the following equation step by step and justify your steps when using an exponential property.

Solve the following equation step by step and justify your steps when using an exponential property.

Answers

Answer:

-1

Step-by-step explanation:

Answer:

-1

Step-by-step explanation:

:)

What is the slope of a line that contains the pair of points (6,-3) and (-5,-4)

Answers

Answer:

Slope (m) =ΔY/ΔX=1/11= 0.090909090909091

θ =

arctan( ΔY ) + 180°ΔX=185.19442890773°

ΔX = -5 – 6 = -11

ΔY = -4 – -3 = -1

Distance (d) = √ΔX2 + ΔY2 = √122 = 11.045361017187

Equation of the line:

y = 0.090909090909091x – 3.5454545454545

or

y = 1x11– 39/11

When x=0, y = -3.5454545454545

When y=0, x = 39

Step-by-step explanation:

solve the question 7 _ 2 3/7​

Answers

Answer:

Do you mean 7 - 2 and 3/7?

If so:

Convert the mixed numbers to improper fractions, then find the LCD and combine.

Exact Form:

32 /7

Decimal Form:

4. 571428

Mixed Number Form:

4  and 4 /7

Step-by-step explanation:

Have a great day!

Answer:

3.7 the answer.........

Choose the correct answer. Sam decides to buy 100 shares of ABC company.They cost $26.25 a share.The commission is 5% of the total price.What is Sam's total cost? $

Answers

Answer:

One share cost: $26.25.

Sam wants to buy 100, which means that the total price of the shares is:

100*$26.25=$2625.

There is also commission of 5% of the total amount:

5% of $2625, which is:

(5/100)*$2625=0.05*$2625=$131.25

So, Sam's total cost will be: the total price of the shares + the commission

$2625+$131.25=$2756.25

Step-by-step explanation:

Answer:

$2756.25

Step-by-step explanation:
Trust

Given m∥ n, find the value of x.

Given m n, find the value of x.

Answers

Answer:

Step-by-step explanation:

3x  +  5  +  x  -  25  =  180

4x  -  20  =  180

4x  =  200

x  =  50

simplify 6to the power of-3 over 6 to the power of5

Answers

1/1679616 or 5.9537418 times 10 to the power of -7


Part A: Factor the expression 18x^2– 39x + 18 completely. Show your work for full credit (6 poionts)
Part B: How do you use multiplication of polynomials to verify the solution is correct? (4 points)

Answers

Answer:

\((a)\\)  \(18x^2 - 39x + 18 = 3(3x -2)(2x - 3)\)

(b) See Explanation

Step-by-step explanation:

Given

\(18x^2 - 39x + 18\)

Solving (a): Factorize Completely

\(18x^2 - 39x + 18\)

Factor out the common term

\(18x^2 - 39x + 18 = 3(6x^2 - 13x + 6)\)

Expand

\(18x^2 - 39x + 18 = 3(6x^2 - 9x -4x + 6)\)

Factorize

\(18x^2 - 39x + 18 = 3(3x(2x - 3) -2(2x - 3))\)

Factor out 2x - 3

\(18x^2 - 39x + 18 = 3(3x -2)(2x - 3)\)

Solving (b): Verify the result

To do this, we simply multiply the terms of the polynomial

\(3(3x -2)(2x - 3)\)

\(3(3x -2)(2x - 3) = (9x - 6)(2x - 3)\)

Open brackets

\(3(3x -2)(2x - 3) = 18x^2 - 27x - 12x + 18\)

\(3(3x -2)(2x - 3) = 18x^2 - 39x + 18\)

Other Questions
Can someone plz help me with this one problem!!! Which research design would be used to determine the relationship between self-concept, physical fitness, and health habits in school-aged children?. a job pays a salary of $32, 000 the first year. during the next 11 years, the salary increases by 2% each year. what is the salary for the 10th year? what is the total salary over the 10-year period? (round to the nearest cent.) which statement best explains why chlorine is added to drinking water what is #1-9 (in picture)??? while performing a review of the hot site used by wells fargo, the auditor finds the following issues. which of the following would be the greatest concern? servers at the hot site have different specifications than the primary site the disk space utilization information are not currentphysical security controls at the hot site are not as robust as the primary sitesystem administrators use shared accounts which never expire Find f(1). CHECK PHOTO ATTACHED what are if statements used for in programs?group of answer choicesmodifying the state of objectsoutputting data in a readable formatconverting data to a different typecontrolling the sequence of executionstoring data for future access A change of a single amino acid at a position distant from the active site of an enzyme can alter the substrate specificity by changing the ________. by changing the stability the enzyme by changing the 3-D shape of the enzyme by changing the binding site for a competitive inhibitor by changing the intracellular location of the enzyme 5. Which item was used by Native American farmers as fertilizer for their crops? (1 point)O dead fishO seashellsOsaltObones For each of the following transactions, select the account to be debited and the account to be credited in the general journal. a. Invested cash in the business, $5,000. b. Paid office rent, $500. c. Purchased office supplies on account, $300. d. Received cash for services rendered (fees), $400. e. Paid cash on account, $50. f. Rendered services on account, $300. g. Received cash for an amount owed by a customer, $100. any years ago a famous member of congress proposed eliminating federal income tax withholding. what criterion for evaluating tax systems did this proposal violate? what would likely have been the result of eliminating withholding? A car traveling 56.0 km/h is 23.0 m from a barrier when the driver slams on the brakes. The car hits the barrier 2.13 s later. (a) What is the magnitude of the car's constant acceleration before impact?(b) How fast is the car traveling at impact? Problem 1:Solve for x: 3x+4=9x+3A }BC-D) None of the above.Show work Is the formula balanced as written? Why or why not? 26. A simple model that shows how energy flows through an ecosystem is calledaA. food chain.B. energy pyramid.C. trophic level. Given the functions f(x)=1x+2 and g(x)=x22x, what is the domain of the composition (fg)(x)?Responsesx2 and x0x is not equal to negative 2, and , x is not equal to 0x0x is not equal to 0all real numbersall real numbersx2x is not equal to negative 2 Betty, Cathy, Isabel, Lani, Alma, and Ursula ran and 800-meter race. Alma beat Isabel by 7 meters. Betty finished 12 meters behind Ursula. Alma finished 5 meters ahead of Lani but 3 meters behind Ursula. Cathy finished halfway between the first and last person. IN what order did they finish? Also indicate the distances between each girl. How does the Nazi Party appeal to the German peoples emotions in the propaganda poster titled Why we fight- four our childrens bread!?Please help Ill do anything! Deb cut 25 feet of rope into pieces that were each 1/4ft long. How many of these pieces did Deb have after cutting the rope?