Question 1
Predict if the bonds formed between the following pairs of elements will be ionic, polar covalent, or
covalent.
Si and O
O and O
C and H
Li and F
Ba and S
Polar Covalent
Covalent
Covalent
lonic
loric

Answers

Answer 1

The following types of bonds exists between the listed atoms;

Si and O - polar covalentO and O - CovalentC and H - CovalentLi and F - ionicBa and S - ionic

What is a polar covalent bonds?

A bond is polar covalent when the electronegativity difference between the bonding atoms is above that found in a nonpolar covalent bond.  Now we shall see the types of bonds between these atoms.

Si and O - polar covalentO and O - CovalentC and H - CovalentLi and F - ionicBa and S - ionic

Learn more about polar covalent bonds:https://brainly.com/question/10777799

#SPJ1


Related Questions

31. Adding an additional oxygen atom to 02 creates....
ozone
oxygen
methane
CFC

PLEASE HELP

Answers

It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs

Answer:

a

Explanation:

At constant current is passed through an electrolytic cell containing molten MgCl2 for 18 hr. if 4.8 x 105 g of Cl2
are obtained. Calculate the current in Amperes.

Answers

The current passing through the electrolytic cell is approximately 2.02 x 10^4 Amperes.

To calculate the current in amperes, we need to use Faraday's laws of electrolysis and the stoichiometry of the reaction.

Faraday's laws state that the amount of substance produced or consumed during electrolysis is directly proportional to the quantity of electricity passed through the cell. The relationship is given by:

Q = nF

Where Q is the electric charge in coulombs (C), n is the number of moles of substance involved in the reaction, and F is Faraday's constant, which is equal to 96,485 C/mol.

In this case, the substance being produced is Cl2, and we know the mass of Cl2 produced, which is 4.8 x 10^5 g.

First, we need to calculate the number of moles of Cl2 produced:

Molar mass of Cl2 = 35.45 g/mol

Moles of Cl2 = mass / molar mass = (4.8 x 10^5 g) / (35.45 g/mol) ≈ 1.354 x 10^4 mol

Now we can calculate the quantity of electricity passed through the cell using Faraday's laws:

Q = nF

Q = (\(1.354 x 10^4\)mol) * (96,485 C/mol)

Q ≈ 1.308 x 10^9 C

The quantity of electricity is given in coulombs. To find the current, we need to divide this value by the time in seconds.

Given that the time is 18 hours, we convert it to seconds:

Time = 18 hours * 60 minutes/hour * 60 seconds/minute

Time = 6.48 x 10^4 seconds

Finally, we can calculate the current:

Current (I) = Q / Time

I = (1.308 x 10^9 C) / (6.48 x 10^4 s)

I ≈ 2.02 x 10^4 Amperes

Therefore, the current passing through the electrolytic cell is approximately 2.02 x 10^4 Amperes.

for more such question on electrolytic visit

https://brainly.com/question/17089766

#SPJ8

after 65 minutes, the amount of a particular radioisotope remaining is 3.13% of the initial amount. what is the half life of the radioisotope?

Answers

Answer:

13 mins

Explanation:

We need to find how many half lives are required to reach .0313

.0313 = 1/2^n    log both sides and solve for n

log.0313 / log (1/2 )   = n     where n= NUMBER of halflives

n = ~ 5 half lives

   these 5 half lives took up 65 minutes

       so EACH half life is 65/5 = 13 mins

Two asteroids are 75,000 m apart one has a mass of 8 x 10^7 N what is the mass of the other asteroid

Answers

The mass of the asteroid is C. 1.2 x \(10^{12}\) Kg

To find the mass of the other asteroid, we can rearrange the equation for the gravitational force between two objects:

F = (G * m1 * m2) / \(r^{2}\)

where F is the force of gravity, G is the gravitational constant, m1 and m2 are the masses of the two asteroids, and r is the distance between them.

Given that the distance between the asteroids is 75000 m, the force of gravity between them is 1.14 N, and one asteroid has a mass of 8 x \(10^{7}\) kg, we can substitute these values into the equation and solve for the mass of the other asteroid (m2):

1.14 N = (6.67430 × \(10^{-11}\) N \(m^{2}\)/\(Kg^{2}\) * 8 x \(10^{7}\) kg * \(m2\)) / \((75000 m)^{2}\)

Simplifying and solving the equation, we find that the mass of the other asteroid (m2) is approximately 1.2 x \(10^{12}\) kg. Therefore, Option C is correct.

The question was incomplete. find the full content below:

Two asteroids are 75000 m apart one has a mass of 8 x \(10^{7}\) kg if the force of gravity between them is 1.14 what is the mass of the asteroid

A. 3.4 x \(10^{11}\) kg

B. 8.3 x \(10^{12}\) kg

C. 1.2 x \(10^{12}\) kg

D. 1.2 x \(10^{10}\) kg

Know more about gravitational force here:
https://brainly.com/question/72250

#SPJ8

PLEASE HELP!!!

How many calories are in 4,180 joules?

Answers

Answer:

To convert joules to calories, you can use the conversion factor:

1 calorie = 4.184 joules

To find out how many calories are in 4,180 joules, divide the given value by the conversion factor:

4,180 joules / 4.184 joules per calorie = 0.9 calories (approximately)

Therefore, there are approximately 0.9 calories in 4,180 joules.

Draw a mechanism for the reaction of methylamine with 2-methylpropanoic acid. Draw any necessary curved arrows. Show the products of the reaction. Include any nonzero formal charges and all lone pairs of electrons. Indicate which side of the reaction is favored at equilibrium.

Answers

Answer:

See figure 1

Explanation:

On this case we have a base (methylamine) and an acid (2-methyl propanoic acid). When we have an acid and a base an acid-base reaction will take place, on this specific case we will produce an ammonium carboxylate salt.

Now the question is: ¿These compounds can react by a nucleophile acyl substitution reaction? in other words ¿These compounds can produce an amide?

Due to the nature of the compounds (base and acid), the nucleophile (methylamine) doesn't have the ability to attack the carbon of the carbonyl group due to his basicity. The methylamine will react with the acid-producing a positive charge on the nitrogen and with this charge, the methylamine loses all his nucleophilicity.

I hope it helps!

Draw a mechanism for the reaction of methylamine with 2-methylpropanoic acid. Draw any necessary curved

A second-order reaction has a half-life of 12 s when the initial concentration of reactant is 0.98 M. The rate constant for this reaction is ________ M-1s-1. A) 12

Answers

Answer: 0.085 (Ms)⁻¹

Explanation: Half life = 12 s

is the initial concentration = 0.98 M

Half life expression for second order kinetic is:

k = 0.085 (Ms)⁻¹

The rate constant for this reaction is 0.085 (Ms)⁻¹ .

What limitations occurs for chalk in vinegar chemistry pd lab experiment?
Also the precautions to take
Need this asap!!

Answers

Answer:

When conducting a chemistry lab experiment using chalk (calcium carbonate) in vinegar (acetic acid), there are several limitations and precautions to be aware of:

Limitations of chalk in vinegar chemistry experiment:

Reaction rate: The reaction between chalk and vinegar is relatively slow, which may require a longer observation period or higher concentration of vinegar to observe significant changes within a reasonable time frame.

Solubility: Chalk may not dissolve completely in vinegar, resulting in incomplete reaction or difficulty in obtaining accurate results.

Product formation: The reaction between chalk and vinegar produces carbon dioxide gas, water, and calcium acetate. The carbon dioxide gas may escape into the atmosphere, leading to loss of product and inaccurate measurements.

pH: Chalk is a basic substance, and the reaction with vinegar, which is acidic, may result in neutralization, leading to a decrease in the overall acidity of the reaction mixture.

Precautions to take in chalk in vinegar chemistry experiment:

Ventilation: The reaction between chalk and vinegar produces carbon dioxide gas, which can displace air and potentially cause asphyxiation in a closed or poorly ventilated area. Conduct the experiment in a well-ventilated area or under a fume hood to ensure adequate air circulation.

Eye and skin protection: Vinegar is an acid and can cause skin and eye irritation. Wear appropriate personal protective equipment (PPE), such as gloves and goggles, to protect yourself from contact with vinegar or any other chemicals used in the experiment.

Chemical handling: Handle the chemicals, including chalk and vinegar, with care, following proper lab safety protocols. Avoid ingestion, inhalation, or direct contact with the chemicals, and dispose of them properly according to local regulations.

Accuracy in measurements: Use calibrated and accurate measuring tools, such as graduated cylinders or burettes, to measure the amount of chalk, vinegar, and other reagents accurately. This will ensure the reliability and accuracy of the experimental results.

Observations: Make careful and detailed observations during the experiment, noting any changes in appearance, gas evolution, or other relevant observations. Take measurements at appropriate intervals and record the data accurately for analysis and interpretation.

It is important to follow good laboratory practices, including proper chemical handling, accurate measurements, and cautious observations, to ensure safe and reliable results in a chalk in vinegar chemistry lab experiment. Consult with a qualified instructor or supervisor for specific guidelines and precautions related to your experiment.

(c) 45 g C,H, react with 45 g Cl₂ according to the equation:
Cl₂ + C6H6 C6H5Cl + HCI. What is the limiting reactant? What mass of HCI will be produced?
-

Answers

In the given reaction, the limiting reactant is C₆H₆ (benzene).

To determine the limiting reactant as well as calculate the mass of HCl produced, compare the moles of each reactant.

The number of moles for each reactant:

Molar mass of Cl₂ = 35.5 g/mol + 35.5 g/mol = 71 g/mol

Moles of Cl₂ = mass of Cl₂ / molar mass of Cl₂

                     = 45 g / 71 g/mol

                     = 0.634 moles of Cl₂

Molar mass of C₆H₆ (benzene) = 12 g/mol + 6(1 g/mol) = 78 g/mol

Moles of C₆H₆ = mass of C₆H₆ / molar mass of C₆H₆

                        = 45 g / 78 g/mol = 0.577 moles of C₆H₆

Determine the stoichiometry between Cl₂ and HCl:

Cl₂ + C₆H₆ → C₆H₅Cl + HCl

Here, we can see that 1 mole of Cl₂ produces 1 mole of HCl.

Thus, the limiting reactant is C₆H₆ (benzene).

Calculate the mass of HCl produced:

Molar mass of HCl = 1 g/mol + 35.5 g/mol = 36.5 g/mol

Moles of HCl produced = moles of C₆H₆ = 0.577 moles

Mass of HCl produced = moles of HCl produced × molar mass of HCl

Mass of HCl produced = 0.577 moles × 36.5 g/mol

                                     ≈ 21.04 g

Therefore, approximately 21.04 grams of HCl will be produced.

For more details regarding limiting reactant, visit:

https://brainly.com/question/10090573

#SPJ1

what is the difference between the coarse adjustment knob and the fine adjustment knob?

Answers

Answer:

COARSE ADJUSTMENT KNOB — A rapid control which allows for quick focusing by moving the objective lens or stage up and down. ... FINE ADJUSTMENT KNOB — A slow but precise control used to fine focus the image when viewing at the higher magnifications. 6.

Coarse adjustment, using the coarse adjustment knobs, raises and lowers the stage more rapidly. Fine adjustment knobs are the smaller knobs and are also used to raise and lower the stage but more slowly and in a more controlled manner under higher magnifications.

Scientists launch a rocket, and they monitor its acceleration and the force exerted by its engines. As the rocket gets higher, the monitors show that the acceleration of the rocket is increasing but the force exerted stays the same. How do Newton’s laws explain why the scientists could expect this to happen?

Answers

The force applied to the rocket by its engines remains constant as it moves up, while its mass decreases, resulting in an increase in acceleration.

Newton's laws of motion provide an explanation for the acceleration of a rocket as it moves away from the ground. According to Newton's second law, the force exerted on an object is directly proportional to its acceleration, and the force required to move an object increases as its mass increases.

In the case of a rocket, its mass decreases as it consumes fuel, which means that less force is required to move it as it climbs higher into the atmosphere.

As the rocket moves up, its acceleration increases while the force exerted on it remains constant. Newton's second law of motion explains that the acceleration of an object is directly proportional to the force applied to it. According to the second law of motion, an object's acceleration is equal to the force exerted on it divided by its mass.

This means that as the rocket climbs higher and its mass decreases due to the consumption of fuel, less force is required to accelerate it, and so its acceleration increases. In other words, the rocket's acceleration is increasing because the force required to move it is decreasing due to the decreasing mass of the rocket.

This phenomenon is also related to Newton's third law of motion, which states that every action has an equal and opposite reaction. The force exerted by the rocket's engines is balanced by an equal and opposite force exerted on the rocket by the exhaust gases, according to this law.

For more such questions on acceleration visit;

https://brainly.com/question/26590057

#SPJ8

A constant electric current deposited 365 mg of Ag in 216 minutes from an aqueous Silver trioxonitrate (v). What is the Current?​

Answers

The electric current is  0.025 A

Electric current refers back to the go with the flow of energy in an electronic circuit and to the amount of strength flowing through a circuit. it's far measured in amperes (A). the bigger the cost in amperes, the more energy is flowing within the circuit.

Ag+ + e¯ →Ag

1F deposits 107.87 g/mol (molecular mass) of silver

1F = 96500 C

Let, 107.87 g/mol needed = 96500 C

Number of coulombs required to deposit 0.3650 g of silver =(96500/107.87) 0.3650  

Q = 326.5 C

According to Faraday’s law, Q = I x t

I = 326.5 C / (216 x 60 s) = 0.025 A

Learn more about electric current here:-https://brainly.com/question/2984202

#SPJ9

If there is sufficient fossil fuel , how will we cope ?

Answers

If there is sufficient fossil fuel, we will cope by utilizing it in a responsible and sustainable manner while actively transitioning towards alternative energy sources. Coping with the abundance of fossil fuels requires a multi-faceted approach that considers environmental, economic, and social aspects.

To cope effectively, we can:

1. Promote energy efficiency: Invest in technologies and practices that minimize energy waste and maximize efficiency in all sectors, including transportation, industries, and buildings.

2. Transition to renewable energy: Increase the adoption of renewable energy sources such as solar, wind, hydro, and geothermal power. This reduces our reliance on fossil fuels and mitigates environmental impacts.

3. Implement policy measures: Enact policies that incentivize the use of renewable energy, discourage excessive fossil fuel consumption, and promote sustainable practices.

4. Invest in research and development: Support and fund research efforts aimed at developing cleaner and more sustainable energy technologies, such as advanced battery storage, hydrogen fuel cells, and carbon capture and storage.

for more questions on fossil
https://brainly.com/question/14004257
#SPJ8

According to Le Châtelier's principle, an increase in temperature will shift the equilibrium position toward the products in an endothermic reaction. (2 points)
O True
O False

Answers

True, according to Le Châtelier's principle, an increase in temperature will shift the equilibrium position toward the products in an endothermic reaction.

Le Châtelier's principle states that changes in the temperature, pressure, volume, or concentration of a system will result in a noticeable and opposing changes in the system in order to achieve a new equilibrium state.

According to Le Châtelier's principle;

Increase in temperature causes the equilibrium to shift in the direction of the endothermic reaction.Decrease in temperature causes the equilibrium to shift in the direction of the exothermic reaction.

Thus, the According to Le Châtelier's principle, an increase in temperature will shift the equilibrium position toward the products in an endothermic reaction.

Learn more about Le Châtelier's principle here: https://brainly.com/question/2943338

Why do you think the Haití earthquake in 2010 happened?

Answers

Both Saturday's earthquake and the one in 2010 are thought to have been caused by the Enriquillo-Plantain Garden fault system, according to the United States.

What is the Haitian problem with the Enriquillo-plantain garden?

The Enriquillo-Plantain Garden fault zone (EPGFZ or EPGZ) is indeed a network of active coaxial left lateral-moving strike - slip faults faults that extends along the southern coast of Hispaniola, the island that is home to Haiti and the Dominican Republic.

Where is the fault system between Enriquillo and Plantain Garden?

As one of Haiti's main plate-bounding fault systems, the Enriquillo-Plantain Garden fault zone is very well known. Initially believed to be the cause of the Mw 7.0 earthquake that struck Port-au-Prince on January 12, 2010, the strike-slip fault is located close to the city.

To know more about Enriquillo-Plantain visit:

https://brainly.com/question/15960054

#SPJ1

Neutralization Reactions

5. Acids and bases go to completion via neutralization reactions, thus titrations are applicable. Refer to educational resources and provide an example of the chemical reactions for the solutions in a–c.
a. A mixture between a strong acid and a strong base.
b. A strong base mixed with a weak acid.
c. A strong acid mixed with weak base.

Answers

Answer:

its a option neutralization takes place between acid and base plz mark me branliest

_________ is caused by deficiency of Vitamin A​

Answers

Answer:

Vitamin A deficiency can result from inadequate intake, fat malabsorption, or liver disorders.

What are the three RID factors?

Answers

recognition, intrusion and distraction

Answer:

recognition, intrusion and distraction

Explanation:

if 650J heat is absorbed by a system and 450J work is done on the system, then find the change in internal energy of the system

Answers

Answer: 380 J. Please mark

Explanation:

How many moles are in 756grams of Na2 CO3?

Answers

To convert mass to moles we will:

\(\begin{gathered} moles=\frac{mass}{molar\text{ }mass} \\ \\ _nNa_2CO_3=\frac{756g}{105.99\text{ }gmol^{-1}} \\ _nNa_2CO_3=7.13mol \\ \end{gathered}\)

Answer: 7.13 mol Na2CO3

NEED ANSWER ASAP
What is the phase change that happens with a gas goes straight to a solid (skip the liquid stage)? Frost would be a good example in everyday life.

Answers

The phase change is called deposition, when a gas transforms into a solid without passing through the liquid phase.

In a particular redox reaction, NO is oxidized to NO−3
and Cu2+ is reduced to Cu+.
Complete and balance the equation for this reaction in acidic solution. Phases are optional.
balanced redox reaction:
NO + Cu^{2+} -> NO_{3}^{-} + Cu^{+}

Answers

The balanced redox equation for the given reaction in acidic solution is:

\(3NO + 3Cu^2+ + 2e^- - > 3NO_3^- + 3Cu^+.\)

To balance the redox reaction:

\(NO + Cu^2+ - > NO_3^- + Cu^+\)

First, let's assign oxidation states to each element/ion in the equation:

Oxidation state of N in NO: +2

Oxidation state of N in \(NO_3^-: +5\)

Oxidation state of Cu in \(Cu^2+: +2\)

Oxidation state of Cu in \(Cu^+: +1\)

From the given oxidation states, we can see that N is being oxidized from +2 to +5, and Cu is being reduced from +2 to +1. We need to balance both the charge and the number of atoms on each side of the equation.

Balancing the nitrogen:

We need three NO molecules on the reactant side to balance the nitrogen atoms on the product side. Thus, the equation becomes:

\(3NO + Cu^2+ - > NO_3^- + Cu^+\)

Balancing the charge:

The charge on the reactant side is 0 (since NO is neutral), while on the product side, we have 1- charge from NO_3^- and 1+ charge from Cu^+. To balance the charges, we need two electrons on the reactant side.

Final balanced equation:

\(3NO + 3Cu^2+ + 2e^- - > 3NO_3^- + 3Cu^+\)

In acidic solution, we need to balance the hydrogen ions \((H^+)\). In this case, there are no hydrogen ions on either side of the equation, so no additional steps are needed.

For more such information on: redox equation

https://brainly.com/question/27907895

#SPJ8

1. What is unsafe about Ernie's behavior?
2. Why is Lydia's behavior appropriate?
Why is it important in a laboratory setting?

Answers

Ernie's behavior is unsafe because,

In the course of playing in the laboratory, he could injure himself or damage the laboratory equipment, in this case, the microscope he is carrying.

Lydia's behavior is appropriate because

As she maintains a calm and serious disposition she can get accurate results from the experiments she performs.

This behavior is important because

The laboratory is a place where serious work is done. To maintain safety and achieve accuracy, Lydia's behavior is recommended.

In that picture, we see Lydia well clad in her laboratory suit, and gloves. She also maintains a serious work ethic as she views the solution in the flat bottom flask.

This is the recommended attitude in the laboratory because it allows for safety and accuracy.

Ernie, on the other hand, runs around the laboratory while playing with the microscope. He could slip and have a chemical fall on him thus causing an injury.

His behavior causes distractions and might also cause mistakes for scientists observing and recording data.

Learn more here:

https://brainly.com/question/11734312

Write the chemical formula for this molecule

Write the chemical formula for this molecule

Answers

The answer is CH3COCl
Write the chemical formula for this molecule

Volcanic eruptions inflation

Volcanic eruptions inflation

Answers

The volcanic eruptions inflation are listed below.

What is volcanic eruption ?

Lava and gas are occasionally discharged explosively from a volcano during a volcanic eruption. When newly erupted lava cascades down a volcano's flanks, it is known as a "glowing avalanche" and is the most deadly sort of eruption. Temperatures of up to 1,200 degrees Fahrenheit can be reached and they can move swiftly.

What is eruption?

The silica content and gas content of the magma play a major role in determining the features of the four different types of eruptions. These include the Hawaiian, Strombolian, Vulcanian, and Plinian eruptions, in order of increasing explosiveness.

The earth surface often expands when magma builds up in an underground reservoir prior to an eruption (named inflation). Similarly, as magma exits the reservoir with the potential to erupt, the land above the reservoir sinks (named deflation).

Therefore, volcanic eruptions inflation are listed above.

Learn more about volcanic eruption from the given link.

https://brainly.com/question/25121802

#SPJ1

expaln the conductivity of magnesium

Answers

Magnesium is not a good conductor. Hence, the conductivity of magnesium is not good.

Magnesium is placed in group 2 of the periodic table. It has 2 valence electrons which are in the fully filled s-subshell. When the subshell is fully filled, the electrons are not available to move to conduct. For example, group 1 has half filled subshell which allows the electrons to move.

But, how does magnesium conduct? As its subshell is fully filled and therefore no electrons are available to move.

In group 2 metals, there is a property called s-p hybridization. The s- and p- subshells overlap so that metals can now move to the unfilled states of the p-subshell.

Hence, magnesium is not a good conductor.

To learn more about magnesium, visit: https://brainly.com/question/488824

#SPJ9

Question 1
This diagram shows Earth in four different positions during its yearly orbit around the sun. Which of the following accurately describes the position of the United States during the summer months?

Question 2
The diagram models 4 lunar phases. During which one is the tide the highest?

Question 3
An HR Diagram is shown below. A star that has a luminosity of 10^-2 is likely a…

Question 4
Earth's atmosphere blocks short wavelengths of the electromagnetic spectrum. Which telescopes DO NOT need to be placed in orbit around Earth to observe short-length radiation?

Question 5
A student models the relationship between the Earth and the Sun using string and a ball. Which of the following explains the relationship demonstrated?

Question 1This diagram shows Earth in four different positions during its yearly orbit around the sun.
Question 1This diagram shows Earth in four different positions during its yearly orbit around the sun.
Question 1This diagram shows Earth in four different positions during its yearly orbit around the sun.
Question 1This diagram shows Earth in four different positions during its yearly orbit around the sun.
Question 1This diagram shows Earth in four different positions during its yearly orbit around the sun.

Answers

Answer 1:

During the summer months in the northern hemisphere (where the United States is located), Earth is in position C, which is when the northern hemisphere is tilted towards the sun.

Answer 2:

The highest tide occurs during the full moon phase, which is represented by position C in the diagram.

Answer 3:

A star that has a luminosity of 10^-2 is likely a red dwarf.

Answer 4:

Telescopes that observe short-wavelength radiation, such as X-rays and gamma rays, do not need to be placed in orbit around Earth because these wavelengths are absorbed by the atmosphere. Therefore, telescopes that observe these wavelengths are typically placed in space, outside of Earth's atmosphere.

Answer 5:

The student is likely demonstrating the relationship between the Earth and the Sun's gravitational pull. The ball represents the Sun, and the string represents the gravitational force pulling the Earth towards the Sun. The demonstration shows how the Earth orbits the Sun due to this gravitational force.

What is gravitational force?

Gravitational force is described as a force that exists between any two objects in the universe that have mass.

It is the force that causes objects with mass to be attracted to each other. The magnitude of the gravitational force between two objects depends on their masses and the distance between them.

Along with the electromagnetic force, the strong nuclear force, and the weak nuclear force, gravity is one of the four fundamental forces of the universe.

Sir Isaac Newton initially introduced it in his law of universal gravitation, and Albert Einstein later elaborated on it in his theory of general relativity.

Learn more about Gravitational force at: https://brainly.com/question/27943482

#SPJ1

I need help calculating the error % in molar mass

Answers

To calculate the error percentage in molar mass, you need to first determine the actual molar mass and the experimental molar mass. The error percentage is then calculated using the following formula:

Error % = |(experimental - actual) / actual| x 100%

For example, let's say the actual molar mass of a compound is 100 g/mol, and the experimental molar mass determined in the lab is 95 g/mol. The error percentage would be:

Error % = |(95 - 100) / 100| x 100%
Error % = |-0.05| x 100%
Error % = 5%

Therefore, the error percentage in molar mass is 5%

Make two molecules of water without any leftovers, what is the result?

Answers

To create molecules, atoms combine. Two hydrogen (H) atoms and one oxygen (O) atom make up a water molecule's three atoms. H2O is a common abbreviation for water because of this.

EXAMPLES OF MOLECULES AND WHAT A MOLECULE IS:

The smallest unit of a material that keeps its content and characteristics is a molecule, which is made up of two or more atoms linked together by chemical bonds. The building blocks of chemistry are molecules.

What exactly are fundamental molecules?

The phrase "the molecules of life" frequently refers to these four categories of molecules. Proteins, carbohydrates, lipids, and nucleic acids make up the four basic building blocks of life. Every single life on Earth depends on one or more of the four categories. These four molecules are necessary for a cell and an organism to exist.

To know more about molecules visit:

https://brainly.com/question/19922822

#SPJ1

Question
Why does corn pop in the microwave?

Answers

Answer:

it pops because the heat and water inside of it

Explanation:

Answer:

when the corn is heated, the water turns into steam, which builds pressure inside the kernel. When it can no longer contain the pressure it pops.

Explanation:

Other Questions
what are the values of each variable This is trigonometry btw CSS Flexible Box Layout is best suited for: Multiple ChoicePlerre draws on his folder when he is riding the bus to school. He likes to work on a drawing in his notebook If he finishes his assignments in class early. Pierre's parentsallow him to draw on his bedroom walls. His room is his canvas. Plerre is most interested inO paintingO buseshomeworkart true or false: traditional businesses accustomed to using print media will be able to transition to digital media with ease. true false question. true false Why was the USS Maine warship attacked.Do you think the attack was fair This essay was written for a course in narrative journalism, a genre that uses individual stories to illuminate public issues. Imagine that Lehna told this story as part of an essay on the need for prison reform for a political science course. How might the essay be different for that purpose when first-mover advantage is crucial and a high degree of competitive intensity prevails, the approach is better for international expansion. Having never been on a plane, I was very nervous on the flight toDisney World. _____ PhraseMain ClauseSubordinate Clause Bonjour ! J'aimerais savoir quel est le rsultats de ces calculs, svp. Je n'y arrive vraiment pas Select the words that have been spelt incorrectly Belligerent Disagreable Iridescent Please do not use a computer or spreadsheet to solve this questionExcel images are not allowed for this questionFirm B faces the following:Revenue per order = $8000750 orders/deliveries per yearNet cost as a percent of revenue = 60%80% of late deliveries redelivered; 20% cancelledCost of redelivery = $350Invoice deduction for redeliveries = $2504. What is the total lost profit or cash flow from an 85% on-time delivery rate?5. What is the total lost profit or cash flow from a 95% on-time delivery rate?6. What is the percentage reduction in total lost profit or cash flow from this 10% increase in on-time delivery?Please solve this question steps by steps. Do not use Excel spreadsheet. It is really important for me. Thank you very much. Two-third's of what body is needed topropose an Amendment?A. Executive BranchB. CongressC. VotersD. Supreme Court 15. Classify Each Angle Pair then find the value of X name a ratio that is proportional to 4/10 Explain how you khow it is proportional A bus slams on its breaks and goes from 30km/hr to 15km/hr in 4 seconds. What is its acceleration? Andy Warhol was one of the most popular artists of his time. His playful style of painting and approach to creating "pop" art made him fashionable and well liked. Warhol's inspiration to become an artist started when he was eight years old. During that time, he became sick and spent a lot of time in bed because of illness. His mother was an artist and gave him drawing lessons to keep him occupied and lift his spirits. He soon discovered that he loved drawing. He also became a fan of film and photography, which helped him realize how much he wanted art to be an important part of his life. Warhol's art career officially began in the 1950s, when he worked as a magazine illustrator and graphic designer in New York City. While working at Glamour, a popular fashion magazine, he became well known for his unique style of photography and quirky handwriting. In the early 1960s, he began to show more interest in painting. Andy experimented with creative new techniques. He started by making paintings that looked like comics and advertisements. Eventually, he began painting common objects in a pop art style. People became fascinated with his work because it was a very different style of art from what they were used to. Warhol painted everyday things such as vacuum cleaners and soup cans. His paintings of ketchup bottles and hamburgers received a lot of attention. Warhol did not just paint. He made art in various mediums and experimented with film and television. However, his popularity greatly grew when he started painting famous people. He painted celebrity portraits of Marilyn Monroe, Elvis, and Mick Jagger. Eventually, celebrities started offering Warhol a great deal of money to paint their portraits. Musicians, wealthy socialites, and film stars were very eager to be painted by the ultra-talented Warhol. Painting celebrities was very profitable, and it became his main source of income. Some of his paintings sold for millions of dollars. Today, some of Warhol's paintings are considered some of the most valuable pieces of art in the world. He is one of the most celebrated founders of pop art.Select all the correct answers.Which two sentences best represent the central idea of the passage?A. Andy's love for drawing, film, and photography drove him to pursue a career in art.B. Andy started his career as a magazine illustrator and graphic designer in New York City.C.Andy's paintings of ketchup bottles and hamburgers made him one of the most celebrated founders of pop art.D. Andy's playful, unique, and quirky style of painting made him famous for his pop art and set him apart from the other painters.E.Andy's mother was an artist, and he inherited this fondness for art from her. The male climacteric represents the end of sexual behavior for men. true or false The distance walks from home to school is 120 meters and 80 meters when he goes to church from home. gusion estimates that the distance lesley walks when he goes directly to church. coming from school is 180 meters guinevere's estimation is 210 meters. which estimation is feasible? make a map lesley's way from home to schooland church. justify your answer. the nurse is helping mrs. smith plan a diet that help keep her serum blood glucose levels consistent through the day. the nurse determines that mrs. smith understood the teaching when she selects snack to eat in each situation?