Prometheus is a character that stole fire from the gods in Greek mythology. Which element is named from Prometheus?

Answer:

The proton determines the identity of an element.

At 2861 degree Celsius the iron begins to boil. At 1,538 °C the substance begins to melt.

The melting point is the point at which the liquid and solid forms of a solid can exist in equilibrium. It can also be defined as the point at which a solid changes into a liquid under normal atmospheric pressure.

The equilibrium point at which water vapor, liquid water, and solid ice can exist in equilibrium is the only point at which the pressure and temperature of water vapor are the same. The equilibrium point of water vapor is the point at which the partial vapor pressure is the same as that of liquid water at the exact temperature of 273.1600 K.

To learn more about iron, refer to the link:

https://brainly.com/question/31984794

#SPJ1

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

polymer mear least receptive to dye

,

The surface area of the Lake Louise in square miles is 0.31 sq. miles

Unit conversion is the process of converting the measurement of a given amount between various units, often by multiplicative conversion factors that alter the value of the measured quantity without altering its effects.

To create a unit conversion issue where one (or more) units cancel out until just the desired unit is left, follow these steps:

The fundamental rule is to multiply when converting from a bigger unit to a smaller unit. Divide if you need to go from a smaller to a larger unit. You will reduce the number, and you are already aware that division is all about reducing numbers.

Given ,

2.59 sq kilometers is equivalent to 1 sq. mile

1 sq. kilometer = (1/2.59) sq. miles

0.8 sq kilometers is equivalent to (1/2.59)*0.8 = 0.31 sq miles

The surface area of the Lake Louise in square miles is 0.31 sq. miles

To learn more about Conversion refer to  :

https://brainly.com/question/29279606

#SPJ1

The surface area of the Lake Louise in square miles is 0.31 sq. miles

Unit conversion is the process of converting the measurement of a given amount between various units, often by multiplicative conversion factors that alter the value of the measured quantity without altering its effects.

To create a unit conversion issue where one (or more) units cancel out until just the desired unit is left, follow these steps:

Find out what kind of unit you have.

Determine the desired unit.

Choose the proper unit conversion factor(s).

unit cancellation and math computations (e.g., multiply, divide).

The fundamental rule is to multiply when converting from a bigger unit to a smaller unit. Divide if you need to go from a smaller to a larger unit. You will reduce the number, and you are already aware that division is all about reducing numbers.

Given ,

2.59 sq kilometers is equivalent to 1 sq. mile

1 sq. kilometer = (1/2.59) sq. miles

0.8 sq kilometers is equivalent to (1/2.59)*0.8 = 0.31 sq miles

The surface area of the Lake Louise in square miles is 0.31 sq. miles

To learn more about Conversion refer to  :

https://brainly.com/question/30299690

#SPJ1

The following statement is true concerning the results of the Human Genome Project:

The Human Genome Project has raised many complicated ethical issues.

What is Human Genome?

The human genome refers to the complete set of genetic information (DNA) present in human cells. It includes both the protein-coding and non-coding regions of DNA. The human genome is made up of about 3 billion base pairs and is organized into 23 pairs of chromosomes. The study of the human genome is an important field of genetics and has many implications for understanding human biology, evolution, and disease.

The Human Genome Project was a scientific research project that aimed to identify and map all the genes in the human genome, which contains all the genetic information needed for human development and function. The project was completed in 2003 and provided a wealth of information about the structure and function of the human genome, including the location and sequence of all human genes.

Learn more about Human Genome from the given https://brainly.com/question/29479722

#SPJ1

Option B is true , the same number of moles of solute in both solution is the same.

Molarity is the ratio of no of moles as per liter solution. It is denoted by M and SI unit is also M or moles/litre.

Molarity = no . Of moles/Volume (L)  

In this question the amount of solution is increased means the volume is increased from 500-700ml it is increased , Molarity is inversly proportional of Volume

it will decrease if volume increase. Adding water do affect the concentration of the solution. The no. Of moles of solute remains because there no increament in amount of NaCl .

Hence ,option B is more correct

to learn more about Molarity click herehttps://brainly.com/question/27931587

#SPJ9

Answer:

In a chemical reaction, reactants contact each other, bonds between atoms in the reactants are broken, and atoms rearrange and form new bonds to make the products.

Explanation:

Answer:

d

Explanation:

The one that best describes the process represented  that takes place when NH₃ is added to water is the correct option is d.  NH₃  is acts as a Bronsted lowry base.

The chemical reaction is :

NH₃(aq)  +   H₂O(l)   ---->   NH₄⁺(aq)     +    OH⁻(aq)

Base          Acid            conjugate acid      conjugated base

In the above reaction the ammonia that is NH₃ acts as a base when it dissolve in the water because when it dissolve in water it produces the OH⁻ that is responsible for the pH in the solution. NH₃ is the Bronsted Lowry base as it accepts the protons that is donated by the   H₂O and form the NH₄⁺ ion which is a conjugate acid of the  NH₃ .

This question is incomplete the complete question is :

NH₃(aq)  +   H₂O(l)   ---->   NH₄⁺(aq)   +  OH⁻(aq)

which of the following best describes the process represented above that takes place when NH₃ is added to water?

a. Water is acts as an conjugated acid

b. There is more NH₃ than  H₂O

c.  NH₃  does not react with water

d.  NH₃  is acts as as Bronsted lowry base

To learn more about  NH₃ here

https://brainly.com/question/29298785

#SPJ4

The mass of hydrogen needed to produce 51.0 grams of ammonia is  ≈ 9.07 grams.

To determine the mass of hydrogen required to produce 51.0 grams of ammonia (NH3) using the Haber process, we need to calculate the stoichiometric ratio between hydrogen and ammonia.

From the balanced chemical equation:

3 H₂(g) + N₂(g) → 2 NH₃(g)

We can see that for every 3 moles of hydrogen (H₂), we obtain 2 moles of ammonia (NH₃).

First, we need to convert the given mass of ammonia (51.0 grams) to moles. The molar mass of NH₃ is 17.03 g/mol.

Number of moles of NH₃ = Mass / Molar mass

                     = 51.0 g / 17.03 g/mol

                     ≈ 2.995 moles

Next, using the stoichiometric ratio, we can calculate the moles of hydrogen required.

Moles of H₂ = (Moles of NH₃ × Coefficient of H₂) / Coefficient of NH₃

           = (2.995 moles × 3) / 2

           ≈ 4.493 moles

Finally, we can convert the moles of hydrogen to mass using the molar mass of hydrogen (2.02 g/mol).

Mass of H₂ = Moles × Molar mass

          = 4.493 moles × 2.02 g/mol

          ≈ 9.07 grams

Therefore, approximately 9.07 grams of hydrogen is needed to produce 51.0 grams of ammonia in the Haber process.

Know more about the mass of hydrogen here:
https://brainly.com/question/14083730

#SPJ8

Answer:

Measure the volume of water poured into a graduated cylinder, then place the object in the water and remeasure the volume. The difference between the two volume measurements is the volume of the object. Now simply divide the mass by the volume to calculate the density of the object.

Answer:

Testing of thesis testing is used to determine the plausibility of a thesis.

The test assess the plausibility of the thesis of a sample data.

It occurs through different way, the first step is used to test the state the two suppositions.

In the coming step evaluation of data, third step include carry out plan and dissect the data.

The final step is to dissect the results of the data, it can moreover accept the thesis and reject the null thesis.

Learn further about thesis, then

brainly.com/question/17173491?

The concentration of a substance can be expressed using molarity, molality or percent.

The term concentration has to do with the amount of substance present in solution. Now let us solve the problems individually;

a) Number of moles =  0.850 grams/80 g/mol = 0.011 moles

molarity = 0.011 moles/345 * 10^-3 L = 0.032 M

b) Number of moles =  13.5g /58 g/mol = 0.23 moles

molality = 0.23 moles/250 * 10^-3 Kg = 0.92 m

c) Number of  moles = 16.5 g/128 g/mol = 0.13 moles

molality = 0.13 moles/54.3  * 10^-3 Kg =2.39 m

d) Total mass present =  12 g +  18 g + 25 g + 500 g = 555 g

mass percent of calcium sulfate =  12 g/555 g * 100/1 = 2.2 %

mass percent of sodium nitrate =  18 g/ 555 g  * 100/1 = 3.2 %

mass percent of potassium chloride = 25 g / 555 g  * 100/1 = 4.5%

mass percent of water =  500 g / 555 g  * 100/1 =90.1%

e) Total mass present = 125 g + 1500g = 1625 g

Mass percent of NaCl =  125 g/1625 g * 100/1 = 7.7%

f) Total volume of solution = 15 L +  28 L  = 43 L

percent by volume of acetone = 15 L/43 L * 100/1 =  34.9%

Learn more about concentration: https://brainly.com/question/10725862?

Answer: 380 J. Please mark

Explanation:

Answer:

37.0. gsgggsgsghddhhdd

Answer:

≈ 395,8 J/(kg * °C)

Explanation:

m = 44 g = 0,044 kg

\(t_{1}\) = 22 °C

\(t_{2}\) = 33,6 °C

Q = 202 J

The formula is: Q = c * m * (\(t_{2} - t_{1}\))

c = \(\frac{Q}{m * (t_{2} - t_{1} )}\)

Calculating:

c = 202 J / 0,044 kg * (33,6 °C - 22 °C) ≈ 395,8 J/(kg * °C)

Explanation:

3 moles of O2 will be produced from 2moles of NaCLO3.

hope this helps you.

The number of moles of carbondioxide that will be produced in the combustion of methane is 3 moles (option D).

Stoichiometry refers to the study and calculation of quantitative (measurable) relationships of the reactants and products in chemical reactions (chemical equations).

According to this question, methane undergoes combustion in air to produce carbondioxide and water. Methane is the limiting reactant because the other reactant is oxygen of the air which is always present in excess.

Based on the chemical equation given above, 1 mole of methane produces 1 mole of carbondioxide.

This means that 3 moles of methane will produce 3 moles of carbondioxide.

Learn more about stoichiometry at: https://brainly.com/question/9743981

#SPJ1

Answer:

- Increase pressure .

Explanation:

Hello,

In this case, during the dissolution process, the solute's molecules rearrange in order to get together with the solvent's molecules, in this case water.

Now, since we are talking about a solid whose particles are intimately held together, the only way to separate them is by increasing the temperature because the molecules start moving so they can join water's molecules, decreasing particle size since they will be more likely to separate to each other and increasing stirring since the applied energy will break the solid's intramolecular forces.

In such a way, since pressure significantly affects gases and slightly affects liquid, it is not able to modify a solid, just extreme pressures such as it needed to produce diamonds, is able to affect a solid. For that reason, increasing the pressure will not increase the solid's solubility.

Best regards.

Answer:

P tot= P Ar +P O2+ P He

Explanation:

Option A is the answer

The molarity of a solution containing 4.2 mol of NaCl and a volume of 2.3 L is 1.9 M

The molarity is the number of moles of solute per litre of solution.

n=4.2

V=2.3 L

M=n/V

M=4.2/2.3

\(M=1.82\)

Molarity is ≅1.9 M

To learn more about molarity visit:

https://brainly.com/question/8732513

#SPJ9

Answer: B.gas & liquid

Answer: Oxygen and glucose are both reactants in the process of cellular respiration. The main product of cellular respiration

If the caffeine concentration in a particular brand of soda is 2.99 mg/oz, drinking, The number of cans of soda would be lethal is 258 cans.

Caffeine is a stimulant. In the brain, it blocks the effects of a chemical called adenosine, which makes you feel sleepy. we then feel more alert and energetic, which is why many people drink soda, coffee or tea to stay awake. Caffeine may keep you awake even if you don't want it to

Given

v = 10 000/3.23 =3095.96 oz

Therefore,

Number of cans = 3095.96 /12 =258 cans

If the caffeine concentration in a particular brand of soda is 2.99 mg/oz, drinking, The number of cans of soda would be lethal is 258 cans.

Learn more about Caffeine here ;

https://brainly.com/question/2677136

#SPJ1

Answer:

If n = 4, then the possible values of 1 and m depend on the equation or expression being used. Without more information, it is impossible to determine what the possible values of 1 and m might be. Can you please provide more context or information about the problem you are trying to solve?

The half-life for the decomposition of NOCl when the concentration of NOCl is 0.15 M and rate constant is 8.0*10^-8 L mol^-1s^-1 is approximately 2.31 hours.

How to calculate the half-life for the decomposition of NOCl?

The second-order reaction can be represented as:

2 NOCl → 2 NO + Cl2

The rate law for the reaction is:

rate = k[NOCl]^2

where k denotes the rate constant and [NOCl] the NOCl concentration.

The half-life (t1/2) for a second-order reaction can be calculated using the following equation:

t1/2 = 1 / (k[NOCl]₀)

where [NOCl]₀ is the initial concentration of NOCl.

Substituting the given values, we get:

t1/2 = 1 / (8.0*10^-8 L mol^-1s^-1 × 0.15 M)

t1/2 = 8333.33 s

Therefore, the half-life for the decomposition of NOCl when the concentration of NOCl is 0.15 M is 8333.33 s or approximately 2.31 hours.

To learn more about half-life, visit: https://brainly.com/question/25750315

#SPJ1