Plzzzzzzzz HELP!!!!!!

Plzzzzzzzz HELP!!!!!!

Answers

Answer 1
It should be =8.32362

Related Questions

Three vertices of GHIJ are G(0,0), H(2, 3), and J(6, 1). Use the grid to the right to complete Problems 10–16. 10. Plot vertices G, H, and J on the coordinate plane. 11. Find the rise (difference in the y-coordinates) from 3 G to H. 0 12. Find the run (difference in the x-coordinates) from Gto H. 13. Using your answers from Problems 11 and 12, add the rise to the y-coordinate of vertex J and add the run to the x-coordinate of vertex J. The coordinates of vertex / are 14. Plot vertex I. Connect the points to draw GHIJ. 15. Check your answer by finding the slopes of IH and JG. slope of IH slope of JG 16. What do the slopes tell you about IH and JG?

Three vertices of GHIJ are G(0,0), H(2, 3), and J(6, 1). Use the grid to the right to complete Problems

Answers

10. We will graph the coordinates of the vertices in the plane:

11. From G to H, we can find the ris by looking at the difference between their y-coordinates:

yhyg=30=3

The rise is 3.

12. The difference in x coordinates is:

xhxg=20=2

The run is 2.

13. If we add the rise and the run to J, we get the coordinates of I:

xi=xj+2=6+2=8yi=yj+3=1+3=4I=(8,4)

14. We add I(8,4) to the plot and connect the points:

15. We have to calculate the slopes of IH and GJ:

mih=yiyhxixh=4382=16mjg=yjygxjxg=1060=16

Both slopes have the same value: m_ih = m_jg = 1/6.

16. As the slopes are equal, that tells us that the segments are parallel.

Three vertices of GHIJ are G(0,0), H(2, 3), and J(6, 1). Use the grid to the right to complete Problems
Three vertices of GHIJ are G(0,0), H(2, 3), and J(6, 1). Use the grid to the right to complete Problems

Suppose that a random variable Z has a standard normal distribution. Find a such that P(Z > a) = 0.204. Give your answer totwo decimal places. ?

Answers

Answer:

0.83

Explanation:

Since the probability P(Z > a) = 0.204< 0.5, 'a' must be lying on the right of zero. Draw the graph.

Find P(0 < Z < a).

P(0a)=0.50.204=0.296

Find 'a' from the standard normal table.

From the table, P(0 < Z < 0.83) = 0.2967. Thus, 'a' approximately equals 0.83.

Suppose that a random variable Z has a standard normal distribution. Find a such that P(Z &gt; a) = 0.204.

I’m stuck help please

Im stuck help please

Answers

Answer: .54 4 points away from 0.5, 0.62 2 points away from 0.6

Step-by-step explanation: nice prodigy

What whole number is closest to the square root of 80

Answers

Answer:

8.94427191

Step-by-step explanation:

8.95 or the closet answer from this

Learning Task 2: Perform the indicated operations to solve the following.

1. 20- 3 + 12 ÷ 6 ✖️ 2 = (____________)

2.5 ✖️ 9-5 + 10 = (_________________)

3. 20 - 12 ÷ 6 + 8 = (________________)

4.9 ✖️ 9 ÷ 3 - 9 + 6 = (______________)

5. 16 ÷ 4 ✖️ 5 7 + 8 =(_____________)


this is times ✖️​

Learning Task 2: Perform the indicated operations to solve the following. 1. 20- 3 + 12 6 2 = (____________)2.5

Answers

1.21
2.50
3.26
4.24
5.236


An architect is making a plan for a new circular playground. If the picture below is the
playground, how much fencing needs to go up to
keep the kids in the circle?

An architect is making a plan for a new circular playground. If the picture below is theplayground, how

Answers

Answer:

201ft

Step-by-step explanation:

The circumference of a circle is equal to

C=piD

d=64ft

substitute:

c=pi(64)=64pift ft

assume pi=3.14

64pi=64*3.14=200.96ft

round to the nearest whole number:

200.96=201ft

another explanation:

Answer:

Length of the fencing required = 201.06 meters

Step-by-step explanation:

Architect is planning a circular playground with diameter = 64 m

We have to calculate the fencing required to cover this playground.

Length of fencing = circumference of the playground

Since circumference of a circle = π × (Diameter)

                                                   = 64π

                                                   = 201.06 meters

Therefore, length of fencing required to keep the kids in a circle will be 201.06 meters.

200.96 meters of fencing needs to go up to keep the kids in the circle. Therefore, option D is the correct answer.

What is circumference of a circle?

The circumference of a circle is the perimeter of the circle. It is the total length of the boundary of the circle. The circumference of a circle is the product of the constant π and the diameter of the circle.

Given that, diameter of a circle is 64 meter.

Here, the radius = 64/2

= 32 meter

We know that, the circumference of a circle can be calculated using 2πr.

Now, circumference = 2×3.14×32

= 200.96 meters

Therefore, option D is the correct answer.

Learn more about the circumference here:

brainly.com/question/28757341.

#SPJ2

What is the scale factor in the dilation?
(please help!)

A. 1/6
B. 1/3
C. 3
D. 6

What is the scale factor in the dilation?(please help!)A. 1/6B. 1/3C. 3D. 6

Answers

Answer:

Step-by-step explanation:

6

PLSS HELP! What is -2m-5m=9m-12? ALGEBRA I

Answers

Step-by-step explanation:

1. -2m-5m-9m=-12

2. -16m= -12

3. m= -12/ -16

4. m=3/4

i have written / sign as a sign of division .

Which option distinguishes the element that needs to be adjusted on the chart in the following scenario?
Donna just completed her demographic chart for her final social studies project on population growth. Her
teacher returns it and says her independent variable is incorrect and needs to be changed.
title
O y-axis value
O legend
Ox-axis value
833
Sign out
Jan 16

Answers

An answer option which distinguishes the element that needs to be adjusted on the chart in the following scenario is: C. x-axis value.

What are the types of variables?

In an experiment, there are two (2) main types of variables and these include the following:

Dependent variable.Independent variable.

What is an independent variable?

In Mathematics, an independent variable can be defined as the variable that is being manipulated by an experimenter or researcher. This ultimately implies that, an independent variable is typically considered to be the cause in an experiment and it is represented by the x-axis value on a graph.

In this scenario, we can reasonably infer and logically deduce that the independent variable (x-axis value) represents the element that should be adjusted on Donna's demographic chart on population growth.

Read more on independent variable here: brainly.com/question/82796

#SPJ1

Consider the vector function given below. r(t) = (7t, 2 cos t, 2 sin t) (a) Find the unit tangent and unit normal vectors T(t) and N(t). T(t)= (b) Use this formula to find the curvature.

Answers

a) For the vector r(t) = (7t, 2 cos t, 2 sin t), the unit tangent vector and unit normal vector is T(t) = (1/√53) × (7, -2 sin (t), 2 cos (t)) and N(t) = (0, -cos (t), -sin (t)) respectively.

b) The curvature is obtained as k = 2/53.

What is a vector?

A vector in mathematics is a quantity that not only expresses magnitude but also motion or position of an object in relation to another point or object. Euclidean vector, geometric vector, and spatial vector are other names for it.

The vector function is given as - r(t) = (7t, 2 cos t, 2 sin t).

Find the value of r'(t) -

r'(t) = (7, -2 sin (t), 2 cos (t))

Find the value of |r'(t)| -

|r'(t)| = √[(7)² + (-2 sin t)² + (2 cos t)²]

|r'(t)| = √(49 + 4 sin²t + 4 cos²t)

|r'(t)| = √[49 + 4 (sin²t + cos²t)]

Apply the formula (sin²t + cos²t = 1) -

|r'(t)| = √[49 + 4(1)]

|r'(t)| = √53

The unit tangent vector T(t) is -

T(t) = r'(t) / |r'(t)|

T(t) = (7, -2 sin (t), 2 cos (t)) / √53

Therefore, the unit tangent vector is (1/√53) × (7, -2 sin (t), 2 cos (t)).

Find the value of T'(t) -

T'(t) = (1/√53) × (0, -2 cos (t), -2 sin (t))

Find the value of |T'(t)| -

|T'(t)| = √[(1/√53)² × [0 + (-2 cos t)² + (-2 sin t)²]

|T'(t)| = √[(1/53) × [0 + 4 cos²t + 4 sin²t]

|T'(t)| = √[(1/53) × [4 (cos²t + sin²t)]

Apply the formula (sin²t + cos²t = 1) -

|T'(t)| = √[(1/53) × [4 (1)]

|T'(t)| = 2/√53

The unit normal vector N(t) is -

N(t) = T'(t) / |T'(t)|

N(t) = (1/√53) × (0, -2 cos (t), -2 sin (t)) / 2/√53

N(t) = (0, -2 cos (t), -2 sin (t)) / 2

N(t) = (0, -cos (t), -sin (t))

Therefore, the unit normal vector is (0, -cos (t), -sin (t)).

The formula for curvature k is -

k = |T'(t)| / |r'(t)|

k = (2/√53) / √53

k = 2/53

Therefore, the curvature is 2/53.

To learn more about vector from the given link

https://brainly.com/question/15519257

#SPJ1

I need help on this question

I need help on this question

Answers

Answer:

25.981 seconds

Step-by-step explanation:

because X represents the magnitutde of falling height substitute 1200 into the original equation and you will find the above answer

A small business owner contributes $2,000 at the end of each quarter to a retirement account that earns 10% compounded quarterly. (a) How long will it be until the account is worth at least $150,000? (Round your answer UP to the nearest quarter.) 43 quarters (b) Suppose when the account reaches $150,000, the business owner increases the contributions to $4,000 at the end of each quarter. What will the total value of the account be after 15 more years? (Round your answer to the nearest dollar.) $

Answers

After 15 more years of contributions of $4,000 at the end of each quarter, the retirement account will be worth approximately $760,514.47.

To calculate this, we need to use the formula for the future value of a lump sum. A lump sum is a one-time payment made at the beginning or end of a specific period. In this case, we're looking at the future value of the retirement account after 15 more years of contributions.

Using the given information, we can plug in the values and solve for FV:

PV = $150,000

Pmt = $4,000

r = 10%

n = 4 (since interest is compounded quarterly)

t = 15 years

First, we need to calculate the future value of the current investment of $150,000:

FV1 = $150,000 x (1 + 0.1/4)⁴ ˣ ¹⁵ = $548,534.24

Then, we can calculate the future value of the quarterly contributions of $4,000 over 15 years:

FV2 = $4,000 x [(1 + 0.1/4)⁶⁰ - 1] / (0.1/4) = $211,980.23

Finally, we can add FV1 and FV2 to get the total future value of the retirement account after 15 more years:

Total FV = FV1 + FV2 = $548,534.24 + $211,980.23 = $760,514.47

To know more about retirement here

https://brainly.com/question/20751552

#SPJ4

What is the inverse of the following statement: “If x is a whole number, then x = 5”?


If x is not a whole number, then x ≠ 5.

If x = 5, then x is a whole number.

If x ≠ 5, then x is not a whole number.

If x is not a whole number, then x = 5.

Answers

if x is not a whole number, then x≠5

Solve pls brainliest

Solve pls brainliest

Answers

Answer:

d = 9.43398113206

Step-by-step explanation:

d=√((x2 – x1)² + (y2 – y1)²)

d = √((-4-1)² + (5+3)²)

d = √((-5)² + (8)²)

d = √(25 + 64)

d = √89

d = 9.43398113206

Answer is 9.43 units for diagonal or hypotenuse

Step by step

Using the two points, graph the two points and count the units of length. Draw your triangle.

Your question mentions Pythagorean Theorem so we will use that to solve.

a^2 + b^2 = c^2

Our triangle sides a= 5 and b=8

5^2 + 8^2 = c^2

25 + 64 = c^2

89 = c^2

Take square root of both sides

9.43 = c

Your diagonal length is
Solve pls brainliest

How many four-digit personal identification numbers (pin) are possible if the pin cannot begin or end with a 0 and the pin must be an even number? a. 3,600 b. 4,000 c. 4,500 d. 8,100 please select the best answer from the choices provided.

Answers

The total number of possible four-digit PINs that cannot begin or end with a 0 and must be an even number is 10,000 - 900 - 4,500 = 4,500. Thus, the correct answer is c. 4,500.

To determine this:

There are 10 options for the first digit (1-9) and 10 options for the last digit (2, 4, 6, 8). For the middle two digits, there are 10 options for each digit (1-9). Therefore, the total number of possible four-digit PINs is 10 x 10 x 10 x 10 = 10,000.

However, we must subtract the number of PINs that begin or end with a 0, which is 9 x 10 x 10 x 1 = 900. We must also subtract the number of PINs that are odd numbers, which is 9 x 10 x 10 x 5 = 4,500.

Therefore, the total number of possible four-digit PINs that cannot begin or end with a 0 and must be an even number is 10,000 - 900 - 4,500 = 4,500. Thus, the correct answer is c. 4,500.

To learn more about the even number, visit:

brainly.com/question/2289438

#SPJ4

Minh spent $3.50 on 25 stickers.
How much did each sticker cost?

answer and i'll give brainliest.

Answers

Answer:

each sticker cost $0.14.

Step-by-step explanation:

To find the cost of each sticker, you can divide the total cost by the number of stickers.

In this case, Minh spent $3.50 on 25 stickers, so the cost of each sticker is:

3.50 / 25 stickers = $0.14/sticker

Therefore, each sticker cost $0.14.

Answer:

Each sticker = $0.14

Step-by-step explanation:

25 stickers =$3.50

1 sticker = 3.5025

1 sticker= $0.14

the three perpendicular bisectors of a triangle intersect in one point called the

Answers

The bisectors intersect at a point called the circumcenter.

ms tabanelli deposits $20,000 in an account that has a 5% annual interest rate compound yearly. If she does not add to or withdraw from the account for 2 years, how much interest will she have earned for the 2-year period?

Answers

Answer:

$2050

Step-by-step explanation:

$20000×1.05×1.05 =

= $20000×1.05²

= $20000×1.1025

= $22050

$22050 - $20000 = $2050

The interest earned for a 2-year period is $2050

What is compound interest?

Compound interest simply means that the interest associated with a bank account, loan, or investment increases exponentially over time.

Given that, Ms Tabanelli deposits $20,000 in an account that has a 5% annual interest rate compound yearly, she does not add to or withdraw from the account for 2 years,

We know that,

A=P(1+r)t

A = amount

P = principal

r = rate

t = time

Putting all the values in the formula,

A = 20000(1+0.05)²

A = 20000(1.05)²

A = 20000×1.1025

A = 22050

Interest earned = Amount - Principal

= 22050 - 20000

= 2050

Hence, the interest earned for a 2-year period is $2050

For more references on compound interest, click;

https://brainly.com/question/14295570

#SPJ2

What is the gradient of a line perpendicular to a line with a gradient of 1/6 ?

Answers

Answer:

-6

Step-by-step explanation:

m1 × m2 = -1

(1/6) × m2 = -1

m2 = -6

if i make 25 dollars in 5 hours what would be the constant rate of change

Answers

Answer:

5 would be your answer.

Step-by-step explanation:

The answer is 5 because you have to divide 25 by 5, and you will get 5.

If I'm wrong, please let me know.

Hope this helps.

Have a great day! :)

Answer:

5

Step-by-step explanation:

This is right because you would divide 25 by 5 and you would get your answer. You make $5 every hour

Use the binomial series to expand the function as a power series. 41−x​ 1−41​x−∑n=2[infinity]​n!3⋅7⋯(4n−5)​xn ∑n=0[infinity]​4n(−1)n+1(4n−5)n​xn 1+ ∑n=1[infinity]​(−1)n+14n⋅n!3⋅7⋯(4n−5)​xn 1+41​x+∑n=2[infinity]​n!3⋅7⋯(4n−5)​xn 1−41​x−∑n=2[infinity]​4n⋅n!3⋅7⋯(4n−5)​xn State the radius of convergence, R.

Answers

The radius of convergence is R = 16/4 = 4.

What do you mean by Binomial number ?

A binomial number is a coefficient of a term in the expansion of a binomial expression raised to a positive integer power. A binomial expression is an algebraic expression with two terms, such as (a+b), (x-y), or (2x+3y). The binomial coefficient, also known as the "choose" function, is denoted by the symbol "n choose k" and represents the number of ways to choose k items from a set of n distinct items, where order does not matter. It is defined as:  n choose k = n! / (k!(n-k)!)

The binomial series states that:

(1+x)r=1+rx+(r(r1)/2!)x2+(r(r1)(r2)/3!)x3+...

We can use this formula to expand the given functions as power series.

(41-x)/(1-41x)

Using the formula, we have:

(41-x)/(1-41x) = (41/x) / (1-41/x)

= (41/x) * (1 + 41/x + (4142)/(2! x²) + (414243)/(3! x³) + ...)

= 41/x + 41²/x²+ 4142²/(2! x³) + 414243²/(3! x^4) + ...

The power series has coefficients:

an=41(42)(43)...(4n1)/n!(41)n,n>=1

The ratio test gives:

limnn+1/an|=lim(4n3)/(41(n+1))=4/41

Therefore, the radius of convergence is R = 41/4.

$n=2n!37(4n5)xn$

Using the formula, we have:

$n=2n!37(4n5)xn=n=2(4n5)!37(4n1)xn=n=2anxn$

where, an=(4n5)!/(37...(4n1)),n>=2

The ratio test gives:

lim|an+1/an|=lim(4n3)(4n2)/(4n+1)(4n)=1

Therefore, the radius of convergence is R = infinity.

$n=04n(1)n+1(4n5)nxn$

Using the formula, we have:

$n=04n(1)n+1(4n5)nxn$=  $n=0(4n5)n(1)nxn$  

=  $1(4x5)+(4x5)2(4x5)3+$

The power series has coefficients:

an=(1)n(4n5)n,n>=0

The ratio test gives:

lim|an+1/an|=lim(4n1)2/(4n+3)(4n+2)=1/16

Therefore, the radius of convergence is R = 16/4 = 4.

Learn more about Binomial expression here:

brainly.com/question/30735781

#SPJ1

if x is th didit at tense place and y is the digit at ones place,the two digit number formed by these digits is.......................​

Answers

Answer:

I think the two digit number formed would be

xy

seeing that x is on the tens place which is the second last place and y is on the ones place meaning it has to be the last value.

I hope this helps

you are skiing down a mountain with a vertical height of 1250 feet. the distance that you ski as you go from the top down to the base of the mountain is 3050 feet. find the angle of elevation from the base to the top of the mountain. round your answer to a whole number as necessary. degree

Answers

Therefore, the degree of the resulting polynomial is m + n when two polynomials of degree m and n are multiplied together.

What is polynomial?

A polynomial is a mathematical expression consisting of variables and coefficients, which involves only the operations of addition, subtraction, multiplication, and non-negative integer exponents. Polynomials can have one or more variables and can be of different degrees, which is the highest power of the variable in the polynomial.

Here,

When two polynomials are multiplied, the degree of the resulting polynomial is the sum of the degrees of the original polynomials. In other words, if the degree of the first polynomial is m and the degree of the second polynomial is n, then the degree of their product is m + n.

This can be understood by looking at the product of two terms in each polynomial. Each term in the first polynomial will multiply each term in the second polynomial, so the degree of the resulting term will be the sum of the degrees of the two terms. Since each term in each polynomial has a degree equal to the degree of the polynomial itself, the degree of the resulting term will be the sum of the degrees of the two polynomials, which is m + n.

To know more about polynomials,

brainly.com/question/11536910

#SPJ1

If a=1/3 find the value of 7a-3

Answers

a=1/3 so 7a becomes 7x1/3

2 1/3-3= -2/3

hope it helps!

The product of 3 and a number is at most nine

Answers

9y is the answer I believe

Point P is located at (–3, –2). P is reflected across the x-axis to create P'. What quadrant is P' in?

Answers

P would be in quadrant 2. I hope this helps! Sense P is in quadrant 3 when you flip it over the x axis which is the horizontal line it would be in quadrant 2

By using sum or difference formulas, cos(-a) can be written as OA. - sin(x) B. - cos(x) Oc.cos(x) D. sin(x) OE. All of the above OF. None of the above By using sum or difference formulas, cos(-a) can be written as OA. - sin(x) B. - cos(x) Oc.cos(x) D. sin(x) OE. All of the above OF. None of the above By using sum or difference formulas, cos(-a) can be written as OA. - sin(x) B. - cos(x) Oc.cos(x) D. sin(x) OE. All of the above OF. None of the above

Answers

By using sum or difference formulas, cos(-a) can be written as - cos(a). Explanation: We know that cosine is an even function of x, therefore,cos(x)=cos(x) .Then, by using the identity cos(ab)=cos(a)cos(b)+sin(a)sin(b), we can say that:cos(aa)=cos²(a)+sin²(a).

This simplifies to:cos(0)=cos²(a)+sin²(a)cos(0)=1So,cos(a)²+sin(a)²=1Or,cos²(a)=1sin²(a)Similarly,cos(a)²=1sin²(a) Since cosine is an even function, cos(a)=cos(a) Therefore, cos(a)²=cos²(a)=1sin²(a)cos(a)=±sqrt(1sin²(a)).

This is the general formula for cos(-a), which can be written as a combination of sine and cosine. Since cosine is an even function, the negative sign can be written inside the square root: cos(a)=±sqrt(1sin²(a))=±sqrt(sin²(a)1)=cos.

To know more about sum visit:

https://brainly.com/question/31538098

#SPJ11

calculate the amount of rupees 31250 at the end of 2½ years, compounded annually at 8% per annum.​

Answers

Principal = 31250

Time= 2 and 1/2 years

Rate= 8% so first we take out the amount for 2 years which would be: 36450

Now we we will take out the amount for 1/2 years. Now the rate for 1/2 years is 4% with principal

The amount for 1/2 years for 4% rate is= 37908

Answer: 37908 is the amount after 2 and 1/2 years at the rate of 8%

Find the circumference of the given circle
Use 3.14 as an approximation of pi

Find the circumference of the given circle Use 3.14 as an approximation of pi

Answers

Answer:

Step-by-step explanation: The circumference of a circle is the _distance around the circle.

Formula: (Remember

There were 10 cards in a bag labeled 0-9 what is the probability of drawing a 3 and then a 5 if the first card is not replaced before the second drawn

Answers

Answer:

1/9 chance

Step-by-step explanation:

Other Questions
Please Help!!!! Solve For L At Wednesday's practice, McKenzie ran amile in 9 minutes. At Saturday's track meet,she ran 2 miles in 19 minutes. On which daydid McKenzie run at a faster rate? please hurry I need to pass this class Which regression model best fits the data set?(2, 13), (4,8), (5, 7.5), (7,7)A linearB. quadraticC. exponential growthD. exponential decay Sociologist george ritzer built off of ______________________ to develop the concept of mcdonaldization. How might opinion polls negatively affect voter behaviors? Find x in the given figure. Research suggests that after people have exerted self control on some behavior they are more likely to? 9y= 5/7solve as a fraction which is a key difference between the medical and the psychological models of mental disorders?the medical model identifies multiple causes for mental illness, while the psychological model identifies sole causes.the medical model relies on therapy for treatment, while the psychological model relies on drugs for treatment.the medical model emphasizes the power of the environment, while the psychological model emphasizes the power of the individual.the medical model places responsibility on the physician, while the psychological model shares responsibility with the patient. I need help with questions 9-12!!! Due today Cost of Bikes ($) at Bike Shop312, 352, 480, 392, 368, 352, 416, 640Ic. modeThe mode is. .Who is at Risk for Emotional Distress?. Where Can I Get Help?. What to Say? Which of these levels of organization includes all the other levels? A. community C. individual B. ecosystem D. population In photosynthesis, what form of energy is sunlight converted to? How is this engery stored? Part BWhich words rhyme in the following stanza from the poem in Trouble with Poetry? Select three choices.She jumped through the back door screen.She licked my soup bowl clean.She barks at all cars.Id send her to MarsFor a break from this wild machine! a sealed 89-m3 tank is filled with 6000 moles of oxygen gas (o2) at an initial temperature of 270 k. the gas is heated to a final temperature of 350 k. the atomic mass of oxygen is 16.0 g/mol, and the ideal gas constant is Determine whether AB || CD. Justify your answer. A C=7, B D=10.5, B E=22.5 , and A E=15 The length of celia's garden is 15 m 24 cm. the length of her friends garden is 2 m 98 cm more than celia's. what is the length of her friend's garden? while the prefrontal is necessary for the manipulation of order information in memory, the ... deals with its maintenancewhile the prefrontal is necessary for the manipulation of order information in memory, the posterior parietal cortex deals with its maintenance