Pls answer this question if you know it

To determine the original pressure of a 750 ml sample of helium (He) at 0 degrees Celsius, we can use the combined gas law, which relates the initial and final conditions of a gas sample. The combined gas law equation is:

(P1 × V1) / (T1) = (P2 × V2) / (T2)

Where:

P1 and P2 are the initial and final pressures, respectively.

V1 and V2 are the initial and final volumes, respectively.

T1 and T2 are the initial and final temperatures, respectively.

Let's assign the given values:

P1 = unknown (original pressure)

V1 = 750 ml (initial volume)

T1 = 0 degrees Celsius (initial temperature)

P2 = 2 atm (final pressure)

V2 = 500 ml (final volume)

T2 = 25 degrees Celsius (final temperature)

Before using the combined gas law equation, we need to convert the temperatures to Kelvin scale by adding 273.15 to both T1 and T2:

T1 = 0 + 273.15 = 273.15 K

T2 = 25 + 273.15 = 298.15 K

Now we can plug in the values into the combined gas law equation:

(P1 × 750 ml) / (273.15 K) = (2 atm × 500 ml) / (298.15 K)

To solve for P1, we can cross multiply and rearrange the equation:

P1 = (2 atm × 500 ml × 273.15 K) / (750 ml × 298.15 K)

P1 = 0.924 atm

Therefore, the original pressure of the 750 ml sample of helium at 0 degrees Celsius is approximately 0.924 atm.

Answer:

If there are more products than reactants, that means the reaction has shifted towards the left, which is the backward direction. If there are more reactants than products, that means the reaction has shifted towards the right, which is the forward direction.

Because it takes no energy to generate a naturally occurring compound, the enthalpy of formation for an element in its elemental state will always be 0.

The free energy shift that happens when 1 mole of a material is created from its component elements in their standard states is referred to as the standard free energy of formation. The standard free energy of production of a pure element in its standard state is zero.

The distinction between Gibbs free energy and standard free energy is that the former is dependent on the experimental circumstances, whilst the latter describes the Gibbs free energy for reactants and products in their standard state.

learn more about standard free energy

https://brainly.com/question/14415025

#SPJ1

The given question is incomplete. The complete question is :

A chemist prepares a solution of barium acetate by measuring out 32 g of barium acetate into a 350 ml volumetric flask and filling the flask to the mark with water. Calculate the concentration in of the chemist's barium acetate solution. Round your answer to significant digits.

Answer:  The concentration of barium acetate solution is 0.375 mol/L

Explanation:

Molarity of a solution is defined as the number of moles of solute dissolved per liter of the solution.

\(Molarity=\frac{n\times 1000}{V_s}\)

where,

n = moles of solute

\(V_s\) = volume of solution in ml

moles of \(Ba(CH_3COO)_2\) = \(\frac{\text {given mass}}{\text {Molar mass}}=\frac{32g}{255g/mol}=0.125mol\)

Now put all the given values in the formula of molality, we get

\(Molarity=\frac{0.125\times 1000}{350ml}\)

\(Molarity=0.357M\)

Therefore, the concentration of solution is 0.375 mol/L

1. A lunar eclipse occurs when the Earth comes between the Sun and the Moon, casting a shadow on the Moon. The main cause of a lunar eclipse is the alignment of the Earth, Moon, and Sun in a straight line. The Earth blocks the direct sunlight from reaching the Moon, causing the Moon to be partially or completely in the Earth's shadow. This can only happen during a full moon when the Sun, Earth, and Moon are in a straight line.

2. A solar eclipse happens when the Moon comes between the Sun and the Earth, blocking the sunlight from reaching certain parts of the Earth. This occurs during a new moon when the Moon is directly between the Sun and Earth. The Moon's shadow falls on a specific region on Earth, creating a temporary darkening of the sky. There are different types of solar eclipses, such as total, partial, and annular, depending on the alignment of the Sun, Moon, and Earth.

3. During a lunar eclipse, when the Moon is in the Earth's shadow, it may appear to turn a reddish color. This phenomenon is known as the "blood moon." The red color is caused by the Earth's atmosphere bending (refracting) sunlight and filtering out shorter wavelengths such as blue and green. The longer wavelengths, such as red and orange, are scattered and make their way onto the Moon's surface, giving it a reddish hue. This effect is similar to the way the atmosphere scatters sunlight during a sunrise or sunset, causing the sky to appear red or orange.

It's important to note that the specific color and intensity of a lunar eclipse can vary based on factors such as the Earth's atmospheric conditions, the amount of dust and pollutants in the atmosphere, and the angle at which sunlight passes through the atmosphere. So, the exact appearance of a lunar eclipse may differ from one event to another.

The 5 moles of water is equal to 90.075 grams of water and 220 J of energy is equal to 52.636 calories.

To change moles of water to grams, it is required to find the molar mass of the substance. The molar mass of water (H2O) is equal to 18.015 grams/mol.

To change 5 moles of water to grams, by using the following calculation:

5 moles × 18.015 grams/mol = 90.075 grams of water

Thus, 5 moles of water is equal to 90.075 grams of water.

To change joules to calories,  by using the conversion factor:

1 cal = 4.184 J.

To change 220 J of energy to calories, by using the following calculation:

220 J ×  (1 cal / 4.184 J) = 52.636 cal

Thus, 220 J of energy is equal to 52.636 calories.

Learn more about water, here:

https://brainly.com/question/29285510

#SPJ1

Cicadas are known for their broadly spaced, pronounced eyes, and short antennae.

While annual cicadas are widespread, periodicals are only found in North America. In the middle and eastern parts of the country, there are mostly periodic broods, and in some places, there are multiple broods.

Adult cicadas are black in color with green or orange-brown markings, and they have wingspans of 1 to 2 inches. They have clear wings with orange veins and big, black or red eyes. Nymphs resemble their adult counterparts in appearance, although they lack wings and are not as vividly colored.

to know more about Cicadas here:

brainly.com/question/29200842

#SPJ1

The mass of the carbon dioxide is  49.72 g from the calculation done.

The phrase "mole fraction," which is often referred to as "molar fraction" or "amount fraction," is used to describe the proportions of a mixture's components. It is an intangible quantity that expresses the proportion between the moles of a given component and the total moles in the combination.

We know that;

Number of moles of ethanol = 9.2/46 g/mol

= 0.2 moles

Now;

Number of moles of water = 216.0 g/18 g/mol

= 12 moles

Mole fraction of water = Number of water/ Total number of moles

0.9 = 12/12 + 0.2 + x

0.9(12.2 + x) = 12

10.98 + 0.9x = 12

x = 1.13 moles

Now;

Moles = mass/Molar mass

1.13 = x/44

x = 49.72 g

Learn more about mole fraction:https://brainly.com/question/30724931

#SPJ1

Answer:

...........................

So,

Henry's law, tells us that the mass of a dissolved gas in a given volume of solvent at equilibrium is proportional to the partial pressure of the gas.

We could write:

Replacing our values, we have:

We're asked to express this concentration in units of grams per liter.

For this, multiply by the molar mass of CO2:

So the answer is 0.64g/L.

Answer:

Life in the Han Dynasty (206 BCE - 220 CE) differed significantly from today in family, government, social structure, religion, and trade. For example, the Han Dynasty emphasized a patriarchal family structure, where the eldest male held authority, and filial piety was highly valued. In contrast, contemporary societies embrace more egalitarian family dynamics with shared decision-making.

The government system of the Han Dynasty relied on a centralized bureaucracy and emphasized meritocracy, while modern societies often adopted democratic systems. Socially, the Han Dynasty followed a hierarchical model influenced by Confucian principles, whereas contemporary societies strive for greater equality and social mobility.

Religion in the Han Dynasty combined Confucianism, Taoism, and Buddhism, whereas modern societies exhibit diverse religious beliefs. Lastly, trade in the Han Dynasty thrived along the Silk Road, while modern trade was globally interconnected and facilitated by technological advancements. These differences highlight the evolution of society over time.

Explanation:

The question requires us to write the chemical reaction equation that represents the basic equilibrium for ammonia (NH3).

A general basic equilibrium equation can be written as:

where the substance B "accpets" a H+ ion and the reaction produces OH- ions as product.

Considering the information above, we can write the following basic equation for NH3:

where ammonia receives an H+ ion, forming NH4+ ion and OH- ions.

Heat transfer plays a crucial role in various aspects of our everyday lives. Here are five examples of how heat transfer occurs in our daily activities:

Cooking; Cooling; Central Heating; Ironing; Showering

Cooking: Heat is transferred from a stove or an oven to the cooking utensils and food. Conduction occurs when the heat is transferred through direct contact between the heat source and the cooking pan. Convection takes place when hot air circulates around the food, evenly cooking it. Radiation is also involved when heat is emitted by the heating elements and absorbed by the food.

Cooling: Heat transfer is essential in cooling processes, such as using refrigerators or air conditioning systems. In refrigeration, heat is transferred from the interior of the refrigerator to the outside environment through the process of convection and radiation. In air conditioning, heat is absorbed from the indoor air and released outside, again utilizing convection and radiation.

Central Heating: Many homes and buildings use central heating systems to warm up indoor spaces. Heat is produced by a furnace or boiler and then distributed through convection and radiation. Radiators or air vents release the heated air, raising the temperature in the rooms.

Ironing: Ironing clothes involves the transfer of heat to remove wrinkles. The iron's heating element conducts heat to the metal plate, which comes into direct contact with the fabric. Conduction transfers heat from the iron to the clothes, causing the fibers to relax and remove the wrinkles.

Showering: When taking a hot shower, heat transfer is involved in multiple ways. Firstly, conduction occurs as the hot water comes into contact with your skin, transferring heat. Secondly, convection takes place as the warm water surrounds your body, creating a warm sensation. Lastly, radiation occurs as the hot water radiates heat, making the shower enclosure feel warm.

These are just a few examples, but heat transfer is involved in numerous other activities, from using hairdryers to heating water for tea. Understanding heat transfer is crucial for designing efficient systems and ensuring our comfort and safety in everyday life.

For more question on Heat click on

https://brainly.com/question/30738335

#SPJ11

Answer:

Explanation:

Comment

A: is in group 1. The properties are quite similar

B: the choices for answer B are in column or group 2. They too will have similar properties.

C: the choices there are in group 18. They do have similar properties.

The answer is D.

Note: group means the same thing as column. They are vertical.

Answer:

100 HZ 1,000 HZ 10,000 HZ there you go :)

Answer:

100 hertz, 1,000 hertz, and 10,000 hertz

Explanation:

I took the k12 test :)

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer: The concentration of \(NO_{2}\) in the given equilibrium mixture is 0.0545 M.

Explanation:

The ratio of concentration of products and reactants raised to the power of their coefficients is called equilibrium constant. The symbol used to denote equilibrium constant is \(K_{eq}\).

As the given reaction equation is as follows.

\(2NO_{2}(g) \rightleftharpoons N_{2}O_{4}(g)\)

The expression for equilibrium constant of this reaction is as follows.

\(K_{eq} = \frac{[N_{2}O_{4}]}{[NO_{2}]^{2}}\)

Now, substitute the given values into above formula as follows.

\(K_{eq} = \frac{[N_{2}O_{4}]}{[NO_{2}]^{2}}\\67.3 = \frac{(0.2)}{[NO_{2}]^{2}}\\So, [NO] = \sqrt{\frac{0.2}{67.3}}\\= 0.0545 M\)

Thus, we can conclude that the concentration of \(NO_{2}\) in the given equilibrium mixture is 0.0545 M.

The arrow in a chemical reaction can be translated as the following:

A. yields

C. react to form

Answer:

The formula mass of iron(II) chloride is 162.21 g/mol.

Total electrons in fluorine (F): 9. Valence electrons in fluorine (F):7.

The element fluorine (F) is located in the periodic table in Group 17, also known as Group VIIA or the halogens. Fluorine has an atomic number of 9, indicating that it contains 9 electrons in its neutral state.

To determine the total number of electrons in a neutral atom of fluorine, we refer to its atomic number, which corresponds to the number of protons and electrons in an atom. Thus, fluorine has a total of 9 electrons.

Valence electrons are the electrons in the outermost energy level, also known as the valence shell, of an atom. For fluorine, the valence electrons are found in the second energy level, specifically in the 2p orbital. Since the second energy level can accommodate a maximum of 8 electrons, fluorine has 7 valence electrons.

Valence electrons play a crucial role in chemical bonding and determining the reactivity of an element. In the case of fluorine, its 7 valence electrons make it highly reactive, as it only needs one additional electron to achieve a stable, full outer electron configuration of 8 electrons. This strong desire to gain an electron makes fluorine one of the most electronegative elements on the periodic table.

In summary, a neutral atom of fluorine (F) has a total of 9 electrons, with 7 of them being valence electrons located in the 2p orbital.

for more such questions on electrons

https://brainly.com/question/371590

#SPJ11

Answer:

12

Explanation:

The answer is 12 because You are looking for hydrogen which is the big H. you look to the number below it and it is 12. So H stands for hydrogen and there are 12 Hydrogen getting you your answer of 12.

Answer:

All of the listed factors can affect the potency of a drug.

Explanation:

All of the listed factors can affect the potency of a drug. Let's discuss each one:

The amount: The potency of a drug can be influenced by the dosage or amount administered. Generally, a higher amount of a drug can lead to a greater effect or potency. However, there may be optimal dosage ranges where the potency is maximized before plateauing or potentially causing adverse effects.

Concentration: The concentration of a drug refers to the amount of the drug present in a given volume or solution. A higher concentration of a drug can increase its potency since a greater quantity of the active substance is available to interact with the target receptors or sites.

Number of exposures: The number of times a person is exposed to a drug can also impact its potency. In some cases, repeated exposures can lead to an accumulation of the drug in the body, resulting in increased potency or stronger effects. However, this can also lead to tolerance, where the body becomes less responsive to the drug over time, requiring higher doses for the same effect.

Exposure method: The way a drug is administered or exposed to the body can affect its potency. Different routes of administration (e.g., oral, intravenous, inhalation, topical) can result in variations in the drug's absorption, distribution, and metabolism, which can influence its potency and onset of action.

It's important to note that potency is different from efficacy, which refers to the maximum therapeutic effect a drug can produce. Potency specifically relates to the amount of drug required to produce a particular effect.

The age of wood 2880 years.

People who passed away would be interred in the tombs of the Ancient Egyptians.This was significant to the Egyptians because they held the view that as long as a person was properly buried in their tomb, life remained even after death.

The sarcophagus was intended to serve as the occupants' eternal home in the afterlife, according to ancient Egyptian belief.Pharaohs and rich citizens' sarcophagi were ornately decorated with carvings and painting.

To know more about ancient Egyptian tomb visit:

https://brainly.com/question/224985

#SPJ4

Answer:

Kp = P(SO2)  *   P(O2)  / P(SO3)

Explanation:

The equation is given as;

SO3(g)  --> SO2(g) + O2(g)

In the pressurer equilibrium constant expression, only the gaseous entities are considered.

It is given as;

Kp = P(products)   /  P(reactants)

Product are  SO2(g) and O2(g)

Reactant is SO3(g)

Kp = P(SO2)  *   P(O2)  / P(SO3)

Answer:

A 1.0 g sample of propane, C3H8, was burned in the calorimeter.

The temperature rose from 28.5 0C to 32.0 0C and the heat of combustion 10.5 kJ/g.

Calculate the heat capacity of the calorimeter apparatus in kJ/0C

Explanation:

\(Heat of combustion = heat capacity of calorimeter * deltaT\\\)

Given,

The heat of combustion = 10.5kJ/g.

\(deltaT = (32.0-28.5)^oC\\deltaT = 3.5^oC\)

Substitute these values in the above formula to get the value of heat capacity of the calorimeter.

\(deltaT =heat capacity of calorimeter * (change in temperature)\\10.5kJ/g = heat capacity of calorimeter * (3.5^oC)\\\\=>heat capacity of calorimeter = \frac{10.5kJ/g}{3.5^oC} \\=>heat capacity of calorimeter = 3.0 kJ/g.^oC\)

Answer:

The heat capacity of the calorimeter is \(3.0kJ/g.^oC.\)

The new volume assuming that the pressure and temperature remain constant is 0.46 L and the correct option is option 1.

The Ideal gas law is the equation of state of a hypothetical ideal gas. It is a good approximation to the behaviour of many gases under many conditions, although it has several limitations. The ideal gas equation can be written as-

                        PV = nRT

where,

P = Pressure

V = Volume

T = Temperature

n = number of moles

Given,

Initial volume = 1.5 L

Initial moles = 7.5 moles.

Moles remaining = 2.3 moles

\(\frac{n_{1} }{V_{1} } = \frac{n_{2} }{V_{2} }\)

\(\frac{7.5}{1.5 } = \frac{2.3}{V_{2} } }\)

V₂ = 0.46 L

Thus, the ideal selection is option 1.

Learn more about Ideal Gas Law, here:

https://brainly.com/question/12624936

#SPJ1

Step 1

The gas is assumed to be ideal. Therefore, the next formula is applied:

------------------------------------------------

Step 2

Information provided:

p = pressure = 147 kPa x (1000 Pa/1 kPa) = 147000 Pa

V = volume = unknown

n = number of moles = 2.10 moles

T = absolute temperature = 340.0 K

R = gas constant = 8.314 m^3 x Pa/mol K (according to the variables and units provided)

-------------------------------------------------

Step 3

Procedure:

V is found from (1):

Next, V = 0.0403 m^3 x (1000 L/1 m^3) = 40.3 L

Answer: V = volume = 40.3 L

The partial pressure of hydrogen gas in the collected gas is 746 torr.

To determine the partial pressure of hydrogen gas in the collected gas, we need to consider the difference between the total pressure of the collected gas and the vapor pressure of water at the given temperature. The partial pressure of hydrogen gas is the pressure exerted by hydrogen alone.

Given information:

Total pressure of the collected gas (Ptotal) = 767 torr

Vapor pressure of water (Pwater) = 21.0 torr

The partial pressure of hydrogen gas (Phydrogen) can be calculated using Dalton's law of partial pressures, which states that the total pressure of a mixture of gases is equal to the sum of the partial pressures of each individual gas.

Phydrogen = Ptotal - Pwater

Plugging in the given values:

Phydrogen = 767 torr - 21.0 torr

Phydrogen = 746 torr

Therefore, the partial pressure of hydrogen gas in the collected gas is 746 torr.

It's important to note that in this calculation, we assume that the water vapor does not react with or dissolve in the hydrogen gas and that the gases behave ideally. Additionally, it's assumed that the collected gas is dry, meaning all the water vapor has been removed or does not significantly contribute to the total pressure.

Fo rmore such questions on partial pressure visit:

https://brainly.com/question/19813237

#SPJ8

Answer:

Pop your popcorn for 2 minutes in the microwave but if you like to pop your popcorn old fashion get popcorn seeds and put them in an pot and then put a lid over it then pop it.

Explanation: