PLEASE HELP!!!!!!!!! WILL MARK BRAINLIEST

PLEASE HELP!!!!!!!!! WILL MARK BRAINLIEST

Answers

Answer 1

Answer:

19.278049929737628457607385688801

Explanation:

Volume = L * W * H

Volume = 17.78 * 9.21 * 4.45 = 728.70441

Density = Mass / Volume

Mass = 14,048

14,048 / 728.70441 = 19.278049929737628457607385688801

Density = 19.278049929737628457607385688801

Answer 2

Explanation:

So density = mass/volume

Using this formula we'll solve the question.

mass = 14,048g/1000 = 14.048 kg

volume = 17.78/100 x 9.21/100 x 4.45/100

volume = 0.3143 m³

density = 14.048 kg/ 0.3143 m³

density = 44.69 kg/m³

round off to = 44.7 kg/m³


Related Questions

Arrange the following three ionic compounds in the order of increasing lattice energy (from smallest lattice energy to largest lattice energy).

MgBr₂
MgO
KBr

Answers

The expected lattice energies, in increasing order, are MgO> MgBr2> KBr.  

The ranking is related that the lattice energy being directly proportional to the strength of the ionic bond. If the bond is strong, the lattice energy would be high.

If the intermolecular force is strong, then the energy requires to break the bond would be greater. Thus, the lattice energy would be high.

MgO has the lowest lattice energy because it is the smallest and has the weakest attractive force between the ions. MgBr2 has a slightly higher lattice energy because the bromine ions are larger and have a stronger attractive force than the oxygen ions. KBr has the highest lattice energy because the potassium ions are larger than the bromine ions and have a stronger attractive force.

To know more about ionic bonds, click below:

https://brainly.com/question/2220825

#SPJ1

recrystallization is a suitable method for purifying... organic oils high melting solids liquids of low volatility liquids of high volatility'

Answers

Solids can be cleaned up by recrystallization. Typically, when there is little to no impurity in the solid, this method performs best.

Recrystallization is a type of purifying technique.

The most crucial process for removing impurities from nonvolatile organic materials is recrystallization. The solute, which needs to be purified, is dissolved in a suitable hot solvent prior to recrystallization. When the solvent cools, the solute is saturable in the solution and crystallizes out (reforms a solid).

What process of recrystallization is it?

Chemicals are purified through the physical process of recrystallization in accordance with their varying solubilities. The procedure is finished by heating the material to dissolve the impurity-containing compound in a mixture of a suitable solvent.

To know more about recrystallization visit:-

https://brainly.com/question/29215760

#SPJ4

A 466 g sample of water is heated from 8.50˚C to 74.60˚C. Calculate the amount of heat absorbed by the water.

Answers

According to the specific heat capacity,129370.92 joules of heat is absorbed by 466 g of sample of water.

What is specific heat capacity?

Specific heat capacity is defined as the amount of energy required to raise the temperature of one gram of substance by one degree Celsius. It has units of calories or joules per gram per degree Celsius.

It varies with temperature and is different for each state of matter. Water in the liquid form has the highest specific heat capacity among all common substances .Specific heat capacity of a substance is infinite as it undergoes phase transition ,it is highest for gases and can rise if the gas is allowed to expand.

It is given by the formula ,

Q=mcΔT

According to the data given and substitution of the values in the given formula,Q=466×4.2×66.10=129370.92 J.Thus, 129370.92 joules of heat is absorbed by 466 g of water.

Learn more about specific heat capacity,here:

https://brainly.com/question/1747943

#SPJ1

who can help me on this one ?

who can help me on this one ?

Answers

Answer:

eight strong bonds to the atoms that it touches and six weaker bonds to the atoms it almost touches. This makes it easier to understand why a metal might prefer the body-centered cubic structure to the hexagonal or cubic closest-packed structure.

3. If an element has 47 protons and 54 neutrons what is the element and what is its atomic
mass?
4. If one atom has 47 neutrons and a mass of 87 and another one has 41 protons and a
mass of 87, are they isotopes of each other?
5. Draw the electron dot diagram for the element Phosphorous.

Answers

3.Ag(silver) the atomic mass is 106.42
4.Nb(Niobium) the atomic mass is 92.906
5.
3. If an element has 47 protons and 54 neutrons what is the element and what is its atomicmass?4. If

What is the molarity of the solution produced when 152 g of ammonia is dissolved in sufficient water to prepare 2.75 L of solution?

Answers

Step 1

A solution is made up of a solute and a solvent

Solute = ammonia = NH3

Solvent = water = H2O

-----------

Step 2

Information provided:

The mass of NH3 = 152 g

The volume of the solution = 2.75 L

Information needed:

The molar mass of NH3 = 17.0 g/mol

----------

Step 3

Molarity (mol/L or M) = moles of NH3/volume of the solution (L)

Moles of NH3 = mass of NH3/molar mass NH3 = 152 g/17.0 g/mol = 8.94 moles

Therefore, Molarity = 8.94 moles/2.75 L = 3.25 mol/L

Answer: Molarity = 3.25 mol/L

A classroom has one triple-beam balance. To complete an experiment, each student must use the balance for 6 minutes. The class meets for 1 hour. How many students can participate in the experiment?

Answers

As the class is of 1 hour and  and each student uses for 6 minutes so in 1 hour 10 students will use the balance.

What is a balance?

A scale or balance is a device used to measure weight or mass. These are also known as mass scales, weight scales, mass balances, and weight balances.

The traditional scale consists of two plates or bowls suspended at equal distances from a fulcrum. One plate holds an object of unknown mass (or weight), while known masses are added to the other plate until static equilibrium is achieved and the plates level off, which happens when the masses on the two plates are equal.

Learn more about balance,here:

https://brainly.com/question/1173599

#SPJ1

Name this molecule c4h7bro

Name this molecule c4h7bro

Answers

Answer:

I believe its : "2-Bromobutanal"

List the 2 pKa's for H2SO4

Answers

No pKa1 because it is strong acid, pKa2 = 1.99

Please help me on this! Please

Please help me on this! Please

Answers

Observation vs Inference

An observation is based on factual information that can be found through the use of the 5 senses: touch, taste, smell, sight, hearing. An inference is a guess or conclusion that is made after something is observed.

1.  The clouds mean it is going to rain today.

the clouds have been observed by sight and a guess has been made that it will rain as a result of this observation. Therefore it is an Inference.

It's rainy and cold.

both of these are factual information based on the 5 senses. Rain can be seen by sight and you can feel whether something is hot or cold, Therefore it is an Observation.

The grass is going to get very green after the rain.

The rain can be observed by sight but there is a guess that the grass will become very green. There was an observation and a inference made upon that observation. Therefore it is an Inference.

(Please see the question in the image) All coefficients that are number two are wrong answers and need to be replaced.

(Please see the question in the image) All coefficients that are number two are wrong answers and need

Answers

The balanced equation is:

\(2\text{NaN}_{3_{}\text{ }}\text{ }\rightarrow3N_2\text{ + 2Na}\)

The equation is balanced because we have the same amount of elements in the reactants side (to the left of the arrow) and in the products side (to the right of the arrow).

Why would you weigh less on another planet than you do on Earth?
O A. You would have less mass on the other planet.
OB. The other planet has a smaller radius than Earth has.
O C. The other planet is much less massive than Earth.
O D. The other planet is closer to the outer edge of the solar system
than Earth is.

Answers

Answer:

I think the answer could be A

Explanation:

because there is different amounts of gravity which makes us lighter, although it could be wrong

QUESTION 7 Can you use alligation for any type of liquid? ​

Answers

Answer:

Yes you can use alligation for a type of liquid. Explanation: Alligation is an old and practical method of solving arithmetic problems related to mixtures of ingredients.

Matter are anything that is made up of atoms. The quantity of matter can be observed only on the basis of mass and volume calculation. Thus, we can use allegation for any type of liquid.

What is matter?

Matter is a substance that has some mass and can occupy some volume. The matter is mainly used in science. Matter can be solid, liquid or gas.

Matter is anything that is made up of atoms. Anything around us that can be physically seen and touched are matter. Ice, water and water vapors are example of matter.

Mass can also be represented as number of molecules. We also saw that matter occupy some volume and that volume is measured only in liter. Allegation is a form of liquid that we may utilize. Allegation is a time-tested and useful strategy for tackling mathematical issues involving combinations of elements.

Thus, we can use allegation for any type of liquid.

To learn more about matter, here:

https://brainly.com/question/4562319

#SPJ2

When a baseball bat hits a baseball, what happens to the energy?
completo ancur

Answers

Answer: the baseball bat transfor its energy in the ball.

Explanation: you hit it with one and find out and tell me what you think what happen.

Why is Pluto a dwarf planet?
Group of answer choices

A) it can't clear its orbital path of smaller objects

B) its not round

C) its too far away from the sun

D) it doesn't orbit the sun

Answers

c is the right answer have a good day
Answer is c hope you pass have a great day!

The genetic material of a prokaryotic cell is found in the

Answers

Answer:

The genetic material of a prokaryotic cell is found in the cytoplasm.

Explanation:

In most living species, which monosaccharide is the most important source of energy?

Answers

In most living species, glucose is the monosaccharide which is the most important source of energy.

What is monosaccharide?

A simple sugar or monosaccharide is a carbohydrate which can be digested into smaller carbs. A monosaccharide, like other carbohydrates, is composed of three chemical components: carbon, hydrogen, as well as oxygen.

It is the most basic kind of molecule of glucose and therefore is frequently used to build more complicated compounds. Aldoses, ketoses, as well as their derivatives are examples of monosaccharides. A monosaccharide has the typical chemical formula CnH2nOn or (CH2O)n. In most living species, glucose is the monosaccharide which is the most important source of energy.

Therefore, in most living species, glucose is the monosaccharide which is the most important source of energy.

To learn more about monosaccharide, here:

https://brainly.com/question/13416862

#SPJ1

which is the graph of the function g(x) = f(-x)​

Answers

To graph the function g(x) = f(-x), you can start with the graph of f(x) and then reflect it about the y-axis.

What is a graph of the function g(x) = f(-x)?

To find the graph of the function g(x) = f(-x), we can start with the graph of the function f(x) and then reflect it about the y-axis.

If the graph of f(x) is symmetric with respect to the y-axis, meaning it is unchanged when reflected, then g(x) = f(-x) will have the same graph as f(x).

However, if the graph of f(x) is not symmetric with respect to the y-axis, then g(x) = f(-x) will be a reflection of f(x) about the y-axis.

In either case, the resulting graph of g(x) = f(-x) will be symmetric with respect to the y-axis.

Learn more about the graph of functions at: https://brainly.com/question/17089414

#SPJ1

which is the graph of the function g(x) = f(-x)

2. 4.6gof X is burnt completelyto produce 6.2g of X oxide (X,O). M (0) = 16 gmol ¹. Calculate the amount of oxygen that reacted in this experiment. [2 MARKS]
[ii] calculate the mass of 1 mole of x.[2mark]
[iii] predict and give a reason explaining the reaction of x2o in water.[1mark]​

Answers

As per the given data, 1.6 grams of oxygen reacted in this experiment.

To calculate the amount of oxygen that reacted in the experiment, we need to determine the difference in the mass of X oxide (X,O) formed and the mass of X initially used.

Given:

Mass of X = 4.6 g

Mass of X oxide (X,O) = 6.2 g

To find the amount of oxygen that reacted:

Mass of oxygen = Mass of X oxide - Mass of X

= 6.2 g - 4.6 g

= 1.6 g

Therefore, 1.6 grams of oxygen reacted in this experiment.

Calculate the mass of 1 mole of X:

Given that the mass of X is 4.6 g, we can calculate the molar mass of X by dividing the mass by the number of moles:

Molar mass of X = Mass of X / Number of moles of X

Molar mass of X = 4.6 g / 0.1 mol

Molar mass of X = 46 g/mol

Therefore, the mass of 1 mole of X is 46 grams.

Thus, the answer is 46 grams.

For more details regarding moles, visit:

https://brainly.com/question/30885025

#SPJ1

The equilibrium constant for the reaction represented by the equation below is greater than 1.0. Which of the following gives the correct relative strengths of the acids and bases in the reaction?H2PO4− + HBO32− ⇄ HPO42− + H2BO3−Acids BasesA.H2PO4− > H2BO3− and HBO32− > HPO42− B.H2BO3− > H2PO4− and HBO32¯ > HPO42− C.H2PO4− > H2BO3− and HPO42− > HBO32− D.H2BO3− > H2PO4− and HPO42− > HBO32− E.H2PO4− = H2BO3− and HPO42− = HBO32−

Answers

Giving the right relative importance of the bases and acids used in the reaction is H2PO4 > H2BO3 and HBO32 > HPO42.

What are acids, exactly?

A chemical that produces salts and release hydronium ions into water when it reacts with any of these metals. Acids have one sour taste and give some colours a reddish tint. Chemicals taste acidic whenever dissolved in water and conduct electricity, and combine with metals to produce oxygen and hydrogen. Litmus is one indicator compound that can be used to identify acids. Acids cause the blue litmus material to turn red. One type of acid is sodium hydroxide.

Which one has the strongest acid?

For example, pure sulfuric acid has a shocking pH of -12 while nitric acid has a pH of 1.08 and bleach has a pH of 1.6. So, the strongest "regular" acid you will encounter is weakly acidic.

To know more about acid visit:

https://brainly.com/question/29796621

#SPJ4

Explain the difference between wavelength and frequency

Answers

Answer:

Wavelength (typically measured in nanometers) is the distance between two points in a wave.Frequency (typically measured in Hertz) is the number of waves in a specific time . Frequency and wavelength have both direct and inverse relationships. The crucial difference between frequency and wavelength is that frequency shows the total number of wave oscillations in a given time. As against wavelength specifies the distance between two specific points of a wave.

Explanation:

Frequency is how often something changes per second be it amplitude of a voltage on a wire or be it the bobbing back and forth of a bobblehead. Frequency is how often something moves up and down in a second. If a bobble head moves forward and backward in one second then it has a bobbling frequency of 1 Hertz (Hz). The unit of frequency is Hertz (Hz) or # of cycles or oscillations per second. A wavelength is measured in distance like meters (m). For photons or light or radiowaves the equation is wavelength=speed of light/frequency.

Answer:

Wavelength (typically measured in nanometers) is the distance between two points in a wave, while frequency is how often something changes per second be it amplitude of a voltage on a wire or be it the bobbing back and forth of a bobblehead.

lphins... Acid. (b) Chlorine reacts with red hot iron powder to give Iron(III) Chloride but not Iron (II) Chloride. Explain. (1Mark)​

Answers

(a) Because acid is caustic, dolphins can perish from exposure to it. Acids are compounds that give other things protons (H+). Acid can react with the proteins and lipids in dolphins' skin when they come into touch with it, leading to chemical burns and damage to the underlying tissue. Systemic consequences from this include death.

(b) Because chlorine is a potent oxidizer, it interacts with red-hot iron powder to produce Iron(III) chloride (FeCl3) rather than Iron(II) chloride (FeCl2). FeCl3 is created when chlorine at high temperatures rapidly accepts electrons from iron atoms. Contrarily, iron interacts with HCl, a less potent oxidizer than chlorine, to produce FeCl2.

Learn more about chlorine at :

https://brainly.com/question/31560014

#SPJ1

How much would the temperature of a 34.2 g sample of argon gas decrease when 2.8 kJ of heat is removed?
Your answer should be in °C.

Answers

Answer:

8.90

Explanation:

because I calculated it

8.90 I hope I helped!!

X = atomic number - number of core electrons

Which of the following explains the identity of X and its trends down a group?

A. X is the effective nuclear charge, and it remains constant down a group.

B. X is the screening constant, and it remains constant down a group.

C. X is the effective nuclear charge, and it increases down a group.

D. X is the screening constant, and it increases down a group.

Answers

Based on the expression given in the question, X is the effective nuclear charge, and it increases down a group.

What is an effective nuclear charge?

Effective nuclear charge is the net nuclear charge that an electron in an atom experiences, after subtracting the nuclear charge shielded by other electrons.

The effective nuclear charge is denoted by Zeff and can be calculated by subtracting the number of shielding electrons from the atomic number.

Therefore, based on the expression given in the question, X is the effective nuclear charge, and it increases down a group.

Learn more about effective nuclear charge at: https://brainly.com/question/13664060

#SPJ1

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Help with Chemistry Thank You To Who Ever Helps Things Have Been Hard For Me.

Answers

Answer:

1.The electonic configuration of elements and their position in the periodic table are related to each other, From the electronic configuration of the elements, we can determine the period and the group to which the element belongs

Let's consider, sodium with atomic number 11 and k, l, and M shells have 2,8,and 1 electrons. since, there are 3 principal energy levels so we concluded sodium belongs to third period M Shell(valance shell) has only 1 electrons. so sodium belongs to group 1.

2. Entire D-block elements are known as Transition Elements.

3. Group 17 is the halogen group.

4. Main group of elements are...... 1,2, and 13 through 18.

5. Group 18 are the noble gas elements .

12. a). Smaller

b). Increases

c). More reactive

d). Softer

7. a). k › Ca › Ge › Br › Kr

b). Ra › Ba › Sr › Ca › Mg › Be

9. a). Ca(calcium) ion is smaller.

b). Cl(chlorine) atom is smaller.

c). Mg(magnesium) atom is smaller.

10. a). F(fluorine)

b). Sr(strontium)

c). Pb(lead)

d). At(Astatine)

If you placed 413g of Bal2 in a beaker and filled it with water to a total volume of 750ml, calculate the molarity of the solution

Answers

To calculate the molarity of a solution, we need to determine the number of moles of the solute (Bal2) and then divide it by the volume of the solution in liters.

Given:

Mass of Bal2 = 413 g

Volume of solution = 750 ml = 0.75 L

1. Calculate the number of moles of Bal2:

First, we need to convert the mass of Bal2 to moles using its molar mass. The molar mass of Bal2 can be calculated by summing the atomic masses of boron (B) and iodine (I):

Molar mass of Bal2 = (atomic mass of B × 1) + (atomic mass of I × 2)

Molar mass of Bal2 = (10.81 g/mol × 1) + (126.90 g/mol × 2)

Molar mass of Bal2 = 10.81 g/mol + 253.80 g/mol

Molar mass of Bal2 = 264.61 g/mol

Now we can calculate the number of moles of Bal2:

Moles of Bal2 = Mass of Bal2 / Molar mass of Bal2

Moles of Bal2 = 413 g / 264.61 g/mol

Moles of Bal2 ≈ 1.561 mol

2. Calculate the molarity of the solution:

Molarity (M) = Moles of solute / Volume of solution (in liters)

Molarity (M) = 1.561 mol / 0.75 L

Molarity (M) ≈ 2.081 M

Therefore, the molarity of the solution is approximately 2.081 M.

The molarity of the solution is approximately 1.408 M as to calculate the molarity of a solution, one must need to know the number of moles of the solute and the volume of the solution in liters.

The molar mass of BaI₂ is:

Ba (barium) atomic mass = 137.33 g/mol

I (iodine) atomic mass = 126.90 g/mol

Molar mass of  BaI₂ = (Ba atomic mass) + 2 × (I atomic mass)

= 137.33 + 2 × 126.90

= 137.33 + 253.80

= 391.13 g/mol

Given that the mass of BaI₂ is 413 g,

Number of moles = Mass / Molar mass

= 413 g / 391.13 g/mol

= 1.056 moles

Volume of solution = 750 ml = 750/1000 = 0.75 L

Finally, one can calculate the molarity of the solution using the formula:

Molarity = Number of moles / Volume of solution

= 1.056 moles / 0.75 L

= 1.408 M

Learn more about molarity here.

https://brainly.com/question/13386686

#SPJ1

What are two processes that must occur to form soil?

Question 1 options:

weathering breaks rocks into minerals and plants die and decay


erosion and weathering


Plants produce loam and plants produce humus


erosion transports mineral particles and plants die and decay

Answers

Erosion and weathering are two processes that must occur to form soil.

What is soil formation?

Soil formation is the process by which soil is created over time through the physical, chemical, and biological interactions between rocks, minerals, organic matter, water, air, and living organisms.

Soil formation is a slow and complex process that can take centuries or even millennia, and it can be influenced by a variety of factors, including climate, topography, parent material, time, and human activities.

What is erosion and weathering?

Weathering refers to the physical and chemical processes that break down rocks and minerals at or near the Earth's surface.

Erosion, on the other hand, refers to the movement and transport of weathered materials, such as soil, rock fragments, and sediment, by water, wind, or glaciers. This can result in the reshaping of landscapes, the creation of new landforms, and the deposition of sediments in new locations.

Learn about Weathering here https://brainly.com/question/829782

#SPJ1

class material don't interact please

Answers

A 0.00143 M  concentration of MnO4^- is not a reasonable solution .

Number of moles of carbonate

The ions left in solution are Na^+ and NO3^-

Number of moles of calcium nitrate  = 100/1000 L × 1 = 0.1 moles

Since;

1 mole of sodium carbonate reacts with 1 mole of calcium nitrate  then 0.1 moles of sodium carbonate were used.

Conductivity of filtrate

The claim of the student that the concentration of sodium carbonate is too low is wrong because the value was calculated from concentration  and volume of calcium nitrate  and not using the precipitate. If the filtrate is tested for conductivity, it will be found to conduct electricity because it contains sodium and NO3 ions.

2) In the reaction as shown, the MnO4^- ion was reduced.

The initial volume is 3.4 mL while the final volume is 29.6 mL.

Number of moles of MnO4^- ion = (29.6 mL - 3.4 mL)/1000 × 0.0235 M = 0.0006157 moles

The calculations are performed as follows

If 2 moles of MnO4^- reacted with 5 moles of acid

0.0006157 moles of MnO4^- reacted with  0.0006157 moles ×  5 moles/ 2 moles

= 0.0015 moles

In this case, number of moles of acid = 0.139 g/90 g/mol = 0.0015 moles

Number of moles of MnO4^-  = 0.00143 M × (29.6 mL - 3.4 mL)/1000

= 0.000037 moles

If 2 moles of MnO4^- reacts with 5 moles of acid

0.000037 moles of MnO4^- reacts with 0.000037 moles × 5 moles/ 2 moles

= 0.000093 moles

Hence, this is not a reasonable amount of solution.

Learn more about MnO4^- : https://brainly.com/question/10887629

5. Which of the following would alter the reaction rate? (select all that are true)
Changing particle size
Adding heat
Adding a catalyst

Answers

Both changing particle size and adding a catalyst can influence the reaction rate, while adding heat specifically affects the rate by increasing the kinetic energy of the reactant particles.

The correct option are A and C.

Both changing particle size and adding a catalyst can alter the reaction rate.

Changing particle size can affect the reaction rate because it influences the surface area available for the reactant particles to interact. Smaller particle sizes result in a larger surface area, increasing the frequency of collisions between particles and accelerating the reaction. Conversely, larger particle sizes reduce the surface area, leading to fewer collision events and slower reaction rates.

Adding heat can also alter the reaction rate. Increasing the temperature provides more thermal energy to the reactant particles, causing them to move faster and collide with greater energy. This enhanced kinetic energy leads to more successful collisions and an increased reaction rate.

Adding a catalyst can significantly affect the reaction rate. A catalyst provides an alternative reaction pathway with lower activation energy, enabling the reaction to occur more easily. By lowering the energy barrier, a catalyst increases the rate of reaction without being consumed or permanently altered in the process.

The correct option are A and C.

For more such questions on catalyst

https://brainly.com/question/21598276

#SPJ8

Other Questions
What evidence can you find to indicate that Farquhar is experiencing great pain despite his feelings that he is escaping? Draw the structural formula for ethynylcyclohexane. A flat, triangular twinned diamond crystal is called a describe the missionary work of fr. pierre-jean de smet by answering the following: when and where did he minister? what was his relationship with the indians? what were the results of his missionary work? Someone help me Explain how non-genetic factors can affect phenotype. Give an example. A 39.2 g sample of copper tookup the 4.4 cm3 of space.What is the density of thecopper piece in g/cm3?[?] g/cmRecord your answer to the tenths place.Density (g/cm) which of the following best explains the changes depicted in map 2 ? responses a. the rise of the safavid persian empire b. european imperialism and increasing ethnic nationalism c. sunni versus shia rivalries within the islamic world d. the decline of silk road trade routes A ball thrown horizontally at 12.6 m/s from the roof of a building lands 20.0 m from the base of the building How long does it take for the ball to reach the ground and How tall is the building? which of the following options correctly express the relationship between the volume and temperature of a gas at constant pressure? select all that apply. Who was the leader of the movement for Indian independence?Mohandas GandhiGeorge MarshallRudyard KiplingDwight D. Eisenhower Which of the following best states the difference between inductive reasoning and deductive reasoning 3 7/8- 3/8 I really need help! Question 2(Multiple Choice Worth 1 points)(02.05 MC)Choose the table that represents g(x) = -2xf(x) when f(x) = x + 4. What is the quotient t? using accrual-basis accounting, on which date should bills company record revenue for the accounting and tax services? Given the following quadratic in standard form,y = 2x - 6x + 4Does the parabola open up or down? Explain how you know. A city park is in the shape of a rectangle with width of 25 yd. and length of 60 yd. What is the length of the diagonal that runs across the park? A. B. C. D. HELP!!! I CANT SEEM TO GET IT RIGHT!A cyclist rides her bike at a speed of 10 miles per hour. What is this speed in kilometers per hour? How many kilometers will the cyclist travel in 5 hours?In your computations, assume that 1 mile is equal to 1.6 kilometers. Do not round your answers.(giving brainliest) the books on the table were arrange properly, whats is adjective? What is the expected return for the following stock? (State your answer in percent with one decimal place.) Outcomes Possible returns Probability better 40% 13% same 26% 22% worse 19% 65% 25.20% 20.55