PLEASE HELP QUICKLY! I KNOW THE ANSWER IS 65 BUT WHAT DOES F REPRESENT??

The equation 201.50 = f + 6.50(21) represents the cost of printing the shirts at a second printing company. Find the solution to the equation and state what the solution represents in this situation.​

Answers

Answer 1

Answer:

maybe it means how many shirts

Answer 2

Answer:

F= 65

Step-by-step explanation:

Hope it helps


Related Questions

Hi, I'm often really slow at learning math and my condition makes it harder, can someone help me?

Find the zeroes of the function and state their multiplicities.
q(x) = 10x^3 - 58x^2 + 40x

Answers

The answer: 0, 4/5 and 5


Explanation: first, we factor out 2x and get: 2x(5x^2-29x+20)=0

In order for this equation to be equal to zero, either 2x must equal to zero or (5x^2-29x+20) must equal to zero

Having said that, if:
2x = 0
X=0

If:
(5x^2-29x+20) = 0
X=4/6, x=5

Tried every app none have the answer please help

Tried every app none have the answer please help

Answers

Answer:

opotion has not correct answer

answer is 15.

Answer:

3710    or      3710

Step-by-step explanation:

(3)(35)=3710

(√3)(35) = √3 · 35

{√3 = 312}                 {radical rule: Double exponent: use braces to clarify}

335 =  312 · 35

{35 = 315}                  {radical rule: Double exponent: use braces to clarify}

 312 · 35 =   312 · 315     {exponent rule:  Double exponent: use braces to clarify}

                (1/2 + 1/5 = 5/10 + 2/10 = 7/10)

              =3710        {opposite of radical rule: Double exponent: use braces to clarify ;  xab=xab}

             = 3710

so, the simplified version of this equation can either be written as:

3710    or      3710

hope this helps!!

(I can't clearly see the last option, but if it's either of these, then it's correct)

alguien me ayuda ,, Hallar la suma de los primeros 20 numeros multiples de 3

Answers

Answer:

630

Step-by-step explanation:

1st = 3

2nd = 6

3rd = 9 ...

20th = 60

Súmalos todos juntos para encontrar la suma.

3 + 6 + 9 + 12 + 15 + 18 + 21 + 24 + 27 + 30 + 33 + 36 + 39 + 42 + 45 + 48 + 51 + 54 + 57 + 60 = 630

La suma de los primeros 20 múltiplos de 3 es 630

¡Espero que esto ayude!

what is the answer to 2x+5=12x-15

Answers

Answer:

Hi there!

Your answer is

x=2

Step-by-step explanation:

2x+5=12x-15

-12x

-10x+5=-15

-5

-10x= -20

/-10

x= 2

Answer:

x=2

Step-by-step explanation:

First you would subtract 2x from both sides so. Then you will add 15 so you can isolate your x onto your right side. Then you will divide both sides by 10 to get x=2.

I just need the length of the unknown side and why it makes sense

I just need the length of the unknown side and why it makes sense

Answers

Answer:

Step-by-step explanation:

According to Pythagorean theorem, the square value of hypotenuse (the side length that sees angle measure 90) is equal to sum of square value of two legs:

let x represent the missing length

x^2 + 3^2 = 7^2

x^2 + 9 = 49 subtract 9 from both sides

x^2 = 40 find the root for both sides

x = 40 or 6.3 inches approximately

Which of the following is a counterexample to the given statement?
The name of every month ends in the letter y.
a. January
b. July
C February
d. December

Answers

The name of every month ends in the letter y is the given statement. February is a counterexample to this statement. This is because February does not end with the letter 'y'. So the right  option is (c) February.

What is a counterexample?

In mathematics, a counterexample is an example that opposes or disproves a statement, proposition, or theorem. It is a scenario, an instance, or an example that goes against the given statement.

Therefore, a counterexample demonstrates that the given statement is false or invalid.In this case, the statement is: "The name of every month ends in the letter y." We have to find which of the months listed does not end in "y."February is the only month in the options listed that does not end in the letter "y."

Thus, it is a counterexample to the given statement. Therefore, the correct option is C, February.

For more questions on: counterexample

https://brainly.com/question/29197877

#SPJ8                  

Bobby measured the middle school and made a scale drawing. The gym is 135 inches wide in the drawing. The actual gym is 63 feet wide. What scale did Bobby use for the drawing?
15 inches :
feet

Answers

Answer:

Below

Step-by-step explanation:

135 in : 63 feet

135 in : 63 * 12 in

135 in : 756 in

 5 in : 28 in

  5 : 28

Graphing y=mx+b

what is the slope (m) of y=x-3 ?

Answers

Answer:

1

Step-by-step explanation:

"m" is the number in front of x and in this case it would be one (x times 1 is x)

the answer is 1 because if there is nothing in front of x then it is just one

The coordinate grid shows points A through K. What point is a solution to the system of inequalities? y > −2x + 10 y > 1/2x − 2 coordinate grid with plotted ordered pairs, point A at negative 5, 4 point B at 4, 7 point C at negative 2, 7 point D at negative 7, 1 point E at 4, negative 2 point F at 1, negative 6 point G at negative 3, negative 10 point H at negative 4, negative 4 point I at 9, 3 point J at 7, negative 4 and point K at 2, 3
answer:
a) E
b) K
c) B
d) D

Answers

Based on the analysis, point D at (-7, 1) is the only solution to the system of inequalities y > -2x + 10 and y > (1/2)x - 2. Therefore, the correct answer is option d) D.

To determine which point is a solution to the system of inequalities y > -2x + 10 and y > (1/2)x - 2, we can test each point to see if it satisfies both inequalities.

a) Point E at (4, -2):

Substituting the coordinates into the inequalities:

-2 > -2(4) + 10 -> -2 > -8 + 10 -> -2 > 2 (False)

-2 > (1/2)(4) - 2 -> -2 > 2 - 2 -> -2 > 0 (False)

b) Point K at (2, 3):

Substituting the coordinates into the inequalities:

3 > -2(2) + 10 -> 3 > -4 + 10 -> 3 > 6 (False)

3 > (1/2)(2) - 2 -> 3 > 1 - 2 -> 3 > -1 (True)

c) Point B at (4, 7):

Substituting the coordinates into the inequalities:

7 > -2(4) + 10 -> 7 > -8 + 10 -> 7 > 2 (True)

7 > (1/2)(4) - 2 -> 7 > 2 - 2 -> 7 > 0 (True)

d) Point D at (-7, 1):

Substituting the coordinates into the inequalities:

1 > -2(-7) + 10 -> 1 > 14 + 10 -> 1 > 24 (False)

1 > (1/2)(-7) - 2 -> 1 > -3.5 - 2 -> 1 > -5.5 (True)

Based on the analysis, point D at (-7, 1) is the only solution to the system of inequalities y > -2x + 10 and y > (1/2)x - 2. Therefore, the correct answer is option d) D.

For more questions on inequalities

https://brainly.com/question/1870140

#SPJ11

Which power of Congress is the most important?
Select one:
O a. the authority to regulate commerce
O b. the authority to establish the federal courts.
O c. the authority to make laws
O d. the authority to coin money

Answers

C. The authority to make laws

. prove: if a line containing a vertex of an isosceles triangle is parallel to the base of the triangle it bisects each exterior angle at the vertex.

Answers

Using the properties of Isosceles Triangle we get that When the line containing the vertex of an isosceles triangle is drawn from the vertex angle perpendicular to the base, it bisects the vertex angle and the base.

Based on the length of the sides of the triangle, there are three types of equilateral triangles . , isosceles triangle, unequal triangle. An isosceles triangle is a triangle with two sides of equal length and corresponding angles are equal.

Statement : -

Let ABC be an isosceles triangle such that AB=AC.

Let AD be the bisector of ∠A.

we have to prove:- BD=DC

Proof :-

In △ABD&△ACD

AB=AC(∵△ABC is an isosceles triangle)

∠BAD=∠CAD(∵AD is the bisector of ∠A)

AD=AD (Common)

By S.A.S.(side angle side)

△ABD≅△ACD

By corresponding parts of congruent triangles-

⇒BD=DC

Hence proved that the perpendicular drawn from the vertex angle to the base bisect the vertex angle and base.

To learn more about Isosceles triangle , refer:

https://brainly.com/question/25812711

#SPJ4

Complete question:

Prove that if a line containing a vertex of an isosceles triangle is perpendicular drawn from the vertex angle to the base bisect the vertex angle and the base.

. prove: if a line containing a vertex of an isosceles triangle is parallel to the base of the triangle

In a trial designed to test the effectiveness of a drug in preventing heart​ disease, 12,170 male physicians were treated with the drug and 12,173 male physicians were given placebos. Among the subjects in the drug treatment​ group,
148 experienced myocardial infarctions​ (heart attacks). Among the subjects given​ placebos, 295 experienced myocardial infarctions. Use a 0.05 significance level to test the claim that the drug has no effect on myocardial infarctions.
a. Test the claim using a hypothesis test.
b. Test the claim by constructing an appropriate confidence interval.
c. Based on the​ results, does the drug appear to be​ effective?

Answers

a. Reject the null hypothesis if the test statistic falls outside the critical region.

b. Reject the null hypothesis if the confidence interval does not include zero.

c. If p-value < 0.05 and the confidence interval does not include zero, the drug appears to be effective. Otherwise, it does not appear to be effective.

a. To test the claim that the drug has no effect on myocardial infarctions, we can use a hypothesis test.

Null Hypothesis (H0): The drug has no effect on myocardial infarctions.

Alternative Hypothesis (Ha): The drug has an effect on myocardial infarctions.

We can use a two-proportion z-test to compare the proportions of myocardial infarctions between the drug treatment group and the placebo group.

The test statistic for the two-proportion z-test is given by:

z=(p1p2)/(p(1p))((1/n1)+(1/n2))

Where p1 and p2 are the sample proportions of myocardial infarctions in the drug treatment group and placebo group respectively, n1 and n2 are the sample sizes of the two groups, and p is the combined sample proportion.

Using the given data:

n1=12170 (number of physicians treated with the drug)

n2=12173 (number of physicians given placebos)

x1=148 (number of myocardial infarctions in the drug treatment group)

x2=295 (number of myocardial infarctions in the placebo group)

p1=x1/n1p2=x2/n2

Let's calculate the test statistic and compare it with the critical value at a significance level of 0.05 (z-critical value = 1.96 for a two-tailed test). If the test statistic falls outside the critical region, we reject the null hypothesis.

b. To test the claim by constructing a confidence interval, we can calculate the confidence interval for the difference in proportions between the two groups. The formula for the confidence interval is:

CI=(p1p2)z(p1(1p1)/n1)+(p2(1p2)/n2)

where z is the critical value corresponding to the desired confidence level.

Using the given data, we can calculate the confidence interval and check if it includes zero. If the confidence interval includes zero, we fail to reject the null hypothesis.

c. Based on the results of the hypothesis test and the confidence interval, we can make a conclusion about the effectiveness of the drug. If the p-value is less than the significance level (0.05) and the confidence interval does not include zero, we can conclude that the drug appears to be effective in preventing myocardial infarctions. Otherwise, if the p-value is greater than the significance level and the confidence interval includes zero, we fail to reject the null hypothesis and conclude that the drug does not appear to be effective.

To know more about null hypothesis, refer here:

https://brainly.com/question/30821298

#SPJ4

what is −4y−4+(−3)? kkkxznkk;mxk;mxck;mk;mk;xc

Answers

Answer:

-4y-7

Step-by-step explanation:

- 4 y - 4 + ( - 3 )

We keep the -4y as it is since it can not be simplified. Then we try to open the parentheses. we do this by multiplying by 1.

- 4 y - 4 + 1 * ( - 3)

= - 4 y - 4 - 3

Then we combine the - 4 and -3.

= - 4 y - 7

Answer: I can confirm that it is '-4y-7'

Step-by-step explanation:

Consider the following equation: x^2+xy+y^3=1

find the value of y at the point where x=1

find the value of y’ at the point where x=1

find the value of y’’ at the point where x=1

find the value of y’’’ at the point where x=1

Answers

Answer:

Step-by-step explanation:

To find the value of y at the point where x=1, we can substitute x=1 into the equation:

x^2+xy+y^3=1

1+y+y^3=1

y+y^3=0

y(y^2+1)=0

y=0 or y=-1 or y=1

To find the value of y' at the point where x=1, we need to take the derivative of the equation with respect to x:

2x + y + xy' + 3y^2y' = 0

y' = -(2x+y)/(3y^2+x)

When x = 1, y' = -(2(1)+y)/(3y^2+1)

To find the value of y'' at the point where x=1, we need to take the derivative of the equation with respect to x again:

2 + y' + xy'' + 3(2y)(y') = 0

y'' = -(2+y')/(3(2y)+(x))

When x = 1, y'' = -(2+y')/(3(2y)+(1))

To find the value of y''' at the point where x=1, we need to take the derivative of the equation with respect to x one more time:

y'' + xy''' + 3(2y')(y') + 3y(3y)(y') = 0

y''' = -(y'' + 3(2y')(y') + 3y(3y)(y'))/(x)

When x = 1, y''' = -(y'' + 3(2y')(y') + 3y(3y)(y'))/(1)

It is important to note that to find the exact value of y, y', y'', y''' we need to find the value of y in the equation x^2+xy+y^3=1 and substitute it into the derivative equations, but without the equation solved we can't find the exact values.

What is the average rate of change of f(x)=1/4x2-4 over the interval from 0 to 3?

Answers

The average rate of change of the function f(x) = (1/4)x^2 - 4 over the interval from 0 to 3 is -3/2.

The average rate of change of a function over an interval is calculated by finding the difference in the function's values at the endpoints of the interval and dividing it by the difference in the x-values. In this case, we are given the function f(x) = (1/4)x^2 - 4 and the interval from 0 to 3.

To find the value of the function at the endpoints, we substitute the x-values into the function.

At x = 0: f(0) = (1/4)(0)^2 - 4 = -4.

At x = 3: f(3) = (1/4)(3)^2 - 4 = 9/4 - 4 = -7/4

The difference in the function values is: (-7/4) - (-4) = -7/4 + 16/4 = 9/4.

The difference in the x-values is: 3 - 0 = 3.

Finally, we divide the difference in the function values by the difference in the x-values to find the average rate of change: (9/4) / 3 = 9/4 * 1/3 = 9/12 = 3/4 = -3/2.

Therefore, the average rate of change of f(x) = (1/4)x^2 - 4 over the interval from 0 to 3 is -3/2.

Learn more about function here:

https://brainly.com/question/31062578

#SPJ11

68% of people use Netflix, 28% use Hulu, and 25% of people use both. What is the probability that a person who uses Hulu also uses Netflix?

Answers

Step-by-step explanation:

URGENTLY!!

higher mathematics

Solve the system of equations by Cramer's method.

For the correct execution of the task I give 25 points!

if p(x) = x+ 7/ x-1 and q (x) = x^2 + x - 2, what is the product of p(3) and q(2)? a. 50 b. 45 c. 40 d. 20 e. 6

Answers

Answer:

d. 20

Step-by-step explanation:

To answer the question given, we will follow the steps below:

we need to first find p(3)

p(x) = x+ 7/ x-1

we will replace all x by 3 in the equation above

p(3) = 3+7 / 3-1

p(3) = 10/2

p(3) = 5

Similarly to find q(2)

q (x) = x^2 + x - 2,

we will replace x by 2 in the equation above

q (2) = 2^2 + 2 - 2

q (2) = 4 + 0

q (2) = 4

The product of p(3) and q(2)   =   5 × 4   = 20

Help plz plz plz plz .

Help plz plz plz plz .

Answers

The slope is m hope this helps

What is the slope of the line passing through the points (2,1) and (4,7)?

Answers

Answer:

3

Step-by-step explanation:

Use the slope formula.

SLOPE:

⟶:y2y1x2x1=riserun

y2=7y1=1x2=4x1=2

Solve.

\(\Longrightarrow: \sf{\dfrac{7-1}{4-2}= \dfrac{6}{2}=\boxed{\sf{3}}\)

Therefore, the slope of the line passing through the points (2,1) and (4,7) is 3, which is the correct answer.

I hope this helps, let me know if you have any questions.

Please help me! No links!!!
what is v?

v-6=-20

Answers

Answer:

Hi! The answer to your question is v = 14

Step-by-step explanation:

☆*: .。..。.:*☆☆*: .。..。.:*☆☆*: .。..。.:*☆☆*: .。..。.:*☆

☆Brainliest is greatly appreciated!☆

Hope this helps!!

- Brooklynn Deka

Answer:

12

Step-by-step explanation:

20-60=12

A quarter back completes 23% of his passes. We want to observe this quarterback during one game to see how many pass attempts he makes before completing one pass. What is the probability that the quarterback throws exactly 6 incomplete passes before he has a completion

Answers

Answer:

Pr=0.0479

Step-by-step explanation:

Given

p=23% --- proportion of completed passes

Required

The probability that he has 6 incomplete before he has 1 completion

Let:

q proportion of back passes not completed

Using complement rule:

q=1p

q=123%

q=10.23

q=0.77

The event that he has 6 incomplete passes before he completed one is:

q q q q q q p

And the probability is:

Pr=qqqqqqp

Pr=q6p

Pr=0.7760.23

Pr=0.0479

What is the effect on total liabilities when a company buys a building in exchange for a 20-year note payable?

Answers

When a company purchases a building in exchange for a 20-year note payable, the effect on total liabilities is an increase by the value of the note payable.

When a company acquires a building through a 20-year note payable, it means that the company agrees to make regular payments over the course of 20 years to the seller or a lending institution. This transaction has a direct impact on the company's balance sheet, specifically on the liabilities side. The note payable represents a long-term liability for the company, as it is a debt that needs to be repaid over an extended period.

Upon the purchase of the building, the company records an increase in the building asset account to reflect the acquisition. Simultaneously, the company recognizes a corresponding increase in the note payable account on the liabilities side. This increase in the note payable represents the amount owed by the company for the building purchase. As a result, the total liabilities of the company rise by the value of the note payable.

It is important to note that the company will also incur interest expenses over the 20-year period, which will further impact its financial statements. The interest expense associated with the note payable will be recorded periodically, typically on a monthly or annual basis, depending on the terms of the agreement. This interest expense will be recognized in the income statement and will result in additional costs for the company over the life of the loan. However, the initial effect on total liabilities is primarily the increase in the note payable, representing the outstanding balance owed on the building purchase.

Learn more about value here:

https://brainly.com/question/29282806

#SPJ11

In 2020, a total of 9559 Nissan Leafs were sold in the US. For the 12-month period starting January 2020 and ending December 2020, the detailed sales numbers are as follows: 651, 808, 514, 174, 435, 426, 687, 582, 662, 1551, 1295 and 1774 units.

before the Nissan plant in Smyrna, Tennessee, started to produce the Nissan Leaf they were imported from Japan. Although cars are now assembled in the US, some components still imported from Japan. Assume that the lead time from Japan is one weeks for shipping. Recall that the critical electrode material is imported from Japan. Each battery pack consists of 48 modules and each module contains four cells, for a total of 192 cells. Assume that each "unit" (= the amount required for an individual cell in the battery pack) has a value of $3 and an associated carrying cost of 30%. Moreover, assume that Nissan is responsible for holding the inventory since the units are shipped from Japan. We suppose that placing an order costs $500. Assume that Nissan wants to provide a 99.9% service level for its assembly plant because any missing components will force the assembly lines to come to a halt. Use the 2020 demand observations to estimate the annual demand distribution assuming demand for Nissan Leafs is normally distributed. For simplicity, assume there are 360 days per year, 30 days per month, and 7 days per week.

(a) What is the optimal order quantity?
(b) What is the approximate time between orders?

Answers

(a)The optimal order quantity is  4609 units.

(b)The time between orders is  1.98 months.

To determine the optimal order quantity and the approximate time between orders, the Economic Order Quantity (EOQ) model. The EOQ model minimizes the total cost of inventory by balancing ordering costs and carrying costs.

Optimal Order Quantity:

The formula for the EOQ is given by:

EOQ = √[(2DS) / H]

Where:

D = Annual demand

S = Cost per order

H = Holding cost per unit per year

calculate the annual demand (D) using the 2020

sales numbers provided:

D = 651 + 808 + 514 + 174 + 435 + 426 + 687 + 582 + 662 + 1551 + 1295 + 1774

= 9559 units

To calculate the cost per order (S) and the holding cost per unit per year (H).

The cost per order (S) is given as $500.

The holding cost per unit per year (H)  calculated as follows:

H = Carrying cost percentage × Unit value

= 0.30 × $3

= $0.90

substitute these values into the EOQ formula:

EOQ = √[(2 × 9559 × $500) / $0.90]

= √[19118000 / $0.90]

≈ √21242222.22

≈ 4608.71

Approximate Time Between Orders:

To calculate the approximate time between orders, we'll divide the total number of working days in a year by the number of orders per year.

Assuming 360 days in a year and a lead time of 1 week (7 days) for shipping, we have:

Working days in a year = 360 - 7 = 353 days

Approximate time between orders = Working days in a year / Number of orders per year

= 353 / (9559 / 4609)

= 0.165 years

Converting this time to months:

Approximate time between orders (months) = 0.165 × 12

= 1.98 months

To know more about quantity here

https://brainly.com/question/14581760

#SPJ4

When the Better Builder Company completed a small construction job, they found that the following expenses had been incurred: labor, $672.25; gravel, $86.77; sand, $39.41; cement, $180.96; and bricks, $204.35. What total bill should they give the customer if they want to make a profit of $225 on the job?

Answers

Answer: 1372.33

Step-by-step explanation: add it all up

Addition can be defined as the process of adding two numbers. The total bill Better Builder Company should give the customer if they want to make a profit of $225 on the job is $1408.74.

What is Addition?

Addition can be defined as the process of adding two numbers such that the result is the combined value of the two numbers.

To make a profit the Better builder company needs to add all the expenses and the profit they need to make. Therefore, the sum can be written as,

Total Bil = $672.25 + $86.77 + $39.41 + $180.96 + $204.35 + $225

              = $1408.74

Hence, the total bill Better Builder Company should give the customer if they want to make a profit of $225 on the job is $1408.74.

Learn more about Addition:

https://brainly.com/question/13167637

#SPJ2

Gabby has 72 gum balls to share with 8 friends equally B how many gumballs does each friend get

Gabby has 72 gum balls to share with 8 friends equally B how many gumballs does each friend get

Answers

Answer:

9

Step-by-step explanation:

Because 9 times 8 is 72. Hope this helps

Answer:

9

Step-by-step explanation:

8 times 9 = 72 so you use division

14. Write a conditional statement that is TRUE and has a converse that is FALSE.

i need help on all 3

14. Write a conditional statement that is TRUE and has a converse that is FALSE. i need help on all 3

Answers

Answer:

conditional: if it is a rose then it's a flower

converse: if it is a flower then it's a rose

11. A researcher in a personal submarine begins at the surface of the ocean.
The submarine descends 20.6 meters and then ascends 57 meters. What
is the depth of the personal submarine?
A-26.3 meters
14.9 meters
B-14.9 meters
26.3 meters

Answers

The depth of the personal submarine is -14.9 meter.

What is an integer?

An integer is a whole number that can be positive, negative, or zero and is not a fraction. Integer examples include: -5, 1, 5, 8, 97, and 3,043. 1.43, 1 3/4, 3.14, and other numbers that are not integers are some examples.

Given that,

The submarine descends 20.6 meters and then ascends 5.7 meters. it means 20.6 is a negative number and 5.7 is a positive number.

Now,

To find the depth adding the -20.6+5.7

-20.6+5.7

-14.9

Hence, The depth of the personal submarine is -14.9 meter

To learn more about integer from the given link:
https://brainly.com/question/28148275
#SPJ9

: Prove that a) X'Y' + X'Y +XY = X' +Y b) A'BC' + ABC' + BC'D = BC' Find the complement of the following function a) WX(Y'Z+YZ') + W'X'(Y' +Z)(Y+Z') b) (A+B'+C') (A'B' +C)(A + B'C') Find Dual of question 2 (a, b),

Answers

a) X'Y' + X'Y + XY simplifies to X' + Y.

b) A'BC' + ABC' + BC'D simplifies to BC'.

Complement of the functions:

a) Complement is W' + X' + YZ.

b) Complement is (A' + B + C)(A'B' + C' + A'B).

a) To prove X'Y' + X'Y + XY = X' + Y, we can use Boolean algebra identities:

X'Y' + X'Y + XY

= Y'(X' + X) + XY(Distributive Law)

= Y' + XY(X + X' = 1)

= X' + Y(Commutative Law)

Therefore, X'Y' + X'Y + XY simplifies to X' + Y.

b) To prove A'BC' + ABC' + BC'D = BC', we can simplify the expression using Boolean algebra:

A'BC' + ABC' + BC'D

= BC'(A' + A) + BC'D   (Distributive Law)

= BC' + BC'D(A + A' = 1)

= BC'(BC' + BC'D = BC' + BC'(1) = BC')

Hence, A'BC' + ABC' + BC'D simplifies to BC'.

Complement of the given functions:

a) The complement of WX(Y'Z + YZ') + W'X'(Y' + Z)(Y + Z') is W' + X' + YZ.

b) The complement of (A + B' + C')(A'B' + C)(A + B'C') is (A' + B + C)(A'B' + C' + A'B).

Learn more About Distributive Law from the given link

https://brainly.com/question/25224410

#SPJ11

what would the value of X be on this one?

what would the value of X be on this one?

Answers

Answer:

i think it's 51 because if you add 106 and 23 together it's 129 then 180-129= 51

Step-by-step explanation:

which one of them is it?

which one of them is it?

Answers

Answer:

A.8 and7

Step-by-step explanation:

Supplementary angles are angles that add to 180 degrees.

Let's examine the answer choices.

A. ∠8 and ∠7

⇒ These angles are on a straight line together, so they are supplementary.

B. ∠5 and ∠1

⇒ These angles have no relation to each other. They are on different lines that are not parallel.

C. ∠7 and ∠4

⇒These angles also have no relation to each other.

D. ∠2 and ∠4

⇒ These angles are vertical, but not supplementary.

The correct answer is A. ∠8 and ∠7

Other Questions
indentured servitude is a gray area between contract labor and slavery.true or false select the best single answer. make a qualitative prediction of the sign of h o soln for the dissolution of alcl3(s) and the dissolution of fecl3(s).Make a qualitative prediction of the sign of Delta H degree_soln for the dissolution of AlCl_3(s) and the dissolution of FeCl_3(s). Delta H degree_soln (AICI_3) < 0. Delta H degree_soln (FeCl_3) > 0 Delta H degree (AlCl_3) > 0, Delta H degree_soln (FeCl_3) < 0 Delta H degree_soln (AlCl_3) < 0, Delta H degree (FeCl_3) < 0 Delta H degree_soln (AICI_3) > 0. Delta H degree_soln (FeCl_3) > 0 write an equation of the line through (-3, -6) having slope 16/7. give the answer in standard form.The equation of the line is ? x- ? y= ? What is a likely purpose of the hair in an adults armpits and genital regions, especially given that this hair grows during puberty? Think about an animal like a rhinoceros, a deer, or an antelope. What parts of their body other than their hair must be composed of quite similar material to your nails and hair? What kind of locations in the world (either in the United States or globally) might be easier to live in for people with Seasonal Affective Disorder? Which kinds of places might be worse? Your friend Olivia has a blemish on her shoulder that she cant easily see herself, so she asks you to check it out for her to help her decide if she should see her doctor. What are at least three things you would look for to help you advise her? (Remember: ABCDE!) What might an elevated skin temperature indicate beside a fever from a cold, flu, or other typical viral disease? How might you test for an elevated temperature? what is the degree of the simplest polynomial with integer coefficients that has 2 , 2 , 2 + i , and 2 + 2i as some of its zeros?a. 6b. 7c. 8d. 9 Oneof the main feature for the industry policies during 1949 to 1978is instability. true of false ? What is the meaning of Defying Gravity song? xamine the low and two higher views of this longitudinal section of a specimen of a blood vessel. Choose from the list the identification of this blood vessel Hint Examine the lower right higher power view carefully noting the placement of the two profiles of the cells in the two adjacent layers. Med Image Bins A large artery B. integument C muscular artery D. heart OE skin OF. large vein G. medium artery What is the subject of this sentence? Reading The Call of the Wild is one of my favorite parts of the day. A triplet of bases in a template strand of DNA is 5' GAT 3'. What would be the corresponding codon for mRNA? (3 points)A. 3' CTA5B. 3CUA5C. 5CTA3D. 5CUA3 the total factory overhead for martin company is budgeted for the year at $675,000. martin manufactures two garden products: a leaf blower and a garden wagon. these products each require 4 direct labor hours (dlh) to manufacture. each product is budgeted for 4,500 units of production for the year. what would the total number of budgeted direct labor hours for the year be? Select the correct answerAnnabeth and Charlie are both on road trips. Annabeth's distance, in miles, from New York thours after 12:00p.m. is modeled by this function.D(t) = 60lt 31Charlie's distance, in miles, from New York thours after 12:00 p.m. is modeled by this table,t0246810F(t)27018090090180Who will have traveled for a greater amount of time when their distance from New York stops decreasing and starts increasing?.CharlieOBThis cannot be determined from the given informationOC. They will have traveled the same amount of time,ODAnnabeth Q1: Draw the Schematic: F=A(B+C), a) How many MOSFETS do you need to design the circuit? b) If A=0, B=C= 1, what is F? c) Find the on off condition of each MOSFET Q2: Draw the Schematic: F=A+BC, a) How many MOSFETS do you need to design the circuit? b) If A=0, B=C= 1, what is F? c) Find the on off condition of each MOSFET Q3: Draw the Silicon Lattice Structure. Find the value of x ??? Based on the consultation letter from Dr. Lu, your job is to develop a History ofthe Present Illness (HP1). Your response needs to include a description of whatthe patient would be telling the physician she is noticing on her skin based on theconditions seen in the consultation letter. Please, Just please help me The length of a rectangle is the sum of the width and 2. The area of the rectangle is 63 square units. What is the width, in units, of the rectangle? The oxides SO2 and N2O5 will form what acids? What are 2 examples of discontinuous variations? A soccer team has a record of 13 wins and 7 losses. What percent of their games has the team won?