\(\huge\mathfrak\blue{answer}\)
Answer for the 6th question is
c. Water boiling
Answer for the 7th question is
a. Chemical change
Answer for the 8th question is
b. A glass cup falls from the counter and shatters on the ground
(mark me brainliest please :))
\(\large\sf\blue{thank \: you}\)
An 85.0 kg patient being treated for a serious infection is to receive an iv infusion of 1 /mg kg gentamicin, a powerful antibiotic. the pharmacy has prepared a 250. ml iv bag of normal saline in which 0.500 g of gentamicin has been dissolved. what is the total volume of the iv solution that should be given to the patient? round your answer to the nearest ml
Answer: 1/ms=8mk
Explanation:
With respect to earths climate system at the proposed strategy of dimming the sun would be an example of which of the following A) tipping point B) climate, forcing C) greenhouse effect D) earths energy budget
With respect to earths climate system at the proposed strategy of dimming the sun would be an example of climate forcing.
What is climate?Climate is the long-term weather pattern in a region, typically averaged over 30 years. More rigorously, it is the mean and variability of meteorological variables over a time spanning from months to millions of years.
Some of the meteorological variables that are commonly measured are temperature, humidity, atmospheric pressure, wind, and precipitation. In a broader sense, climate is the state of the components of the climate system, including the atmosphere, hydrosphere, cryosphere, lithosphere and biosphere and the interactions between them. The climate of a location is affected by its latitude, longitude, terrain, altitude, land use and nearby water bodies and their currents.
Learn more about climate,here:
https://brainly.com/question/10440860
#SPJ1
The relative number of atoms of a compound can be calculated
by dividing the percentage of an element by the:
Answer:
Obtain the relative numbers of atoms of each element in the compound by dividing the number of moles of each element in the 100 g sample by the number of moles of the element present in the smallest amount.
Answer:
Obtain the relative numbers of atoms of each element in the compound by dividing the number of moles of each element in the 100 g sample by the number of moles of the element present in the smallest amount.
Water flows over Niagara Falls at the average rate of 2,400,000 kg/s, and the average height of the falls is about 50 m. Knowing that the gravitational potential energy of falling water per second = mass (kg) × height (m) × gravity (9.8 m/s2), what is the power of Niagara Falls? How many 15 W LED light bulbs could it power?
Explanation:
It is given that,
Water flows over Niagara Falls at the average rate of 2,400,000 kg/s
The average height of the falls is 50 m
We need to find the power of Niagara Falls.
The gravitational potential energy of falling water is given by :
P = mgh
Power is rate of doing work i.e.
\(P=\dfrac{W}{t}\\\\P=\dfrac{mgh}{t}\\\\P=\dfrac{m}{t}\times gh\)
We have, m/t = 2,400,000 kg/s
So,
\(P=2400000\times 9.8\times 50\\\\P=1.176\times 10^9\ W\)
If the number of bulbs are n that could power 15 W LED, the,
\(n=\dfrac{1.176\times 10^9}{15}\\\\n=78400000\ \text{bulbs}\)
4. What is free energy?
Answer:
A thermodynamic quantity equivalent to the capacity of a system to do work.
Explanation:
cho lượng dư Al tác dụng với dung dịch H2SO4 đặc nóng. Đâuuf tiên thấy giải phóng ra khí màu A mùi sốc, khí A làm mất màu dung dịch nước brom. Tiếp theo tạo thành kết tủa màu vàng. Rồi thoát ra khí không màu B mùi trứng thối, khí B cũng làm mất màu dung dịch nước brom, tạo kết tủa khi dẫn vào dung dịch Cu(NO3)2. Viết các phương trình phản ứng
Hope it helps you!
-miraculousfanx-
_______ properties depend on the concentration of a solute in a solution but not on the identity of the solute.
This problem is providing us with a statement in which we need to figure out the word fitting in the blank. At the end, after analyzing the information, the word turns out to be colligative as show below:
Colligative properties.In chemistry, colligative properties of solutions account for the behavior of a solution with respect to the pure solvent, to which a solute is added.
Among them, we have boiling point elevation, freezing point depression, vapor pressure lowering and osmotic pressure, which are all affected by the concentration of the solute but not by the identity of the solute.
In such a way, we conclude that the correct word that fits in the blank is colligative as shown below:
"Colligative properties depend on the concentration of a solute in a solution but not on the identity of the solute."
Learn more about colligative properties: https://brainly.com/question/10323760
Please help me!!!!! I REALLY NEED HELP!!! What is my carbon footprint and how can I reduce it?
Answer:
your carbon footprint is how often you use a car of vehical you can decreese it by riding a bike or walking.
Explanation:
Carbon footprint is like when you ride a car and it produces lots of carbon monoxide in the air. Ways to reduce it is by walking, riding a bicycle or using the bus for transportation. Hope this helps.
How does the ionosphere affect radio frequencies?
Group of answer choices
FM frequencies are not reflected and shortwave frequencies are bounced off the ionosphere and back to Earth several times.
FM frequencies are bounced back to Earth and back several times.
Shortwave radio frequencies are absorbed by the ionosphere and FM frequencies pass through.
Shortwave radio frequencies are not affected and pass through the ionosphere.
Answer:Shortwave radio frequencies are not affected and pass through the ionosphere.
Explanation:
What does it mean to classify?
1.to put books in alphabetical order
2.to separate objects or ideas into groups based on ways they are alike
3.to separate stamps by year and then by color
4.to organize music by category and then by title
Answer:
2
Explanation:
to separate objects or ideas into group based on ways they are alike
i am begging anyone to help me with this! (all tutors i've asked said they can't solve it but i need someone to help me out) - i can get the first little bit of it so maybe we can work through it together?
First, we need to calculate how much energy we will get from this combustion.
Assuming the combustion is complete, we have the octane reacting with O₂ to form only water and CO₂, so:
\(C_8H_{18}+O_2\to CO_2+H_2O\)We need to balance the reaction. Carbon only appear on two parts, so, we can start by it:
\(C_8H_{18}+O_2\to8CO_2+H_2O\)Now, we balance the hydrogen:
\(C_8H_{18}+O_2\to8CO_2+9H_2O\)And in the end, the oxygen:
\(C_8H_{18}+\frac{25}{2}O_2\to8CO_2+9H_2O\)We can multiply all coefficients by 2 to get integer ones:
\(2C_8H_{18}+25O_2\to16CO_2+18H_2O\)Now, we need to use the enthalpies of formation to get the enthalpy of reaction of this reaction.
The enthalpy of reaction can be calculated by adding the enthalpies of formation of the products multiplied by their stoichiometric coefficients and substracting the sum of enthalpies of formation of the reactants multiplied by their stoichiometric coefficients.
For the reactants, we have (the enthalpy of formation of pure compounds is zero, which is the case for O₂):
\(\begin{gathered} \Delta H\mleft\lbrace reactants\mright\rbrace=2\cdot\Delta H\mleft\lbrace C_8H_{18}\mright\rbrace+25\cdot\Delta H\mleft\lbrace O_2\mright\rbrace \\ \Delta H\lbrace reactants\rbrace=2\cdot(-250.1kJ)+25\cdot0kJ \\ \Delta H\lbrace reactants\rbrace=-500.2kJ+0kJ \\ \Delta H\lbrace reactants\rbrace=-500.2kJ \end{gathered}\)For the products, we have:
\(\begin{gathered} \Delta H_{}\mleft\lbrace product\mright\rbrace=16\cdot\Delta H\lbrace CO_2\rbrace+18\cdot\Delta H\lbrace H_2O\rbrace \\ \Delta H_{}\lbrace product\rbrace=16\cdot(-393.5kJ)+18\cdot(-285.5kJ) \\ \Delta H_{}\lbrace product\rbrace=-6296kJ-5139kJ \\ \Delta H_{}\lbrace product\rbrace=-11435kJ \end{gathered}\)Now, we substract the rectants from the produtcs:
\(\begin{gathered} \Delta H_r=\Delta H_{}\lbrace product\rbrace-\Delta H\lbrace reactants\rbrace \\ \Delta H_r=-11435kJ-(-500.2kJ) \\ \Delta H_r=-10934.8kJ \end{gathered}\)Now, this enthalpy of reaction is for 2 moles of C₈H₁₈, so for 1 mol of C₈H₁₈ we have half this value:
\(\Delta H_c=\frac{1}{2}\Delta H_r=\frac{1}{2}\cdot(-10934.8kJ)=-5467.4kJ\)Now, we have 100 g of C₈H₁₈, and its molar weight is approximately 114.22852 g/mol, so the number of moles in 100 g of C₈H₁₈ is:
\(\begin{gathered} M_{C_8H_{18}}=\frac{m_{C_8H_{18}}}{n_{C_8H_{18}}} \\ n_{C_8H_{18}}=\frac{m_{C_8H_{18}}}{M_{C_8H_{18}}}=\frac{100g}{114.22852g/mol}\approx0.875438mol \end{gathered}\)Since we have approximately 0.875438 mol, and 1 mol releases -5467.4kJ when combusted, we have:
\(Q=-5467.4kJ/mol\cdot0.875438mol\approx-4786.37kJ\)Now, for the other part, we need to calculate how much heat it is necessary to melt a mass, m.
First, we have to heat the ice to 0 °C, so:
\(\begin{gathered} Q_1=m\cdot2.010J/g.\degree C\cdot(0-(-10))\degree C \\ Q_1=m\cdot2.010J/g\cdot10 \\ Q_1=m\cdot20.10J/g \end{gathered}\)Then, we need to melt all this mass, so we use the latent heat now:
\(Q_2=n\cdot6.03kJ/mol\)Converting mass to number of moles of water we have:
\(\begin{gathered} M=\frac{m}{n} \\ n=\frac{m}{M}=\frac{m}{18.01528g/mol} \end{gathered}\)So:
\(Q_2=\frac{m}{18.01528g/mol}_{}\cdot6.03kJ/mol\approx m\cdot0.334716kJ/g\)Adding them, we have a total heat of:
\(\begin{gathered} Q_T=m\cdot20.10J/g+m\cdot0.334716kJ/g \\ Q_T=m\cdot0.02010kJ/g+m\cdot0.334716kJ/g \\ Q_T=m\cdot0.354816kJ/g \end{gathered}\)Since we have a heat of 4786.37 kJ form the combustion, we input that to get the mass (the negative sign is removed because it only means that the heat is released from the reaction, but now it is absorbed by the ice):
\(\begin{gathered} 4786.37kJ=m\cdot0.354816kJ/g \\ m=\frac{4786.37kJ}{0.354816kJ/g}\approx13489g\approx13.5\operatorname{kg} \end{gathered}\)Since we have a total of 20kg of ice, we can clculate the percent using it:
\(P=\frac{13.5\operatorname{kg}}{20\operatorname{kg}}=0.675=67.5\%\)Pls help me I don’t know how to do this
Explanation:
We have a 63.9 g sample of calcium hydroxide. First we have to convert those grams into moles. To do that we have to use the molar mass of calcium hydroxide.
Calcium hydroxide = Ca(OH)₂
molar mass of Ca = 40.08 g/mol
molar mass of O = 16.00 g/mol
molar mass of H = 1.01 g/mol
molar mass of Ca(OH)₂ = 1 * 40.08 g/mol + 2 * 16.00 g/mol + 2 * 1.01 g/mol
molar mass of Ca(OH)₂ = 74.10 g/mol
mass of Ca(OH)₂ = 63.9 g
moles of Ca(OH)₂ = 63.9 g /(74.10 g/mol)
moles of Ca(OH)₂ = 0.862 moles
In 1 molecule of Ca we have 2 atoms of O. So in 1 mol of Ca(OH)₂ we will have 2 moles of O atoms.
1 mol of Ca(OH)₂ = 2 moles of O atoms
moles of O atoms = 0.862 moles of Ca(OH)₂ * 2 moles of O /1 mol of Ca(OH)₂
moles of O atoms = 1.724 moles
One mol is similar to a dozen. When we say that we need a dozen eggs we know that we need 12 eggs. If we want a mol of eggs, we want 6.022*10^23 eggs. So one mol of something is 6.022 * 10^23 of that.
1 mol of O atoms = 6.022 * 10^23 atoms
n° of O atoms = 1.724 moles * 6.022 * 10^23 atoms/1 mol
n° of O atoms = 1.04 * 10^24 atoms
Answer: In a 63.9 g sample of Ca(OH)₂ we have 1.04 *10^24 atoms of oxygen.
a particular alnico (aluminum, cobalt, nickel, and iron) bar magnet (magnet a) has a mass of 10 g. it produces a magnetic field of magnitude 3e-05 t at a location 0.19 m from the center of the magnet, on the axis of the magnet.
The alnico bar magnet (magnet A) with a mass of 10 g generates a magnetic field of 3e-05 T at a distance of 0.19 m from its center on the magnet's axis.
The magnetic field strength of a magnet depends on various factors, including its size, shape, and material composition. In this case, the alnico magnet, which consists of aluminum, cobalt, nickel, and iron, produces a magnetic field of magnitude 3e-05 T at the specified location.
The strength of the magnetic field decreases as you move farther away from the center of the magnet along its axis. The distance of 0.19 m from the center indicates a specific point on the magnet's axis where the magnetic field strength is measured. At this location, the magnetic field strength is found to be 3e-05 T.
The magnetic field strength is a measure of the force experienced by a magnetic material within the magnetic field. It is typically measured in Tesla (T) and represents the intensity of the magnetic field at a particular point. The strength of the magnetic field is influenced by the magnet's properties, such as its size, shape, and magnetic moment.
Learn more about alnico bar magnet from the given link:
https://brainly.com/question/14860884
#SPJ11
If the pressure of a gas sample is quadrupled and the absolute temperature is doubled, by what factor does the volume of the sample change
Answer:
The new volume of the sample is halved.
Explanation:
Data obtained from the question include the following:
Initial volume (V1) = V
Initial temperature (T1) = T
Initial pressure (P1) = P
Final pressure (P2) = quadrupled = 4P
Final temperature (T2) = doubled = 2T
Final volume (V2) =?
Thus, we can obtain the new volume of the same by using the combined gas equation as shown below:
P1V1 /T1 = P2V2 /T2
P × V/T = 4P × V2/2T
Cross multiply
T × 4P × V2 = P × V × 2T
Divide both side by T × 4P
V2 = (P × V × 2T) / (T × 4P)
V2 = V/2
V2 = ½V
Therefore, the new volume of the sample is halved .
A student designs an experiment to see the effects exposing a block of ice to sunlight over time. The students makes a hypothesis that longer the expose the more quickly the ice will melt.
Identify the control group, experimental group, independent variable, dependent variable, controlled variable.
In this experiment, the experimental group is ice, the independent variable is sunlight while on the other hand, the dependent variable is block of ice.
What are dependent and independent variables?Dependent variable is a type of variable in which a variable whose value depends on another variable while on the other hand, independent variable is a type of variable in which a variable whose value does not depends on another variable. Dependent variable is denoted by X whereas the independent variable is denoted by Y.
So we can conclude that In this experiment, the experimental group is ice, the independent variable is sunlight while on the other hand, the dependent variable is block of ice.
Learn more about variable here: https://brainly.com/question/25223322
#SPJ1
If a cell inside of an organism were unable to exchange food, water, and other materials with its environment, what would happen to it? It would produce new cells. It would maintain homeostasis. It would not be able to survive. It would move to a new location.
Answer:
It would not be able to survive
Explanation:
A cell can only survive by exchanging materials with its environment. exchange of materials is necessary for life.
For instance, a cell gives out carbon dioxide and takes in oxygen which is necessary for life.
Most cells depend on exchange of materials with their environment for nutrition.
Can you please help me to answer this?
I give you a brainlest!
Which part of a neuron contains the nucleus? A. axon B. cell body C. dendrite D. myelin sheath E. neural impulse
The part of neuron which consist the nucleus is the cell body and nucleus is present at the center of cell body.
What is neuron?Neurons are the essential part of the nervous system also known as nerve cell, as they help in the information transportation process.
Neuron have distinct body parts as our human body have like cell body, axon, dendrites, schwann cell, axon, myelin sheath, neural impulse, node of ranvier, axon terminal and synaptic nob.
Among the following parts, cell body is the main and first part of the neuron and in this part dendrites at the outer part and nucleus at the central part is present.
So, nucleus is present at the cell body.
To know more about neuron, visit the below link:
https://brainly.com/question/13061744
Yeast converts glucose (C6H12O6) into ethanol (d = 0.789 g/mL) in a process called fermentation. An unbalanced equation for the reaction can be written as follows:
C6H12O6(aq)C2H5OH(l)+CO2(g)
If 675.0 g of glucose yields 107.8 mL of ethanol, what is the percent yield for the reaction?
The percent yield for the reaction is 24.64%.
In order to determine the percent yield for the reaction, we'll need to first balance the equation, then calculate the theoretical yield, and finally compare the actual yield with the theoretical yield.
Balanced equation for the fermentation of glucose to ethanol and carbon dioxide:
C6H12O6 (aq) → 2 C2H5OH (l) + 2 CO2 (g)
Now let's find the theoretical yield:
1. Calculate moles of glucose:
molecular weight of glucose = (6 x 12.01) + (12 x 1.01) + (6 x 16.00) = 180.18 g/mol
moles of glucose = 675.0 g / 180.18 g/mol = 3.746 moles
2. Determine moles of ethanol produced:
From the balanced equation, 1 mole of glucose produces 2 moles of ethanol.
So,
moles of ethanol = 3.746 moles of glucose x 2 = 7.492 moles
3. Calculate the mass of ethanol:
molecular weight of ethanol = (2 x 12.01) + (6 x 1.01) + (1 x 16.00) = 46.07 g/mol
mass of ethanol = 7.492 moles x 46.07 g/mol = 345.16 g (theoretical yield)
Next, let's find the actual yield:
1. Convert volume of ethanol (107.8 mL) to mass using density (0.789 g/mL):
mass of ethanol (actual yield) = 107.8 mL x 0.789 g/mL = 85.1 g
Now, we can calculate the percent yield for the reaction:
percent yield = (actual yield / theoretical yield) x 100
percent yield = (85.1 g / 345.16 g) x 100 = 24.64 %
To learn more about fermentation, visit:
https://brainly.com/question/27887751
#SPJ11
Aluminum metal reacts with solid sulfur to produce solid aluminum(III) sulfide.
The chemical equation when aluminum metal reacts with solid sulfur to produce solid aluminum(III) sulfide would be \(2Al (s) + 3S (s) -- > Al_2S_3 (s)\)
Chemical equationThe reaction between aluminum metal and solid sulfur to produce aluminum (III) sulfide would be as follow:
The chemical symbol of aluminum metal = Al
The chemical symbol of sulfur = S
Aluminum has a valence electron of 3 while sulfur has a valance electron of 2. In order to form a bond between them, the valence electron of one becomes the subscript of the other. In other words, aluminum receives the valence of sulfur (2) while sulfur receives the valence of aluminum (3). Thus:
\(2Al +3 S --- > Al_2S_3\)
When all the phases are considered, the equation becomes: \(2Al (s) + 3S (s) -- > Al_2S_3 (s)\)
More on chemical equations can be found here: https://brainly.com/question/12047033
#SPJ1
Aluminum metal reacts with solid sulfur to produce solid aluminum(III) sulfide. Express your answer as chemical equations. identify all the phases in your answer.
A block of iron has a mass of 826 g. What is the volume of the block of iron whose density at 25°C is 7.9 ?
Answer:
1.04×\(10^{-4}\)\(m^{3}\)
Explanation:
Use the References to access important values if needed for this question. Enter electrons as e-.
A voltaic cell is constructed from a standard Pb2+|Pb Half cell (E° red = -0.126V) and a standard F2|F- half cell (E° red = 2.870V). (Use the lowest possible coefficients. Be sure to specify states such as (aq) or (s). If a box is not needed, leave it blank.)
The anode reaction is:___________
The cathode reaction is:__________
The spontaneous cell reaction is:__________
The cell voltage is ___________V
We know the standard reduction potentials of the half-cells involved, so we can find the cell voltage and the spontaneous reaction. Thus;
The anode reaction is:
Pb(s) → Pb2+(aq) + 2e-
This is the oxidation half-reaction that occurs in the Pb half-cell.
The cathode reaction is:F2(g) + 2e- → 2F-(aq).
This is the reduction half-reaction that occurs in the F2 half-cell.
The spontaneous cell reaction is
:Pb(s) + F2(g) → Pb2+(aq) + 2F-(aq).
This is the combination of the oxidation and reduction half-reactions, with the electrons canceled out from both sides.
The cell voltage is 2.996 V The standard cell potential is calculated as follows:
standard cell potential = E°(reduction) - E°(oxidation)standard cell potential = 2.870 V - (-0.126 V)standard cell potential = 2.996 V, The cell voltage is positive, indicating that the reaction is spontaneous.
To know more about oxidation half-reaction visit;
https://brainly.com/question/12686471
#SPJ11
100 degrees celsius between the freezing and boiling points of water a coin with a mass of 5.6 grams 45.2 kilojoules of heat produced in a reaction 16 ounces in a pound 268 attendees at a conference
The exact numbers are 100 degrees Celsius between the freezing and boiling points of water and 45.2 kilojoules of heat produced in a reaction.
The other numbers are not exact because they can be measured with some degree of uncertainty. For example, the number of attendees at a conference could be 268, but it could also be 267 or 269. The mass of a coin could be 5.6 grams, but it could also be 5.59 grams or 5.61 grams.
Exact numbers are numbers that have no uncertainty. They are often defined by convention or by physical laws. For example, the number of degrees Celsius between the freezing and boiling points of water is defined by the Celsius scale. The number of kilojoules of heat produced in a reaction is defined by the laws of thermodynamics.
To learn more about freezing and boiling points, here
https://brainly.com/question/32031404
#SPJ4
Calculate the number of Liters (L) needed to make a 0.1-M (molar) sodium hydroxide (NaOH) solution made with 20.0-grams of solute.
The volume (in liters) needed to make 0.1-M (molar) sodium hydroxide (NaOH) solution containing 20 grams of solute is 5 Liters
How do i determine the volume needed?We shall begin our calculation by obtaining the mole of 20 grams of NaOH. Details below:
Mass of NaOH = 20 grams Molar mass of NaOH = 40 g/mol Mole of NaOH =?Mole = mass / molar mass
= 20 / 40
= 0.5 mole
Now, we shall obtain the volume needed. This is shown below:
Molarity of solution = 0.1 MMole of NaOH = 0.5 moleVolume needed =?Volume needed = mole / molarity
= 0.5 / 0.1
= 5 Liters
Thus, the volume needed is 5 Liters
Learn more about volume:
https://brainly.com/question/29144710
#SPJ1
A student is determining the density of an unknown metal with a mass of table(Au) g. The student partially fills a graduated cylinder with water and measures the volume of the water by itself as 54.8 mL. The student then adds the metal to the water and measures the new volume as 87.3 mL. What is the density, in g/mL, of the metal?
Density in g/mL of the metal is 7.88g/ml and 'density is the substances mass per unit volume'
Here given data is a student is determining the density of an unknown metal with a mass of Au is = 256.0g and then student partially fills a graduated cylinder with water and measures the volume of the water by itself as = 54.8 mL and then student then adds the metal to the water and measures the new volume = 87.3 mL
Density id defined as ratio of mass per unit volume
Volume of water displaced = 87.3 mL-54.8 mL = 32.5mL
We have to calculate density = ?
Density = mass/volume
Density = 256.0g/32.5mL
Density = 7.88g/mL
Density of metal is 7.88g/mL
Know more about density
https://brainly.com/question/21502132
#SPJ1
a push or a pull between an object (many types)
Your answer
Answer:
your answer would be force
Explanation:
what would you expect to see if your product was pure? if it was impure in diels-alder reaction on the ir spectrum
If the product of a Diels-Alder reaction is pure, then the IR spectrum should show sharp peaks at the following frequencies
If the product is impure, then the IR spectrum may show additional peaks due to impurities. For example, if the product contains water, then the IR spectrum may show a peak at 1600 cm-1 due to the O-H stretching vibration.
The IR spectrum of a Diels-Alder product can be used to confirm the structure of the product. The sharp peaks in the IR spectrum are due to the vibrations of the functional groups in the product. The frequencies of these vibrations are characteristic of the functional groups, so they can be used to identify the functional groups in the product.
If the product is impure, then the IR spectrum may show additional peaks due to the impurities. These peaks may be due to the vibrations of the functional groups in the impurities. For example, if the product contains water, then the IR spectrum may show a peak at 1600 cm-1 due to the O-H stretching vibration.
The presence of impurities in the IR spectrum can be used to determine the purity of the product. The more impurities that are present, the more peaks will be seen in the IR spectrum. The absence of any peaks due to impurities indicates that the product is pure.
To learn more about diels-alder reaction click brainly.com/question/30751490
#SPJ11
I WILL GIVE YOU BRAINLIEST!!!
Answer:
The second option
Answer:
Intent to cause harm
What is causing the shrinking of the taiga forest biome?
Answer:
Deforestation
Explanation:
The value of softwood means that large areas of Russia's taiga have been cleared: deforestation is occurring at a rate of 12 million hectares per year (2014). As much as half of the logging in the far east of Siberia is illegal
Answer:
deforestation
Explanation:
and tectonic plates
Which causes genetic variations and can result in different alleles