Answer:
1st truee 2nd D
Explanation:
democratus proposed that matter made up of indivisible particles he named it Atomos in lattin language
which is our atom now
photons have verver small mass
so they considered particles
in the same time the have wave properties
thats why it is said that their nature is dual nature
just like electrons
Answer:
true
Explanation:
When the suns radiant energy for the Earth oceans, it causes water to change state by that rating which form of energy does water vapor have
Water vapor has latent heat energy, which is absorbed or released during the process of changing states from liquid to gas or gas to liquid.When the sun's radiant energy hits the Earth's oceans, it causes the water molecules to absorb this energy and become more energized.
This leads to the water molecules breaking apart and transforming into water vapor, which is a gaseous state of water. Water vapor has a specific form of energy known as latent heat. This is the energy required to change the physical state of water from a liquid to a gas or from a gas to a liquid. The process of converting water into water vapor requires energy, and this energy is stored in the water vapor in the form of latent heat.
The amount of latent heat absorbed or released by water vapor is dependent on the temperature and pressure conditions. When the water vapor condenses back into liquid form, this latent heat is released into the atmosphere. This process plays a critical role in weather and climate patterns as it drives the movement of heat and moisture throughout the Earth's atmosphere.
In summary, water vapor has latent heat energy, which is absorbed or released during the process of changing states from liquid to gas or gas to liquid. This energy plays a vital role in the Earth's weather patterns and is a critical component of the Earth's energy balance.
For more such questions on heat energy
https://brainly.com/question/934320
#SPJ11
Help with 3.A and B image provided below
a. P=0.971 atm=737.6 mmHg
b. n=2.88 x 10⁻³
Further explanationDalton's law of partial pressures states that the total pressure of a mixture of gases is equal to the sum of the partial pressures of the component gases
\(\tt P_T=P_1+P_2+..P_n\)
A. vapor pressure of water at 22.5 = 20.4 mmHg
Pt=P H₂ + P H₂O
758 = P H₂ + 20.4
P H₂=737.6 mmHg=0.971 atm
B.Ideal gas Law = PV=nRT
P = 0.971 atm
V = 72 ml = 0.072 L
R = 0.082 L/atm mol
T = 22.5 + 273.15 =295.65
\(\tt n=\dfrac{0.971\times 0.072}{0.082\times 295.65}=2.88\times 10^{-3}\)
Help me out
On another planet, the isotopes of titanium have the given natural abundances.
The average atomic mass of titanium on the given planet is approximately 46.68164 atomic mass units (u). The average atomic mass may vary depending on the specific isotopic composition of titanium found on different celestial bodies or regions.
To calculate the average atomic mass of titanium on the given planet, we need to consider the natural abundances and masses of each isotope of titanium.
The average atomic mass is calculated by multiplying the natural abundance of each isotope by its respective mass and summing them up.
Let's perform the calculation step by step:
Step 1: Multiply the abundance of each isotope by its mass:
(73.700% * 45.95263 u) + (15.000% * 47.94795 u) + (11.300% * 49.94479 u)
Step 2: Calculate the individual contributions from each isotope:
= (0.737 * 45.95263) + (0.150 * 47.94795) + (0.113 * 49.94479)
Step 3: Add up the individual contributions:
= 33.84765431 + 7.1921925 + 5.64179347
Step 4: Sum up the contributions:
= 46.68164 u
Therefore, the average atomic mass of titanium on the given planet is approximately 46.68164 atomic mass units (u).
It's important to note that the calculation assumes the provided natural abundances are accurate and representative of the titanium isotopes on that planet.
for more questions on atomic mass
https://brainly.com/question/30390726
#SPJ8
For the equilibrium that exists in an aqueous solution of nitrous acid (HNO2, a weak acid), the equilibrium constant expression is: _________
a. K = [ H+] [NO2-] / [HNO2]
b. K = [ H+] [N] [O]2 / [HNO2]
c. K = [ H+] [NO2-] / [HNO2]
d. K = [H+]2 [NO2-] / [HNO2]
e. None of these
Answer: For the equilibrium that exists in an aqueous solution of nitrous acid (HNO2, a weak acid), the equilibrium constant expression is K = [ H+] [NO2-] / [HNO2].
Explanation:
An expression that depicts the ratio of products and reactants raised to the power of their coefficients at equilibrium is called equilibrium constant.
An equilibrium constant is denoted by the symbol 'K'.
For example, the dissociation of nitrous acid in aqueous solution is as follows.
\(HNO_{2} \rightleftharpoons H^{+} + NO^{-}_{2}\)
Hence, its expression for equilibrium constant is as follows.
\(K = \frac{[H^{+}][NO^{-}_{2}]}{[HNO_{2}]}\)
Thus, we can conclude that for the equilibrium that exists in an aqueous solution of nitrous acid (HNO2, a weak acid), the equilibrium constant expression is K = [ H+] [NO2-] / [HNO2].
5. Which of the following would alter the reaction rate? (select all that are true)
Changing particle size
Adding heat
Adding a catalyst
Both changing particle size and adding a catalyst can influence the reaction rate, while adding heat specifically affects the rate by increasing the kinetic energy of the reactant particles.
The correct option are A and C.
Both changing particle size and adding a catalyst can alter the reaction rate.
Changing particle size can affect the reaction rate because it influences the surface area available for the reactant particles to interact. Smaller particle sizes result in a larger surface area, increasing the frequency of collisions between particles and accelerating the reaction. Conversely, larger particle sizes reduce the surface area, leading to fewer collision events and slower reaction rates.
Adding heat can also alter the reaction rate. Increasing the temperature provides more thermal energy to the reactant particles, causing them to move faster and collide with greater energy. This enhanced kinetic energy leads to more successful collisions and an increased reaction rate.
Adding a catalyst can significantly affect the reaction rate. A catalyst provides an alternative reaction pathway with lower activation energy, enabling the reaction to occur more easily. By lowering the energy barrier, a catalyst increases the rate of reaction without being consumed or permanently altered in the process.
The correct option are A and C.
For more such questions on catalyst
https://brainly.com/question/21598276
#SPJ8
A student measures the length of an object to be 152 cm. What is the measurement in km?
Answer:
0.00152 km
Explanation:
The easiest way to complete the conversion is by (1) converting cm to m and then (2) converting m to km. It is important to arrange the conversions in a way that allows for the cancellation of units.
1,000 m = 1 km
100 cm = 1 m
152 cm 1 m 1 km
------------- x -------------- x ---------------- = 0.00152 km
100 cm 1,000 m
\(\large\displaystyle\text{$\begin{gathered}\sf So \to \ \ 152\not{cm}*\frac{1 \ km}{100,000\not{cm}}=0.00152 \ km \end{gathered}$}\)
Answer:Therefore, the measurement of the object in km is: 0.00152 Kilometers.
I hope my answer is useful to you
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Continual eruptions occur along mid-ocean ridges, forming new sea-floor rock. The
rocks closest to a mid-ocean ridge are the youngest | oldest. As you move away from
a mid-ocean ridge, the rocks get younger | older. This implies that crust is being
consumed | produced at mid-ocean ridges
The characteristics of the ocean ridges allow finding the results to complete the statements are:
The rocks near the ridge are YOUNGER. While you walk away the rocks are OLDER. This implies that the cortex is PRODUCING in the ridges.
The oceanic ridges are mountain ranges or chains of volcanic mountains at the bottom of the ocean, in these the magma that rises cools and forms young rocks, in they are pushed by the other rocks that emerge, in general they are located on the edges of the tectonic plates .
Therefore, the oceanic ridges are the point where the earth's crust is separating, therefore it has the youngest rocks and in the furthest points it has the oldest.
Let's find the correct words for each phrase to be correct:
The rocks near the ridge are YOUNGER. You walk away the rocks are OLDER. This implies that the cortex is PRODUCING in the ridges.
As a consequence of the characteristics of the ocean ridges, we can find the results to complete the statements are:
The rocks near the ridge are YOUNGER. While you walk away the rocks are OLDER. This implies that the cortex is PRODUCING in the ridges.
Learn more here: brainly.com/question/3404002
4.Calculate the molarity of a 3.5 L that contains 2.8 mol of HNO3.5.State the mass of the solute required to prepare 125 mL of 0.25 M Ba(NO3)2 solution.6.Calculate the concentration of a 60,0 mL solution that contains 0.075 mol of NH4Cl.7.Calculate the molarity of a 400.0 mL solution that contains 41.5 g of NaCl.8. What volume of 1.50 M KCl can be made from 550 g of KCI.9.Calculate the concentration of a 600.0 mL solution that contains 2.50 g of CaCO3.10. State the mass of the solute required to prepare 325 mL of a 1.5 M CuSO4.5 H2O solution.11. Calculate the molarity of a 200 mL solution that contains 1.2 x 1024 molecules of NaOH.12.How many moles of Cu(NO3)2 are contained in 400.0 mL of 0.90 M Cu(NO3)2.13. A 250.0 mL sample of 0.10 M Na2SO4 is evaporated to dryness. The resulting solid is thenweighed. What mass of solute would be recovered from the solution?
0.8M
Explanations:The formula for calculating the molarity of a substance expressed as;
\(molarity=\frac{mole}{volume}\)Given the following parameters
• mole of HNO3 = 2.8moles
,• Volume of solution = 3.5L
Substitute the given parameters into the formula to have:
\(\begin{gathered} molarity=\frac{2.8moles}{3.5L} \\ molarity=0.8M \end{gathered}\)Hence the molarity of a 3.5 L that contains 2.8 mol of HNO3 is 0.8M
How many moles of sodium hypobromite (NaBrO) should be added to 1.00 L of 0.050 M hypobromous acid
(HBrO) to form a buffer solution of pH 9.15? (Assume that no volume change occurs when the NaBrO is added)
(Ka=2.5x10)
The concentration terms are molality, normality and mole fraction. Molarity can be used to find out the ionic strength of any solution. Therefore, 0.050moles of sodium hypobromite (NaBrO) should be added to 1.00 L of 0.050 M hypobromous acid (HBrO) to form a buffer solution of pH 9.15
What is molarity?Molarity can be calculated by dividing number of moles of solute by volume of solution in litre. Molarity is affected by temperature. Its unit is mole/liter. It measure the concentration of any solute in a solution.
Mathematically,
Molarity= number of moles of solute/volume of solution in litre
Where,
moles= ?
volume= 1.00 L
Molarity=0.050 M
Substituting values in equation, we get
0.050=number of moles of solute/1.00
number of moles of solute=0.050moles
Therefore, 0.050moles of sodium hypobromite (NaBrO) should be added to 1.00 L of 0.050 M hypobromous acid (HBrO) to form a buffer solution of pH 9.15
Learn more about Molarity, here:
https://brainly.com/question/16727614
#SPJ1
Explain how the elimination of a predator from an ecosystem might result in starvation amongst its prey species.
Answer:
If the primary predator of a prey species is eliminated, the prey species’ population will increase to the point of overpopulating the ecosystem. This overpopulation will result in depletion of the prey species’ food supplies as more individuals compete for the same resources and can ultimately lead to the prey species starving.
Explanation:
Elimination of a predator from an ecosystem might lead to famine amongst its prey species because:
the populations of the prey species thrive in the absence of selective pressure by the predatorthe thriving of the populations will put pressure on the available food resources for the prey species leading to significant intra-species competition.available foods might eventually get depleted as population and competition surge.food depletion means the population may end up dying of hunger if the status quo remains.More on food webs can be found here: https://brainly.com/question/2233704?referrer=searchResults
Determine if the following aqueous solutions will be acidic, basic or neutral:
CH3COONa
Answer:
(i) Neutral (ii) Basic (iii) Basic
Explanation:
Sodium acetate dissolves in water to form acetic acid which is weak acid and sodium hydroxide is strong base and the solution is basic in nature.......
Electricity generated from any source comes with its own advantages and disadvantages. So, no source of energy for generating electricity is perfect. However, imagine that there is an energy source that perfectly meets the needs of society. Describe this ideal source of energy. Include relevant factors such as cost, supply, safety, reliability, and environmental impact.
Answer:
Wind energy
An ideal source of energy needs to be reliable, cost effective, safe and must lead to almost zero adverse environmental impact.
Wind energy is energy obtained from air moving at high velocity. This energy is harvested using windmills which convert mechanical energy to electrical energy.
Wind is inexpensive because it occurs naturally. However, a large expanse of land is required in order to mount sufficient number of windmills that will generate enough electrical energy for practical purposes.
This method of electricity generation is safe and does not lead to any environmental hazard unlike the burning of fossil fuels, use of nuclear energy or loss of habitat due to hydroelectric power generation.
Explanation:
A 575.4575.4 mL sample of carbon dioxide was heated to 377377 K. If the volume of the carbon dioxide sample at 377377 K is 824.7824.7 mL, what was its temperature at 575.4575.4 mL
Answer:
263 K
Explanation:
Assuming ideal behaviour and constant pressure, we can solve this problem by using Charles' law, which states that at constant pressure:
T₁V₂=T₂V₁In this case:
T₁ = ?V₂ = 824.7 mLT₂ = 377 KV₁ = 575.45 mLWe input the data:
T₁ * 824.7 mL = 377 K * 575.45 mLAnd solve for T₁:
T₁ = 263 Kdraw the product of each of the reactions. reaction a. the starting material is a 6 carbon ring where there is a double bond between carbons 1 and 2 and a methyl substituent on carbon 1. this reacts with an excess of h 2 in palladium to give product a. draw the product of reaction a. reaction b. the starting material is an 8 carbon ring where there is a triple bond between carbons 1 and 2. this reacts with an excess of h 2 in palladium to give product b.
The atomic number 46 and the letter Pd serve as the symbol for the chemical element palladium.
What is Palladium?
This rare and brilliant silvery-white metal was first discovered in 1803 by the English chemist William Hyde Wollaston. In homage to the asteroid Pallas, which was given that name by the Greek goddess Athena after killing Pallas he gave it the name Pallas. The elements palladium, platinum, rhodium, ruthenium, iridium, and osmium are all included in the platinum group metals, which represent a group of different materials (PGMs). Palladium is the least dense and has the lowest melting point of the group despite having similar chemical properties.
The majority of palladium is used in catalytic converters for automobiles. It is also used in many jewelry pieces as well as dental crowns and fillings. Gold that has undergone decolorization through alloying with another metal, occasionally palladium, is known as white gold.
To know more about palladium, check the link below:
brainly.com/question/14652727
#SPJ4
Using the following reaction, determine the theoretical yield of Acetylsalicylic acid if given 2.31 grams of salicylic acid? (reminder, salicylic acid is the limiting reagent)
The theoretical yield of Acetylsalicylic acid is found out to be: 3.01 grams.
What is limiting reagent?The limiting reagent is a substance that prevents a chemical reaction from occurring completely.
When a limiting reagent is used in a chemical reaction, the atoms, molecules, or ions of the other reactant that it (the limiting reagent) reacts with will either stay free or unreacted.
What is acid?Popular compounds called acids and bases interact with one another to create salt and water. The Latin word "acere," which meaning "sour," is where the term "acid" originates.
According to the problem, we have 2.31 grams of salicylic acid. We need to determine the theoretical yield of acetylsalicylic acid.
The molar mass of salicylic acid is 138.12 g/mol. Therefore, the number of moles of salicylic acid we have is:
n = mass / molar mass
n = 2.31 g / 138.12 g/mol
n = 0.0167 mol
According to the balanced equation, 1 mole of salicylic acid reacts with 1 mole of acetic anhydride to produce 1 mole of acetylsalicylic acid. Therefore, the number of moles of acetylsalicylic acid produced is also 0.0167 mol.
The molar mass of acetylsalicylic acid is 180.16 g/mol. Therefore, the theoretical yield of acetylsalicylic acid is:
mass = n x molar mass
mass = 0.0167 mol x 180.16 g/mol
mass = 3.01 g
Therefore, the theoretical yield of acetylsalicylic acid is 3.01 grams.
To know more about reagent visit:
https://brainly.com/question/31228572
#SPJ1
According to the equation, 2Al(s) + 6H2O(l) + 2KOH(aq) to make 2K[Al(OH)4](aq) + 3H2(g). How many grams of hydrogen gas would be formed in the reaction of 1.15 grams of Al and excess KOH?
Answer:
0.06457g of H₂
Explanation:
2Al(s) + 6H₂O(l) + 2KOH(aq) → 2K[Al(OH)₄](aq) + 3H₂(g)
Based on the equation 2 moles of Al produce 3 moles of hydrogen.
First, we need to convert mass of Al to moles and then with the chemical equation find moles and mass of hydrogen:
Moles Al (Molar mass: 26.982g/mol):
1.15g Al * (1mol / 26.982g) = 0.04262 moles Al
Moles H₂:
0.04262 moles Al * (3 moles H₂ / 2 mol Al) = 0.06393 moles H₂
Mass hydrogen (Molar mass: 1.01g/mol):
0.06393 moles H₂ * (1.01g/mol) =
0.06457g of H₂
Engineers must consider how removing or adding thermal energy changes the energy in materials on the molecular level. Describe how the different
weather conditions would affect the concrete in the roads and what the construction teams might need to consider when choosing materials for each
road.
The thermal energy will affect the temperature of road and increase the temperature which causes cracks on the roads after some times. Thus the construction team must use temperature resistant material.
What is thermal energy?Thermal energy is defined as internal energy present in a thermodynamically balanced system as a result of its temperature.
It can also be defined as the energy derived from matter's temperature.
There are three types of thermal energy transfer.
ConductionRadiationConvectionThus, the thermal energy will affect the temperature of road and increase the temperature which causes cracks on the roads after some times. Thus the construction team must use temperature resistant material.
To learn more about thermal energy, refer to the link below:
https://brainly.com/question/11278589
#SPJ1
A sample of gas at 2815 torr is cooled from 150.0 C to 100.0 C. Assuming the volume is constant what is the pressure in atm of the gas at 100.0 C
A sample of gas at 2815 torr is cooled from 150.0 C to 100.0 C. Assuming the volume is constant, 2482.2torr is the pressure in atm of the gas at 100.0 C.
The force delivered perpendicularly to an object's surface per unit area across how that force is dispersed is known as pressure (symbol: p / P). The pressure in relation to the surrounding air pressure is known as gauge pressure, also spelt gauge pressure.
Pressure is expressed using a variety of units. Some of these are calculated by dividing a unit of force by a unit of area; for instance, the metric system's unit of pressure, a pascal (Pa), is equal to one newton / square metre (N/m2).
P₁/T₁=P₂/T₂
2815 ×373/423=2482.2torr
To know more about pressure, here:
https://brainly.com/question/12971272
#SPJ1
Tell me ththe answer pls
How many moles of H2O are needed to produce 6.3 moles of H2
Answer:
H2 to O2
H2 to H2O
H20 to O2
H2O to H2
O2 to H20
O2 to H2
Explanation:
True or False: All organisms stay in the same habitat for their entire lives.
Answer: False
Explanation: Some animals have to move to different places maybe because their habitat is destroyed or they aren’t comfortable with it.
ILL GIVE BRAINLY PLEASE HELP!!! What type of transport across the cell (plasma) membrane requires energy?
active transport
bilayer
passive transport
concentration gradient
Active transport requires energy to transport the molecules across the cell membrane. Thus, Option A is correct.
Active transport is the transport of molecules from a lower concentration to a higher concentration across the cell (plasma) membrane. As this process is against the concentration gradient, it requires cellular energy to transport the molecules or ions. Active transport involves Primary active transport and secondary active transport.
Passive transport involves the movement of molecules from a higher to lower concentration gradient and thus does not require energy and is slower than active transport.
Therefore, only active transport requires energy for the transportation of molecules across the cell membrane.
To learn more about active transport,
brainly.com/question/12133248
Metric Conversion: Which units are equivalent (the same) as 75g? (Pick 3)
(1 Point)
7500 mg
750 dg
7.5 dag
.075 Kg
The unit that is equivalent to 75g is 0.075 kg, 750 dg, and 7.5 dag. The correct options are b, c, and d.
What are measuring units?Measuring units are the units used to denote the measurement quantities. There are seven basic measuring units. They are length, Time, Amount of substance, Electric current, Temperature, Luminous intensity, and Mass.
The current unit is given grams, which are used to measure the mass of any object.
1000 grams is equal to 1 kilogram and 1 dg = 0.1 g, and 1 dag = 10 g. So by this formula, each of the quantities can be calculated.
1 kg = 1000 g
So, 0.075 kg = (0.075 × 1000)g = 75 g
1 dg = 0.1 g
So, 750 dg = (750 × 0.1) g = 75 g
1 dag = 10 g
So, 7.5 dag = (7.5 × 10) g = 75 g
Thus, the correct options are b. 750 dg, c. 7.5 dag, and d. .075 Kg.
To learn more about measuring units, refer to the link:
https://brainly.com/question/867034
#SPJ2
Isotopes are: A. are only theoretical. B. only formed in laboratories. C. found in nature. D. found in the nuclear reactions in stars but not on Earth.
Answer:
B. only formed in laboratories
Explanation:
i know
Isotopes are only formed in Laboratories. hence, Option (B) is correct.
What are Isotopes ?
Each of two or more forms of the same element that contain equal numbers of protons but different numbers of neutrons in their nuclei, and hence differ in relative atomic mass but not in chemical properties; in particular, a radioactive form of an element is known as Isotope.
Isotopes are two or more types of atoms that have the same atomic number and position in the periodic table, and that differ in nucleon numbers due to different numbers of neutrons in their nuclei.
Therefore, Isotopes are only formed in Laboratories. hence, Option (B) is correct.
Learn more about Isotopes here ;
https://brainly.com/question/12955625
#SPJ2
What do these two changes have in common?
sewing an apron
bleaching clothes
Type of Isomery and Formula
Condesada
The type of isomerism shown is structural isomerism and the molecular formula of the compounds are as follows:
C₄H₈C₂H₆OC₄H₁₀What are isomers?Isomers are molecules that have the same molecular formula but differ in the arrangement or spatial orientation of atoms within the molecule. In simpler terms, isomers are compounds that have the same chemical formula but different structures.
Isomerism arises due to the different ways in which atoms can be connected or arranged within a molecule.
Learn more about isomers at: https://brainly.com/question/27794837
#SPJ1
What does the law of constant composition state?
Answer:
The law of constant composition states that the proportions of the elements in a compound are always the same, no matter how the compound is made.
What should be included when designing a scientific question
When designing a scientific question, you should ensure the question is:
AnswerableSpecificUnderstandableMeasurableWhat is a scientific question?A scientific question is an inquiry that scientists examine via methods such as observation, experimentation or data collection leading to an answer.
They often require specific parameters for setting up experiments along with means for measuring outcomes or phenomenon under investigation while also needing testable results to establish validity. As such successful ones must possess traits like precision in defining boundaries within which observations will take place making them measurable so they may produce documented evidence supporting the validity of their findings
Learn about scientific question here https://brainly.com/question/1675602
#SPJ1
he decomposition of NaClo3 is a first order reaction. A sample of NaClo3 was 90% decomposed in 48 minutes. How long would it take for a sample NaclO3 to be 50% decomposed
The time taken for 50% to be decomposed is the half life and this is 14.4 mins.
What is the time taken?We know that a first order reaction would have a half life that can be obtained from the formula;
N/No = (1/2)^ t/\(t_{\frac{1}{2} }\)
N = Number of atoms at time t
No = Number of atoms initially present
t = time taken
\(t_{\frac{1}{2} }\) = Half life of the reaction
Thus;
We have that the substance is 90% decomposed so only 10% of the original sample remains.
Now;
0.1No/No = (1/2)^48/\(t_{\frac{1}{2} }\)
0.1 = (0.5)^48/\(t_{\frac{1}{2} }\)
ln (0.1) = 48/\(t_{\frac{1}{2} }\) ln(0.5)
-2.3 = 48/\(t_{\frac{1}{2} }\) (-0.69)
48/\(t_{\frac{1}{2} }\) =-2.3/-0.69
\(t_{\frac{1}{2} }\) = 14.4 min
Learn more about half life:https://brainly.com/question/24710827
#SPJ1