Please help ASAP i will give brainley when I can!

Please Help ASAP I Will Give Brainley When I Can!

Answers

Answer 1
the diameter is about 25.47, SO B!!!

Related Questions

Does the relation shown in the diagram below represent a function? Explain why or why not

Does the relation shown in the diagram below represent a function? Explain why or why not

Answers

The relation is function because each value in the domain matches only one value in the range, the relationship described above can be thought of as a function.

Given that,

In the picture we can see the domain and range.

We have to find if the domain and range is function or not.

Each of the sets of domain values has precisely one range value, according to the mapping.

Every domain value in a relation must have precisely one range value in order for it to be referred to as a function. It is not recommended to assign or map a domain value to more than one range value.

Therefore, The relation is function because each value in the domain matches only one value in the range, the relationship described above can be thought of as a function.

To learn more about function visit: https://brainly.com/question/5975436

#SPJ1

30 points look at picture

30 points look at picture

Answers

Answer:

3/7

Step-by-step explanation:

Normalize the following vectors.a) u=15i-6j +8k, v= pi i +7j-kb) u=5j-i , v= -j + ic) u= 7i- j+ 4k , v= i+j-k

Answers

The normalized vector is:

Vhat = v / |v| = (1/√3)i + (1/√3)j - (1/√3)k

What is algebra?

Algebra is a branch of mathematics that deals with mathematical operations and symbols used to represent numbers and quantities in equations and formulas.

a) To normalize the vector u = 15i - 6j + 8k, we need to divide it by its magnitude:

|u| = sqrt(15² + (-6)² + 8²) = sqrt(325)

So, the normalized vector is:

uhat = u / |u| = (15/√325)i - (6/√325)j + (8/√325)k

Similarly, to normalize the vector v = pi i + 7j - kb, we need to divide it by its magnitude:

|v| = √(π)² + 7² + (-1)²) = √(p² + 50)

So, the normalized vector is:

Vhat = v / |v| = (π/√(p² + 50))i + (7/√(p² + 50))j - (1/√(p² + 50))k

b) To normalize the vector u = 5j - i, we need to divide it by its magnitude:

|u| = √(5² + (-1)²) = √(26)

So, the normalized vector is:

uhat = u / |u| = (5/√(26))j - (1/√(26))i

Similarly, to normalize the vector v = -j + ic, we need to divide it by its magnitude:

|v| = √(-1)² + c²) = √(c² + 1)

So, the normalized vector is:

Vhat = v / |v| = - (1/√(c² + 1))j + (c/√(c² + 1))i

c) To normalize the vector u = 7i - j + 4k, we need to divide it by its magnitude:

|u| = √(7² + (-1)² + 4²) = √(66)

So, the normalized vector is:

uhat = u / |u| = (7/√(66))i - (1/√(66))j + (4/√(66))k

Similarly, to normalize the vector v = i + j - k, we need to divide it by its magnitude:

|v| = √(1² + 1² + (-1)²) = √(3)

So, the normalized vector is:

Vhat = v / |v| = (1/√(3))i + (1/√(3))j - (1/√(3))k

To learn more about Algebra from the given link:

https://brainly.com/question/24875240

#SPJ4

please help me lol.

please help me lol.

Answers

I wish I could lol good luck

given the midpoint ( M) and either endpoint of AB , find the other endpoint. B(-10,-7) and M(-2,1)​

Answers

Answer:

is equal to

(-12)

(-6) this is the endpoint

can you help me please?​

can you help me please?

Answers

Answer:

it is a it the first one. 7/13

Answer:

A.

Step-by-step explanation:

The bottom number is the same so leave then and just add the top.

Makes 7/13

please I need help on some math bro this my test

please I need help on some math bro this my test

Answers

the answer is “lucas has $35 to spend. he has already spent 3.50. how many items, x, worth $2.50 can lucas purchase”

explanation:
- the first two answers are wrong because he cannot spend more than 35 dollars
- the third one is wrong because it would be 3.50x, not 2.50x
It the one that’s say Lucas can spend at least $35. He has already spent $3.50 how many items X, worth $2.50. Can Lucas purchase.


The answer has to be simplified

The answer has to be simplified

Answers

Answer:

2x^2 sqrt 5x

Step-by-step explanation:

1. Factor out the perfect square

sqrt 2^2x5x^5

sqrt 2^2x5x^4xx

2. The root of a product is equal to the product of the roots of each factor

sqrt 2^2 sqrtx^4 sqrt 5x

3. Reduce the index of the radical and exponent with 2

2 sqrt x^4 sqrt 5x

2x^2 sqrt 5x

The answer is 2x^2 sqrt 5x

Write an equation that represents the line.
Use exact numbers.

Write an equation that represents the line.Use exact numbers.

Answers

Answer:

y=43x+2

Step-by-step explanation:

In order to write an equation that represents a line, you have to write it in Slope-Intercept Form.

Slope-Intercept Form: y = mx+b

Where b represents the Y-intercept

Where m represents the Slope

**********************************************

That's all you need to know about Slope-Intercept Form!

How do we get started?

Well first off, take a look at the graph and spot two points that are shown

The two points will be: (0, 2) and (3, -2)

Then use the two points to Solve for the Slope of the line!

m = slope

m = y2y1x2x1       Second y - first y/ Second x - First x

m = 2230        

m = 43           Turn the whole answer negative since there's a negative

m = 43           Final Answer

so the slope of the line is -4/3

Now we need to get the Y-intercept of the line!

Easy we don't need to solve just look how many units the graph goes up in y-axis?

2 units

so the y-intercept of the line is 2

Equation: y = -4/3x + 2

Which inequality is a true statement?

Select each correct answer.

−3=−1
−3≤−1
−3 −1
−3≥−1

Answers

Answer:

The true answer is " -3 < -1.

Step-by-step explanation:

I say this because these numbers are negatives. If you put them on a number line you can see that the bigger numbers are farther from the postitives. Postitive numbers are bigger so whatever is close to them is bigger. So because (-1) is closer to them it would be greater, which is what the symbol "<' states.

Five employees are available to perform four jobs. The lime it takes each person to perform each job is given in Table 50. Determine the assignment of employees to jobs that minimizes the total time required to perform the four jobs.
TABLE 50
Person
Time (hours)
Job 1
Job 2
Job 3
Job 4
1
22
18
30
18
2
18

27
22
3
26
20
28
28
4
16
22

14
5
21

25
28

Answers

To determine the assignment of employees to jobs that minimizes the total time required to perform the four jobs, we need to consider the time taken by each person to complete each job. Using the given Table 50, we can analyze the data and identify the optimal assignment.

By examining Table 50, we can identify the minimum time taken by each person for each job. Starting with Job 1, we see that Person 4 takes the least time of 16 hours. Moving to Job 2, Person 2 takes the least time of 18 hours. For Job 3, Person 1 takes the least time of 25 hours. Lastly, for Job 4, Person 4 takes the least time of 14 hours.

Therefore, the optimal assignment would be:

- Person 4 for Job 1 (16 hours)

- Person 2 for Job 2 (18 hours)

- Person 1 for Job 3 (25 hours)

- Person 4 for Job 4 (14 hours)

This assignment ensures that the minimum total time is required to perform the four jobs, resulting in a total time of 16 + 18 + 25 + 14 = 73 hours.

To learn more about minimize total time click here: brainly.com/question/15071332

#SPJ11

find the first partial derivatives of the function. (sn = x1 2x2 ... xn; i = 1, ..., n. give your answer only in terms of sn and i.) u = sin(x 1 2x2 ⋯ nxn) ∂u ∂xi =

Answers

To find the partial derivative of the function u = sin(x1 2x2 ⋯ nxn) with respect to xi, where i is an integer between 1 and n, we need to use the chain rule. The answer can be expressed as follows: ∂u/∂xi = cos(x1 2x2 ⋯ nxn) * 2ixi * x1 2x2 ⋯ xi-1 2xi-1 xi+1 2xi+1 ⋯ xn.

To explain further, we start by applying the chain rule to u = sin(x1 2x2 ⋯ nxn) with respect to xi. We treat all the variables except xi as constants, so we get:

∂u/∂xi = cos(x1 2x2 ⋯ nxn) * ∂(x1 2x2 ⋯ nxn)/∂xi

Next, we use the product rule to differentiate x1 2x2 ⋯ nxn with respect to xi. We treat all the variables except xi as constants, so we get:

∂(x1 2x2 ⋯ nxn)/∂xi = 2ixi * x1 2x2 ⋯ xi-1 2xi-1 xi+1 2xi+1 ⋯ xn

Substituting this result back into our original equation, we get:

∂u/∂xi = cos(x1 2x2 ⋯ nxn) * 2ixi * x1 2x2 ⋯ xi-1 2xi-1 xi+1 2xi+1 ⋯ xn

Therefore, the partial derivative of the function u = sin(x1 2x2 ⋯ nxn) with respect to xi is cos(x1 2x2 ⋯ nxn) multiplied by 2ixi multiplied by the product of all the variables except xi in the original function.

To learn more about partial derivative click here, brainly.com/question/31397807

#SPJ11

alexis likes to go for boat rides along a river with her family. in still water, the boat travels about 7 kilometers per hour. in the river, it takes them the same amount of time t to go upstream 4 kilometers as it does to travel downstream 8 kilometers. if the speed of the river is r, which of the following expressions represents the time it takes to travel 4 kilometers upstream?

Answers

It takes 51.33 min or 6/7 hrs to travel upstream 4 km.

What is relative velocity?

it is the speed measured with respect to an observer whether he is moving or stationary and it might differ for different observers.

speed of boat = 7 km/hr

speed of river = r km/hr

speed upstream = 7-r km/hr

speed downstream = 7+r km/hr

time taken to go upstream 4 km = 4/(7-r)

time taken to go downstream 8 km = 8/(7+r)

as time taken is equal in both scenario:

4/(7-r) = 8/(7+r)

on solving we get:

r = 7/3 km/hr

put this value in time taken for upstream

4/(7-(7/3)) = 6/7 km/hr or 51.33 min

to learn more about relative speed:

https://brainly.com/question/29523095

#SPJ4

Using the relative velocity formula, we know that it takes 51.33 min or 6/7 hrs to travel upstream 4 km.

What is relative velocity?

Think about two trains that are traveling in the same direction and at the same pace.

Even though the tracks, buildings, and trees on either side of the track indicate that both trains are moving, to the observer of one train, the other train appears to be stationary.

The other train seems to be moving at a constant speed.

So, we know that:

Speed of boat = 7 km/hr

Speed of river = r km/hr

Now,

Speed upstream = 7-r km/hr

Speed downstream = 7+r km/hr

Time taken to go upstream 4 km = 4/(7-r)

Time taken to go downstream 8 km = 8/(7+r)

As the time taken is equal in both scenarios:

4/(7-r) = 8/(7+r)

On solving we get:

r = 7/3 km/hr

Put this value in time taken for upstream as follows:

4/(7-(7/3)) = 6/7 km/hr or 51.33 min

Therefore, using the relative velocity formula, we know that it takes 51.33 min or 6/7 hrs to travel upstream 4 km.

Learn more about relative speed here:

https://brainly.com/question/29523095

#SPJ4

Someone help me I’m struggling on this question

Someone help me Im struggling on this question

Answers

Answer:

3s75

3s12

s4

-3s - 7 < 5 is the correct inequality.

PLEASE HELP IM GONNA FAIL WILL GIVE BRIANLESS

PLEASE HELP IM GONNA FAIL WILL GIVE BRIANLESS

Answers

Answer:

8) 1,965,600 passwords

9) 1/8

Step-by-step explanation:

8) 9 · 8 · 7 · 6 ·26 ·25  = 1,965,600

9) 1/2 · 1/2 · 1/2 = 1/8

Find all solutions for a triangle with A = 40°, B = 60°, and c = 20.
a. C = 80°; a = 15.3; b = 17.6
C = 80°; a = 13.1: b = 17.6
b. C = 70°; a = 13.1; b = 14.5
d. no solution

Answers

Answer:C

Step-by-step explanation:

180-(60+40)=80°

C=80°

20/sin80. =a/sin40

a=(20sin40)÷sin80

=13.1

Your friend is filling out a form that needs her height in all inches. She is 5 ft 8 inches tall. What is her height in inches? Conversion ratio: 1 ft = 12 in
A 60 in
B 68 in
C 13 in

Answers

b) 68 in


Convert feet to inches by multiplying by 12.

Add the inch value to the converted feet to get the height in inches.

Multiply the height in inches by 2.54 to get the height in centimeters.

Solve the inequality for x. 3x + 9 < 3

Answers

Answer:

x > - 2

Step-by-step explanation:

3x + 9 < 3

3x (+ 9 - 9) < 3 - 9

3x < -6

3x/3 < -6/3

x > -2 (dividing by negative numbers, you reverse the inequality sign at the end of an equation)




How are conclusions and recommendations drawn in a study? In your response, 1.1 relate to the findings 1.2 Relate to the literature review 미 [2] [3]

Answers

Conclusions and recommendations are significant aspects of a research study that are typically drawn from the findings and literature review.

Conclusions and recommendations are significant components of a research study.

The findings and literature review serve as critical sources in developing conclusions and recommendations.

Let's examine the process of drawing conclusions and recommendations in a research study.

Relating conclusions to the findingsThe conclusion is a final interpretation of the study's results based on the findings.

The findings section should demonstrate the variables under analysis, whether hypotheses were accepted or rejected, and any significant results obtained.

It should emphasize the implications of the findings in light of the study's original purpose or research questions.

A well-written conclusion should also provide any explanations for findings that weren't anticipated and why they are crucial.

A summary of the key points and a brief discussion of how the study contributes to the knowledge base and the research field are two other components of an effective conclusion.

Relating recommendations to the literature reviewRecommendations are the actions that researchers suggest based on the study's findings.

The researcher should tie the recommendation to the literature review in the study's final section.

The review of related literature provides the context for the study and the literature gaps that the study aims to address.

A well-written recommendation should make explicit the specific actions that stakeholders should take to apply the study's findings.

The researcher must also describe the potential benefits of implementing the recommendations and the rationale for the recommended actions.

To summarize, conclusions and recommendations are significant aspects of a research study that are typically drawn from the findings and literature review.

The researcher should provide a comprehensive summary of the study's outcomes and implications in the conclusion section.

Recommendations should be closely related to the literature review and describe the appropriate actions that stakeholders should take to apply the findings of the study.

For more questions on literature

https://brainly.com/question/32141343

#SPJ8

Guys what is the answer to -6x+x?

Answers

Answer:

-5 x

Step-by-step explanation:

Simplify the following:

-6 x + x

Combine like terms in -6 x + x.

x - 6 x = -5 x:

Answer:  -5 x

x stands for one so -6x+1 = -5x

so the answer is -5x

during a huge snowstorm in the White Mountains last year it snowed 66.5 cm in one day how much did it snow in meters?​

Answers

Answer: It snowed 0.665 meters

hope this helps! :)

Answer:

Step-by-step explanation:

61.5cm= (6.15/100)m = .615m

Select the statement that shows equivalent measurements.

5.2 meters = 0.52 centimeters
5.2 meters = 52 decameters
52 meters = 520 decimeters
5.2 meters = 5,200 kilometers

Answers

The statement that shows equivalent measurements is "52 meters = 520 decimeters." Option C.

To determine the equivalent measurements, we need to understand the relationship between different metric units.

In the metric system, each unit is related to others by factors of 10, where prefixes indicate the magnitude. For example, "deci-" represents one-tenth (1/10), "centi-" represents one-hundredth (1/100), and "kilo-" represents one thousand (1,000).

Let's analyze each statement:

5.2 meters = 0.52 centimeters: This statement is incorrect. One meter is equal to 100 centimeters, so 5.2 meters would be equal to 520 centimeters, not 0.52 centimeters.

5.2 meters = 52 decameters: This statement is incorrect. "Deca-" represents ten, so 52 decameters would be equal to 520 meters, not 5.2 meters.

52 meters = 520 decimeters: This statement is correct. "Deci-" represents one-tenth, so 520 decimeters is equal to 52 meters.

5.2 meters = 5,200 kilometers: This statement is incorrect. "Kilo-" represents one thousand, so 5.2 kilometers would be equal to 5,200 meters, not 5.2 meters.

Based on the analysis, the statement "52 meters = 520 decimeters" shows equivalent measurements. So Option C is correct.

For more question on equivalent visit:

https://brainly.com/question/2972832

#SPJ8

Note the correct and the complete question is

Select the statement that shows equivalent measurements.

A.) 5.2 meters = 0.52 centimeters

B.) 5.2 meters = 52 decameters

C.) 52 meters = 520 decimeters

D.) 5.2 meters = 5,200 kilometers

the _____ is the sum of the lengths of the sides of a closed plane figure.

Answers

The perimeter is the sum of the lengths of the sides of a closed plane figure.

The total distance from the outside of the closed figure is called the perimeter. Sum of all sides of a closed figure. The formula is: perimeter = sum of all sides

The units for the perimeter of a polygon remain the same as the units for each side. If the sides have different units, convert them to the same units and then find the perimeter.

Perimeter of a regular polygon

A regular polygon has all equal sides. So if the polygon has 'n' sides, add the same length 'n' times. Perimeter of regular polygon = (length of one side) × number of sides

Example: Perimeter of regular hexagon is 6 × length of side

Perimeter of irregular polygon

Total distance around polygon is. It can be found by summing all the sides of the polygon. Rectangle perimeter = 2( length + width)

To learn more about perimeter, refer:

https://brainly.com/question/397857

#SPJ4

the _____ is the sum of the lengths of the sides of a closed plane figure.

What does 1.022 represent in the expression?

What does 1.022 represent in the expression?

Answers

Because b > 1, the correct response in this situation would be: "1.022 is the growth factor for the GDP since 1950, and the GDP increases by a factor of 1.022 every year."

In this instance, we're assuming that we can use the following function to simulate the US GDP, or gross domestic product, in dollars:

GDP=11(1.0220)t

We can also see that the exponential model formula given by: governs this formula.

\(GDP = 11(1.0220)^{t\)

Where a denotes the starting sum, b the model's growth/decay rate, and t is the number of years since 1950.

The value of b in this instance is provided by:

b = 1.022

And when we calculated r as the growth rate, we obtained:

1.022 = 1 + r

r = 1.022 - 1

r = 0.022

Because b > 1, the correct response in this situation would be: "1.022 is the growth factor for the GDP since 1950, and the GDP increases by a factor of 1.022 every year."

To know more about GDP

https://brainly.com/question/15682765

#SPJ1

This element orients readers by previewing the structure of the report.
O Definitions of key terms
O Organization
O Sources and methods

Answers

The element that orients readers by previewing the structure of the report is "Organization."

Organizing a report effectively helps readers understand the flow of information and the logical structure of the content. By providing an overview of the organization, readers can anticipate the main sections, their sequence, and the connections between them.

The organization element typically includes headings, subheadings, and a clear hierarchy of information. It outlines the main sections and subsections of the report, indicating how they are related and how they contribute to the overall message or argument.

In addition to the organization element, the other options listed—Definitions of key terms and Sources and methods—also play important roles in a report. Definitions of key terms clarify terminology and provide a common understanding, while Sources and methods explain the sources of information and the methods used in the report's research or analysis. However, in the context of previewing the structure, the Organization element specifically serves this purpose.

to learn more about organization click here:brainly.com/question/12825206

#SPJ11


A parabola opening up or down has vertex (0, 0) and passes through (-6,-9).
Write its equation in vertex form.
Simplify any fractions

Answers

Answer:

the formula is 1.5x^2

Step-by-step explanation:

Since the vertex is 0,0 h and k are both 0

then you plug in the -6 and -9 to the equation

a(-6)=-9

3/2(x)^2

hope that answers your question

Question 3 of 10
What is the value of x?
75
37

Question 3 of 10What is the value of x?7537

Answers

X= 180-(75+37) = 68 is the answer

Find the measures of the interior angles of the triangle.

Find the measures of the interior angles of the triangle.

Answers

Answer:

see explanation

Step-by-step explanation:

the 3 interior angles of Δ ABC sum to 180°

sum the 3 angles and equate to 180

x - 44 + x + 48 = 180

2x + 4 = 180 ( subtract 4 from both sides )

2x = 176 ( divide both sides by 2 )

x = 88

Then

∠ A = 48°

∠ B = x = 88°

∠ C = x - 44 = 88 - 44 = 44°

From triangle sum theory a+b+c = 180

Susan buys a movie ticket for $12.50 and 3 buckets of popcorn that cost $14.20 each with her
$100. Which statement is true?

Answers

50$ i believe but a could be wrong

Answer: the answer is NO

Step-by-step explanation:

Khan academy

Conservationists have despaired over destruction of tropical rain forest by logging, clearing, and burning." These words begin a report on a statistical study of the effects of logging in Borneo. Here are data on the number of tree species in 12 unlogged forest plots and 9 similar plots logged 8 years earlier:

Col1 Unlogged 2218 222015121 13 13 1913 19 15

Col2 Logged 17 4 181418151510 12 Use the data to give a 90% confidence interval for the difference in mean number of species between unlogged and logged plots. Compute degrees of freedom using the conservative methoo. Interval: ________to__________.

Answers

Answer: -8.16 to 15.84

Step-by-step explanation: Confidence Interval is an interval in which we are a percentage sure the true mean is in the interval.

A confidence interval for a difference between two means and since sample 1 and sample 2 are under 30, will be

x1x2 ± t.Sp1n1+1n2

where

x₁ and x₂ are sample means

t is t-score

Sp is estimate of standard deviation

n₁ and n₂ are the sample numbers

The estimate of standard deviation is calculated as

Sp=(n11)s12+(n21)s22n1+n22

where

s₁ and s₂ are sample standard deviation of each sample

Degrees of freedom is:

df=n1+n22

df = 12 + 9 - 2

df = 19

Checking t-table, with 90% Confidence Interval and df = 19, t = 1.729.

The mean and standard deviation for 12 unlogged forest plots are 17.5 and 3.53, respectively.

The mean and standard deviation for 9 logged plots are 13.66 and 4.5, respectively.

Calculating estimate of standard deviaton:

Sp=(121)(3.53)2+(91)(4.5)212+92

Sp=299.0719

Sp= 15.74

The difference between means is

x1x2 = 17.5 - 13.66 = 3.84

Calculating the interval:

t.Sp1n1+1n2 = 1.729.15.74.112+19

t.Sp1n1+1n2 = 27.2121108

t.Sp1n1+1n2 = 27.210.194

t.Sp1n1+1n2 = 12

Then, interval for the difference in mean is 3.84 ± 12, which means the interval is between:

lower limit: 3.84 - 12 = -8.16

upper limit: 3.84 + 12 = 15.84

The interval is from -8.16 to 15.84.

Other Questions
What accounting book is used to capture changes to the trial balance According to the five-step model of the marketing process, a company should ________ before designing a customer-driven marketing strategy. Jim is choosing between two exercise routines.In Routine #1, he does only running, burning 15.5 calories per minute.In Routine #2, he burns 26 calories walking. He then runs at a rate that burns 10.3 calories per minute.For what amounts of time spent running will Routine #1 burn more calories than Routine #2?Use t for the number of minutes spent running, and solve your Inequality for t. The Schalaefer Law Firm promises to pay $4000.00 a month for office space from Waymeier Properties for their promise to provide the space and all utilities. This is an example of a ____ contract. A. Voidable B. Unenforceable C. Bilateral D. Unilateral what is the definition of protagonist? (19) In a school of 320 pupils. 0.625 are girlsand 0.3 of the boys have long hair. Howmany boys have short hair How many of the states had to agree for the Constitution to be changed? whats is the recursive equation?? The first 4 terms in the sequence are 3,6,12,24 HELPWhich element of a story is most clearly a motif?A. A bag of jewels that the characters try to stealB. A detailed description of a wheat field in fallC. A storm's arrival whenever there is conflictD. A detail that foreshadows what happens later When are sentence fragments used in stage directions?when the play is written for a very young audiencewhen the cast of characters includes just two characterswhen they appear between a characters name and the characters linewhen the action is more physical than mental at Smalltown University, is reading applications submitted by prospective students. The president of Smalltown University is weary about admitting too many domestic students and not enough international students. However, the applications are blinded so Jenny cannot see if an applicant is a domestic student or international student. Jenny is instructed by the president to admit exactly 14 applicants to the Department of Mathematics in a given year. Suppose that 55 domestic students and 45 international students applied to the Department of Mathematics at Smalltown University this year, and suppose that there is no difference in the qualifications of domestic and international students applying to Smalltown University. Let X represent the number of domestic applicants that Jenny selects this year. Calculate the mean, M. and standard deviation, o, of X. Please give the exact value for the mean and round your standard deviation to the nearest three decimal places. (X) = o(X) = why is a good experimental design more important than a true hypothesis please help me fill in the blank! What are the benefits of comparison?. Arc Length Formula:: Cx = degree measure of arcC-circumferenceDirections: Find each arc length. Round to the nearest hundredth.10. If EB = 15 cm, find the length of CD. 11. IF NR = 8 ft, find the length of NMP.DC12. IF VS = 12 m, find the length of UT.13. If JH = 21 in, fnd the length of KJG.12759DBS14. If FG = 27 yd, find the length of FED.15. If WS = 4.5 mm, find the length of TS.4780128317.62 the electrodermal response, or the electrical conductance of the skin, is called Describe why Dr. Martin Luther King, Jr. was an agent of historical change. Project management can be viewed as a set of interconnected processes where all plans are connected with each other. Based on what you have learned in the course a what is the connection between Scope management, Time Management. Cost Management, and Risk Management? How each of these factors influences each other? (2 marks b. How Scope Management and Risk Management impact each other? (2 marics) c. How Time Management would be impacted by Scope Management Find the value of 9y - 9 giving that -4y - 1 = 7. Simplify your answer as much as possible.9y - 9 = ? Regulations for annuity recommendations would apply when a consumer is at least what age?50 years old62 years old65 years old70 years old