Answer:copper,stainless steel,iron,diamond,oak,calk,air
Explanation:your metlas is your meterials that absorbs most heat'
Did cellular respiration occur in trial 3 with the yeast and sugar?
PLEASE HELP ITS DO RIGHT NOWW
Answer:
In summary, yeast is a single-celled fungus that uses cellular respiration, which converts glucose and oxygen into carbon dioxide and ATP. ... Aerobic respiration makes the most ATP, between 36 and 38. Fermentation is anaerobic respiration and happens without oxygen.
18. What is the density of a substance with a mass of 0.90 kg and a volume of 1.2 mL?
21. An oxygen tank in the lab has a pressure of 12 atm at 250C. If the pressure inside the gas tank exceeds 25 atm, the tank will explode. If a fire occurs in the lab, raising the temperature of the gas inside the cylinder to 398oC, will the tank explode?
Answer:
fffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff
Explanation:
Step 7: Put the Metal in the Water and Measure
Temperature Changes (Lead)
Measure the initial temperature of the water to the
nearest 0.1°C. Record in the data table.
Initial temperature of metal =
Initial temperature of water
Final temperature of both = [
27
DONE
26
25
24
23
Intro
Continue
AL
250 ml
=பா-©
200
150
100
1
27
O
°C
°C
answer 100,22.6,23.3,0.7, 76.6
The answer of temperature change is mentioned below
What is Temperature Change ?
The change in temperature is given by
ΔT=Final Temperature −Initial Temperature
Measurements of temperature
It is a measure of the degree of hotness or coldness of a body
To determine temperature changes,
the initial and final temperature of the iron and water is recorded.
For Iron
Iron at higher temperature is dipped in water
Water is at lower temperature so there will be change in temperature fo both
These data are recorded
Temperature change = Final temperature - Initial temperature.
a) Temperature change for metal = 200 - 100 = 100 0C
Temperature change for water = 22.5
Temperature change for both = 23.3
b) For water 0.7
For iron Metal 76.6
To know more about temperature change
https://brainly.com/question/19724978
#SPJ1
Answer: initial temp of metal: 100 C, initial temp of water 22.4, final temp of both 27.1
Explanation:
A homogeneous mixture is a solid, liquid, or gaseous mixture that has the same proportions of its components.
a. True
b. False
Answer:
true
Explanation:
It is because it appears uniformly in the eye
The quantity of mass of an object contained within its volume is a measure of
Sulfur trioxide reacts with water to form sulfuric acid according to the following reaction: SO₃ + H₂O → H₂SO₄ Given the atomic mass of hydrogen is 1 amu, the atomic mass of oxygen is 16 amu, and one molecule of sulfuric acid has a mass of 98 amu, what is the atomic mass of sulfur trioxide?
Explanation:
The atomic mass of sulfur trioxide can be calculated as follows:
1 molecule of sulfuric acid has a mass of 98 amu, and it is composed of 2 hydrogen atoms, 1 sulfur atom, and 4 oxygen atoms. So, the mass of hydrogen and oxygen atoms in 1 molecule of sulfuric acid is (2 * 1 amu) + (4 * 16 amu) = 34 amu.
Therefore, the mass of sulfur in 1 molecule of sulfuric acid is 98 amu - 34 amu = 64 amu.
Since 1 molecule of sulfuric acid is formed from 1 molecule of sulfur trioxide, the atomic mass of sulfur trioxide can be calculated as 64 amu.
Sulfur trioxide reacts with water to form sulfuric acid according to the following reaction: SO₃ + H₂O → H₂SO₄ Given the atomic mass of hydrogen is 1 amu, the atomic mass of oxygen is 16 amu, and one molecule of sulfuric acid has a mass of 98 amu, the atomic mass of sulfur trioxide is 80 amu.
According to the law of conservation of mass, in a reaction, atomic mass of the reactants will be equal to atomic mass of the products if the reaction is balanced and above reaction is balanced. Hence,
Mass of SO₃ + Mass of H₂O = Mass of H₂SO₄
x + 18 = 98
x = 80 amu = Mass of SO₃
Therefore, when Sulfur trioxide reacts with water to form sulfuric acid according to the following reaction: SO₃ + H₂O → H₂SO₄ Given the atomic mass of hydrogen is 1 amu, the atomic mass of oxygen is 16 amu, and one molecule of sulfuric acid has a mass of 98 amu, the atomic mass of sulfur trioxide is 80 amu.
Learn more about atomic mass, here:
https://brainly.com/question/17067547
#SPJ2
how many liters of O2 are needed to produce 5.62 g of SO2 in the following reaction? 4FeS2+11O2 ->2Fe2O3+8SO2
8moles of SO_2 need 11mol O_2
1mol need=11/8=1.4molO_2Moles of sO_2
\(\\ \rm\hookrightarrow \dfrac{5.62}{64}=0.1\)
So
Moles of O_2
1.4(0.1)=0.14molWe know
1mol at STP=22.4L1.4mol=0.14(22.4)=3.13L O_2What is the total number of moles of products formed when 1.20 moles of ammonia reacts? 4NH3+5O2 --> 4NO+6H2O
Explanation:
Step 1 - We need to rewrite the equation here:
4NH3+5O2 --> 4NO+6H2O
The ratio between ammonia (NH3) and the products are:
NH3 and NO:
4:4
NH3 and H2O:
6 H2O
So if we have 1.2 moles of ammonia:
1.2 moles of NH3 ---- x moles of NO
4 moles of NH3 ---- 4 moles of NO
x = 1.2 moles of NO
1.2 moles of NH3 --- x moles of H2O
4 moles of NH3 --- 6 moles of H2O
4x = 7.2
x = 7.2/4
x = 1.8 moles of H2O.
Answer: The total number of moles of products formed is 1.2 moles of NO and 1.8 moles of H2O.
Here are the other two options
what mass of glucose c6h12o6 would be required to prepare 5000 mL of a 0.215 M solution
Approximately 194.0 grams of glucose (C6H12O6) would be required to prepare a 5000 mL solution with a concentration of 0.215 M.
To determine the mass of glucose (C6H12O6) required to prepare a 0.215 M solution in 5000 mL, we need to use the formula:
Molarity (M) = moles of solute / volume of solution (in liters)
First, let's convert the volume of the solution from milliliters (mL) to liters (L):
5000 mL = 5000/1000 = 5 L
Now, we can rearrange the formula to solve for moles of solute:
moles of solute = Molarity (M) x volume of solution (L)
moles of solute = 0.215 M x 5 Lmoles of solute = 1.075 mol
Since glucose (C6H12O6) has a molar mass of approximately 180.16 g/mol, we can calculate the mass of glucose using the equation:
mass of solute = moles of solute x molar mass of solute
mass of glucose = 1.075 mol x 180.16 g/mol
mass of glucose = 194.0 g (rounded to three significant figures)
Therefore, approximately 194.0 grams of glucose (C6H12O6) would be required to prepare a 5000 mL solution with a concentration of 0.215 M. It's important to note that the molar mass of glucose used in this calculation may vary slightly depending on the level of precision required.
For more such questions on glucose visit:
https://brainly.com/question/397060
#SPJ8
Why did Rutherford choose alpha particles in his experiment?
............................................................................................................................
Answer:
............................................................................................................................
Explanation:
because ........................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................
the human population grew form 1 billion in the year 1800to blank billion in the year 200
The human population grew from 1 billion in the year 1800 to approximately 7.8 billion in the year 2021.
In the year 1800, the estimated global human population was around 1 billion. Over the next two centuries, significant advancements in technology, medicine, agriculture, and improved living conditions contributed to a rapid increase in population.
The growth rate of the human population began to accelerate in the 20th century. By the year 1927, the global population reached 2 billion. It took just 33 years for the population to double, reaching 4 billion in 1960. The population continued to grow at an unprecedented rate, with 6 billion people on Earth by the year 1999. As of 2021, the estimated global population stands at approximately 7.8 billion.
This remarkable growth in population can be attributed to several factors, including advancements in healthcare leading to reduced infant mortality rates, improved access to education and contraception, increased agricultural productivity, and overall socio-economic development.
It's important to note that population growth has not been uniform across all regions. Different countries and regions have experienced varying rates of population growth due to factors such as fertility rates, mortality rates, migration patterns, and government policies.
For more such questions on population visit:
https://brainly.com/question/30148263
#SPJ8
Which of the following items are made from renewable resources? Select the two correct answers. (1 point)
Responses
plastic fork
plastic fork
metal can
metal can
leather jacket
leather jacket
electronics
electronics
printer paper
A leather jacket and printer paper are examples of items that can be made from renewable resources, while plastic forks, metal cans, and electronics are not considered renewable due to their reliance on non-renewable materials and processes. Option C, E
The two correct answers that are made from renewable resources are:
C) Leather jacket: Leather is derived from animal hides, which are a byproduct of the meat industry. As long as there is a sustainable and responsible approach to animal farming, the production of leather can be considered renewable. The hides are obtained from animals that are raised for meat consumption, and their use in leather production helps reduce waste.
E) Printer paper: Printer paper can be made from various sources, including trees, bamboo, and recycled paper fibers. If the paper is sourced from sustainably managed forests or from fast-growing plants like bamboo, it can be considered renewable. Additionally, the use of recycled paper fibers reduces the demand for materials and promotes a more circular economy.
The other options, A) plastic fork, B) metal can, and D) electronics, are not made from renewable resources:
A) Plastic fork: Plastics are typically derived from fossil fuels, which are non-renewable resources. The production of plastic involves the extraction and processing of petroleum or natural gas, both of which are finite resources.
B) Metal can: Metal cans are predominantly made from aluminum or steel. While these metals can be recycled, their initial production requires the extraction of raw materials from the Earth, which is not a renewable process.
D) Electronics: Electronics are made from a wide range of materials, including metals, plastics, and various chemical compounds. The production of electronics involves the extraction of raw materials, many of which are non-renewable resources.
Option C and E.
For more such questions on renewable resources visit:
https://brainly.com/question/27734408
#SPJ8
The molar mass of Be is 9.01 g/mol.
How many atoms are in 18.02 g of Be?
A. 2.697 x 10-²² atoms Be
B. 162.4 atoms Be
C. 1.085 x 10²5 atoms Be
D. 1.204 x 1024 atoms Be
Help
Skip
The molar mass of Be is 9.01 g/mol. Atoms in 18.02 g of Be is : D.) 1.204 x 1024 atoms Be
What is molar mass?The mass in grams of one mole of the compound is known as molar mass of a substance.
As moles of Be = mass of Be / molar mass of Be
moles of Be = 18.02 g / 9.01 g/mol
moles of Be = 2 mol
number of atoms of Be = moles of Be x Avogadro's number
number of atoms of Be = 2 mol x 6.022 x 10²³
So, number of atoms of Be = 1.204 x 10²⁴
Therefore, the answer is option D, 1.204 x 10²⁴ atoms Be.
To know more about molar mass, refer
https://brainly.com/question/837939
#SPJ1
which statement is true in electrophilic aromatic substitution no meta directors have a nitrogen atom directly attached to the ring
The statement is true in electrophilic aromatic substitution is no meta directors have the nonbonding electrons on the atom that is directly attached to ring.
The electrophilic aromatic substitution reaction is an organic reaction. In this the electrophile replace an atom that is attached to an aromatic ring. The types of electrophilic aromatic substitution reactions are :
Electrophilic aromatic halogenation reactionsAromatic nitration reactionsAromatic sulfonation reactionsFriedel crafts alkylation reactionFriedel crafts acylation reactionThus, no meta directors have the nonbonding electrons on the atom that is directly attached to ring in the electrophilic aromatic substitution reaction. The substituents present on aromatic ring influence the reactivity.
To learn more aromatic substitution here
https://brainly.com/question/14777217
#SPJ4
7. Which object would be the least dense in a tub of
water?
A. Golf ball
B. Glass marble
C. Rubber ball
D. Beach ball
Prior to the spill, the mining waste holding pond was intended to temporarily hold water to allow time for particles to settle and the pH to be adjusted. Suppose the pond was used as intended, assuming no flow in or out. Cyanide (a common chemical used to extract gold from ore) is present in the pond at a concentration of 0.5 mg/L. Cyanide has a decay rate of 0.05/hr. What would the cyanide concentration be after 1 day of holding the water in the pond
Answer:
0.15 mg/L
Explanation:
Decay is a first order process so;
ln[A] = ln[A]o - kt
[A]o = initial concentration = 0.5 mg/L
[A] = concentration at time t
t = time taken = 1 day = 24 hours
k = decay constant = 0.05/hr
ln[A] = ln(0.5) - 0.05(24)
ln[A] = -0.693 - 1.2
ln[A] = -1.893
e^ln[A] = e^-1.893
[A] = 0.15 mg/L
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Part D What evidence can be used to support the fact that oxidation, reduction, or both took place in test tube 5?
Copper atoms (Cu) were created by reducing copper ions (Cu2+). An illustration of a reduction reaction is this. (Mg2+).To create Mg2+ ions, Mg atoms lost their electrons. An example of an oxidation reaction is this.
Oxidation and reduction occurred in test tube 5. Here is the equation for the reaction that took place:MgSO4 (aq) + Cu (s) CuSO4 (aq) + MgCuSO4's blue hue was neutralised to a solid copper hue. Copper atoms (Cu) were created by reducing copper ions (Cu2+). An illustration of a reduction reaction is this. Cu atoms are created when Cu2+ gains electrons. Due to the presence of magnesium ions (Mg2+), the solution was greenish-yellow.To create Mg2+ ions, Mg atoms lost their electrons. An example of an oxidation reaction is this. Two electrons were lost by the magnesium atom, leaving two electrons behind.
As a result, test tube 5 experienced both oxidation and reduction.It is possible to prove that oxidation, reduction, or both took place through the reaction's electron transfer and colour changes. A reduction reaction was seen when copper ions transformed into copper atoms. An oxidation reaction was evident when magnesium atoms transformed into magnesium ions.
For more question on reaction
https://brainly.com/question/11231920
#SPJ8
What is meant by functional group in an organic compound?
Functional group for
A) keton
B) acid anhydride
C) aldehyde
D) amide
C) alcohol
Answer:
i THINK the answer to this is C) aldehyde
Answer:
The answer is C, the guy above is correct.
Explanation:
base your answers to questions 63 through 65 on the information below and on your knowledge of chemistry. tritium, hydrogen-3, is a radioisotope.
Answer:
63. What is the atomic number of tritium?
The atomic number of tritium is 1, as it is a isotope of hydrogen, which has an atomic number of 1.
64. How is tritium typically produced?
Tritium is typically produced through nuclear reactions, such as those in a nuclear reactor or during nuclear weapons testing. It can also be produced in small amounts through the interaction of cosmic rays with the Earth's atmosphere.
65. What are some of the applications of tritium?
Tritium has a number of applications, including as a radioactive tracer in medical imaging and research, and as a fuel for nuclear fusion reactions. It can also be used in self-powered lighting devices, such as exit signs and emergency lighting. Additionally, Tritium is used to produce the radioactive isotope Helium-3, which is used in nuclear magnetic resonance imaging (MRI) and in neutron detection.
The following molecular equation represents the reaction that occurs when aqueous solutions of lead(II) nitrate and barium bromide are combined.
Pb(NO2)3(aq)+BaBr2(aq) = PbBr2(s)+Ba(NO3)2(aq)
Write the balanced net ionic equation for the reaction.
The balanced net ionic equation for the reaction that occurs when aqueous solutions of lead(II) nitrate and barium bromide is,
Pb2+ (aq.) + 2Br-(aq.) -------------> PbBr2
Lead(II) nitrate, Pb(NO3)2 and barium bromide, BaBr2, are soluble in aqueous solution. This which means that they dissociate completely to form cations and anions when dissolved in water.
Pb(NO2)3 (aq.) + BaBr2(aq.) -----------> PbBr2 (s) + Ba(NO3)2 (aq.)
Balanced net ionic equation for the reaction is the chemical equation that shows only those elements, compounds, and ions that are directly involved in the chemical reaction. Net ionic equations must be balanced by both mass and charge. Balancing by mass means ensuring that there are equal masses of each element on the product and reactant sides. Balancing by charge means making sure that the overall charge is the same on both sides of the equation.
To learn more about Net ionic equation please visit:
https://brainly.com/question/19705645
#SPJ4
Say if each of the following is a Brownsted Lorry acid or base or both i.e. amphoterica) H2O b) OH- c) H3O + d) NH3 e) NH4 + f) NH2 g) NO3- h) CO3 2- i) HBr j) HCN
First, a bit of theory:
Brønsted-Lowry Acids and Bases
Like water, many molecules and ions may either gain or lose a proton under the appropriate conditions. Such species are said to be amphiprotic.
If the molecules or ions gain protons, they are bases.
if they lose protons, we have an acid.
---------------------------------------------------------------------------------
a) H2O is both, acid and base. Amphoteric
b) OH- is a base, gains.
c) H3O + is an acid, loses.
d) NH3 is a base, gains.
e) NH4 + is an acid, loses.
f) NH2- is a base, gains.
g) NO3- is a base, gains.
h) CO3 2- is a base, gains.
i) HBr is an acid, loses.
j) HCN is an acid, loses.
Why is fusion only possible with small nuclei?
Answer:
The measurement of the mass of nuclei has revealed that the mass of the constituent protons and neutrons is more than the mass of the nucleus
Explanation:
Hope this helps ya have a nice day
When fossil fuels are burned, they emit carbon dioxide into the atmosphere. After centuries of large amounts of carbon dioxide accumulating in the atmosphere, the earth's temperature increases by 1°C.
What is the connection between increasing carbon dioxide and increasing temperature?
The connection between increasing carbon dioxide and increasing temperature is: carbon dioxide absorbs heat from the sun and traps it in earth's atmosphere. Since the heat cannot escape, it causes the earth's temperature to increase which is the first option.
When carbon dioxide (CO₂) and other greenhouse gases are present in the atmosphere, they act as a natural blanket, allowing sunlight (solar radiation) to pass through and reach the Earth's surface. Some of this solar radiation is absorbed by the Earth's surface, while the rest is reflected back towards space as heat (infrared radiation). However, greenhouse gases like carbon dioxide have the property of absorbing and re-emitting infrared radiation.
Learn more about fossil fuel here
https://brainly.com/question/2029072
#SPJ1
Chlorophyll is found in
A. neither plant
nor animal cells.
B. animal cells.
C. plant cells.
D. plant and animal cells.
Answer:
Only plant cells
Explanation:
This organelle helps plants photosynthesize. Humans do not do that.
Nitrogen N2 gas and hydrogen H2 gas react to form ammonia NH3 gas. Suppose you have 2.0 mol of N2 and 1.0 mol of H2 in a reactor.
Calculate the largest amount of NH3 that could be produced.
Round your answer to the nearest 0.1 mol.
The largest amount of NH3 that could be produced is 4.0 mol (rounded to the nearest 0.1 mol).
To determine the largest amount of NH3 that can be produced from the given amounts of N2 and H2, we need to consider the stoichiometry of the balanced chemical equation:
N2 + 3H2 → 2NH3
According to the balanced equation, 1 mole of N2 reacts with 3 moles of H2 to produce 2 moles of NH3.
Given:
2.0 mol of N2
1.0 mol of H2
Based on the stoichiometry of the equation, we can determine the limiting reactant, which is the reactant that will be completely consumed first and will determine the maximum amount of product that can be formed.
To do this, we compare the moles of N2 and H2 to the stoichiometric ratio:
N2: 2.0 mol
H2: 1.0 mol × (3 mol of H2 / 1 mol of N2) = 3.0 mol
Since the ratio of N2 to H2 is 1:3, we can see that N2 is the limiting reactant because we have fewer moles of N2 than the stoichiometric requirement.
Now we can determine the maximum amount of NH3 that can be produced from the limiting reactant, N2. Since 1 mole of N2 reacts to produce 2 moles of NH3, we can calculate:
Maximum moles of NH3 = 2.0 mol of N2 × (2 mol of NH3 / 1 mol of N2) = 4.0 mol of NH3
For more such questions on NH3 visit:
https://brainly.com/question/14854495
#SPJ8
What would a student carrying out a titration use a to transfer 25 mL of sodium hydroxide into a conical flask?
a) conical flask
b) burette
c) measuring cylinder
d) pipette
62 minutes remaining4 OF 15 QUESTIONS REMAIN1 PoirQuestion 7The G base of a DNA molecule has the molecular formula C₁0H12O6N5P. Which two elements in the given formula exhibit showsimilar chemical and physical properties?A) N and PO and PN and O
Answer
A) N and P
Explanation
Nitrogen and phosphorous are part of the same 'family' on the periodic table, group 15, also called the nitrogen group. Since phosphorus is just below nitrogen, we can expect nitrogen and phosphorus to have some similar properties. They are non-metals and have similar properties when making compounds.