Answer:
yep
Explanation:
that why I have someone else post questions for me. But its a good incentive to help others to help you to help me to you to help others.
observe the increase in temperature every 60 seconds for 300 seconds
final temp of metal -
initial temp of water -
final temp of both -
in celsius
The final temperature of the metal is 1.88°C, while the final temperature of water is 50°C. The final temperature of both is 25.94°C (average of 1.88°C and 50°C).
To answer the question, it is necessary to use the formula: Q = m * c * ΔT. The formula is used to calculate the amount of heat gained or lost by a substance. Here, the heat lost by the metal will be equal to the heat gained by water. Let's use the following terms in our answer:
- ΔT: change in temperature
- m: mass of substance
- c: specific heat capacity
Initially, the metal has a higher temperature, while the water has a lower temperature. Heat energy will flow from the metal to the water until both substances reach a common temperature.
The rate of heat transfer will be directly proportional to the difference in temperature between the two substances. To observe the increase in temperature every 60 seconds for 300 seconds, we will make a table with time intervals and corresponding temperature readings.
Finally, we can use the formula to find the final temperature of the metal and water. Let's assume that the mass of water and metal are equal, and both are 100 grams. The specific heat capacity of water is 4.18 J/g °C, while the specific heat capacity of the metal is 0.91 J/g °C.
Heat lost by metal = Heat gained by waterm * c * ΔT(metal) = m * c * ΔT(water)100 * 0.91 * (50 - T) = 100 * 4.18 * (T - 20) 4550 - 91T = 418T - 8364.37T = 83.64T = 1.88°C
Therefore, the final temperature of the metal is 1.88°C, while the final temperature of water is 50°C. The final temperature of both is 25.94°C (average of 1.88°C and 50°C).
For more such question on temperature visit:
https://brainly.com/question/4735135
#SPJ8
what is the ion concentration of 0.05 M Cacl2?
The ion concentration of 0.05 M \(CaCl_2\) would be 0.05 mol Ca ions and 0.1 mol Cl ions respectively.
Concentration of ions\(CaCl_2\) contains two ions according to the following equations:
\(CaCl_2 -- > Ca^{2+} + 2Cl^-\)
1 mole 1 mole 2 moles
0.05 M CaCl2 contains 0.05 moles of the solute in 1 liter of the solution. Thus, the equivalent mole of Ca ion would be 0.05 moles while that of Cl ion would be 0.10 mole (0.05x2).
Concentration of Ca ions = 0.05 moles
Concentration of Cl ions = 0.05 x 2 = 0.010 moles
In other words, the ion concentrations of 0.05 M CaCl2 would be 0.05 moles of Ca ions and 0.10 moles of Cl ions.
More on ion concentrations can be found here: https://brainly.com/question/12726151
#SPJ1
Which of the following combinations will result in a precipitate, according to solubility rules?
Potassium iodide (KI) and silver nitrate (AgNO3)
Ammonium chloride (NH4Cl) and sodium hydroxide (NaOH)
Sodium nitrate (Na2CrO4) and barium chloride (BaCl2)
Calcium sulfate (CaSO4) and sodium carbonate (Na2CO3)
Silver nitrate, sodium hydroxide, ammonium chloride, and potassium iodide (KI, AgNO3, NH4Cl) (NaOH).
What does chloride in a blood test indicate?One of your blood's electrolytes is chloride. Chloride blood tests verify that you have the right amounts of chloride within your blood for good health. Chloride levels in the blood can be abnormal for a variety of reasons, including dehydration, vomiting, and certain medical diseases.
What does a low chloride blood test mean?A measurement of a chloride concentration is the blood chloride value. Specifically, the number of milliequivalents of chloride per liter. Hypochloremia, then, is a condition in which your blood chloride concentration is below normal. Hyperchloremia is the medical term for having excessive levels of chloride within your blood.
To know more about chloride visit:
https://brainly.com/question/13211879
#SPJ1
A student carried out an investigation to discover the effect of a new factory on a wetland ecosystem. The results of the investigation are in the table. What can be concluded from the results of the investigation? The factory had a negative effect on all the populations in the ecosystem. The factory had a negative effect on the algae and a positive effect on the shellfish and crab populations. The factory had a positive effect on all the populations in the ecosystem. The factory had a positive effect on the algae and a negative effect on the shellfish and crab populations.
The factory had a negative effect on all the populations in the ecosystem. This is the effect of a new factory on a wetland ecosystem. Therefore, the correct option is option A.
A wetland is a composite ecosystem that also contains ecosystems related to hydrology, soil, vegetation, or biology. The rate of urbanisation in China's national economic growth process is now rising quickly, so by the end of 2021, the country's resident population will have an urbanisation rate of 64.72%. The factory had a negative effect on all the populations in the ecosystem. This is the effect of a new factory on a wetland ecosystem.
Therefore, the correct option is option A.
To know more about wetland ecosystem, here:
https://brainly.com/question/29987463
#SPJ1
16. Given the unbalanced equation:
_Al + CuSO4 → _A1,(SO2), + --Cu
When the equation is balanced using
the smallest whole-number coefficients,
what is the coefficient of AI?
(1) 1 (2) 2 (3) 3
(4) 4
Explanation:
Consider matrix A.
What is the inverse of A? Fill in the missing elements in the matrixs.Consider matrix A.
What is the inverse of A? Fill in the missing elements in the matrixs.
(2) 2.
Explanation:
2Al + 3CuSO4 → Al2(SO4)3 + 3Cu
Hence, now yet it's balanced chemical equation.
Suppose a 250.mL flask is filled with 1.1mol of Br2 , 1.8mol of OCl2 and 0.50mol of BrOCl . The following reaction becomes possible: +Br2gOCl2g +BrOClgBrClg The equilibrium constant K for this reaction is 3.38 at the temperature of the flask. Calculate the equilibrium molarity of OCl2 . Round your answer to two decimal places.
I lil one nice to meet you and how is your day
Stamples of heterogeneous equilibria. FeO(s) + CO(g) = Fe(s) + CO₂(g) II. H₂(g) L₂(g) = 2HI(g) III. CO₂(g) + C(s) = 2CO(g) IV. N₂(g) 3H₂(g) + 2NH3(g) Identify I.
An example of heterogeneous equilibrium is:
I. FeO(s) + CO(g) ⇌ Fe(s) + CO₂(g)What is heterogeneous equilibrium?Heterogeneous equilibrium refers to an equilibrium state in a chemical reaction where the reactants and products exist in different physical states or phases. It occurs when substances in different phases, such as solids, liquids, and gases, are involved in a chemical reaction.
Considering the given equations:
The equation I: FeO(s) + CO(g) ⇌ Fe(s) + CO₂(g) represents a heterogeneous equilibrium.
This is because the reactants and products involve different phases (solid and gas). FeO is a solid (s), CO is a gas (g), Fe is a solid (s), and CO₂ is a gas (g). The reaction involves the conversion of a solid and a gas to another solid and a gas, and the equilibrium is established between these different phases.
Learn more about heterogenous equilibrium at: https://brainly.com/question/25257772
#SPJ1
What is the mass of 1.0 × 10^9 molecules of aspartame?
Answer:
294.3 g/mol b.
The mass of 1.0*10^9 molecules of aspartame is 2.943*10^11 g/mol
ASPARTAME
Aspartame is used as an artificial non-saccharide sweetener 200 times sweeter than sucrose, and is commonly used as a sugar substitute in foods and beverages.
CALCULATION
mass of one molecule of aspartame = 294.3g/mol
mass of 1.0*10^9 molecules of aspartame =294.3*(1.0*10^9) g/mol
=2.943*10^11 g/mol
refer https://brainly.com/question/25225559
#SPJ2
Is salt more or less dense than water?
Answer:
less dense
Explanation:
because when u put it in it sinks
Answer:
salt is more denser than water.
Explanation:
it makes the mass of water denser.
Balance the given equations by inserting the appropriate coefficients.
chemical equation=p4+O2
The reaction equation that is balanced is obtained as; \(P_{4} + 5O_{2} ----- > 2P_{2} O_{5}\)
What is reaction equation?We know that it is common to use a chemicals reaction equation to show what is going on in a reaction system. The chemical reaction equation would include the symbols of the elements that are combined in the reaction equation.
The first rule that must be observed when we are writing a balanced reaction equation is that the number of atoms of each element on the reactant side must be the same as the number of atoms of the same element on the left hand side. This is what we call an atom count. If the atom count is not complete it then follows that the reaction equation is not balanced as written
Having said this let us now attempt to write the balanced reaction equation between phosphorus and oxygen molecules which are both poly atomic.
The balanced reaction equation is; \(P_{4} + 5O_{2} ----- > 2P_{2} O_{5}\)
Learn more about reaction equation:https://brainly.com/question/3588292
#SPJ1
In which of the following compounds does iron have the lowest oxidation number?FeOHB. All are equalC. Fe(OH)3D. Fe(OH)2
Answer:
A. FeOH
Explanation:
To determine the oxidation number of iron in each compound it is important to consider that the total charge of OH is -1, and then we have to multiply it by the corresponding subscript:
Fe in FeOH has an oxidation number of +1.
Fe in Fe(OH)3 has an oxidation number of +3.
Fe in Fe(OH)2 has an oxidation number of +2.
So, iron has the lowest oxidation number in FeOH.
Michelle is trying to find the average atomic mass of a sample of an unknown
element. She finds that her sample contains 59.34% of an isotope with a mass of
113.6459, while the rest of the sample is an isotope with a mass of 115.8488. What
is the average atomic mass of her sample? Please round your answer to 0.01 amu.
The average atomic mass of her sample is 114.54 amu
Let the 1st isotope be A
Let the 2nd isotope be B
From the question given above, the following data were obtained:
Abundance of isotope A (A%) = 59.34% Mass of isotope A = 113.6459 amuMass of isotope B = 115.8488 amuAbundance of isotope B (B%) = 100 – 59.34 = 40.66%Average atomic mass =?The average atomic mass of the sample can be obtained as follow:
\(Average \: atomic \: mass \: = \frac{mass \: of \: A \times A\%}{100} + \frac{mass \: of \: B \times B\%}{100} \\ \\ Average \: atomic \: mass \: = \frac{113.6459\times 59.34}{100} + \frac{115.8488\times 40.66}{100} \\ \\ Average \: atomic \: mass \: = 114.54 \: amu \\ \\ \)
Thus, the average atomic mass of the sample is 114.54 amu
Learn more about isotope: https://brainly.com/question/25868336
This type of equation is a what reaction?
Answer:
Decomposition
Explanation:
H2CO3 Breaks down to H2O and CO2
Convert a length of 22.0 m to inches
Answer:
866.142 inches
Explanation:
By formula
HQ5.40
Homework Answered Due Today, 11:59 PM
The reaction 3H₂(g) + N₂(g) → 2NH3(g) has an enthalpy of reaction of -92.6 kJ/mol. If 1 g of hydrogen and 2 g of nitrogen are
reacted, how much heat is produced (kJ)?
The amount of heat energy produced when 1 g of hydrogen and 2 g of nitrogen are reacted, is -6.61 KJ
How do i determine the heat energy produced?First, we shall obtain the limiting reactant. Details below:
3H₂ + N₂ -> 2NH₃
Molar mass of N₂ = 28 g/molMass of N₂ from the balanced equation = 1 × 28 = 28 g Molar mass of H₂ = 2 g/molMass of H₂ from the balanced equation = 3 × 2 = 6 gFrom the balanced equation above,
28 g of N₂ reacted with 6 g of H₂
Therefore,
2 g of N₂ will react with = (2 × 6) / 28 = 0.43 g of H₂
We can see that only 0.43 g of H₂ is needed in the reaction.
Thus, the limiting reactant is N₂
Finally, we the amount of heat energy produced. Details below:
3H₂ + N₂ -> 2NH₃ ΔH = -92.6 KJ
Molar mass of N₂ = 28 g/molMass of N₂ from the balanced equation = 1 × 28 = 28 gFrom the balanced equation above,
When 28 grams of N₂ reacted, -92.6 KJ of heat energy were produced.
Therefore,
When 2 grams of N₂ will react to produce = (2 × -92.6) / 28 = -6.61 KJ
Thus the heat energy produced from the reaction is -6.61 KJ
Learn more about heat energy:
https://brainly.com/question/31429264
#SPJ1
Determine the mass of the following samples
3 moles of Mg
4.2 moles of NaCI
Answer:
See below
Explanation:
From periodic chart
Mg = 24.305 gm per mole
24.305 * 3 = 72.915 gm
Na = 22.989
Cl = 35.45 summed = 58.439 gm per mole
58.439 * 4.2 = 245.4438 gm
The store paid 4.50 for a book and sold it for $7.65.what is the profit as a percent of the cost to the store? A. 3. 15% b. 58.8% c. 70% d. 315%
Answer: This would be C.) 70%
Explanation:
Which of the following atoms is the smallest?
Be
Ne
O
Li
B
Answer:
Li
Explanation:
The element, Neon (Ne), is the smallest among the given elements
From the question,
We are to determine which of the given elements is the smallest.
The given elements are
Be - Beryllium
Ne - Neon
O - Oxygen
Li - Lithium
B - Boron
From the periodic table, we can observe that all of the given elements belong to period 2.
Using the trend of atomic size on the periodic table,
We know that, atomic size decreases across the period.
This means, the atomic sizes of the elements will decrease in the order
Li > Be > B > O > Ne
Hence, the element, Neon (Ne), is the smallest among the given elements
Learn more here: https://brainly.com/question/16153450
Solve the equation 5m+4=7m+6
How many grams of the excess reactant remain after the limiting reactant is completely consumed? Express your answer in grams to three significant figures.
The question is incomplete, the complete question is;
One of the steps in the commercial process for converting ammonia to nitric acid is the conversion of NH3 to NO How many grams of NO and of H20 form? Enter your answers numerically separated by a comma. 4NH3(g) +502(g)------->4NO(g)+6H2O(g)
In a certain experiment, 1.10 g of NH3 reacts with 2.02 g of O2. How many grams of the excess reactant remain after the limiting reactant is completely consumed? Express your answer in grams to three significant figures.
Answer:
Mass of excess ammonia 0.034 g of ammonia
Mass of water formed= 1.37g
Mass of NO formed = 1.50g
Explanation:
The limiting reactant is the reactant that yields the least number of moles of product.
For NH3, molar mass of ammonia = 17g mol-1
Number of moles of ammonia reacted= 1.10g/17 gmol-1 = 0.065 moles of ammonia
According to the reaction equation;
4 moles of ammonia yields 4 moles of NO
Hence 0.065 moles of ammonia will yield 0.065 ×4/4 = 0.065 moles of NO
For oxygen, molar mass of oxygen gas = 32gmol-1
Number of moles of oxygen gas= 2.02g/32gmol-1 = 0.063 moles of oxygen
From the reaction equation;
5 moles of oxygen gas yields 4 moles of NO
0.063 moles of oxygen will yield 0.063 ×4 /5 = 0.050 moles of NO
Hence oxygen is the limiting reactant and ammonia is the excess reactant.
Amount of excess ammonia = Amount of ammonia - amount of oxygen
Amount of excess ammonia= 0.065-0.063= 2×10^-3 moles
Mass of excess ammonia = 2×10^-3 moles × 17 gmol-1 = 0.034 g of ammonia
Mass of NO formed is obtained from the limiting reactant. Since molar mass of is 30gmol-1. Then mass of NO formed = 0.050 moles of NO × 30gmol-1 = 1.50 g of NO
For water;
5 moles of oxygen yields 6 moles of water
Hence 0.063 moles of oxygen yields 0.063 × 6/5 = 0.076 moles of water
Molar mass of water = 18gmol-1
Hence mass of water = 0.076 moles × 18gmol-1 = 1.37g of water
Question 10 of 35
The graph shows the change in temperature of a sample
of water in a closed system as thermal energy is added
over time.
Temperature (°C)
150°C
100°C.
50°C-
g
0°C-
-50°C
10
20 30 40 50
Time (min)
What happens to the temperature of the water when it begins to melt?
OA The temperature remains at 100°C until the change of state is
complete
B. The temperature continues to increase during the change of state
C. The temperature continues to decrease during the change of
state.
OD. The temperature remains at 0°C until the change of state is
complete.
Answer:
D. The temperature remains at 0°C until the change of state is complete.
A sample from one of Earth's oceans has a salinity of 34. What is the concentration of dissolved salts in this sample of seawater when expressed in ppmppm
Answer:
Concentration of dissolved salts = 34,038.76 ppm
Explanation:
Given:
Salinity of ocean water = 34
Find:
Concentration of dissolved salts
Computation:
Salinity of ocean water = 34 g/l
1g/l = 1001.14 ppm
Concentration of dissolved salts = 1001.14 ppm x 34
Concentration of dissolved salts = 34,038.76 ppm
which property is least helpful in identifying a sample of matter? A. melting point B. Volume. C. Reactivity. D. Boiling point
Answer:
which property is least helpful in identifying a sample of matter is (B) VOLUME
Explanation:
volume depend on the amount of substance present and are not useful in the identification of a sample of matter. volume is an extensive property so it is not useful identifying the sample of matter.
In the barium chloride laboratory activity, what change occurred in the physical appearance of the barium chloride during the heating process?
A. Barium chloride changed from sparkly white to dull white.
B. Barium chloride changed from dull white to sparkly white.
C. Barium chloride changed from sparkly yellow to dull yellow.
D. Barium chloride changed from dull yellow to sparkly yellow.
Barium chloride turned from sparkly white into dull white during the heating process.
Barium chloride: What is it?An inorganic substance with the formula BaCl2 is barium chloride. It is among the most popular barium salts that dissolve in water. Like the majority of some of the other water-soluble barium salts, is also white, extremely hazardous, and gives flames a yellow-green tint.
What results from consuming barium chloride?Among the most common barium salts is barium chloride. Bacl2 is hygroscopic and soluble in water. Deep hypokalemia, generalized muscle weakness, and eventually paralysis of the limbs and breathing muscles can occur within 1 to 4 hours of consumption.
To know more about barium chloride visit :
https://brainly.com/question/2572464
#SPJ1
Sodium chloride can be used to preserve meat because
Answer:
Salt is effective as a preservative because it reduces the water activity of foods. .
Calculate the percent dissociation of acetic acid (CH,CO,H) in a 0.60 mM aqueous solution of the stuff. You may find some useful data in the ALEKS Data resource. Round your answer to 2 significant digits. 1% x10 Х ?
Previous question
The percent dissociation of acetic acid (CH,CO,H) in a 0.60 mM aqueous solution is 98.38%.
When 0.60 mM of acetic acid (CH3COOH) is dissolved in water, it dissociates according to the following equation:
CH3COOH(aq) ↔ H+(aq) + CH3COO-(aq)
The percent dissociation of acetic acid (CH3COOH) in the aqueous solution is calculated using the following equation:
% dissociation = [H+]/[CH3COOH] × 100
where [H+] is the concentration of the hydrogen ion and [CH3COOH] is the concentration of the acetic acid.
1. To calculate the concentration of the hydrogen ion in the solution, we need to use the equilibrium constant expression for the dissociation of acetic acid, which is:
Ka = [H+][CH3COO-]/[CH3COOH]
where Ka is the acid dissociation constant for acetic acid.
2. To calculate the concentration of the hydrogen ion in the solution, we need to use the quadratic formula, since the dissociation of acetic acid is incomplete:
% dissociation = (1 - α) × 100
where α is the degree of dissociation of acetic acid.
Since α is small, we can assume that the change in the concentration of acetic acid is negligible.
Thus,[H+] = α[CH3COOH]
3. Substituting the values, we get:
Ka = [H+][CH3COO-]/[CH3COOH][H+] = Ka × [CH3COOH]/[CH3COO-]α = [H+]/[CH3COOH] = Ka × [CH3COOH]/([CH3COOH] + [CH3COO-])α
= (1.74 × 10-5) × (0.60 × 10-3)/(0.60 × 10-3 + 0.64 × 10-3)α
= 0.0162% dissociation
= (1 - α) × 100% dissociation
= (1 - 0.0162) × 100% dissociation
= 98.38%
The percent dissociation of acetic acid (CH3COOH) in the aqueous solution is 98.38%.
For more such questions on dissociation , Visit:
https://brainly.com/question/9396848
#SPJ11
Calculate the amount in grams in 0.52600 moles of vanadium.
Answer:
26.795229
Explanation:
This is how much it is
The average kinetic energy of the molecules in a gas sample depends only on the temperature, . However, given the same kinetic energies, a lighter molecule will move faster than a heavier molecule, as shown in the equation for rms speed
rms speed=3ℳ⎯⎯⎯⎯⎯⎯⎯⎯⎯√
where =8.314 J/(mol⋅K) and ℳ is molar mass in kilograms per mole. Note that a joule is the same as a kilogram‑meter squared per second squared (kg·m2/s2).
What is the rms speed of Cl2 molecules at 413 K?
Answer:
12.1 m/s
Explanation:
Step 1: Given data
Molar mass of chlorine (M): 70.9 g/molIdeal gas constant (R): 8.314 J/(mol⋅K)Absolute temperature (T): 413 KStep 2: Calculate the root-mean-square speed of chlorine molecules
We will use the following expression.
rms-speed = √(3 × R × T/ M)
rms-speed = √(3 × 8.314 J/(mol⋅K) × 413 K/ 70.9 g/mol)
rms-speed = 12.1 m/s
Which of these reservoirs contains the most water?
Answer:
Glaciers
Explanation:
Reservoirs refers to paces where water are stored. The largest water reservoir on earth are the oceans which contain about 97% of all the water on the earth.
The next highest reservoir are the glaciers or the polar ice caps. These hold quite an enormous amount of the water found on earth.
Surface and other fresh water only account for about 1.2% of all the surface water on earth.Ground water accounts for a very minute percentage of the water found on earth.
what is the best way to learn and understand high school chemstry?
Answer:
Firstly, try to Go through your chapter and pay attention to main keywords.
secondly try to watch 'Uube' videos related to specific topic instead of chapter and pay attention to it closely and watch it with a keen interest.
Discuss topics that you find harder with your friends or peer group members, Because you learn faster when you study with the people of your age.
Answer:
i think the best way to learn chemistry is study over things that involve it
Explanation: