ni2 and o2- have ionic radii of 0.069 and 0.140 nm, respectively. calculate the likely coordination number

Answers

Answer 1

Here using the radius ratio rule

Therefore ,

RA+RB  = 0.0690.140

RA+RB = 0.49

Hence coordination number is  0.49.

What is Radius Ratio Rule?

Radius Ratio is the ratio of smaller ionic radius (cation) to bigger ionic radius (cation) (anion). Radius ration = rs/rl.

What is its significance?

The radius ratio rule aids in determining the coordination number of ions in a binary ionic compound. <br>It is used to predict the crystal structure of a binary ionic molecule.

Hence  0.49 is a correct answer.

To know more about Radius Ratio Rule follow link

https://brainly.com/question/10232398

#SPJ4


Related Questions

How can you cause a physical change?

ill give 10 points

Answers

examples
crushing a can
melting an ice cube
boiling water
mixing salt and water
breaking a glass
dissolving sugar and water
shredding paper
chopping wood

How many atoms are in .35 mol of water?

Answers

2.91 is the amount of atoms

based on the structures of h3po2(l), h3po3(l), and h3po4(l), determine the number of ionizable protons (acidic hydrogen atoms) per formula unit.

Answers

Answer:

H3PO2 is monoprotic as the structure 1 OH group

H3PO3 is diprotic as the structure  has 2 OH groups

H3PO4 is triprotic as the structure has 3 OH groups

Explanation:

H3PO2 has 1 ionizable proton, H3PO3 has 2 ionizable protons, and H3PO4 has 3 ionizable protons per formula unit.

1. H3PO2(l): Hypophosphorous acid
Structure: H-P(OH)2
Ionizable protons: 1
Explanation: In this structure, there is only one acidic hydrogen atom directly bonded to the phosphorus atom, which can be ionized to form H+ ion.

2. H3PO3(l): Phosphorous acid
Structure: H2P(OH)O
Ionizable protons: 2
Explanation: In this structure, there are two acidic hydrogen atoms directly bonded to the phosphorus atom. Both can be ionized to form H+ ions.

3. H3PO4(l): Phosphoric acid
Structure: H3PO4
Ionizable protons: 3
Explanation: In this structure, there are three acidic hydrogen atoms directly bonded to the phosphorus atom via oxygen atoms. All three can be ionized to form H+ ions.

In summary, H3PO2 has 1 ionizable proton, H3PO3 has 2 ionizable protons, and H3PO4 has 3 ionizable protons per formula unit.


To know more about ionizable protons refer here:

https://brainly.com/question/29366722#


#SPJ11

how is liming a lake similar to a doctor prescribing medicine for a patient?

Answers

an anti-acid medication

by what factor does the rate change if the concentration of hno2 is doubled

Answers

By the  factor of 2 the rate change if the concentration of hno2 is doubled.

The rate law describes the relationship between the rate of a chemical reaction and the concentrations of its reactants. When the concentration of one of the reactants is altered, the rate of the reaction also changes correspondingly. The relationship between the rate of the reaction and the concentration of reactants is given by the rate law equation.

A factor is calculated using the following formula:

Factor = New concentration / Original concentration

As per the question, if the concentration of HNO2 is doubled, the factor is calculated as follows:

Factor = New concentration / Original concentration = 2x / x = 2

The factor is 2. It means that if the concentration of HNO2 is doubled, the rate of the reaction will increase by two times.

This is because the rate of the reaction is directly proportional to the concentration of HNO2.

For example, if the original rate is 100 units and the concentration of HNO2 is doubled, the new rate will be 200 units (100 x 2).

In conclusion, the factor by which the rate changes if the concentration of HNO2 is doubled is 2. This implies that the rate of the reaction will double if the concentration of HNO2 is doubled. This is due to the direct proportionality of the rate of the reaction with the concentration of HNO2.

Learn more about chemical reaction -

brainly.com/question/25769000

#SPJ11

1. Which of the following is an example of a chemical reaction? *
O A. mixing lemonade powder with water
O B. burning marshmallows over a fire
O C. melting butter in a pan
D. boiling water on a stove

Answers

The answer is B because it is a chemical reaction

Answer:Burning marshmellows over fire

Explanation:

Please! I need help
Describe how water molecules can hydrate various substances.

Answers

Answer:

The two hydrogen atoms and one oxygen atom within water molecules (H2O) form polar covalent bonds. ... As a result of water's polarity, each water molecule attracts other water molecules because of the opposite charges between them, forming hydrogen bonds.

Explanation:

Not my work, but I hope this helps!

Which kind of thermal energy transfer warms your hand when you hold a hot
mug of tea?
A. Radiation
B. Convection
C. Conduction
D.Translation

Answers

C

Conduction: Heat transfers into hands when holding a hot cup of coffee. Heat energy is transferred between or inside substances by conduction. We can use any media for conduction, but physical media is required.

The kind of thermal energy transfer that warms your hand when you hold a hot mug of tea is called conduction. The correct option is C.

What is conduction?

Direct contact between molecules inside a substance allows for the transfer of energy, typically in the form of heat and/or electricity. Conduction can occur in gases, liquids, and solids.

Conduction heat transfer primarily takes place in stationary mediums, including solids or fluids that are at rest.

When holding a hot cup of coffee, heat is transferred to the hands. Conduction is the method of transferring heat energy inside or between materials. Any medium can be used for conduction, although physical mediums are necessary.

Therefore, the correct option is C. Conduction is correct for the process mentioned above.

To learn more about conduction, refer to the link:

https://brainly.com/question/28170183

#SPJ2

Nancy rides her bike with a constant speed of 12 km/h. How far can she travel in 3 hours 20 minutes?
15 km
25 km
60 km
40 km

Answers

she will travel 40 km in 3 hours and 20 minutes

RIGHT ANWSER WILL BE MARKED BRAINLIEST

RIGHT ANWSER WILL BE MARKED BRAINLIEST
RIGHT ANWSER WILL BE MARKED BRAINLIEST

Answers

Answer:

11460

Explanation:

if you could choose from having fire or ice powers, what would you choose?

Answers

Answer: I would choose ice

Ice is the solid state of water, a normally liquid substance that freezes to the slid state at temperatures of 0 °C (32 °F) or lower and expands to the gaseous state at temperatures of 100 °C (212 °F) or higer

Answer:

fire

Explanation:

just my opinion but.

If you have fire you could melt things and it defeats ice and ice is easily melted.

Fire is good in a "battle" too lol.

a reaction is made up in the following way: 14 ml of 4.5 m acetone 12 ml of 1.3 m hcl 14 ml of 0.0051 m i2 13 ml of water. it takes 359 seconds for the i2 color to disappear from the reaction mixture. what was the rate of reaction? express your answer as a decimal number (no exponents). include proper (abbreviated) units.

Answers

The rate of reaction would be 0.0000142 mol/Ls.

Rate of chemical reactions

The rate of reaction can be determined by using the following equation:

Rate = (Δ[C]) / (Δt)

where Δ[C] is the change in concentration of the reactant over a certain time interval, and Δt is the time interval.

I2 + HCl + CH3COCH3 → ICl + CH3COCH2Cl + H2O

Rate = (-Δ[I2]) / (Δt)

To calculate the change in iodine concentration, we need to know the initial and final concentrations. The initial concentration of iodine is 0.0051 mol/L (since 14 mL of 0.0051 M I2 was added to the reaction mixture). The final concentration is zero, since the iodine color disappears completely.

moles = concentration × volume (in liters)

moles acetone = 4.5 mol/L × 0.014 L = 0.063 mol

moles HCl = 1.3 mol/L × 0.012 L = 0.0156 mol

Since iodine is the limiting reactant, it will be completely consumed during the reaction. The moles of iodine are:

moles I2 = 0.0051 mol/L × 0.014 L = 7.14 × 10^-5 mol

Now, we can calculate the change in iodine concentration as follows:

Δ[I2] = 0.0051 mol/L - 0 mol/L = 0.0051 mol/L

The time interval is given as 359 seconds.

Plugging in the values we get:

Rate = (-Δ[I2]) / (Δt) = (-0.0051 mol/L) / (359 s) ≈ 1.42 × 10^-5 mol/L*s

Therefore, the rate of reaction is approximately 1.42 × 10^-5 mol/L*s.

More on the rate of chemical reactions can be found here: https://brainly.com/question/13571877

#SPJ1

How many significant figures are in 320001

Answers

there are 6. looked it up

find values of the intrinsic carrier concentration n. for silicon at -55°c, 0°c, 20°c, 75°c, and 125°c. at each temperature, what fraction of the atoms is ionized? recall that a s

Answers

The intrinsic carrier concentration and the fraction of ionized atoms of silicon at -55℃, 0℃, 20℃, 75℃, 125℃ is calculated below.

The intrinsic carrier concentration in intrinsic material is the number of electrons found in the conduction band or holes in the valence band. This quantity of carriers is determined by the material's band gap as well as its temperature.

Because the number of holes equals the number of electrons, the concentration of each is equal to some amount, ni, and this quantity is known as the intrinsic carrier concentration, and the pure semiconductor material is referred to as intrinsic material.

Given:

B = 5.4 x 1031

EG = 1.12 ev for silicon

K = 8.62 x 105

Silicon crystal = 5 x 1022 atoms/cm3

To find:

Intrinsic carrier concentration, ni = ?

Fraction of ionized atom = ?

Formula:

\(ni^2 = BT^3 e^{\frac{-E_G}{KT}\)

Fraction of ionized atom = ni / 5 x 1022

Calculations:

(a) For -55℃:

T = -55 + 273 = 218K

ni = 5.410312183e(1.128.62105218)

ni = 2.7018 x 106 carriers/cm3

Fraction of ionized atom = 2.7018 x 106 / 5 x 1022

Fraction of ionized atom = 5.403 x 1017 atoms/cm3

(b) For 0℃:

T = 0 + 273 = 273K

ni = 5.410312733e(1.128.62105273)

ni = 1.53 x 109 carriers/cm3

Fraction of ionized atom = 1.53 x 109 / 5 x 1022

Fraction of ionized atom = 3.07 x 1014 atoms/cm3

(c) For 20℃:

T = 20 + 273 = 293K

ni = 5.410312933e(1.128.62105293)

ni = 8.65 x 109 carriers/cm3

Fraction of ionized atom = 8.65 x 109 / 5 x 1022

Fraction of ionized atom = 1.73 x 1013 atoms/cm3

(d) For 75℃:

T = 75 + 273 = 348K

ni = 5.410313483e(1.128.62105348)

ni = 3.724 x 1011 carriers/cm3

Fraction of ionized atom = 3.724 x 1011 / 5 x 1022

Fraction of ionized atom = 7.449 x 1012 atoms/cm3

(e) For 125℃:

T = 125 + 273 = 398K

ni = 5.410313983e(1.128.62105398)

ni = 4.75 x 1012 carriers/cm3

Fraction of ionized atom = 4.75 x 1012 / 5 x 1022

Fraction of ionized atom = 9.51 x 1011 atoms/cm3

The complete question is in the image given below.

Learn more about Intrinsic carrier concentrations of silicon here:

https://brainly.com/question/15078086

#SPJ4

find values of the intrinsic carrier concentration n. for silicon at -55c, 0c, 20c, 75c, and 125c. at

Atoms of a given elements with have the same mass true or false?

Answers

Answer: True

Explanation:

Help me please!!!!!!!

Help me please!!!!!!!

Answers

Answer:

1. 264.369

2. 1772.65

3. 3.25

4.488

5. 0.164525

Explanation: I just added 0's to the ones that didnt have as many decimals which made it easy.

what is the expression constant dissociation for ethylamine? what is the expression constant dissociation for ethylamine? kb

Answers

The answer is that the expression constant dissociation for ethylamine is known as Kb.

The Kb value for ethylamine can be determined by measuring the concentration of the products and reactants at equilibrium after the reaction:

C2H5NH2 + H2O ⇌ C2H5NH3+ + OH-.

The Kb expression for ethylamine is [C2H5NH3+][OH-]/[C2H5NH2].

Kb is the equilibrium constant for the dissociation of a weak base, like ethylamine, in water. It measures the extent to which the base dissociates in water to form hydroxide ions (OH-) and the conjugate acid of the base (C2H5NH3+). The higher the Kb value, the stronger the base. The Kb value for ethylamine is 6.4 x 10⁻⁴ at 25°C.

To know more about ethylamine  visit:

brainly.com/question/9439418

#SPJ11

How many moles of ch4 are contained in 96. 0 grams of ch4.

Answers

Answer:

6 mol

Explanation:

Discussion

The answer is very nearly six. I will use rounded whole numbers to get the molar mass. Every periodic table is different so you will have to redo my numbers using your periodic table.

The trick is to find 1 mole of CH4 and divide that into 96.

Givens

96.0 grams of CH4

Solution

Find 1 mol of CH4

1 * 1C = 1 * 12 = 12 grams of Carbon in 1 mol of CH4

4 * H = 4 * 1 = 4 grams of Hydrogen in 1 mol of CH4

Total = 16 grams of C and H in 1 mol of CH4

Find 96 grams in mols.

Formula

mol = given mass / molar mass

given mass = 96 grams

molar mass = 16 grams

Mol = 96 / 16

Answer: mol = 6

What is the balance equation for
_AI+_Pb(NO3)2—__Pb+__Ca(NO3)2

Answers

Answer:

2 Al + 3 Pb(NO3)2 > 2 Al(NO3)3 + 3 Pb

Explanation:

New evidence can cause scientists to revise a scientific theory. If new evidence comes to
light, which is most likely to happen?

Answers

Answer: after years of research if the evidence still supports a change the theory will be revised

Explanation:

I think that’s it

What halogen can react with sodium chloride solution to produce chlorine?

Answers

Answer:

As electro-negativity decreases from Florine to downwards in the group and only Florine is above Chlorine, so Florine should react with sodium chloride solution to produce chlorine.  

mark me brinilylist pls

A nuclear power plant generates electricity using nuclear energy. The nuclear energy comes from the heat released by the fission of one uranium atom into two smaller atoms. This heat is used to convert water into steam in a nuclear reactor, which is then used to turn turbines to generate electricity.

How is nuclear energy different from wind energy?
A.
The fuel for nuclear energy is unlimited whereas wind is limited.
B.
The fuel for nuclear energy is limited whereas wind is unlimited.
C.
Wind energy is expensive whereas nuclear energy is economical.
D.
Wind energy causes pollution whereas nuclear energy is pollution-free.

Answers

Nuclear energy differs from wind energy because the fuel for nuclear energy is limited whereas wind is unlimited. Option B.

Nuclear versus wind energy

Both nuclear and wind energy's end goal is to turn turbines which are used to generate electricity. However, both energy sources have separate routes they take in order to turn the turbines.

Nuclear energy utilizes the heat generated through nuclear fission to heat water into steam in a nuclear reactor. The steam is then used to turn turbines. Wind energy, on the other hand, utilizes the energy in the wind to turn two or three propellers around rotors. The rotors then turn the generator that is used to generate electricity.

The only major difference between the two energy sources is that the fuel (Uranium) for nuclear reactors in nuclear energy is limited in availability. Uranium deposits are not renewable.

More on sources of energy can be found here: https://brainly.com/question/29763772

#SPJ1

What is the term for the number of protons in the nucleus of each atom of an element?

Answers

Answer:

atomic number

Explanation:

atomic number is the number of protons

Who wrote the first modern chemical textbook?
O Antoine Lavoisier
O Dmitri Mendeleev
O Henry Moseley
O Johann Dobereiner

Answers

Answer:

Antoine Lavoisier

Explanation:

Antoine Lavoisier wrote the first modern textbook. It is the answer.

The modern chemical textbook was written by Antoine Lavoisier. The book is titled as Elementary Treaties On Chemistry.

Who is Antoine Lavoisier?

Antoine Lavoisier is known as the father of modern chemistry. He contributed a lot to revolutionize chemistry. Antoine Lavoisier proposed the law of conservation of mass.

Nomenclature of chemical compounds was proposed by Antoine Lavoisier. He studied about the combustion and respiration in detail and the results are written in the book Elementary Treaties On Chemistry.

Hence, the first modern chemical textbook was written by Antoine Lavoisier.

To learn more about Antoine Lavoisier, refer the link here,

https://brainly.com/question/1764419

#SPJ2

Suppose that you are the quality engineer in a company that manufactures a certain chemical product. This product is obtained from the chemical reaction of two components under a high temperature environment, and the level of contaminant of the resulting product is the main parameter subjected to quality control. After a thorough statistical analysis on the data collected from this process, you found that the process variability follows the normal distribution, in which the average contaminant level in the product, , in parts per million (ppm) is a function of other variables of the process given by the following equation:
student submitted image, transcription available belowstudent submitted image, transcription available belowin which P1 is the average purity index of the component 1, P2 is the average purity index of the component 2, and T is the temperature at which the chemical reaction is processed in °C. For the standard deviation of the contaminant level in the product, c, also in parts per million, you found the following equation:
c = 1500P1 2 + 1700P2 2 + 2000P1P2T
in which P1 is the standard deviation of the purity index of the component 1, P2 is the standard deviation of the purity index of the component 2, and T is the standard deviation of the chemical reaction temperature. Currently, the product is being processed with components 1 and 2 having average purity levels of 0.80 and 0.85, respectively. To sustain the chemical reaction, the average temperature of the process must be set to a minimum value of 120°C. Additionally, the standard deviation for the purity index of both components is 0.1, and the standard deviation of the temperature is 0.5°C. In one week, you will have a meeting with a new costumer, who is interested on your product but not sure about its quality standards.
a) If your new customer has established a target value for the contaminant level in the product of 380 ppm, is the current process accurate enough to meet this target value? If not, propose two modifications in the process to meet the target value. Justify your proposals based on numbers. Take into consideration that the maximum purity index possible for the components is 1, and that the maximum reaction temperature allowable is 250°C for safety reasons.
b) Your customer also has a strict requirement that 99% of the products should have a contaminant level between 350 and 410 ppm. Is the current process capable (or precise enough) to meet this requirement? If not, propose two additional modifications in the process to meet the customer requirements. Justify your proposals based on numbers.

Answers

The current process is not accurate enough to meet the target contaminant level of 380 ppm. Two modifications can be proposed to improve the process.

Firstly, increasing the average purity index of component 1 (P1) to 0.85 will reduce the contaminant level. Secondly, reducing the average temperature (T) to the minimum value of 120°C will also decrease the contaminant level. These modifications can be justified based on the given equations for the contaminant level and standard deviation.

In the equation for the contaminant level, a higher P1 value will result in a lower contaminant level. By increasing P1 from 0.80 to 0.85, the contaminant level will decrease. Similarly, by reducing the average temperature from its current value, the contaminant level can be further reduced.

To meet the customer's requirement of 99% of the products having a contaminant level between 350 and 410 ppm, additional modifications are needed. Firstly, decreasing the standard deviation of the purity index for both components (P1 and P2) will reduce the process variability and bring the contaminant levels closer to the target range.

Secondly, reducing the standard deviation of the temperature (T) will also help in reducing the variability of the contaminant levels. These modifications will improve the precision of the process and increase the likelihood of meeting the customer's requirement.

In conclusion, the current process is not accurate enough to meet the target contaminant level and the precision requirement of the customer. Modifying the average purity index of component 1, average temperature, and the standard deviations of purity indices and temperature can improve both accuracy and precision.

Learn more about contaminant

brainly.com/question/28328202

#SPJ11

How did the Bronsted-Lowry acid-base theory clarify what Svante Arrhenius was not able to explain in his theory of acids and bases regarding ammonia?​

Answers

Svante Arrhenius theory suggests that in order for a substance to release either H+ or OH- ions, it must contain that particular ion. However, this does not explain the weak base ammonia (NH3), In Bronsted-Lowry acid-base theory, acids are defined as proton donors; whereas bases are defined as proton acceptors.

What is ammonia?

With the chemical formula NH3, ammonia is a nitrogen and hydrogen inorganic compound. Ammonia is a colorless gas with a strong, pungent odor.

It is a stable binary hydride and the most basic pnictogen hydride. In terms of biology, it is a typical nitrogenous waste, especially among aquatic organisms, and it significantly contributes to the nutritional requirements of terrestrial organisms by acting as a precursor to 45 percent of the world's food and fertilizers.

Approximately 70% of ammonia is used to create fertilizers, including urea and diammonium phosphate, in a variety of shapes and compositions. Additionally, pure ammonia is sprayed onto the ground.

Learn more about ammonia

https://brainly.com/question/14854495

#SPJ9

An atom with one electron in its valence
shell will tend to:

Answers

it will tend to become positively charged

An atom with one electron in its valence shell will tend to lose that electron to achieve the noble gas configuration and becomes a cation.

What is a cation?

Cations are positively charged ions and are formed when an atom loses its electrons. They lose one or more electrons from their valence shell but do not lose any protons. Therefore, they get a net positive charge. Some examples of cations are  Potassium (K⁺), Calcium (Ca²⁺), and hydrogen (H⁺).

Anions and cations are both ions and have opposite electrical charges. They feel attraction for each other. A cation repels another cation whereas an anion repels another anion.

An atom that has one electron in its valence shell will always tend to lose that electron to get completely filled electronic configuration. So the atom will convert into a cation to attain the more stable noble gas configuration.

For example, sodium has an electronic configuration 1s²2s²2p⁶3s¹. It has one electron in its valence shell, so it converts into Na⁺ by losing one electron and attains a configuration similar to Neon noble gas.

Learn more about cations, here:

https://brainly.com/question/1333307

#SPJ6

Calculate the osmotic pressure of a 9.45 mM aqueous solution of MgCl2 at 20 degrees Celsius?

Answers

The osmotic pressure of the 9.45 mM aqueous solution of MgCl₂ at 20 degrees Celsius is approximately 0.2336 atm.

To calculate the osmotic pressure of a solution, we can use the equation;

π = MRT

Where:

π = osmotic pressure (in pascals or N/m²)

M = molarity of solution (in mol/L or M)

R = ideal gas constant (8.314 J/(mol·K) or 0.0821 L·atm/(mol·K))

T = temperature (in Kelvin)

First, we need to convert the given concentration of MgCl₂ from millimolar (mM) to molarity (M). Since 1 mM = 0.001 M, the concentration becomes;

M = 9.45 mM × 0.001 = 0.00945 M

Next, we will convert the temperature from Celsius to Kelvin:

T = 20 + 273.15=293.15 K

Now we calculate the osmotic pressure;

π = (0.00945 M) × (0.0821 L·atm/(mol·K) × (293.15 K)

Simplifying the equation;

π = 0.2336 atm

Therefore, the osmotic pressure of the 9.45 mM aqueous solution of MgCl₂ at 20 degrees Celsius is approximately 0.2336 atm.

To know more about osmotic pressure here

https://brainly.com/question/29819107

#SPJ4

Suppose you have an ice cube with mass of 8.00 g at a temperature of 295 K. If that ice cube is heated until it is completely converted to steam at 373 K how many joules of heat must be added ?

Answers

Explanation:

In order to be able to answer this question, you must know the value of water's enthalpy of fusion, ΔHfus

Why do scientists clone banana plants, but not humans?

Answers

Answer:

There are legal and ethical restrictions regarding human cloning.

Explanation:

Answer:

Scientists clone banana plants and not humans because there are legal and ethical restrictions regarding human cloning.

hopethishelpedyou

Other Questions
We know for a fact that the equation:[tex]|z+z'| \leqslant |z|+|z'|[/tex]holds for any 2 complex numbersI came up with the conclusion that:[tex]|z+z'|=|z|+|z'|[/tex]only holds when z and z' are pure imaginary or pure real numbers of the SAME sign.How can i prove this algebraically/geometrically?Note: Irrelevant answers will be reported PLEASE HELP FAST IF CORRECT ILL GIVE BRAINLIEST!!!!Garth sells baseball caps outside the stadium. The graph shows the number of caps sold and the income from the sales. It represents a linear function.Which statement best describes Garth's income from selling these caps?A. He gets $35.00 per cap,B. He gets $49.50 per cap.C. He gets $17.50 per cap.D. He gets $5.00 per cap. What research methods do psychologists use, and for what purposes? PLS SOMEONE HELP ME:) this is science class The _____ in which ratio is expressed is important Given pre-image line y=0, which transformation would result in a graph with twoperpendicular lines?Rotation of 270 degrees counterclockwise(z,y) (2x, y)Reflection across the x-axis(2,y) (C-1, y+1) If h:k = 2:5, x:y=3:4 and 2h+x:k+2y = 1:2, find the ratio h-x: k-y. A street performer tosses a ball straight up into the air (event 1 ) and then catches it in his mouth (event 2 ). For each of the following observers, state whether the time they measure between these two events is the proper time or the dilated time: (a) the street performer; (b) a stationary observer on the other side of the street; (c) a person sitting at home watching the performance on TV (d) a person observing the performance from a moving car. another name for the area of equatorial low pressure is the ________. which pediatric age group is characterized as challenging to asses and having numerous the postganglionic axons of the sympathetic branch of the ans are considered short. platinum has a density of 21.4 grams per cubic centimeter. A bar of platinum has a mass of about 1000 grams. It has a width of 51 millimeters and a height of 9.7 millimeters. Find the length of the bar to the nearest millimeter. Why does the student put the maggots on gauze im stuck pls help me 6 what is the area of this figure?? the payroll register of seaside architecture company indicates $880 of social security and $217 of medicare tax withheld on total salaries of $15,500 for the period. assume earnings subject to state and federal unemployment compensation taxes are $5,300 at the federal rate of 0.8% and state rate of 5.4%. prepare the journal entry to record the payroll tax expense for the period. if an amount box does not require an entry, leave it blank. if required, round your answers to two decimal places. the greek letter ("alpha") in the exponential smoothing formula can be any value between -10 and 10.truefalse Yesterday, December 7, 1941- a date which will live in infamy- the united states of america was suddenly and deliberately attacked by naval and air forces of the empire of japan what rhetorical device is used in the opening sentence of this speech? a. Ethos b. Logic c. Logos d.Pathos complete the table by indicating the change in each determinant necessary to increase aggregate demand. A critical control process that needs to take place during the sensory register stage of the information-processing model is known as?