name the 3 atomic number of lithium​

Answers

Answer 1

Lithium with atomicnumber 3 and potassium with atomic number 19 are placed in same group because they are having the same number of valence electron that is 1 . The first and second element in the the second group will be beryllium and magnesium with atomic number 4 and 12 respectively.

I hope my answer will help you
Answer 2
It has only one atomic number and that’s 3

Related Questions

Graphite is a form of____.

A. Galena
B. Corundum
C. Chalcopyrite
D. Carbon
E. Bauxite

Answers

Answer:

D. Carbon

Explanation:

Graphite, archaically referred to as plumbago, is a crystalline form of the element carbon with its atoms arranged in a hexagonal structure. You'll get the substance when carbon is stacked in sheets. It occurs naturally in this form and is the most stable form of carbon under standard conditions. Under high pressures and temperatures, it converts to diamond. Graphite is used in pencils and lubricants. It is a good conductor of heat and electricity. Its high conductivity makes it useful in electronic products such as electrodes, batteries, and solar panels.

1 gallon of water is about 210.3mol. What mass is this?

Answers

Answer:

3785.4g

Explanation:

210.3 mol of water are

210.3 mol × (18.0g/mol) = 3785.4g

please join me for dinner tonight.(write the sentence kind).give the right answer for this question ​

Answers

Answer:

Sentence type wish

The answer to the question: No.

Answer:

Will you join me for dinner tonight?

Explanation:

like and rate and brainiest plz

Next calculate the mass of H₂O in the oceans. To do this, assume that the density of seawater is 1.025 gm/cm³ and that seawater is 96.5 percent H₂O. Express the answer in grams.

Finally compare the mass of H2O in the oceans to the mass of H₂O originally contained in the mantle. Which is bigger? By how much? Could the H₂O of the oceans have come from the outgas- sing of the mantle?

Answers

The mass of H₂O in the oceans is much larger than the mass of H₂O originally contained in the mantle by a factor of approximately 3860

The mass of H2O in the oceans can be calculated using the following formula:mass of H2O in the oceans = volume of seawater × density of seawater × percentage of H2O in seawater where the volume of seawater is the total volume of the oceans on Earth, which is approximately 1.332 billion km³.

The density of seawater is 1.025 gm/cm³, and seawater is 96.5 percent H₂O. Therefore, the mass of H2O in the oceans is:m = 1.332 × 10⁹ km³ × (1.025 gm/cm³) × (0.965)= 1.307 × 10²¹ gmTo compare the mass of H₂O in the oceans to the mass of H₂O originally contained in the mantle, we need to first find the mass of H₂O originally contained in the mantle. The total mass of the mantle is approximately 4.5 × 10²⁴ gm, and it is estimated that the mantle contains between 50 and 100 ppm of H₂O.

Taking an average value of 75 ppm and using the mass of the mantle, we can calculate the mass of H₂O originally contained in the mantle as follows: mass of H₂O in mantle = (75 ppm) × (4.5 × 10²⁴ gm)= 3.38 × 10¹⁹ gm Therefore, the mass of H₂O in the oceans is much larger than the mass of H₂O originally contained in the mantle by a factor of approximately 3860. It is unlikely that the H₂O of the oceans came from the outgassing of the mantle alone, as the amount of H₂O in the oceans is much greater than the amount of H₂O originally contained in the mantle. Other sources of water, such as comets and asteroids, are thought to have contributed to the water content of the oceans.

To learn more about mantle visit;

https://brainly.com/question/31542515

#SPJ11

a 750.0 ml solution contains 5.00 g of naoh. if the molar mass of naoh is 39.9969 g/mol, what is the molarity of the solution

Answers

A 750.0 ml solution contains 5.00 g of NaOH. if the molar mass of NaOH is 39.9969 g/mol, what is the molarity of the solution. The molarity of the solution is approximately 0.250 M.

To calculate the molarity, we need to determine the number of moles of NaOH in the solution. We can use the given mass of NaOH and its molar mass to find the number of moles:

Number of moles of NaOH = Mass of NaOH / Molar mass of NaOH

= 5.00 g / 39.9969 g/mol

≈ 0.125 mol

Next, we convert the volume of the solution from milliliters to liters:

Volume of solution = 750.0 ml = 750.0 / 1000 = 0.750 L

Finally, we can calculate the molarity by dividing the number of moles of NaOH by the volume of the solution in liters:

Molarity = Number of moles of NaOH / Volume of solution in liters

= 0.125 mol / 0.750 L

0.250 M

Hence, the molarity of the solution is approximately 0.250 M.

To know more about molar mass, click here:

https://brainly.com/question/15299296

#SPJ11

9. Mr. James owns 12 gas stations in Newport News. He wants to build a
new gas station on the same block that already has a gas station. There
are 3 other different gas stations near by. He thinks it will allow the
community to have a choice as to which gas to use. What type of
viewpoint does Mr. James have?
O preservationist viewpoint
conservationist viewpoint
developmental viewpoint

Answers

Answer:

Option C, developmental view point

Explanation:

A person with preservationist viewpoint will think of only preserving the natural resources and the environment. While a person with a conservationist viewpoint will think of conserving the landscape, architecture, heritage, culture, buildings, rituals, etc.  

However, a person with developmental viewpoint will think of developing resources at ease. He/She will prioritize development and comfort of customer above all.  

Hence, option C is correct

at the equivalence point for a weak acid-strong base titration, an equal number of h and oh- have reacted, producing a solution of water and salt. what affects the ph at the equivalence point for this kind of titration? group of answer choices the auto-ionization of water the basicity of the salt anion none of these the acidity of the salt cation

Answers

In a weak acid and strong base titration, the pH at the equivalence point is affected by: the basicity of the salt anion. Hence, the final pH of the equivalence factor will be higher than 7.

How do weak acid and strong base titration work?

At the equivalence point, the mixture of a weak acid and a strong base produces basic salt. This happens because the acid is too weak to donate the hydrogen ions to the solution, so it has an anion of a strong base. Meanwhile, the base is strong enough to accept hydrogen ions from water, so it has a cation of a weak acid. It affects the salt pH to be greater than 7 (basic salt).

Learn more about titration here https://brainly.com/question/28989947

#SPJ4

Non-red hair is dominant. And Red hair is recessive. What are Josh's genotype and phenotype?

Answers

Phenotype = Non-red

Genotype = depends on what genes you are using

Give the word equation for the reaction between hydrogen and oxygen

Answers

Answer:

Hydrogen gas (H₂) + Oxygen gas (O₂) → Water (H₂O)

Explanation:

Hydrogen reacts with oxygen to form water. The reactants are hydrogen and oxygen and the product is water.

Answer:

Word Equation:

Hydrogen + Oxygen = Water

Hydrogen gas reacts with Oxygen gas to give Water.

The chemical Reaction is as follows:

    \(2H_{2} + O_{2}\)   =>    \(2H_{2}O\)

Part of Newtons first law states an object at rest stays at rest unless acted upon by an unbalanced force. Which one is NOT an example of this law?

Answers

Solution :

Sir Isaac Newton was a great scientist. The discoveries of the Newton change the way we see the world. Newton gave us the fundamental principles through which the entire universe is governed.

Newtons 1st law of motion states that a body moves or stays in position until and unless an external force is applied to the body.

This is the law of nature.

An example which do not support this law can be a body having a huge mass and a small boy applies force to move it but is unable to move the body.

43) How many grams of calcium phosphate are theoretically produced if we start with 3.40 moles of Ca(NO3)2 and 2.40 moles of Li3PO4?
Reaction: 3Ca(NO3)2 + 2Li3PO4 → 6LiNO3 + Ca3(PO4)2
A) 310
B) 248
C) 1054
D) 351
E) not enough information

Answers

Rounding to the nearest gram, the answer is A) 310.

The balanced chemical equation is:

\(3Ca(NO_{3} )_{2}\) + 2 Li3PO4 -> 6 LiNO3 + Ca3(PO4)2

The stoichiometry of the reaction shows that 3 moles of \(Ca(NO_{3} )_{2}\)  react with 2 moles of Li3PO4 to produce 1 mole of Ca3(PO4)2.

Given that 3.40 moles of \(Ca(NO_{3} )_{2}\)  and 2.40 moles of Li3PO4 are present, we can use the stoichiometry of the reaction to determine which reactant is limiting:

For \(Ca(NO_{3} )_{2}\) : 3.40 moles \(Ca(NO_{3} )_{2}\) x (1 mole Ca3(PO4)2 / 3 moles \(Ca(NO_{3} )_{2}\) = 1.13 moles Ca3(PO4)2

For Li3PO4: 2.40 moles Li3PO4 x (1 mole Ca3(PO4)2 / 2 moles Li3PO4) = 1.20 moles Ca3(PO4)2

Since Li3PO4 produces more moles of Ca3(PO4)2 than \(Ca(NO_{3} )_{2}\)  it is the limiting reactant. Therefore, the maximum amount of Ca3(PO4)2 that can be produced is 1.20 moles.

The molar mass of Ca3(PO4)2 is 310.18 g/mol. Therefore, the theoretical yield of Ca3(PO4)2 is:

1.20 moles x 310.18 g/mol = 372.216 g

Rounding to the nearest gram, the answer is A) 310.

Learn more about stoichiometry

https://brainly.com/question/30215297

#SPJ4

What energy-storing molecule is broken down in the first step of cellular respiration?

Answers

Glucose  is broken down in the first step of cellular respiration.

Glycolysis, the first stage of cellular respiration, takes place in the cell cytoplasm. It involves the splitting of glucose into two three-carbon molecules through a 10-step process divided into two phases. The first phase involves the division of a six-carbon sugar molecule, while the second phase extracts and stores energy in the form of ATP and NADH. These two phases are known as the energy investment and energy generation phases. The overall net energy gain from this process is two ATP.

If you need to learn more about cellular respiration, click here

https://brainly.com/question/13721588?referrer=searchResults

#SPJ4

Need Help ! ASAP !! Please

Need Help ! ASAP !! Please

Answers

Answer:

Option 1.

Explanation:

3.6cm * 1inch/2.54 cm = 1.417 inch

Practice writing in scientific passive voice by summarizing chemical properties of the periodic table in your own words.

Your summarization should be at least three sentences long and refrain from using the first person.

Answers

The metals in the periodic table react with water to form bases, the nonmetals react with water to form acids while the metalloids have intermediate properties.

What is the periodic table?

The periodic table is an arrangement of elements according to their increasing atomic numbers. The atomic number of an elements has to do with the number of protons in the atom as well as the number of electrons in the neutral atom of the substances.

We know that the periodic table is composed of the metals, the non metals and the metalloids. The metals are found towards the far left end of the periodic table and they have properties such as ability to liberate hydrogen when reacted with acids and the ability to tarnish when exposed to the atmosphere.

Towards the middle of the table, we have the metalloids whose properties are intermediate between those of the metals and the nonmetals. The nonmetals are known to dissolve in water to produce acids just as the bases react with water to produces bases.  Some metals are amphoteric.

Learn more about the periodic table:https://brainly.com/question/11155928

#SPJ1

What property of a metal does the image represent

Answers

Answer:

malleable

Explanation:

The image represent in malleable property of metal.

Final answer:

The image possibly represents the photoelectric effect of a metal, which is when it emits electrons after being exposed to electromagnetic radiation. Metals are also characterized by physical properties such as conductivity, malleability, metallic luster, and metallic bonding.

Explanation:

Based on your question, the image possibly represents the photoelectric effect, a key property of metals. This phenomenon occurs when a metal surface exposed to electromagnetic waves of a certain frequency absorbs radiation and emits electrons. These emitted electrons are called photoelectrons. Metals can also exhibit free electron model behavior, where electrons freely roam within the metal structure.

Metals possess unique physical properties like conductivity, malleability, and metallic luster. Malleability refers to the metal's ability to deform without breaking, while conductivity refers to the metal's ability to transfer heat or electricity. A metallic luster gives metals their characteristic shiny appearance.

Finally, metals are also known for their metallic bonding—a unique force that holds together the atoms within a metallic solid. Metallic bonding gives rise to many useful and varied bulk properties of metals.

Learn more about Properties of Metals here:

https://brainly.com/question/33514448

#SPJ2

Write net Brønsted equations that show the acid-base reactions of common household items.
1) washing soda and vinegar (sodium carbonate and HC2H3O2)
2) Vitamin C and ammonia (H2C6H6O6 and NH3)

Answers

The net Brønsted equations that show the acid-base reactions of common household items as washing soda and vinegar  are acid-base reactions. Na2CO3 + 2HC2H3O2 ⇔ 2NaC2H3O2 + CO2 + H2O 2. Vitamin C and ammonia are acid-base reactions. The net Brønsted equations. H2C6H6O6 + NH3 ⇔ H2C6H6O6+ NH2– 2H2O.

The reaction between sodium carbonate (Na2CO3) and acetic acid (HC2H3O2) is a classic acid-base reaction.

The bicarbonate ion (HCO3-) in sodium carbonate acts as a weak base, while the acetic acid (HC2H3O2) in vinegar acts as a weak acid, as stated in the given question.

The bicarbonate ion (HCO3-) in sodium carbonate reacts with the hydrogen ion (H+) in acetic acid to form carbonic acid (H2CO3), which spontaneously decomposes into carbon dioxide gas (CO2) and water (H2O).

The net Brønsted equation for this reaction is Na2CO3 + 2HC2H3O2 ⇔ 2NaC2H3O2 + CO2 + H2O.

The reaction between Vitamin C (ascorbic acid, H2C6H6O6) and ammonia (NH3) is a Brønsted acid-base reaction.

In water, Vitamin C acts as a weak acid, while ammonia acts as a weak base, as given in the question.

The hydrogen ion (H+) of ascorbic acid donates a proton to the lone pair of electrons on ammonia, forming an ammonium ion (NH4+).

The Brønsted equation for this reaction is H2C6H6O6 + NH3 ⇔ H2C6H6O6+ NH2– 2H2O.

Read more about Brønsted equations.

https://brainly.com/question/28298777

#SPJ11

if water at 0 oc is heated, it actually decreases in volume until it reaches4°C5°C6°C7°C

Answers

When water at 0°C is heated, it actually decreases in volume until it reaches 4°C. Yes, that is correct.

This is because as water is heated, its molecules start to move faster and the space between them increases. However, at 4°C, water molecules become more densely packed due to the formation of hydrogen bonds, which causes an increase in volume. This continues until water reaches its maximum density at 4°C. As the temperature increases beyond 4°C, the volume of water begins to decrease again until it reaches 7°C, where it starts to expand again.
If water at 0°C is heated, it actually decreases in volume until it reaches 4°C. At temperatures between 5°C, 6°C, and 7°C, the volume of water will begin to increase again as it continues to be heated.

Visit here to learn more about water molecules:

brainly.com/question/26529979

#SPJ11

What is the volume of 8.8g of carbon dioxide at STP?​

Answers

The volume of 8.8g of carbon dioxide at STP is 4.38 L.

At STP, what is 22.4 L?

1 mole of any gas will take up 22.4 L of space at standard temperature and pressure (STP). A balanced chemical equation and the Ideal Gas Law can be used to determine the amount or mass of gas consumed or created in a chemical process.

n = m/M

where m is the molar mass of carbon dioxide and M is its mass in terms of molecules.

Considering that the molar mass of carbon dioxide is 44.01 g/mol:

n = 8.8 g / 44.01 g/mol

n = 0.1998 mol

Next, we can plug in the values of n, R, P, and T into the ideal gas law and solve for V:

V = (nRT)/P

V = (0.1998 mol x 0.0821 L·atm/(mol·K) x 273.15 K) / 1 atm

V = 4.38 L

To know more about volume visit:-

https://brainly.com/question/16434653

#SPJ1

Determine the energy of a photon whose frequency is 5.55 × 1017 Hz.
Answer in units of J.

Answers

Espero que esos ejercicios y esas fórmulas te ayuden

according to your lab procedure, identify the chemicals necessary to produce co2 (g). write a net ionic equation for the generation of co2 (g).

Answers

To produce CO2 (g), the necessary chemicals are a carbonate (such as sodium bicarbonate or calcium carbonate) and an acid (such as vinegar or hydrochloric acid). The net ionic equation would be: H+ (aq) + CO32- (aq) → CO2 (g) + H2O (l) or 2H+ (aq) + CO32- (aq) → CO2 (g) + H2O (l)

Based on your lab procedure, the necessary chemicals to produce CO2 (g) are typically a carbonate or bicarbonate salt, such as sodium carbonate (Na2CO3) or sodium bicarbonate (NaHCO3), and an acid, such as hydrochloric acid (HCl).

The net ionic equation for the generation of CO2 (g) using sodium bicarbonate (NaHCO3) and hydrochloric acid (HCl) is as follows:

HCO3- (aq) + H+ (aq) → CO2 (g) + H2O (l)

This equation represents the reaction between bicarbonate ions and hydrogen ions to produce carbon dioxide gas and water.

More on CO2 production: https://brainly.com/question/31519674

#SPJ11

how does excessive burning of fossil fuels affect our planet

Answers

Excessive burning of fossil fuels such as coal, oil, and natural gas can have a significant impact on our planet. The primary way in which burning fossil fuels affects the planet is through the release of greenhouse gases, such as carbon dioxide (CO2) into the atmosphere.

These gases trap heat from the sun, which causes the Earth's temperature to rise, a phenomenon known as global warming. This can lead to a variety of negative effects, such as:

Climate change: The increase in temperature can cause more frequent and severe weather events such as heat waves, droughts, and floods. It can also cause sea levels to rise and glaciers to melt, leading to coastal flooding and changes in precipitation patterns.

Loss of biodiversity: Warmer temperatures can cause species to migrate or die out, leading to a loss of biodiversity. Changes in precipitation patterns can also affect the survival of certain species.

Ocean acidification: The ocean absorbs a large amount of CO2, which can cause the pH of seawater to decrease, making it more acidic. This can harm marine life, especially those that have shells or skeletons made of calcium carbonates, such as coral and certain types of plankton.

Learn more about global warming here:

https://brainly.com/question/12908180

#SPJ4

Ribbon diagrams shows secondary structures and appear less detailed than other model types. In one to two sentences, give a reason the chemists would use ribbon diagrams. What type of information do they provide?​

Answers

Answer:

They show helixes and proteins

Explanation:

Ribbon diagrams are the Richardson diagrams that represent the protein structures. Chemist prefers using Ribbon diagrams to show the various structure of the proteins.

What are ribbon diagrams?

The Ribbon diagram is used to represent the structural organization of the protein in the polypeptide chains or individually. It shows the three-dimensional structure and organization of the protein framework.

The ribbon diagram for the secondary structure of the protein shows the intramolecular and intermolecular structure along with helixes and bonding. It shows the detailed structure of the protein organization including the helix and sheets.

Therefore, the ribbon diagram is used by chemists to determine the structure of the protein as they give the details about the helix and sheet.

Learn more about ribbon diagrams, here:

https://brainly.com/question/2794632

#SPJ2

The ionic size of fluoride (F^-1)

Answers

Answer:lonic

Explanation:A neutral atom has an equal number of electrons and protons. When an electron is lost, the atom becomes positively charged and is called a cation. On the other hand, when an electron is gained by an atom, it becomes negatively charged and is called an anion. The distance of the nucleus of an ion and the valence electron is referred to as the ionic radius.

can carbon atoms be arranged in different ways and why is that? explain.

Answers

Answer:

1. Yes.

Pure carbon can exist in different forms depending on how its atoms are arranged.

The forms pure carbon can exist in include: diamond, graphite, and fullerenes. All three forms exist as crystals, but they have different structures.

2. WHY?

Each carbon atom forms four covalent bonds.

Atoms of carbon can either bond with each other or with atoms of other elements in which, the bonds may be single, double, or triple bonds. Because of carbon's ability to form so many covalent bonds, it often forms polymers.

Explanation:

calculate the mass of a sample of cobalt containing 3.31x10^22 atoms

Answers

Answer:

Mass = 3.24 g

Explanation:

Given data:

Number of atoms of cobalt = 3.31 × 10²² atoms

Mass of cobalt = ?

Solution:

We will calculate the number of moles of cobalt first.

1 mole contain 6.022× 10²³ atoms

3.31 × 10²² atoms  × 1 mol / 6.022× 10²³ atoms

0.0549 mol

Mass of cobalt:

Mass = number of moles × molar mass

Mass = 0.0549 mol × 58.93 g/mol

Mass = 3.24 g

calculate the concentration of an aqueous hbr solution that has ph 4.25 HBr is a strong acid

Answers

The concentration of the aqueous HBr solution with a pH of 4.25 is approximately 3.16 x 10 ⁻⁵ M.

The pH of a solution is a measure of its acidity or basicity and is defined as the negative logarithm (base 10) of the hydrogen ion concentration ([H+]). In this case, the given pH of 4.25 represents the negative logarithm of the hydrogen ion concentration.

To calculate the concentration of HBr, we can use the equation:

pH = -log[H+]

Rearranging the equation, we get:

[H+] = 10^(-pH)

Substituting the given pH of 4.25 into the equation, we have:

[H+] = \(10^(^-^4^.^2^5^)\)

= 3.16 x 10 ⁻⁵M.

Using a calculator, we find that [H+] is approximately 3.16 x 10 ⁻⁵M. Since HBr is a strong acid, it completely dissociates in water, resulting in an equal concentration of H+ and Br- ions. Therefore, the concentration of the HBr solution is also approximately 3.16 x 10 ⁻⁵ M.

Learn more about  concentration

brainly.com/question/31725240

#SPJ11

draw the lewis structure for xenon tetrafluoride (xef4). how many valence electrons surround the central xe atom in this structure?

Answers

36 valence electrons surround the xenon atom in XeF4.

What is Lewis structure?

The valence shell electrons in a molecule are represented in an excessively simple form by a Lewis Structure. It is used to illustrate how the electrons in a molecule are placed around specific atoms.

Through using present periodic table, we first count the valence electrons present in the XeF4 molecule. Once they have been determined, we can arrange them around the main atom and attempt to fill each atom's outer shell. Thus, there are 8 + 4 * 7 = 36 valence electrons in XeF4. In order to obtain the optimum Lewis structure for the molecule, formal charge is taken into consideration. Remember that fluorine (F) cannot form a double bond because of its highly electronegative nature, and that xenon (Xe) can contain up to 8 valence electrons.

Therefore, 36 valence electrons surround the xenon atom in XeF4.

To learn more about Lattice energy from the given link.

https://brainly.com/question/20300458

#SPJ4

draw the lewis structure for xenon tetrafluoride (xef4). how many valence electrons surround the central

Explain in your own words. What does DNA mean?

Answers

Answer:

DNA aka deoxyribonucleic acid is a molecule in cells that holds genetic information. Their main job is to tell the cell what type of protein to make. The other instructions they hold for the organism is instructions on how to develop, survive and reproduce.

Explanation:

DNA is the genetic material made of two polynucleotide chains that coil around one another to create a double helix is called deoxyribonucleic acid (DNA).

All known organisms and many viruses have genetic information in the polymer that is necessary for their development, operation, growth, and reproduction. Nucleic acids include ribonucleic acid and DNA.

DNA is the genetic material found inside bodily cells that contribute to an individual's unique genetic makeup. Similar to the game's code or a home's blueprints, it contains the directions for creating the body.

Learn more about DNA, here:

https://brainly.com/question/30006059

#SPJ2

a child runs 60m race with an average speed of 4 m/s.how long did the child take to complete the race? give the correct unit for your answer plz

Answers

Answer:

option c. i took the quiz

Explanation:

Question 52 points)
The electromagnetic waves with the highest frequency are ______ waves

Answers

Answer: Gamma Rays

Explanation:

The waves with the highest frequency are Gamma Rays. These electromagnetic waves travel at a very high speed. Best of Luck to you!

Other Questions
the perspective that does not rigidly believe in any one theoretical perspective but considers multiple theories and selects the best features from each is known as a(n) theoretical orientation. multiple choice question. humanistic behavioral cognitive eclectic mars and venus are at very different distances from the sun and venus is twice the size of mars, yet their atmospheric compositions are nearly identical. how can this be given their dramatic physical differences? explain using the data and equations above. (note: you may need to do some calculations here to backup your reasoning). Find the area of the triangle A. 27 m2B. 72 m2C. 36 m2D. 18 m2will mark brainliest! 3. The parabola y = z is changed to the form y = a(z - p)2 + by translating the parabola 2 units up and 4 units right and expanding it vertically by a factor of 3. What are the values of , p, and ?-a= 2,p=3,q=4-a = 2,p=4,q=3- a = 4, p = 2,4 = 3-a = 3, p = 4,9 - 2 In which of these substances are the atoms held together by metallic bonding?A.CrB.SiC.S8D.CO2E.Br2 define boiling point Why do you think West and East Africa saw several societies develop within the same geographic areas? Cual es el sujeto, predicado, complemento directo y complemento circunstancial de las siguientes oraciones:1. Prepare una torta para mi cumpleaos 2. La profesora explic la revolucin francsa 3. La librera cierra a las 8 de la noche Followng is the general format of a four-column bank reconcifition with the various categories and presentation numbered (1) through (B): Indicate the proper location for the following reconciling items: Assume the books record NSF checks as disbursements. An 11/30 NSF check will appear as: select one: a. 6 and 8 b. 3 and 5 c. 3 and 8 d. 6 and 7 e. 5 and 8 It's due in 5 minutes. HELP A television normally costs $1,420. Due to a store sale, the television is now $1,065. What was the percentage taken off the television? EXPLAIN which health teaching concept should the nurse emphasize when instructing the parents of a child with polycythemia caused by a congenital heart disorder? the perimeter of a rectangular field is 374 yards. if the width of the field is 88 yards, what is its length Why did the United States government incarcerate Japanese Americans during World War II? What nerves carry signals to the brain and tell it what is going on in the outside world? Nexis Corp. issues 1,000 shares of $15 par value common stock at $25 per share. When the transaction is recorded, credits are made to: Group of answer choices Common Stock $15,000 and Paid-in Capital in Excess of Par Value $10,000. Common Stock $25,000 and Retained Earnings $15,000. Common Stock $15,000 and Paid-in Capital in Excess of Stated Value $10,000. Common Stock $25,000. What impact did Fitzgeralds editor/publisher have on his work? What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2(g) FILL IN THE BLANK. a state-licensed loan originator who fails to maintain a valid license for a period of___years or longer shall be required to retake the nmls test. the nurse is teaching a class of expectant parents about changes that are to be expected during pregnancy. which changes would the nurse explain result from melanocyte stimulating hormone pls help ASAP!!! 40 points!!!!