Methanol and isopropyl alcohol are types of alcohol that are highly toxic and can cause death.
Methanol is extremely poisonous, and oral, pulmonary, and/or cutaneous exposures can result in serious systemic poisoning and even mortality. Because alcohol-based hand rubs typically contain ethanol, isopropyl alcohol, n-propyl alcohol, or mixtures of these alcohols, methanol must never be added to them.
It's critical to distinguish between isopropyl alcohol and methanol and ethylene glycol, which pose greater gastrointestinal risks. Although it increases the osmol gap, isopropyl alcohol does not raise anion gap acidosis, retinal toxicity (as methanol does), or kidney failure (as ethylene glycol does).
Since isopropanol is mainly metabolised to acetone, it usually causes less clinically serious effects when consumed than ethylene glycol or methanol.
To know more about methanol go through:-
https://brainly.com/question/26694084
#SPJ4
KBr + AgNO3 + KN03 + AgBr
Zn + 2HCI - H2 + ZnCl2
MgC03 + MgO + CO2
2Fe(OH)3 + Fe203 + 3H20
Na2CO3 + Ca(OH)2 + CaCO3 + 2NaOH
AgNO3 + HCI + AgCI + HNO3
Out of the chemical equations above, how many is (are)
considered as a double replacement reaction?
Two of the chemical equations above are considered as double replacement reactions.
- KBr + AgNO₃ → AgBr + KNO₃
- Na₂CO₃ + Ca(OH)₂ → CaCO₃ + 2NaOH
A double replacement reaction is a type of chemical reaction where two compounds react and exchange ions to form two new compounds. In order to determine if a chemical equation is a double replacement reaction, we need to see if the cations and anions in the reactants switch places to form new compounds.
In the first equation, the potassium ion (K⁺) and the silver ion (Ag⁺) switch places to form silver bromide (AgBr) and potassium nitrate (KNO₃). In the second equation, the sodium ion (Na+) and the calcium ion (Ca²⁺) switch places to form calcium carbonate (CaCO₃) and sodium hydroxide (NaOH). The other equations are either single replacement, decomposition, or combination reactions.
Learn more about double replacement reactions here:
https://brainly.com/question/31864474
#SPJ11
what are cells
1. the smallest things that can carry out life processes
2. parts of a molecule
3. parts of an atom
1.the smallest things that can carry out life proccess
The temperature of some air is minus 20 degrees C at 95kPa of pressure. What is the potential temperature, assuming a reference pressure at sea level (101.3kPa) ? Give your answer in degrees C, to the nearest degree.
The potential temperature is 15°C.
Given,The temperature of some air is minus 20 degrees C at 95 kPa of pressure.
Reference pressure at sea level = 101.3 kPa
The potential temperature (θ) is the temperature a parcel of dry air would have if it were adiabatically brought to a standard reference pressure, typically 1000 millibars (100 kPa).
Potential temperature is directly proportional to the absolute temperature and inversely proportional to the pressure in a system.
In order to find the potential temperature of the given air, we can use the formula below:
θ = T × (P0 / P)^(R/cp)
where,θ = potential temperature (in Kelvin)
T = temperature (in Kelvin)
P0 = reference pressure (in Pa)
P = actual pressure (in Pa)
R = gas constant for dry air (287 J/(kg·K))
cp = specific heat of dry air at constant pressure (1004 J/(kg·K))
Converting the given temperature in Celsius to Kelvin:
T = -20°C + 273.15K= 253.15K
The formula can be written as:
θ = T × (P0 / P)^(R/cp)θ
= 253.15 × (101300/95000)^(287/1004)θ
= 288.5 K
Converting the potential temperature from Kelvin to Celsius:
θ = 288.5 K - 273.15
= 15.35°C (to the nearest degree)'
= 15°C (rounded off to the nearest degree).
Therefore, the potential temperature is 15°C.
Learn more about the potential temperature from the given link-
https://brainly.com/question/4735135
#SPJ11
Write the products and balance the equation:
C4H7OH + O2 → CO2 +H2O
Answer:
C4H7OH + 6O2 => 4CO2 + 4H2O
Explanation:
hope This helps :)
calculate the energy (j) and wavelength (nm) of the photon emitted by the 4-1 transition in a hydrogen atom.
The energy and the wavelength of the photon emitted by the state 4-1 transition in the hydrogen atom is the energy is 2 × 10⁻¹⁸ J and the wavelength is 97.2 nm.
The wavelength expression is as :
1 / λ = R (1/ n2² - 1/n1²)
Where,
R = Rydberg constant = 1.09 × 10⁷ m⁻¹
n2 = 1
n1 = 4
1 / λ = 1.09 × 10⁷ ( 1/ 1² - 1/4²)
λ = 9.7 × 10⁻⁸ m
λ = 97.2 nm
The energy expression is as :
E = hc / λ
Where;
h = 6.26 × 10⁻³⁴ J.s
c = 3 × 10⁸ m/s
λ = 97.2 nm
E = ( 6.26 × 10⁻³⁴ × 3 × 10⁸ ) / 97.2
E = 2 × 10⁻¹⁸ J
The energy of the photon is 2 × 10⁻¹⁸ J.
To learn more about wavelength here
https://brainly.com/question/23824792
#SPJ4
what's a vacuum exactly
Answer:
Vacuum: space in which there is no matter or in which the pressure is so low that any particles in the space do not affect any processes being carried on there It is a condition well below normal atmospheric pressure and is measured in units of pressure (the pascal).-the internet gave me this answer so..
Explanation:
hope this helps :)
The Ka value for acetic acid, CH3COOH(aq), is 1.8x10^-5. Calculate the ph of a 2.80 M acetic acid solution.
PH=
Calculate the ph of the resulting solution when 3.00 mL of the 2.80 M acetic acid is diluted to make a 250.0 mL solution.
PH=
Answers are not 4.6 or 3.8
The pH of the solution containing 2.80 M acetic acid is 2.34.
Given, The Ka value for acetic acid, CH3COOH(aq), is 1.8x10^-5.Molar concentration of acetic acid, CH3COOH(aq), is 2.80 M.
Step 1 The equation for the ionization of acetic acid is as follows.CH3COOH(aq) + H2O(l) ⇆ H3O+(aq) + CH3COO-(aq)
Step 2Expression for Ka isKa = [H3O+][CH3COO-]/[CH3COOH(aq)]1.8 x 10-5 = [H3O+][CH3COO-]/2.80[H3O+] = √(Ka [CH3COOH(aq)]) = √(1.8 x 10-5 x 2.80) = 0.00462 M
Step 3pH = -log[H3O+] = -log(0.00462) = 2.34
So, the pH of the solution containing 2.80 M acetic acid is 2.34.
Acetic acid (CH3COOH) is a weak acid with a Ka value of 1.8x10⁻.
By utilizing this Ka value and the molar concentration of acetic acid, the pH of a 2.80 M acetic acid solution can be calculated.
Using the equation Ka = [H3O+][CH3COO-]/[CH3COOH(aq)], and after simplifying,
it can be determined that [H3O+] = √(Ka [CH3COOH(aq)]).
After substituting the values for Ka and [CH3COOH(aq)], [H3O+] is found to be 0.00462 M.
Finally, pH can be calculated by the expression pH = -log[H3O+], and we obtain the answer of pH=2.34.
To know more about acetic acid visit:
brainly.com/question/15202177
#SPJ11
Name a substance which will undergo changes from solid to liquid to gas between 0c and 100c
Answer:
WATER
Explanation:
Water melting point 0 c boiling 100c
Answer these questions to get marked as a BRAINLIEST!!!!
Answer:
c
Explanation:
Answer:
I think ur answer would be C.)
Explanation:
hope this helps <3
How many CARBON atoms are present in 2C3H8O3 ?
Answer:
b
Explanation:
How is a balanced chemical equation similar to a recipe? Explain
Explanation:
A balanced chemical equation is very similar to a recipe. Clicking on the s'more on the left will show you more of the similarities between cooking and stoichiometry. A balanced chemical equation gives you the ingredients (reactants) and the final food (products).
When energy decreases what happens to particle motion?
Answer:
When a substance is cooled, its internal energy decreases: the movement of its particles decreases. bonds between particles form when a substance condenses or freezes, or sublimes to form a solid from a gas. What is called energy? Energy is the capacity of a physical system to do work.
Explanation:
Water, also known as H2O, cannot be separated into hydrogen and oxygen.
Answer:
stands for the element hydrogen, and the O stands for the element oxygen. So, H2O means two atoms of hydrogen mixed with one atom of oxygen. All pure water is the same, two parts hydrogen to one part oxygen. ... Water cannot be separated by any physical means.
Explanation:
Water which is a compound, also known as H₂O, cannot be separated into hydrogen and oxygen by any physical means.
What is a compound?
Compound is defined as a chemical substance made up of identical molecules containing atoms from more than one type of chemical element.
Molecule consisting atoms of only one element is not called compound.It is transformed into new substances during chemical reactions. There are four major types of compounds depending on chemical bonding present in them.They are:
1)Molecular compounds where in atoms are joined by covalent bonds.
2) ionic compounds where atoms are joined by ionic bond.
3)Inter-metallic compounds where atoms are held by metallic bonds
4) co-ordination complexes where atoms are held by co-ordinate bonds.
They have a unique chemical structure held together by chemical bonds Compounds have different properties as those of elements because when a compound is formed the properties of the substance are totally altered.
Learn more about compound,here:
https://brainly.com/question/13516179
#SPJ6
What is the ph of a 205 ml sample of 2.668 m benzoic acid (c6h5cooh) (ka = 6.4 x 10-5)?
The pH of a 205 ml sample is 1.58.
Balanced chemical eqation for benzoic acid release proton in water:
C₆H₅COOH(aq) ⇄ C₆H₅COO⁻(aq) + H⁺(aq)
V(C₆H₅COOH) = 205 mL; volume of benzoic acid
c(C₆H₅COOH) = 2.668 M; concentration of benzoic acid
Ka = 6.4 x 10-5; acid constant of benzoic acid
c(C₆H₅COO⁻) = c(H⁺) = x; unknown concentration
Ka = (c(C₆H₅COO⁻) x c(H⁺)) / c(C₆H₅COOH)
6.4 x 10-5 = x² / 2.668 M - x
x² + (6.4 x 10-5)x - 1.7 x 10⁻⁴ = 0
Solve for x, using quadratic formula:
x = c(H⁺) = 0.026 M
pH = -logc(H⁺)
pH = -log0.026
pH = 1.58
More about acid: brainly.com/question/17825334
#SPJ4
9A. A sample of hydrogen at 1.56 atm had it's pressure decreased to 0.73
atm producing a new volume of 751 mL. What was its original volume? *
Answer:
351.43mL
Explanation:
To calculate the original volume of hydrogen gas in this question, the Boyle's law equation will be used. Boyle's law equation is:
P1V1 = P2V2
Where; P1 = initial pressure
V1 = initial volume
P2 = final pressure
V2 = final volume
According to this question, the P1= 1.56atm, V1 = ?, P2 = 0.73atm, V2 = 751mL
Hence;
P1V1 = P2V2
1.56 × V1 = 0.73 × 751
1.56 V1 = 548.23
V1 = 548.23/1.56
V1 = 351.43mL
Therefore, the original volume of hydrogen gas is 351.43 mL.
Magnesium hydroxide is only very slightly soluble in water. The reaction by which it goes into solution is: Mg(OH) 2 (s) rightleftharpoons Mg^ 2+ (aq)+2OH^ minus (a q) What will happen if O H minus is added to the solution and why?
Answer:
there will a definite decrease in solute solution
Explanation:
acid reaction acting upon negative charge.
4.23 x 10^23 molecules of Fe is how many liters of Fe?
Answer: 15.7 L Fe
Explanation:
\((\frac{4.23*10^{23} molecules Fe }{1} )*(\frac{22.4L Fe}{6.023*10^{23}molecules Fe } )= 15.7 L Fe\)
Basic mole conversion
The volume of 4.23 × 10²³ molecules of Fe is equal to 15.734 L.
What is Avogadro's number?Avogadro’s number can be represented as the number of entities in one mole of any substance. Generally, these entities can be molecules, electrons, protons, atoms, or ions, depending upon the chemical reaction or reactant and product.
The value of Avogadro’s number is approximately equal to 6.022× 10²³ mol⁻¹. We know that at STP the volume of any gas or substance is equal to 22.4 liters.
Given, the number of molecules of the Fe = 4.23 × 10²³
The volume of the one mole of Fe = 22.4 L
So 6.022 × 10²³ molecules of Fe have mass = 22.4 L
Then 4.23 × 10²³ Fe molecules will have the volume:
= 4.23 × 10²³ ×22.4/6.022× 10²³
= 15.734 L
Therefore, the volume of 4.23 × 10²³ molecules of Fe is 15.734 liters.
Learn more about Avogadro's number, here:
brainly.com/question/11907018
#SPJ5
What is the weight of a 15kg object on Earth.
Answer:
dang this was a week ago
Explanation:
lol
why should we care if people in other parts of the world pollute their drinking water?
Answer: This may seem unlikely for whereever you're living but say if a drought happened in your country and water is very limited, then we'd have to import water from other countries but if their water is unclean then we also have a problem of no water. Most bottled water sold in stores comes from other countries aswell.
chlorine has 7 valence electrons. with what group/family of elements will chlorine most likely bond with?
Chlorine is most likely to bond with elements from Group 1 (alkali metals) or other elements that can donate an electron to chlorine, allowing it to achieve a stable octet configuration.
Chlorine (Cl) has 7 valence electrons in its outermost energy level. In order to achieve a stable electron configuration, chlorine tends to gain one electron to complete its octet (8 valence electrons).
Based on its tendency to gain an electron, chlorine belongs to Group 17, also known as Group VIIA or the halogens, in the periodic table. The elements in Group 17 include fluorine (F), chlorine (Cl), bromine (Br), iodine (I), and astatine (At). All of these elements have 7 valence electrons and exhibit similar chemical behavior.
Chlorine can form bonds with elements from other groups by accepting an electron to achieve a stable electron configuration. For example, chlorine can readily react with elements from Group 1, such as sodium (Na), to form an ionic compound like sodium chloride (NaCl). In this case, chlorine gains an electron from sodium to achieve a full outer shell, and sodium loses an electron to also achieve a stable electron configuration.
In summary, chlorine is most likely to bond with elements from Group 1 (alkali metals) or other elements that can donate an electron to chlorine, allowing it to achieve a stable octet configuration.
learn more about alkali metals here
https://brainly.com/question/18534253
#SPJ11
what is a salient factor?
Answer:
technology is a silent factor
Explanation:
learned about it in computer class.
What is one disadvantage of using fossil fuels?
Answer:
Fossil fuels contribute to greenhouse gases, which is one of their major disadvantages. The most harmful for the environment is coal because it has many more harmful combustion products than other fossil fuels.
what evidence is there that joule had a exceptional education
Evidence is there that joule had a exceptional education are :
Joule was educated at home with private tutors. When he was child , his father hired leading scientist as the great scientist john Dalton to be his teacher. when he was young he had taken brewery and missed out university. other than this joule had exceptional education. They were taught chemistry , physics the scientific method. he study to continue in home based laboratory. in this laboratory he performed experiments before and after work. Joule gave relationship between heat , electricity and mechanical work but it was widely ignored but later on Thomson recognized joule's work .
Thus, Joule had a exceptional education .
To learn about Joule here
https://brainly.com/question/7637410
#SPJ1
A battery lighting a bulb is an example of ____energy converting to____energy.
magnetic
electrical
chemical
gravitational
heat
nuclear
kinetic
why is it better to use deionized water in chemistry experiments
which reaction is faster?why?
Answer:no answer
Explanation:
Temperature. Usually reactions speed up with increasing temperature. Physical state of reactants. Powders react faster than blocks - greater surface area and since the reaction occurs at the surface we get a faster rate.
two groups of students compare their winch results from an efficiency lab. the results are above. what explanation best explains why group 1 has a higher efficiency?
The group 1 has a higher efficiency because group 1 has a higher output power.
Efficiency - What Is It?Efficiency in chemistry is a comparison of the energy input and output in a specific system. Its definition is given by the equation and is expressed as the proportion of output to input energy: The representation of energy in the form of heat or power using this equation is quite common.
Efficiency is a function of input and output. Including waste and spoilage, output is the total amount of productive work completed (or work output). To create a percentage, efficiency is simply multiplied by 100.
To know more about power visit:
https://brainly.com/question/287674
#SPJ4
How many molecules are in 34.61 grams of sulfur dioxide?
Give your answer in scientific notation using the form M*10^N
Type your answer...
This problem is providing us with the mass of sulfur dioxide and the molecules contained are required. At the end, the result turns out to be 3.252x10²³ molecules, according to:
Avogadro's number:In chemistry, we use the Avogadro's number in order to successfully perform mole-mass-particles calculations. Defined as 6.022x10²³, it provides the number of atoms, molecules and ions in one mole of the substance.
In this case, in order to obtain the result, one first calculates the moles in 34.61 grams of sulfur dioxide and then utilize the Avogadro's number to obtain the number of molecules as shown below:
\(34.61gSO_2*\frac{1molSO_2}{64.1gSO_2}*\frac{6.022x10^{23}molecules}{1molSO_2} \\\\3.252x10^{23}molecules\)
Learn more about Avogadro's number: https://brainly.com/question/20091306
The picture shows two lightbulbs powered by a solar cell. Describe the
energy transfers that make the bulbs light, starting with energy from the
Sun.*
Answer:
light energy --> electric energy ----> light and heat energy by the bulb
Explanation:
The energy transfers that make the bulbs light, starting with energy from solar energy to electrical energy and from electrical energy to heat & light energy.
What is energy transfer?Transfer of energy is a process in which one form of energy will convert into other form of energy, and total energy during this conversion is conserved. When the solar energy comes from the Sun and falls on the solar panel, then PV cells that are present in the panel will absorb this solar energy and generate electrical charge. This electrical charges are responsible for the flow of internal electricity inside the cell.This generated electricity used by the bulbs to generate light energy as well as heat energy.
Hence, Solar energy will convert in to electrical energy which in turn converts into light and heat energy.
To know more about conservation of energy, visit the below link:
https://brainly.com/question/166559
Helpppppoop. Question 6 of 10
Which term best describes the state of matter modeled in the beaker?
A. Disorganized
B. Amorphous
C. Liquid
D. Solid
Answer:D. Solid
Explanation:
A. Disorganized
B. Amorphous
C. Liquid
D. Solid