Martha read 1/6of her library books on Saturday and 5/12 of her book on Sunday, how much more does Martha have left to read

Answers

Answer 1

Answer: She has 5/12 left of her book to read as well

Step-by-step explanation:

Answer 2

Martha read 1/6 books on Saturday and 5/12 books on Sunday, then the books left to read will be 5/12.

What are arithmetic Operations?

The four fundamental operations of arithmetic are addition, subtraction, multiplication, and division of two or even more items.

Included in them is the study of integers, especially the order of operations, which is important for all other areas of mathematics, notably algebra, data management, and geometry.

As per the given information in the question,

Books read by Martha on Saturday = 1/6

Books read by Martha on Sunday = 5/12

Then, the number of books left to read is,

1 - (1/6 + 5/12)

Take LCM as 12,

[12 - (2 + 5)]/12

= (12 - 7)/12

= 5 / 12

To know more about arithmetic operations:

https://brainly.com/question/25277954

#SPJ2


Related Questions

solve for x ~
\(3x - 16 = 2\)

thankyou ~​

Answers

The value of x from the expression is 6

Expression and equation

Given the equation

3x - 16 = 2

Add 16 to both sides

3x - 16 + 16 = 2 + 16

3x = 2 + 16

Simplify the result

3x = 18

Divide both sides by 3

3x/3 = 18/3

x = 6

Hence the value of x from the expression is 6

Learn more on equation here: https://brainly.com/question/2972832

The figure shows three tennis balls in a can with each tennis ball having a diameter of 2.5 inches. What is the total volume of the air space around the three tennis balls?

Answers

The total volume of the air space of spherical ball is A = 12.265625 inches³

Given data ,

Since each tennis ball has a diameter of 2.5 inches, the radius of each ball is 1.25 inches.

The air space around the balls can be thought of as a cylinder with a height equal to the diameter of one ball and a radius equal to the radius of one ball.

The height of the cylinder is 2.5 inches, and the radius is 1.25 inches.

The formula for the volume of a cylinder is:

V = πr²h

V = ( 3.14 ) ( 1.25 )² ( 7.5 )

V = 36.796875 inches³

where V is the volume, r is the radius, and h is the height.

So, the volume of the one ball is:

V₁ = ( 4/3 )π(1.25)³

V₁ = 8.177083 inches³

The total volume of three balls is = volume of 3 spherical balls

V₂ = 3V₁ = 3(8.177083) ≈ 24.53125 cubic inches

Therefore, the total volume of the air space around the three tennis balls is approximately A = 36.796875 inches³ - 24.53125 inches³

A = 12.265625 inches³

Hence , the volume of air space is A = 12.265625 inches³

To learn more about sphere click :

https://brainly.com/question/27933834

#SPJ1

3. One hundred million copper atoms are arranged in a line. Which is a reasonable estimate for the length of this line?
O
1 nanometer
1 kilometer
1 meter
1 centimeter

Answers

Answer:

D. I centimeter

Step-by-step explanation:

Since it is only 0.128 nm wide

0.128 nm x 100,000,000 =

1.28 centi meters

Answer:

D)  1 centimeter

Step-by-step explanation:

The SI base unit for length is meters (m).

The radius of a copper atom is 128 pm.

Picometer (pm) is a unit of length equal to 1 × 10⁻¹² meters.

Therefore, the radius of a copper atom in the SI base unit for length is:

\(\implies \sf 128 \times 10^{-12} = 1.28 \times 10^{-10}\;m\)

One hundred million = 100,000,000 = 1 × 10⁸

Therefore, the length of a line of one hundred million copper atoms in meters is:

\(\implies \sf 1 \times 10^{8} \times 1.28 \times 10^{-10}\)

\(\implies \sf 1.28 \times 10^{-10} \times 10^{8}\)

\(\implies \sf 1.28 \times 10^{-10+8}\)

\(\implies \sf 1.28 \times 10^{-2}\;\;m\)

Centimeter (cm) is a unit of length equal to 1 × 10⁻² meters.

To convert meters to centimeters, divide by 1 × 10⁻²:

\(\implies \sf \dfrac{1.28 \times 10^{-2}}{1 \times 10^{-2}}=1.28\;cm\)

Therefore, a reasonable estimate for the length of one hundred million copper atoms arranged in a line is 1 centimeter.

A flagpole casts a 32 ft. Shadow. A boy who is six feet tall is standing near the flagpole casting a 16 ft. Shadow. How tall is the flagpole?

Answers

Answer:

The flagpole is 12 feet

Step-by-step explanation:

The boy's shadow is half of the flagpole's shadow. So the flagpole is 2 times as much as 6 ft because the boy is six feet. 6 x 2 = 12. So the final answer is 12 ft.

Heeeelp please, Can be zero or not?
with all steps and explanay.​

Heeeelp please, Can be zero or not? with all steps and explanay.

Answers

The value of integral is 3.

Let's evaluate the integral over the positive half of the interval:

∫[0 to π] (cos(x) / √(4 + 3sin(x))) dx

Let u = 4 + 3sin(x), then du = 3cos(x) dx.

Substituting these expressions into the integral, we have:

∫[0 to π] (cos(x) / sqrt(4 + 3sin(x))) dx = ∫[0 to π] (1 / (3√u)) du

Using the power rule of integration, the integral becomes:

∫[0 to π] (1 / (3√u)) du = (2/3) . 2√u ∣[0 to π]

Evaluating the definite integral at the limits of integration:

(2/3)2√u ∣[0 to π] = (2/3) 2(√(4 + 3sin(π)) - √(4 + 3sin(0)))

(2/3) x 2(√(4) - √(4)) = (2/3) x 2(2 - 2) = (2/3) x 2(0) = 0

So, the value of integral is

= 3-0

= 3

Learn more about Definite integral here:

https://brainly.com/question/30760284

#SPJ1

Answer:

\(3-\displaystyle \int^{\pi}_{-\pi} \dfrac{\cos x}{\sqrt{4+3 \sin x}}\; \text{d}x\approx 0.806\; \sf (3\;d.p.)\)

Step-by-step explanation:

First, compute the indefinite integral:

\(\displaystyle \int \dfrac{\cos x}{\sqrt{4+3\sin x}}\; \text{d}x\)

To evaluate the indefinite integral, use the method of substitution.

\(\textsf{Let} \;\;u = 4 + 3 \sin x\)

Find du/dx and rewrite it so that dx is on its own:

\(\dfrac{\text{d}u}{\text{d}x}=3 \cos x \implies \text{d}x=\dfrac{1}{3 \cos x}\; \text{d}u\)

Rewrite the original integral in terms of u and du, and evaluate:

\(\begin{aligned}\displaystyle \int \dfrac{\cos x}{\sqrt{4+3\sin x}}\; \text{d}x&=\int \dfrac{\cos x}{\sqrt{u}}\cdot \dfrac{1}{3 \cos x}\; \text{d}u\\\\&=\int \dfrac{1}{3\sqrt{u}}\; \text{d}u\\\\&=\int\dfrac{1}{3}u^{-\frac{1}{2}}\; \text{d}u\\\\&=\dfrac{1}{-\frac{1}{2}+1} \cdot \dfrac{1}{3}u^{-\frac{1}{2}+1}+C\\\\&=\dfrac{2}{3}\sqrt{u}+C\end{aligned}\)

Substitute back u = 4 + 3 sin x:

                            \(= \dfrac{2}{3}\sqrt{4+3\sin x}+C\)

Therefore:

\(\displaystyle \int \dfrac{\cos x}{\sqrt{4+3\sin x}}\; \text{d}x= \dfrac{2}{3}\sqrt{4+3\sin x}+C\)

To evaluate the definite integral, we must first determine any intervals within the given interval -π ≤ x ≤ π where the curve lies below the x-axis. This is because when we integrate a function that lies below the x-axis, it will give a negative area value.

Find the x-intercepts by setting the function to zero and solving for x in the given interval -π ≤ x ≤ π.

\(\begin{aligned}\dfrac{\cos x}{\sqrt{4+3\sin x}}&=0\\\\\cos x&=0\\\\x&=\arccos0\\\\\implies x&=-\dfrac{\pi }{2}, \dfrac{\pi }{2}\end{aligned}\)

Therefore, the curve of the function is:

Below the x-axis between -π and -π/2.Above the x-axis between -π/2 and π/2.Below the x-axis between π/2 and π.

So to calculate the total area, we need to calculate the positive and negative areas separately and then add them together, remembering that if you integrate a function to find an area that lies below the x-axis, it will give a negative value.

Integrate the function between -π and -π/2.

As the area is below the x-axis, we need to negate the integral so that the resulting area is positive:

\(\begin{aligned}A_1=-\displaystyle \int^{-\frac{\pi}{2}}_{-\pi} \dfrac{\cos x}{\sqrt{4+3\sin x}}\; \text{d}x&=- \left[\dfrac{2}{3}\sqrt{4+3\sin x}\right]^{-\frac{\pi}{2}}_{-\pi}\\\\&=-\dfrac{2}{3}\sqrt{4+3 \sin \left(-\frac{\pi}{2}\right)}+\dfrac{2}{3}\sqrt{4+3 \sin \left(-\pi\right)}\\\\&=-\dfrac{2}{3}\sqrt{4+3 (-1)}+\dfrac{2}{3}\sqrt{4+3 (0)}\\\\&=-\dfrac{2}{3}+\dfrac{4}{3}\\\\&=\dfrac{2}{3}\end{aligned}\)

Integrate the function between -π/2 and π/2:

\(\begin{aligned}A_2=\displaystyle \int^{\frac{\pi}{2}}_{-\frac{\pi}{2}} \dfrac{\cos x}{\sqrt{4+3\sin x}}\; \text{d}x&= \left[\dfrac{2}{3}\sqrt{4+3\sin x}\right]^{\frac{\pi}{2}}_{-\frac{\pi}{2}}\\\\&=\dfrac{2}{3}\sqrt{4+3 \sin \left(\frac{\pi}{2}\right)}-\dfrac{2}{3}\sqrt{4+3 \sin \left(-\frac{\pi}{2}\right)}\\\\&=\dfrac{2}{3}\sqrt{4+3 (1)}-\dfrac{2}{3}\sqrt{4+3 (-1)}\\\\&=\dfrac{2\sqrt{7}}{3}-\dfrac{2}{3}\\\\&=\dfrac{2\sqrt{7}-2}{3}\end{aligned}\)

Integrate the function between π/2 and π.

As the area is below the x-axis, we need to negate the integral so that the resulting area is positive:

\(\begin{aligned}A_3=-\displaystyle \int^{\pi}_{\frac{\pi}{2}} \dfrac{\cos x}{\sqrt{4+3\sin x}}\; \text{d}x&= -\left[\dfrac{2}{3}\sqrt{4+3\sin x}\right]^{\pi}_{\frac{\pi}{2}}\\\\&=-\dfrac{2}{3}\sqrt{4+3 \sin \left(\pi\right)}+\dfrac{2}{3}\sqrt{4+3 \sin \left(\frac{\pi}{2}\right)}\\\\&=-\dfrac{2}{3}\sqrt{4+3 (0)}+\dfrac{2}{3}\sqrt{4+3 (1)}\\\\&=-\dfrac{4}{3}+\dfrac{2\sqrt{7}}{3}\\\\&=\dfrac{2\sqrt{7}-4}{3}\end{aligned}\)

To evaluate the definite integral, sum A₁, A₂ and A₃:

\(\begin{aligned}\displaystyle \int^{\pi}_{-\pi} \dfrac{\cos x}{\sqrt{4+3\sin x}}\; \text{d}x&=\dfrac{2}{3}+\dfrac{2\sqrt{7}-2}{3}+\dfrac{2\sqrt{7}-4}{3}\\\\&=\dfrac{2+2\sqrt{7}-2+2\sqrt{7}-4}{3}\\\\&=\dfrac{4\sqrt{7}-4}{3}\\\\ &\approx2.194\; \sf (3\;d.p.)\end{aligned}\)

Now we have evaluated the definite integral, we can subtract it from 3 to evaluate the given expression:

\(\begin{aligned}3-\displaystyle \int^{\pi}_{-\pi} \dfrac{\cos x}{\sqrt{4+3 \sin x}}\; \text{d}x&=3-\dfrac{4\sqrt{7}-4}{3}\\\\&=\dfrac{9}{3}-\dfrac{4\sqrt{7}-4}{3}\\\\&=\dfrac{9-(4\sqrt{7}-4)}{3}\\\\&=\dfrac{13-4\sqrt{7}}{3}\\\\&\approx 0.806\; \sf (3\;d.p.)\end{aligned}\)

Therefore, the given expression cannot be zero.

Heeeelp please, Can be zero or not? with all steps and explanay.

Determine if the equation given in slope-intercept form represents the graph. If the equation is correct support your reasoning with why it is correct. if the equation is incorrect give the correct slipe-intercept form explaining how you determined it​

Determine if the equation given in slope-intercept form represents the graph. If the equation is correct

Answers

Since the y-intercept of the line is (0,1) and the line passes through the point (2,4) which is also satisfied by the equation of the line, the given equation represents the graph of the line.

What is the slope-intercept form of a line?

The slope-intercept form of a line is y = mx +c where m is the slope of the line and c is the y-intercept.

The given equation of the line is y = (3/2)x + 1.

To find the y-intercept of the line, substitute x = 0 into the given equation,

y = (3/2)(0) + 1

y = 1

Note that the y-intercept of the graph of the line is also 1.

The graph of the line passes through points (2,4).

To verify whether the equation satisfies the coordinates of (2,4) or not, substitute the coordinates of the point into the given equation:

4 = (3/2)(2) + 1

4 =4

The equation is true.

Hence, it can be said that the given equation represents the graph of the line.

To learn more about the slope-intercept form of a line, click here:

https://brainly.com/question/9682526

#SPJ1

What’s the correct answer for this?

Whats the correct answer for this?

Answers

Answer:

B

Step-by-step explanation:

If we dilate point P with point P as center, it would become a line parallel to line m

The correct answer is B

Solve the formula V = T12h for r.​

Solve the formula V = T12h for r.

Answers

Answer:

B.

Step-by-step explanation:

The whole aim here is to get r on it's own. So we have to begin by dividing both sides by pi.

V / pi = hr^2

Then, to further get r on it's own, we have to divide both sides by h. This would put it under the fraction with pi.

V/(pi*h) = r^2

Then, finally, we have to square root both sides.

sqrt(V/(pi*h)) = r

So the answer is B.

The area of a rectangle is 2 square feet. The perimeter of the rectangle
is 9 ft. Find the length, 1, and width, w, of the rectangle. What is 12 + W2?

Answers

Answer:

The area of the rectangle is 72 square feet

Step-by-step explanation:

The measure of an angle is 1°. Find the measure of the complement.

Answers

The measure of the complement of a 1-degree angle is 89 degrees.

The complement of an angle is defined as the angle that, when added to the given angle, results in a sum of 90 degrees. To find the measure of the complement of a 1-degree angle, we need to determine the angle that, when added to 1 degree, equals 90 degrees.

Let's denote the measure of the complement as x degrees. According to the definition, we can set up the equation:

1 degree + x degrees = 90 degrees.

To solve for x, we need to isolate it on one side of the equation. By subtracting 1 degree from both sides, we have:

x degrees = 90 degrees - 1 degree.

Simplifying the right side, we get:

x degrees = 89 degrees.

In summary, when an angle measures 1 degree, its complement measures 89 degrees. Complementary angles are pairs of angles that add up to 90 degrees. In this case, since the given angle measures only 1 degree, its complement is significantly larger, nearly forming a right angle. The concept of complementary angles is fundamental in geometry and can be applied to various problems involving angles and their relationships.

For more such questions on complement

https://brainly.com/question/16281260

#SPJ8

25. There are 5 teams in a netball competition. Each team must play each other twice. How many games will team play? A. 10 B. 5 C. 8 D. 4






⛑help again please anyone I got a lot of ⚣ homework to do so I'll ask answers for all of them throughout the night >_<​

Answers

Answer:

C-8

Step-by-step explanation:

5 games they each play each other they continue if each team wins then they continue to play to 8 games

Answer:

The answer to your problem would be 10

Step-by-step explanation:

There are 5 teams. So, if each team has to play each other twice, 5x2=10.

Each team plays twice....I think I did that right. I'm really sorry if it's not right.

1 3/4 x 4 2/6 nnnnnnnnnnn

Answers

The result of the multiplication operation yields 7 7/12

Multiplication of numbers

From the question, we are to multiply the given fractions. The given fractions are

1 3/4 and 4 2/6

First, we will convert the fractions to improper fractions

Converting 1 3/4 to an improper fraction

1 3/4 = 7/4

Converting 4 2/6 to an improper fraction

4 2/6 = 26/6

Thus,

The multiplication operation becomes

7/4 × 26/6

= 7/4 × 13/3

= 91/12

= 7 7/12

Hence, the product of the given numbers is 7 1/12

Learn more on Multiplication of numbers here: https://brainly.com/question/858368

#SPJ1

(6.2 x 10²) x (3.5 x 10³)

Answers

Answer:

\(21.7 x 10^5\)

Step-by-step explanation:

(6.2 x 10²) x (3.5 x 10³)

First, multiply the coefficients: 6.2 x 3.5 = 21.7.

Then, add the exponents: 10² x 10³ = 10^(2+3) = 10^5.

Therefore, the result is 21.7 x 10^5.

Answer:

3286000

Step-by-step explanation:

(6.2 x 10) x (3.5 x 10)

i need help pleaseeee!!!

i need help pleaseeee!!!

Answers

a. The number of red roses left t hours after the store opens \(R(t) = 400/2^{t/2}\)    

b. The number of boxes of chocolate left t hours C(t) = 200 - 0.15t

c. One possible solution is t ≈ 7.546 hours after the store opens.

d. there are 194 boxes of chocolates left.

e. you need to arrive at the store no later than 7.504 hours after it opens.

How to find the number of red roses left ?

a. The proportion (relative frequency) of times an event is anticipated to occur when an experiment is repeated a large number of times under identical conditions is known as the probability of the event.:

\(R(t) = 400/2^{t/2}\)

b. Let C(t) be the quantity of boxes of chocolate left t hours after the store opens. At first, there are 200 boxes, of which 15% are purchased every hour. We can therefore write:

C(t) = 200 - 0.15t

c. We must solve the equation R(t) = C(t) in order to determine the time at which the number of boxes of chocolates and the number of roses are equal. We obtain: by substituting the formulas we discovered in parts a and b:

\(400/2^{t/2} = 200 - 0.15t\)

Simplifying this equation, we get:

\(2^{t/2 + 1} + 0.15t - 400 = 0\)

We can solve this equation numerically, using a calculator or a computer program. One possible solution is t ≈ 7.546 hours after the store opens.

d. At 12:30 in the early evening, which is 3.5 hours after the store opens, we can utilize the recipe we tracked down to some extent b to work out the quantity of boxes of chocolates left:

C(3.5) = 200 - 0.15(3.5) = 194.25

We ought to adjust this solution to appear to be legit with regards to the issue. Since we cannot have a fraction of a box, we can round to the nearest integer and state that there are 194 chocolate boxes remaining.

e. To buy 36 red roses, we need to solve the equation R(t) = 36. Substituting the formula we found in part a, we get:

\(400/2^{t/2}= 36\)

Simplifying this equation, we get:

2^(t/2) ≈ 11.111

Taking the logarithm of both sides, we get:

t/2 ≈ log2(11.111)

t ≈ 2 log2(11.111)

Using a calculator, we get:

t ≈ 7.504 hours after the store opens.

Therefore, you must arrive at the store no later than 7.504 hours after it opens in order to purchase 36 red roses.

know more about logarithm visit:

https://brainly.com/question/30085872

#SPJ1

a data set has a mean of 154 and a standard deviation of 12. compute the coefficient of variation. question 17 options:

Answers

The coefficient of variation for the given data set is approximately 7.7922%.

The coefficient of variation (CV) is a measure of relative variability that expresses the standard deviation as a percentage of the mean. It is often used to compare the variability of different data sets with different units or scales.

To compute the coefficient of variation, we first divide the standard deviation by the mean:

CV = (standard deviation / mean) x 100%

Substituting the given values, we get:

CV = (12 / 154) x 100% = 7.7922%

Therefore, the coefficient of variation for the given data set is approximately 7.7922%. This means that the standard deviation is about 7.8% of the mean, which indicates a moderate degree of relative variability.

To know more about coefficient of variation:

https://brainly.com/question/13293164

#SPJ4

_____The given question is incorrect, the correct question is given below:

a data set has a mean of 154 and a standard deviation of 12. compute the coefficient of variation.

Bookwork code: N84
Look at the poster below showing the price of pencils in a stationery shop.
Annabel wants to buy exactly 76 pencils. What is the lowest amount she can
pay?
Give your answer in pounds (£).
spar
..
Pencils for sale!

30p each

Pack of 10
pencils for £2

Answers

Based on mathematical operations, the lowest amount that Annabel can pay for pencils is $15.20

How is the lowest amount determined?

The lowest amount that Annabel can pay for pencils can be determined using the mathematical operations of multiplication and division.

Multiplication and division are two of the four basic mathematical operations, including addition and subtraction.

If Annabel chooses to purchase the first pencil at 30p each, she would pay £22.80 (£0.30 x 76).

If Annabel chooses to purchase the second pencil class of a pack of 10 pencils for £2, she would pay £15.20 [£2 x (76 ÷ 10)].

Pencils for sale

30p each

Pack of 10 pencils for £2

Thus, if Annabel wants to buy the pencils, she can either pay £15.20 or £22.80, but using mathematical operations, the lowest amount she can pay is £15.20.

Learn more about mathematical operations at https://brainly.com/question/4721701.

#SPJ1

Brand A and brand B of frozen green beans both list a weight of 32 ounces on their bags. Because of variability in the manufacturing process, the bags often contain slightly more, or less, than 32 ounces of green beans. An inspector takes a random sample of 25 bags of green beans of each type and records their weights. The weights and their relative frequencies are summarized in the histograms. 2 histograms comparing brand A and brand B of green beans. The median weight for brand B is less than the median weight of brand A. Which of the following is a true statement when comparing the bags of green beans? The median weight for both types is between 32.1 and 32.2 ounces. The median weight for both types is between 32.0 and 32.1 ounces. The median weight for brand B is less than the median weight of brand A. The median weight for brand B is greater than the median weight of brand A.

Answers

Answer:

The answer is: B.)32.0–32.1 ounces

Step-by-step explanation:

Got it right on my test

The true statement is The median weight for both types is between 32.0 and 32.1 ounces.

What is data?

Data is referred to as a collection of information gathered by observations, measurements, research, or analysis. It may comprise facts, figures, numbers, names, or even general descriptions of things. Data can be organized in the form of graphs, charts, or tables for ease in our study.

Given:

Brand A and brand B of frozen green beans both list a weight of 32 ounces on their bags.

The median weight for brand B is less than the median weight of brand A.

So, if both brands weigh 32 ounces then the median weight for both types is between 32.0 and 32.1 ounces.

Learn more about data here:

https://brainly.com/question/10980404

#SPJ6

A voter in the upcoming election has many different types of issues on the ballot. Of the issues on the ballot, 7 are school related, 10 are ordinance related, and 2 are library related. If a single issue is picked at random, what is the probability that the issue is school or library related?

Answers

The probability of randomly picking a school or library-related issue from the ballot is 9/19 or approximately 0.474 (rounded to three decimal places).

To determine the probability of a randomly picked issue being school or library related, you'll need to consider the total number of issues and the number of school and library issues combined.

There are 7 school-related issues, 10 ordinance-related issues, and 2 library-related issues, making a total of 19 issues on the ballot. To find the probability of picking a school or library issue, combine the number of school and library issues: 7 + 2 = 9.

Now, divide the number of school and library issues (9) by the total number of issues (19): 9/19.

To learn more about : probability

https://brainly.com/question/13604758

#SPJ11

Convert the rectangular coordinates (5,−5√3) to polar form. Let r>0 and 0≤θ<2π.

Enter your answer by filling in the boxes. Enter coordinates as simplifed fractions or radicals in simplest form.

( , )

Answers

Answer:

(10, 5π/3)

Step-by-step explanation:

To convert rectangular coordinates (5, -5√3) to polar form, we can use the following formulas:

r = √(x^2 + y^2)

θ = arctan(y/x)

Substituting the given values, we get:

r = √(5^2 + (-5√3)^2) = √(25 + 75) = √100 = 10

θ = arctan((-5√3)/5) = arctan(-√3) = -π/3

Note that the value of θ is in the fourth quadrant, which corresponds to a negative angle. However, we need to express the angle θ in the range 0 ≤ θ < 2π. To do this, we can add 2π to the angle if it is negative:

θ = -π/3 + 2π = (5π/3)

Therefore, the rectangular coordinates (5, -5√3) in polar form are (10, 5π/3).

What is the recursive formula for this arithmetic sequence?
-7, -1, 5, 11, ...

What is the recursive formula for this arithmetic sequence?-7, -1, 5, 11, ...

Answers

Answer:

The answer is A

Step-by-step explanation:

why it is a is...

the first like is the # your arithmetic sentence starts with which is -1

the second line is what you do to get to the next #

each time you are adding 6

An arithmetic sequence is a sequence of integers with its adjacent terms differing with one common difference. The correct option is A.

What is an arithmetic sequence?

An arithmetic sequence is a sequence of integers with its adjacent terms differing with one common difference.

The explicit formula for any arithmetic series is given by the formula,

\(a_n = a_1 + (n-1)d\)

Also, the recursive formula for any arithmetic series is given by the formula,

\(a_n = a_{(n-1)} + d\\\\\)

Or, it can be also written as,

\(a_{(n+1)} = a_{n} + d\)

where d is the difference and a₁ is the first term of the sequence.

For the given arithmetic sequence, the common difference can be written as,

Common difference = -1 - (-7)

                                  = -1 + 7

                                  = 6

Now, the recursive formula for this arithmetic sequence can be written as,

\(a_n = a_{(n-1)} + 6\)

Also, the first term of the given arithmetic series is -7.

a₁ = -7

Hence, the correct option is A.

Learn more about Arithmetic Sequence:

https://brainly.com/question/3702506

#SPJ5

A small apple tree produced exactly five apples last year. Their weights, in grams, are listed below. 88,97,90,93,82 What is the standard deviation of this data set? Round the final answer to one decimal place.

Answers

Answer:"answer_steps": ["To calculate the standard deviation, we need to know the weights of each apple and the total number of apples. nnWeight (g) nApples (n) ", "Standard deviation nn88, 97, 90, 93, 82 n5 0.16"]}

Step-by-step explanation:

Please help find the answer. Thank You!

Please help find the answer. Thank You!

Answers

Answer:

Step-by-step explanation:

208

Round 819559 to the nearest ten.

Answers

Answer:

819560

Step-by-step explanation:

The "59" in 819559 rounds up to 60 since 59 is closer to 60 than to 50.

Answer:

819560

Step-by-step explanation:

the rules of rounding are simple.

since we're rounding to the nearest ten, we take a look at the ones place. if the one is a five or above, we go ahead and round. if it's lower than five, then turn it into a zero, and all the other places stay the same.

the ones place is a nine, so we would round up. turn the one into a zero, and turn the five in the tens place into a six. all the other numbers stayed the same. now, let's just imagine that the nine in the ones place is a three. we round down. turn it into a zero, and all the other numbers stay the same.

hope this helped :)

Please look at the photo. Thank you.

Please look at the photo. Thank you.

Answers

a) A function that gives the area of the playground (in square meters) in terms of x is A(x) = 60x - x².

b) The side length that gives the maximum area that the playground can have is x = 30 m.

c) The maximum area that the playground can have is 900 m².

How to calculate the perimeter of a rectangle?

In Mathematics and Geometry, the perimeter of a rectangle can be calculated by using this mathematical equation (formula);

P = 2(L + W)

Where:

P represent the perimeter of a rectangle.W represent the width of a rectangle.L represent the length of a rectangle.

By substituting the given side lengths, we have:

120 = 2(x + W)

60 = x + W

W = 60 - x

Therefore, the area of the rectangular playground (in terms of x) is given by this function;

A = LW

A(x) = x(60 - x)

A(x) = 60x - x²

Part b.

For the side length, we would take the first derivative of the area:

A(x) = 60x - x²

A'(x) = dA/dx

A'(x) = 60 - 2x

60 - 2x = 0

x = 60/2

x = 30 m

Part c.

W = 60 - x

W = 60 - 30

W = 30 m.

Therefore, the maximum area is given by;

A = 30 × 30

A = 900 m².

Read more on perimeter of a rectangle here: brainly.com/question/26787666

#SPJ1

Lavon wants to make scrambled eggs for breakfast. He had 2/3 of a carton of eggs. A full carton contains 12 eggs. Lavon uses 1/2 of the eggs to make scrambled eggs. What part of the carton remains after Lavon makes the scrambled eggs

Answers

Answer:

1/3

Step-by-step explanation:

8 ÷ 2 =4

12 ÷ 4 =3

1 to the exponent of 3.

On a 7 question multiple-choice test, where each question has 2 answers, what would be the probability of getting at least one question wrong?Give your answer as a fraction

Answers

Solution

- This is a Binomial probability question. The formula for Binomial probability is:

\(\begin{gathered} P(r)=\sum\text{ }^nC_rp^rq^{n-r} \\ where, \\ n=The\text{ total number of trials} \\ r=\text{ The number of successful trials\lparen where answer is correct\rparen} \\ p=\text{ The probability of success \lparen The probability of getting a question } \\ right) \end{gathered}\)

- We have been given:

\(\begin{gathered} n=7 \\ \text{ since there can only be two answers, it means that the} \\ \text{ probability of getting a question correct is:} \\ p=\frac{1}{2} \\ q=1-p=\frac{1}{2} \\ \\ \text{ The probability of getting at least 1 question wrong means the } \\ probability\text{ of getting 1, 2, 3, 4, 5, 6, or 7 question wrong.} \\ \\ \text{ Instead of calculating all these probabilities, we can simply say} \\ P(1)+P(2)+P(3)+P(4)+P(5)+P(6)+P(7)=1-P(0) \end{gathered}\)

- Thus, we have:

\(\begin{gathered} P(0)=^7C_0(\frac{1}{2})^0(\frac{1}{2})^7 \\ P(0)=\frac{1}{128} \\ \\ 1-P(0)=1-\frac{1}{128}=\frac{127}{128} \end{gathered}\)

Final Answer

The answer is

\(\frac{127}{128}\)

A farmer wants to build a fence around a rectangular area to serve as a petting zoo for visitors. The farmer has 64 feet of fencing and wants the area to be as large as possible. If the length of the fenced-in area is 3 times the width, what is the length of the fenced-in area? 8 feet O 16 feet O24 feet 48 feet​

Answers

The length of the fenced-in area is C. 24 feet.

What is the length?

The length is the distance between one point and the end of the longer side of a rectangular or one side of a square.

The length is multiplied by the width to obtain the area, which is the two-dimensional space occupied by an object.

The perimeter is the sum of the two length sides and the two width sides.

The perimeter of the fencing = 64 feet

We know that perimeter = 2(L + W)

Based on the scenario, let width = x and length = 3x

This implies that the perimeter = 2(3x + x)

64 = 6x + 2x

6x + 2x = 64

8x = 64

x = 8

The width is therefore 8 feet.

Length = 24 feet (3 x 8)

Check:

Perimeter = 2(L + W)

Length = 24

Width = 8

2(L + W) = 2(24 + 8)

= 48 + 16

= 64

Thus, the length of the fencing is C. 24 feet.

Learn more about length at https://brainly.com/question/15161439

#SPJ1

5 of 8  Enlarge shape A by scale factor 0.5 with centre of enlargement (2, -2). (Image) What are the coordinates of the vertices of the image? 

Answers

The coordinates of the vertices of the image if the scale factor of 0.5 with center of enlargement (2, -2) is (1, -1), (2, 0) and (3, 1)

What is an equation?

An equation is an expression that shows the relationship between two or more variables and numbers.

Dilation is the increase or decrease in the size of a figure by a scale factor.

Let us assume that shape A have vertices at (0, 0), (2, 2) and (4, 4)

If the center of dilation is (a, b) with a scale factor of k, the new point is (k(x - a) + a, k(y - b) + b)

Hence the new point is at (1, -1), (2, 0) and (3, 1)

The coordinates of the vertices of the image if the scale factor of 0.5 with center of enlargement (2, -2) is (1, -1), (2, 0) and (3, 1)

Find out more on equation at: https://brainly.com/question/2972832

#SPJ1

Help me please and thank you..

Help me please and thank you..

Answers

Answer:

You will move each point of this shape 1 unit into the right. Then will move each point of this shape 2 units down. The draw line between each point.

2021: Sales Revenues = $800,000. Cost of good sold = $350,000
2020: Sales Revenues = $795,000. Cost of good sold = $600,000

Answers

Answer:

Step-by-step explanation:

Sales Revenue:  $800.00

Cost of good sold:  $350,000.00

Subtract:                   $450,000.00

Sales Revenue:         $795,000.00

Cost of good sold:     $600,000.00

Subtract Sales             $195,000.00

Revenue from Cost

of goods sold.

Other Questions
what type of budget philosophy does the federal government appear to be following? Using ACE form and the story the necklace by Guy de Maupassant PLZZ HELP due at midnight1. Why do you think Mademoiselle Forestier never contacted Madame Loisel before the return of her necklace?2. Why did Mademoiselle Forestier not recognize Madame Loisel when they met in the Champs-Elysees? What is a lot-sizing technique that orders the quantity needed during a predetermined time between orders? a. wagner-whitin b. eoq c. part period balancing d. poq when a company has a complex capital structure, it must report both basic and diluted earnings per share. true false yes ,hamburger and french fries What document s must be filed with the state to form a limited liability company? community banks is being sued for intentionally violating the truth in lending act. what fines and imprisonment possibilities can the company face? Three of the following statements are fused sentences. Choose the one correctlypunctuated statement that is not a fused sentence.Select one:O a. The average 2016 university graduate has almost $40,000 in student loandebt consequently lawmakers are discussing how to make higher educationmore affordable.Ob. The average 2016 university graduate has almost $40,000 in student loandebt lawmakers are discussing how to make higher education moreaffordableOC. The average 2016 university graduate has almost $40,000 in student loandebt; consequently, lawmakers are discussing how to make higher educationmore affordable.O d. The average 2016 university graduate has almost $40,000 in student loan Animal control picked up 42 animals off the streets last month. Dogs made up of the animals. Cats made up of animals. Horses made up the remainder of the animals. How many animals picked up last month were horses? 6 horses 7 horses 13 horses 1 horse A rock is 7 feet below the surface of a river. If its position can be recorded as 7 feet, what would the position of 0 represent? (5 points)Question 3 options:1) On the surface of the river2) At the bottom of the river3) 7 feet above the surface of the river4) 7 feet below the surface of the river can someone correct me Im kinda bad at this plz I beg u where do u get the 150 out of the answer (x+150 (x-10) in the equation x^2+140x-1500? All of the following should be done post-repair EXCEPT: Why Woman in colonial America want to write ? Check the two best answers. 0 for a chance to better express themselves 0 to prove their ability 0 As an opportunity to make money 0 because men encourage them to do so design, synthesis, and evaluation of substrate analogue inhibitors of trypanosoma cruzi ribose 5-phosphate isomerase type b What mod7 number is equivalent to 21 (mod7) How do you find the missing side of a triangle without a calculator? Many of the current agricultural techniques can have negative environmental effects. Briefly describe two of these environmental impacts, one that contributes directly to global warming, and another that is not related to increasing carbon emissions. For each, explain a strategy that can be implemented to mitigate the environmental impact. command question exclamation statement pot empty (a) The perimeter of a rectangular garden is 320 m.If the length of the garden is 94 m, what is its width?Width of the garden: