Mark u brainliest and give 30 points.No random answers and pls give answers with explanation/steps or i will report u.​

Mark U Brainliest And Give 30 Points.No Random Answers And Pls Give Answers With Explanation/steps Or

Answers

Answer 1

Answer:

I use equal signs throughout but they are meant to be less than or equal to signs.

s=sandwiches

4.5s+6 less than or equal to 50

The answer is s is less than or equal to 12

Step-by-step explanation:

Finding Inequality

1. we know everything costs 50 in total so that is on one side of the equal sign.

____=50

2. we know he already spent 6 dollars so the money he can spend is 6 dollars less.

____+6=50

3. Each sandwich costs 4.50 $ so how much money does he have left to spend? we figure that out by multiplying the price by the number of sandwiches.

4.5s+6=50

Solving

1. 4.5s-6=50

First use the addition property of equality and add 6 to both sides.

2. 4.5s=56

Then use the division property of equality and divide each side by 4.5

3. you get a decimal but since you can't buy half a sandwich the answer is

s is less than or equal to 12


Related Questions

Use a area model. 2 1/2 x 1/3

Answers

The area of the expression  2 1/2 x 1/3 Using an area model is 5/6.

What is the area model?

The area model is a method of calculating area by parts.

Given that, we are asked to find the area of the expression 2 1/2 x 1/3 Using an area model,

Area =

=(212).(13)=2.13+12.13=23+16=1518=56

Hence, the area of the expression  2 1/2 x 1/3 Using an area model is 5/6.

Learn more about area model, click;

https://brainly.com/question/29213448

#SPJ1

20 points thank you to who ever

20 points thank you to who ever

Answers

Answer:

uh

Step-by-step explanation:

couldnt figure out how to leave XD

Graph the solution set of the system. Please my graph to point.-2x-y ≥2 y ≥-2 x ≥-4

Graph the solution set of the system. Please my graph to point.-2x-y 2 y -2 x -4

Answers

To graph the solution set of the system, first, we have to graph each inequality.

First, express each inequality as an equation.

2xy=2y=2x=4

Then, graph each equation, they represent lines. The second and third equations are horizontal and vertical lines, respectively. While the first equation has an inclination, to graph the first one, we have to find the zeros of the equation.

Y - INTERCEPT (x = 0).

2(0)y=2y=2

The y-intercept is (0,-2).

X - INTERCEPT (y = 0).

2x0=22x=2x=22x=1

The x-intercept is (-1,0).

Using the intercept points, we can draw the line. Also, let's draw the other two.

Once we have all the lines, evaluate the inequalities to see which area is the solution.

y ≥-2 indicates that all the real numbers above or equal to -2 must be the solution.

x ≥-4 indicates that all the real numbers on the right of the line must be the solution.

Now, evaluate the first inequality with a test point (0,0).

2xy22(0)0202

But, we know that zero is not greater than 2, which means the solutions must be below the red line because it can't include the point (0,0).

Unite all three areas to get the final solution set.

Therefore, the purple triangle represents the solution set.
Graph the solution set of the system. Please my graph to point.-2x-y 2 y -2 x -4
Graph the solution set of the system. Please my graph to point.-2x-y 2 y -2 x -4

No more crazy people plz just answer this question

No more crazy people plz just answer this question

Answers

Answer:

y= 1 3/7

Step-by-step explanation:

y= 10/7 in simplest form is 1 3/7

Answer:

Solution given:

y=6x+10/7

comparing above equation with y=mx+c

y intercept =c=10/7

is this right? someone please check?

is this right? someone please check?

Answers

Answer:

The answer looks correct.

Step-by-step explanation:

All the other option doesn't match the above question's statement.

The last answer is the correct (in my opinion)

Answer:

Absolutely Correct

Step-by-step explanation:

Based on the definition of midpoint;

It is equidistant from both endpoints, and it is the centroid both of the segment and of the endpoints.

meaning the distance from the midpoint to one end is the same as the distance to the other end

the measure of ∠abc in the figure is x°. which of the following is an expression for β° ?

Answers

An expression for the measure  β° is 180 - x

The correct answer is an option (d)

We know that the sum of four angles of the quadrilateral is always 360°

In the attached quadrilateral angle A and angle D measures 90 degrees respectively.

The measure of ∠ABC in the figure is x° and the measure of ∠BCD is β°

From above statement for quadrilateral ABCD we have,

⇒ ∠A + ∠B + ∠C + ∠D = 360°

⇒ 90° + x°+ β° + 90° = 360°

⇒ x° + β° = 360° - 180°

⇒ x° + β° = 180°

⇒ β = 180 - x

Therefore, the required expression is β = 180 - x

The correct answer is an option (d)

Learn more about the expression here:

https://brainly.com/question/1859113

#SPJ4

Find the complete question below.

the measure of abc in the figure is x. which of the following is an expression for ?
the measure of abc in the figure is x. which of the following is an expression for ?

The number of people who live in a unit of area is called the population density of the area. It usually given as people "per square mile" or "per square kilometer".

A map of the Orchard Hill Neighborhood is shown. The population of the Orchard Hill Neighborhood is 360 people. The lenght of each block is the same and the lenght of 20 blocks is 1 mile.

What is the area in square miles of Orchard Hill?

A. 0.35 square mile

B. 0.03 square mile

C. 0.15 square mile

D. 0.60 square mile​

The number of people who live in a unit of area is called the population density of the area. It usually

Answers

Answer: 0.03

Step-by-step explanation:

1 block = 1/20 mile = 0.05 miles

4(0.05) = 0.20

3(0.05) = 0.15

A=l•w=0.20(0.15)=0.03

The area of the Orchard Hill is 0.03 square miles if the length of each block is the same and the length of 20 blocks is 1 mile, option (A) is correct.

What is the area of the rectangle?

It is defined as the area occupied by the rectangle in two-dimensional planner geometry.

The area of a rectangle can be calculated using the following formula:

Rectangle area = length x width

We have:

20 blocks = 1 mile

1 block = 1/20 miles = 0.05 miles

Length of 3 blocks = 3×0.05 = 0.15 miles

Length of 4 blocks = 4×0.05 = 0.20 miles

Area of the Orchard Hill = 0.15×0.20 = 0.03 square miles

Thus, the area of the Orchard Hill is 0.03 square miles if the length of each block is the same and the length of 20 blocks is 1 mile, option (A) is correct.

Learn more about the rectangle here:

https://brainly.com/question/15019502

#SPJ2

1. (5 pts) The (per hour) production function for bottles of coca-cola is q=1000K L

, where K is the number of machines and L is the number of machine supervisors. a. (2 pts) What is the RTS of the isoquant for production level q? [Use the following convention: K is expressed as a function of L b. (1 pt) Imagine the cost of operating capital is $40 per machine per hour, and labor wages are $20/ hour. What is the ratio of labor to capital cost? c. (2 pts) How much K and L should the company use to produce q units per hour at minimal cost (i.e. what is the expansion path of the firm)? What is the corresponding total cost function?

Answers

The RTS of the isoquant is 1000K, indicating the rate at which labor can be substituted for capital while maintaining constant production. The labor to capital cost ratio is 0.5. To minimize the cost of producing q units per hour, the specific value of q is needed to find the optimal combination of K and L along the expansion path, represented by the cost function C(K, L) = 40K + 20L.

The RTS (Rate of Technical Substitution) measures the rate at which one input can be substituted for another while keeping the production level constant. To determine the RTS, we need to calculate the derivative of the production function with respect to L, holding q constant.

Given the production function q = 1000KL, we can differentiate it with respect to L:

d(q)/d(L) = 1000K

Therefore, the RTS of the isoquant for production level q is 1000K.

The ratio of labor to capital cost can be calculated by dividing the labor cost by the capital cost.

Labor cost = $20/hour

Capital cost = $40/machine/hour

Ratio of labor to capital cost = Labor cost / Capital cost

                              = $20/hour / $40/machine/hour

                              = 0.5

The ratio of labor to capital cost is 0.5.

To find the combination of K and L that minimizes the cost of producing q units per hour, we need to set up the cost function and take its derivative with respect to both K and L.

Let C(K, L) be the total cost function.

The cost of capital is $40 per machine per hour, and the cost of labor is $20 per hour. Therefore, the total cost function can be expressed as:

C(K, L) = 40K + 20L

To produce q units per hour at minimal cost, we need to find the values of K and L that minimize the total cost function while satisfying the production constraint q = 1000KL.

The expansion path of the firm represents the combinations of K and L that minimize the cost at different production levels q.

Learn more about production

brainly.com/question/31859289

#SPJ11

what is half of 30ml

Answers

Half of 30ml is 30ml divided by 2, this is:

30ml2=15ml

Half of 30ml is 15ml.

Does (2, 4) make the equation y = –6x true?

Answers

Answer:

No

Step-by-step explanation:

When x=2, y=6(2)=12, not 4.

Solve the system using either Gaussian elimination with back-substitution or Gauss-Jordan elimination. (If there is no solution, enter NO SOLUTION. If the system has an infinite number of solutions, express x, y, z, and w in terms of the parameters t and s.)
4x + 12y-7z-20w = 26
3x + 9y-5z-28w = 36
(x, y, z, w)

Answers

The solution of the given system of equations is as follows:

x = x y = y z = -4/3x - 10/9y + 68/27

w = -1/147

Let's solve the given system of equations:

4x + 12y - 7z - 20w = 263x + 9y - 5z - 28w = 36

Divide the first equation by 4 and the second equation by 3 we have:

x + 3y - 7/4z - 5/2w = 26/43x + 3y - 5/3z - 28/3w = 12

Now, multiply the first equation by 3 and subtract from the second equation:

3(1x + 3y - 7/4z - 5/2w = 26/4)3x + 3y - 21/4z - 15/2w = 39/4- (3x + 3y - 5/3z - 28/3w = 12)1/3z + 11/3w = 7/4

Now, solve for z:

z = 21w - 28/3By substituting the value of z in terms of w in the first equation we get:

1x + 3y - 7/4(21w - 28/3) - 5/2w = 26/4x + 3y - 147/4w + 7 = 13/2

Multiply both sides by 2, and we get:2x + 6y - 147/2w + 14 = 13

Therefore,2x + 6y - 147/2w = -1/2

Now, solving for w:{147}/{2w}= {-1}/{2}

w = -1/147

By substituting the value of w in the equation x + 3y - 7/4z - 5/2w = 26/4, we get:

1x + 3y - 7/4z - 5/2(-1/147) = 26/4x + 3y - 7/4z + 5/294 = 13/12

Multiplying both sides by 12, we get:12x + 36y - 21z + 5 = 39

Now, solve for z:

z = -{4}/{3}x - {10}/{9}y + {68}/{27}

Hence, the solution of the given system of equations is as follows:x = x y = y z = -4/3x - 10/9y + 68/27w = -1/147

To know more about the Gauss elimination method,

https://brainly.com/question/2284293

#SPJ11

Please answer.

No links, no fake answers please

Please answer. No links, no fake answers please

Answers

Answer:

29.88953

Step-by-step explanation:

x = 20*sin(90)/sin(42) = 29.88953

State true or false for each statement

State true or false for each statement

Answers

Answer:

true

true

false

false

Step-by-step explanation:

I think that that is right mark brainliest if i'm right

​no links or spamming or i will report you. thank you, have a great day. What is the best estimate for this sum?

1/8+1/6


The sum will be close to 1/4.

The sum will be close to 1/2.

The sum will be close to 1.

Answers

Answer:

The sum will be close to 1/4

Kaye will compute for the area of a circle using the formula A=π×r2.If given is the diameter of a circle , what should be computed first?

Answers

Answer:

Find the radius.

Step-by-step explanation:

The task is to solve for area of a circle, and you are given the diameter.

The formula for area is :

Area of a circle = π × (radius)²

In this formula, there is only one input value, and that is the radius.

To find the radius, you must know the relation :

Radius x 2 = Diameter

Hence, the radius must be computed first and foremost.



Write an equation to solve each problem.The length of a rectangle is 3 cm greater than its width. The perimeter is 24 cm . What are the dimensions of the rectangle?

Answers

The dimensions of the rectangle are width = 4.5 cm and length = 7.5 cm.

Let's define the width of the rectangle as 'w' cm. According to the problem, the length of the rectangle is 3 cm greater than its width, so the length would be 'w + 3' cm.

The perimeter of a rectangle is calculated by adding the lengths of all four sides. In this case, we have two equal sides (width) and two equal sides (length). So, the perimeter formula can be written as:

Perimeter = 2 * (length + width)

Substituting the values from the problem into the equation, we get:

24 = 2 * (w + w + 3)

Now we can solve this equation to find the value of 'w':

24 = 2 * (2w + 3)

Divide both sides of the equation by 2:

12 = 2w + 3

Subtract 3 from both sides:

9 = 2w

Divide both sides by 2:

4.5 = w

So, the width of the rectangle is 4.5 cm. To find the length, we substitute this value back into the expression for the length:

Length = w + 3 = 4.5 + 3 = 7.5 cm

Therefore, the dimensions of the rectangle are width = 4.5 cm and length = 7.5 cm.

Learn more about rectangular from

https://brainly.com/question/2607596

#SPJ11

Solve each system using elimination. 4y - 2x = 6 , 8y = 4x - 12

Answers

The system of equations 4y - 2x = 6 and 8y = 4x - 12 is solved by x = 3 and y = 0.

To solve the system of equations using elimination, we can manipulate the equations to eliminate one variable by multiplying one or both equations by suitable constants. Here's how we can solve the given system:

1) Multiply the first equation by 2 to make the coefficients of x in both equations equal:

  2(4y - 2x) = 2(6)

  8y - 4x = 12

2) Now, we have the following system of equations:

  8y - 4x = 12  ...(Equation 1)

  8y = 4x - 12   ...(Equation 2)

3) Subtract Equation 2 from Equation 1 to eliminate the y variable:

  (8y - 4x) - 8y = 12 - (4x - 12)

  -4x = 4x - 24

4) Simplify the equation:

  -4x - 4x = -24

  -8x = -24

5) Divide both sides of the equation by -8 to solve for x:

  x = (-24) / (-8)

  x = 3

6) Substitute the value of x (x = 3) into either Equation 1 or Equation 2 to solve for y. Let's use Equation 2:

  8y = 4(3) - 12

  8y = 12 - 12

  8y = 0

  y = 0

7) The solution to the system of equations is x = 3 and y = 0.

Therefore, the system of equations 4y - 2x = 6 and 8y = 4x - 12 is solved by x = 3 and y = 0.

Learn more about system of equations here

https://brainly.com/question/13729904

#SPJ11

The FastForward Company balance sheet shows cash $5,000, accounts receivable $7,000, office equipment $3,000, and accounts payable $4,000. What is the amount of equity?


$15,000

$12,000

$19,000

Answers

19’000 correct me if i’m wrong

The correct answer is option C) $12,000.

What is the amount of equity?

The equity of a company, or shareholders' equity, is the net difference between a company's total assets and its total liabilities. A company's equity is used in fundamental analysis to determine its net worth.

Given:

FastForward Company balance sheet shows cash = $5,000Accounts receivable = $7,000Office equipment = $3,000Accounts payable = $4,000.

Total equity = 5000 + 7000 + 4000 - 3000

= $12000

What is an equity example?

Equity is the ownership of any asset after any liabilities associated with the asset are cleared. For example, if you own a car worth $25,000, but you owe $10,000 on that vehicle, the car represents $15,000 equity. It is the value or interest of the most junior class of investors in assets.

Learn more about Equity here: brainly.com/question/24914390

#SPJ2

A manufacturer produces 950 light bulbs per
day. Write an equation to find the number of
bulbs b the manufacturer makes in any
number of days d.

Answers

Answer:

b =950d

Step-by-step explanation:

The manufacturer makes 950 bulbs a day. So, you have to multiply the number of days by 950 to get the number of bulbs made. This can be written as an equation:

b = 950d

Hope this helps :)

An equation to find the number of bulbs b the manufacturer make in any number of days d will be written as b =950d.

What is an expression?

The mathematical expression combines numerical variables and operations denoted by addition, subtraction, multiplication, and division signs.

Mathematical symbols can be used to represent numbers (constants), variables, operations, functions, brackets, punctuation, and grouping. They can also denote the logical syntax's operation order and other properties.

Given that a manufacturer produces 950 light bulbs per day.

The equation can be written as:-

b = 950d

The manufacturer makes 950 bulbs a day. So, you have to multiply the number of days by 950 to get the number of bulbs made. This can be written as an equation:

To know more about an expression follow

https://brainly.com/question/14099845

#SPJ2

which of the following is true about the expected value of perfect information?
a. It is the amount you would pay for any sample study.
b. It is calculated as EMV minus EOL.
c. It is calculated as expected value with perfect information minus maximum EMV.
d. It is the amount charged for marketing research.

Answers

The expected value of perfect information (EVPI) is calculated as EVwPI minus maximum EMV. It quantifies the value of perfect information in decision-making.


The expected value of perfect information (EVPI) is a concept used in decision analysis. It represents the maximum amount of money an individual would pay to have perfect information about an uncertain event before making a decision.

To calculate EVPI, you start with the expected value with perfect information (EVwPI), which is the expected value when you have complete and accurate information about the uncertain event. Then, you subtract the maximum expected monetary value (EMV) from the EVwPI.

The EMV represents the expected monetary value of the decision without any additional information. By subtracting the maximum EMV from the EVwPI, you are essentially measuring the value of the additional information in terms of monetary gain.

To know more about Monetary visit.

https://brainly.com/question/28199887

#SPJ11

Fred sold 14 rolls of wrapping paper for a band fundraiser earning the band $17. 50. Sharon sold 16 rolls of wrapping paper and earned $20. 00 for the band. If this relationship is graphed with the number of rolls sold on the x-axis and the money earned on the y-axis, what is the slope of the graph in dollars per roll?.

Answers

Answer: $1.25 Per Roll

Step-by-step explanation:

(14,17.50) and (16,20)

The dot plot represents the amount of rain recorded by rain gauges in different locations around a city. A number line going from 0. 25 to 2. 75. 0 dots are above 0. 25. 3 dots are above 0. 5. 1 dot is above 0. 75. 3 dots are above 1. 0 dots are above 1. 25. 1 dot is above 1. 5. 2 dots are above 1. 75. 3 dots are above 2. 2 dots are above 2. 25. 1 dot is above 2. 5. 0 dots are above 2. 75. How many rain gauges recorded rainfall? 2 8 11 16.

Answers

The dot plot indicates rainfall recorded by rain gauges. Counting the dots above each value reveals that 16 rain gauges recorded rainfall.



To determine the number of rain gauges that recorded rainfall based on the given dot plot, we need to count the number of dots above each value on the number line.Starting from 0.25, we see that 0 dots are above it. Moving to 0.5, we find 3 dots. Continuing, there is 1 dot above 0.75, 3 dots above 1.0, 0 dots above 1.25, 1 dot above 1.5, 2 dots above 1.75, 3 dots above 2.0, 2 dots above 2.25, 1 dot above 2.5, and finally 0 dots above 2.75.

By adding up the number of dots above each value, we find the total count of rain gauges that recorded rainfall. Summing these values, we get 0 + 3 + 1 + 3 + 0 + 1 + 2 + 3 + 2 + 1 + 0 = 16.Therefore, based on the given dot plot, the number of rain gauges that recorded rainfall is 16.

It's important to note that the brief solution provided assumes that each dot in the dot plot represents a unique rain gauge. If there are multiple dots representing the same rain gauge, the count would need to be adjusted accordingly.

To learn more about number click here

brainly.com/question/29084963

#SPJ11

3) John is starting a roofing business. He will need to buy a truck and some supplies to get his business going. The truck costs $3400 used. If hammers cost $22 each and he only has $3750, how many hammers can he purchase?

Answers

Answer:

15 hammers

Step-by-step explanation:

Let's first find how much money he has left after he buys the truck:

3750-3400=$350

Now let's find how many hammers he can purchase:

350/22=15.91

This means he can purchase 15 hammers since he cannot have .91 of a hammer.

Answer:

15

Step-by-step explanation:

Since John's truck costs 3,400, subtract that from 3,750

3750

-3400

-----------

350

22 goes into 350 fifteen times, hence giving you the answer 15.

remove all independent variables that are not significant at the 0.01 level of significance from the estimated regression equation. what is your recommended estimated regression equation? enter a coefficient of zero for any independent variable you chose to remove.

Answers

The recommended estimated regression equation is Y = βo + β1X1 + β2X2, with any coefficients for the independent variables that were removed set to 0.

The recommended estimated regression equation can be determined by removing all independent variables that are not significant at the 0.01 level of significance. The formula for the estimated regression equation is Y = βo + β1X1 + β2X2 + β3X3 + β4X4, where Y is the dependent variable, X1, X2, X3 and X4 are the independent variables, and β1, β2, β3 and β4 are the regression coefficients.

Using the coefficients from the original regression equation, we can determine which independent variables need to be removed by looking for any that have a p-value greater than the 0.01 level of significance. In this case, we will set the coefficients for the independent variables that need to be removed to 0. The recommended estimated regression equation is Y = βo + β1X1 + β2X2 + 0X3 + 0X4.

Therefore, the recommended estimated regression equation is Y = βo + β1X1 + β2X2, with any coefficients for the independent variables that were removed set to 0.

Learn more about regression here:

https://brainly.com/question/17731558

#SPJ4

Let n1=80, X1=20, n2=50, and X2=10. The value of P_1 ,P_2
are:
0.4 ,0.20
0.5 ,0.20
0.25, 0.20
0.5, 0.25

Answers

The value of P₁ and P₂ are 0.25, 0.20. Hence, the option that best describes the values of P₁ and P₂ are 0.25, 0.20.

Given,n1 = 80, X1 = 20, n2 = 50, and X2 = 10.

Now, the proportion of success for sample 1, P_1 is given by; P₁ = (X₁/n₁)

Similarly, the proportion of success for sample 2, P_2 is given by; P₂ = (X₂/n₂)

Substitute the values of X₁, n₁, X₂, and n₂ to obtain the values of P₁ and P₂;P₁ = (20/80) = 0.25P₂ = (10/50) = 0.2

Therefore, the value of P₁ and P₂ are 0.25, 0.20. Hence, the option that best describes the values of P₁ and P₂ are 0.25, 0.20.

Know more about proportion here:

https://brainly.com/question/1496357

#SPJ11

Prove:
sin (pi/4 + x) = sqrt2/2 (cos x + sin x)

Answers

Answer:

Apply the angle sum identity sin(a+b)=sin(a)cos(b)+cos(a)sin(b).

Step-by-step explanation:

By the angle sum identity, sin(a+b)=sin(a)cos(b)+cos(a)sin(b) for any angles a and b.

Apply this identity to rewrite the left-hand side of the equation:

sin(π4+x)=sin(π4)cos(x)+cos(π4)sin(x).

The angle (π/4) is equivalent to 45, which corresponds to the isosceles right triangle: sin(π/4)=2/2, cos(π/4)=2/2.

Substitute these two values into the expression above and simplify:

sin(π4+x)=sin(π4)cos(x)+cos(π4)sin(x)=22cos(x)+22sin(x)=22(sin(x)+cos(x)).

Thus, sin((π/4)+x)=(2/2)(sin(x)+cos(x)) as requested.

can someone tell me how to mark brainliest

Answers

Answer:

There is a crown next to the person that answered.

Step-by-step explanation:

Answer:

when two person will answer a question then the brainliest option will come and u can mark brainliest according to the person u wish

When we use a confidence interval to reach a conclusion (infer something) about the population mean, we are applying a type of reasoning or logic called

Answers

Statistical inference is a type of reasoning or logic that is applying for a confidence interval to reach a conclusion (infer something) about the population mean. So, option(C) is right one.

A confidence interval for a mean provide us a range of plausible values for the population mean. It indicates where the population parameter is likely to reside.

Descriptive statistic are just mean, median mode etc. and will not give you a point estimate or CI intervals of a population mean.Normal distribution is just a way of fitting a data. It doesn't in itself involve taking CI limits.This is the answer, This also include point estimates, Confidence intervals and hypothesis testing.Graphics: May be a rough answer to see what' the skew of data like. But they don't give you confidence intervals.

Hence, the required answer is statistical inference.

For more information about confidence interval, visit:

https://brainly.com/question/17097944

#SPJ4

Complete question:

When we use a confidence interval to reach a conclusion about the population mean, we are applying a type of reasoning or logic called ______.

A. descriptive statistics

B. the normal distribution

C. statistical inference

D. graphics

Write a quadratic equation with -4 and 3/2 as it’s roots. Write the equation in the form ax^2 + bx + c = 0, where a, b, and c are integers.

Answers

9514 1404 393

Answer:

  2x² +5x -12 = 0

Step-by-step explanation:

When p and q are roots of a quadratic, its factored form can be written as ...

  (x -p)(x -q) = 0

Here, the roots are given as -4 and 3/2, so the factored form would be ...

  (x -(-4))(x -(3/2) = 0

Multiplying by 2 gives us ...

  (x +4)(2x -3) = 0

Expanding the product, we find the desired quadratic is ...

  2x² +5x -12 = 0

Write a quadratic equation with -4 and 3/2 as its roots. Write the equation in the form ax^2 + bx + c

Henry bought a package of cough drops for $3.79. He gave the clerk a $5 bill. How much change should he receive?

Answers

Answer:

$1.21 he will recieve

Step-by-step explanation:

Subtract the price of the cough drops from $5

5-3.79 = 1.21

He gets $1.21 back.

Other Questions
2 Leander purchases a 2-liter bottle of soda. Ifone serving is 1 cup of soda, which expressioncan be used to determine the number ofservings in a 2-liter bottle of soda?(1 cup = 0.24 liter) ifsinx=-5/13 and 3pi/2 is less than or equal to x is less than orequal to 2pi, find sin2x and cos(x/2) According to the marginal productivity theory, employers pay use value to their employees. a. true b. false SlopeY-coordinateX-coordinate Find the slope of the line numerous small, shallow earthquakes tend to occur at __________. the enzyme that catalyzes the isocitrate dehydrogenase reaction shown below would belong to which class? Which continent has the smallest percentage of Christians? Which of the following statements do supporters of net neutrality agree with?a- The same level of service is provided to all websites, regardless of purpose.b- Access to websites cannot be restricted based on content.c- ISPs can charge more for high-bandwidth connections.d- All Internet traffic should be treated equally. Task: Research Neville's method for interpolation and polynomial approximation. The research should cover the following points: 1. A brief history of the method. (1 point) 2. The advantages and disadvantages of the method. (1.5 points) 3. Compare the method with the Lagrange interpolation polynomial. (1.5 points) 4. Let f(x) = 3*, Use Neville's to approximate 3 using the data points Xo = -2, x = -1, x = 0, x3 = 1, and x = 2. (3 points) 5. Find the exact error. Did the method give you a good approximation to 3. (2 points) 6. List of the references written in Harvard style. (1 point) Instructions Find the value of x. Find the point on the line y=-6/7x+6 that is closest to theorigin.Type your answer in the form (x,y). HOLIDAY POINTS HAVE A WONDERFUL DAY The table style feature changes the ________ of a table. a) column width b) row heightc) appearance Segn el artculo, qu representa el merengue para la Repblica Dominicana?Es un ritmo que tiene sus orgenes en la actualidad.Es un ritmo que tiene sus orgenes en la actualidad.AEs una danza que refleja el sufrimiento del pueblo.Es una danza que refleja el sufrimiento del pueblo.BEs un sonido que simboliza el espritu revolucionario.Es un sonido que simboliza el espritu revolucionario.CEs una seal de la identidad nacional dominicana. 2. For each of the reactions below, write a structural reaction equation (which need not be balanced) bydrawing the structures of the reactant & product and name the product formed.a) ethanol + K,CrO, / H / refluxb) ethanol + KCrO, / H / distilc) propan-1-ol + K,CrO,/H. / refluxd) propan-2-ol + K,Cr,O,/ H / refluxe) 3-methylbutan-1-ol + K,CrO, / H / refluxf) 4-chloropentan-1-ol + KCrO,/ H / distil What item imported from surinam does aphra behn (as the narrator of oronooko) claim to have used for the costume of an indian queen? Are any of yall in honors English for 9th grade? What are at least 3 key features of representative government? WARM UP Kerry purchased a used car for $7,400 and had to pay 8% sales tax. How much tax did she pay?