Liquid hexane will react with gaseous oxygen to produce gaseous carbon dioxide and gaseous water . Suppose 44. g of hexane is mixed with 105. g of oxygen. Calculate the minimum mass of hexane that could be left over by the chemical reaction. Be sure your answer has the correct number of significant digits.

Answers

Answer 1

The balanced chemical equation for the reaction between hexane and oxygen to give carbon dioxide and water can be written as follows;C6H14 + 19/2 O2 → 6 CO2 + 7 H2O

To determine the minimum mass of hexane that could be left over by the chemical reaction, we need to identify the limiting reactant in the given chemical equation.

The number of moles of hexane can be calculated as follows; Mass of hexane = 44.0 g

Molar mass of hexane (C6H14) = 6(12.01 g/mol) + 14(1.01 g/mol) = 86.18 g/mol Number of moles of hexane = Mass of hexane / Molar mass of hexane= 44.0 g / 86.18 g/mol = 0.51 mol

Similarly, the number of moles of oxygen can be calculated as follows: Number of moles of oxygen = Mass of oxygen / Molar mass of oxygen Mass of oxygen = 105.0 g Molar mass of oxygen = 2(16.00 g/mol) = 32.00 g/mol Number of moles of oxygen = Mass of oxygen / Molar mass of oxygen= 105.0 g / 32.00 g/mol = 3.28 mol

From the balanced chemical equation;C6H14 + 19/2 O2 → 6 CO2 + 7 H2O1 mole of hexane requires 19/2 moles of oxygen for complete reaction.

The number of moles of oxygen required for the reaction of 0.51 mol of hexane can be calculated as follows;

Number of moles of oxygen required for the reaction of 0.51 mol of hexane= (19/2) × (0.51 mol)= 9.74 mol

From the above calculation, it is evident that oxygen is the limiting reactant because it is required in a greater quantity than it is available in the reaction mixture.

The maximum amount of hexane that can react with 3.28 mol of oxygen is 3.28 mol × (2/19) = 0.3447 mol.

The mass of hexane left unreacted can be calculated as follows; Mass of hexane used up in the reaction = 0.3447 mol × 86.18 g/mol= 29.7 g

Therefore, the minimum mass of hexane that could be left over by the chemical reaction is given by the difference between the initial mass of hexane (44.0 g) and the mass of hexane used up in the reaction (29.7 g);Mass of hexane left over = 44.0 g - 29.7 g= 14.3 g

Therefore, the minimum mass of hexane that could be left over by the chemical reaction is 14.3 g.

To know more about equation, visit

https://brainly.com/question/29174899

#SPJ11


Related Questions

What type of chemical reaction does this represent.

What type of chemical reaction does this represent.

Answers

Answer:

combustion

Explanation:

your welcome :)

1. what molar amount of hydrochloric acid is required for the fischer esterification of lauric acid with ethanol to go to completion?

Answers

The molar amount of hydrochloric acid required for the Fischer esterification of lauric acid with ethanol to go to completion depends on the specific reaction conditions, such as the temperature, pressure, and concentration of reactants.

Hydrochloric acid is typically used as a catalyst in this reaction, and the amount used is usually small, ranging from 0.1 to 1.0% of the molar amount of the reactants. So, for example, if 1 mole of lauric acid and 1 mole of ethanol are used, then the molar amount of hydrochloric acid needed would be 0.01 to 0.1 moles. It's important to note that excess amounts of hydrochloric acid can cause side reactions and yield undesired products.

Know more about hydrochloric acid here;

https://brainly.com/question/15231576

#SPJ11

gas heated to millions of degrees would emit d. mostly radio waves. b. no light, because it is too hot. c. mostly X-rays. a. an equal amount of all wavelengths of light. e. mostly ultraviolet light.

Answers

When gas is heated to millions of degrees, it would primarily emit mostly X-rays.

X-rays have shorter wavelengths and higher energies compared to visible light, which is why they are emitted in significant amounts from extremely hot gas. "an equal amount of all wavelengths of light," is not accurate because the emission spectrum of a hot gas depends on its temperature and composition. "No light, because it is too hot," is also incorrect. "mostly radio waves," is not accurate for gas heated to millions of degrees.  

learn more about:- gas heated degrees here

https://brainly.com/question/27745923

#SPJ11

MAGNESIO + OXIGENO
nombre
formula

Answers

Answer:

Óxido de magnesio

Concepto:Es un óxido metálico, formado por magnesio y oxígeno, de estructura iónica cuya fórmula química es MgO.

Which of the following correctly compares and contrasts the formation of mountains on land to the formation of the mid-Atlantic ridge? A. Mountains and the mid-Atlantic ridge are landforms that are raised above the surrounding land. Some mountains form along convergent plate boundaries. The mid-Atlantic ridge is formed along a divergent plate boundary. B. Mountains and the mid-Atlantic ridge are landforms that are raised above the surrounding land. The mid-Atlantic ridge is formed along a divergent plate boundary. Mountains and the mid-Atlantic ridge are formed along convergent plate boundaries. A mountain is a landform that is raised above the surrounding land. The mid-Atlantic ridge is a landform that forms a deep crevice on the ocean floor. C.Mountains and the mid-Atlantic ridge are formed along divergent plate boundaries. A mountain is a landform that is raised above the surrounding land. The mid-Atlantic ridge is a landform that forms a deep crevice on the ocean floor. Mountains and the mid-Atlantic ridge are formed along divergent plate boundaries. A mountain is a landform that is raised above the surrounding land. The mid-Atlantic ridge is a landform that forms a deep crevice on the ocean floor. The mid-Atlantic ridge is formed along a convergent plate boundary. 30 points

Answers

The correct comparison and contrast of  the formation of mountains on land to the formation of the mid-Atlantic ridge is Option C.

How are mountains formed?

The geological processes that result in mountain creation are referred to as mountain formation. Large-scale motions of the Earth's crust are linked to these processes (tectonic plates). The orogenic process of mountain development may involve folding, faulting, volcanic activity, igneous intrusion, and metamorphism, among other processes. Mountains do not always have a connection to the geological features that can be found there.

What is metamorphism?

The process of metamorphism involves changing the protolith, an existing rock, into a new rock with a different mineral composition or texture. The rock remains essentially solid throughout the metamorphism process, which happens at temperatures between 150 and 200 °C (300 and 400 °F), as well as frequently at high pressures or in the presence of chemically active fluids. Weathering and diagenesis, which are changes that occur at or just below the Earth's surface, are not the same as metamorphism.

To know more about Mid-Atlantic ridge, visit:

https://brainly.com/question/13387451

#SPJ1

Answer:

C. Mountains and the mid-Atlantic ridge are formed along divergent plate boundaries.

Explanation:

got it from the boy/girl up there.

have a great day!

2072 Set D Q.No. 2 Which one has higher concentration and why? [1+1] a. 80 g/litre NaOH solution and 3 M NaOH solution. [1]
b. 5.3 g/litre Na2CO3 and N/10 Na2CO3 solution. [1]

Answers

Answer:

a. To compare the concentration of 80 g/litre NaOH solution and 3 M NaOH solution, we need to convert one of the concentrations to the other unit.

One mole of NaOH weighs 40 grams. So, to convert 80 g/litre NaOH to Molarity, we can divide 80 g/litre by 40 g/mol to get:

80 g/litre NaOH = 2 M NaOH

Therefore, 3 M NaOH has a higher concentration than 80 g/litre NaOH solution.

b. To compare the concentration of 5.3 g/litre Na2CO3 and N/10 Na2CO3 solution, we need to first understand what N/10 solution means.

N/10 Na2CO3 means that the solution contains 1/10th of the normal concentration of Na2CO3. The normal concentration of Na2CO3 is the molar concentration of Na2CO3 that corresponds to the formula weight of Na2CO3, which is 106 g/mol.

So, the normal concentration of Na2CO3 is 1 mol/L or 1 M Na2CO3.

Therefore, N/10 Na2CO3 solution has a concentration of 1/10 M Na2CO3.

Now, let's compare the two concentrations:

5.3 g/litre Na2CO3 = (5.3/106) M Na2CO3 = 0.05 M Na2CO3

Since 0.05 M Na2CO3 is greater than 1/10 M Na2CO3, the concentration of 5.3 g/litre Na2CO3 solution is higher than that of N/10 Na2CO3 solution.

Explanation:

Sodium Chloride is an ionic compound. Its molar mass is 58.44g. One formula unit of NaCl consists of one____, whose chemical symbol is___ and one___whose chemical symbol is___. Please help me to fill in the gaps :)

Answers

Answer: One formula unit of NaCl consists of one cation, whose chemical symbol is Na+ and one anion whose chemical symbol is Cl

Explanation:

For formation of a neutral ionic compound, the charges on cation and anion must be balanced. The cation is formed by loss of electrons by metals and anions are formed by gain of electrons by non metals.  

The cation is formed by the metal sodium which forms  Na+ and the anion is formed by non metal chlorine which forms Cl.

For a formula unit of sodium chloride,  the charges have to be balanced , thus the valencies of ions are exchanged and the neutral compound result. Thus

Na+ and  Cl combine to form neutral NaCl

A water molecule is made of hydrogen and oxygen atoms and has the same formula is H2O how was the mixture of hydrogen oxygen differ from compound not as water

Answers

A mixture of hydrogen and oxygen would not need to have a certain ratio of hydrogen atoms to oxygen atoms to differ from the compound known as water.

Why is water a compound not a mixture?

A water molecule has 2 hydrogen atoms bonded chemically to oxygen atoms and has the formula H₂O.

In a chemical reaction, two atoms react together chemically to form a new product which means the reactants lose their individual properties and obtain new properties of the product formed.

Hence, water is a compound as hydrogen and oxygen atoms are bonded chemically to each other.

On the other hand, if oxygen and hydrogen form a mixture which is a physical change then they retain their individual properties in the mixture. They do not need to be in a specific ratio and there are no chemical changes taking place.

Chemical change determines if a substance is a mixture or a compound.

Thus, a mixture of hydrogen and oxygen is different from water if it doesn't have a certain ratio of hydrogen atoms to oxygen atoms.

Learn more about mixture:

https://brainly.com/question/24647756

#SPJ9

Decompositionof ammonium nitrate produces water and di nitrogen oxide. a) Predict how many grams of water will be produced from decomposition of 0.555 kg of ammonium nitrate.b) If 120. g of water is actually produced, what is the percent yield for this reaction

Answers

NH4NO3(s) ==> 2 H2O(g) + N2O (g) (balanced)

a) We need the molar masses for each compound:

NH4NO3 = 80.0 g/mol (ammonium nitrate)

H2O = 18 g/mol (water)

0.555 kg => 1 kg = 1000 g => 0.555 kg = 555 g

80.0 g NH4NO3 -------- 2 x 18 g H2O

555 g NH4NO3 -------- X = 250 g

Answer a): 250 g water

b) % yield of water

120. g of water = actual yield

250 g of water from a) is the theoretical yield

Therefore, the % yield:

% yield = (actual yield/ theoretical yield) x 100

% yield = 120. g water/250 g water x 100

% yield = 48 %

Answer b): % yield = 48 %

Given the density of 1.2 g/mL and a volume 7.8 mL. What is the mass? Round to the nearest 0.1.

Answers

Answer:

here is my answerrrrrrr

Given the density of 1.2 g/mL and a volume 7.8 mL. What is the mass? Round to the nearest 0.1.

What procedure did you use to complete the lab?

Outline the steps of the procedure in full sentences.

Answers

Hello, 3Coli Here!

Your Answer is Here:

I made a hypothesis, observed my experiments, used a procedure, had and prepared materials that are needed, evidence that support my thesis, and made a conclusion.  

Hopefully, this helps!

Ask your question below!

When a hammer strikes a compound formed by covalent bonds, what will most likely happen to the compound? It will break into many pieces. It will reform into a new shape. It will spread out and then return to its original shape. It will stay solid and resist the force of the hammer.

Answers

A hammer strikes a compound formed by covalent bonds, It will break into many pieces. Therefore, option A is correct.

What is covalent bond ?

An electron exchange that results in the formation of electron pairs between atoms is known as a covalent bond. Bonding pairs or sharing pairs are the names given to these electron pairs. Covalent bonding is the stable equilibrium of the attractive and repulsive forces between atoms when they share electrons.

Atoms join together in a covalent bond by exchanging electrons. Nonmetals typically form covalent connections with one another. For instance, each hydrogen (H) and oxygen (O) atom in water (H2O) shares a pair of electrons to form the molecule of two single-bonded hydrogen atoms and one single-bonded oxygen atom.

Thus, option A is correct.

To learn more about covalent bond, follow the link;

https://brainly.com/question/10777799

#SPJ1

how many joules are given off when 120 grams of water are cooled from 0 0c to -250c?

Answers

A total of 12,552 joules of heat energy will be given off when 120 grams of water are cooled from 0°C to -25°C.

The specific heat capacity of water is 4.184 J/g·°C.

To calculate the amount of heat energy released, we can use the formula:Q = mcΔTwhere Q is the heat energy, m is the mass, c is the specific heat capacity, and ΔT is the change in temperature.

ΔT = (0 - (-25)) = 25°CQ

= (120 g)(4.184 J/g·°C)(25°C)Q

= 12,552 J

The formula for calculating the amount of heat energy released during the cooling process of water is Q = mcΔT. Here, Q is the heat energy, m is the mass, c is the specific heat capacity, and ΔT is the change in temperature. We are given the mass of water and the initial and final temperatures.

To know more about specific heat capacity click on below link:

https://brainly.com/question/1453843#

#SPJ11

Determine the percent yield for the reaction between 15.0g of N2 and 15.0g of H2 if 10.5g of NH3 is produced?

Answers

The response has a 57.7% percent yield. Ammonia is produced through the reaction of nitrogen and hydrogen. N2 + 3 H2 ----> 2 NH3 is the balanced reaction between them.

15.0 g of N2 and 15.0 g of H2 are reacting in our issue. The limiting reactant must be identified before we can calculate the percent yield.

A reaction in chemistry is what?

As atoms' organic compounds are created or shattered, molecular processes happen. Reactants are the materials that initiate a chemical reaction.

Describe reaction using an example.

One or more chemicals transform into one or more other compounds in a chemical reaction. For instance, rust is created when iron and oxygen combine. Sodium acetate and water are created when vinegar and baking soda are combined.

To know more about Reactions visit:

https://brainly.com/question/30115256

#SPJ1

The predicted tidal range along an East Coast shoreline is feet. How much should a fisherman expect the tide to rise during the first hour?
A.2 feet
B.1 foot
C.0.5 feet
D 0.8 feet

Answers

Answer:

b. 1foot

Explanation:

im not that sure but hope this helps !! happy holidays!!

What are pros and cons of hydrogen fuel cells?

Answers

Answer:

Pros: No vehicle emissions other than water vapor. Fuel economy equivalent to about twice that of gasoline vehicles. Hydrogen is abundant, and can be made from renewable energy. Cons: This space-age technology is expensive.

Answer:

The pros of hydrogen fuel cells are that they are very efficient, producing very little waste. They are also very stable, which makes them safe to use.

The cons of hydrogen fuel cells are that they can be expensive to produce and maintain, and they require a lot of energy to power them, meaning that they often aren't as efficient as they could be.

Despite these pros and cons, hydrogen fuel cells are still a very promising technology. With more research, attention, and development, they could be a powerful force in the fight against carbon emissions and global warming.

A chemithry student needs 10.0 g of dimethyl sulfoxide for an experiment. By consu ting the CAC Handbook of Chemisery and Physics, the student discovers that the density of dimethyl sulfoxide is 1.10 g cm
−3
. Calculate the volume of dimethyl sulfoxide the student should pour out. Be sure your answer has the correct number of signif cant digits.

Answers

The volume of dimethyl sulfoxide the student should pour out is 9.09 cm³.

A chemistry student needs 10.0 g of dimethyl sulfoxide for an experiment. By consulting the CAC Handbook of Chemistry and Physics, the student discovers that the density of dimethyl sulfoxide is 1.10 g cm⁻³.

We are given the mass and density of the dimethyl sulfoxide for an experiment for calculating the it's volume.

Mass of dimethyl sulfoxide required m = 10.0 g

Density of dimethyl sulfoxide ρ = 1.10 g cm⁻³

Volume of dimethyl sulfoxide(V).

We know that the formula for calculating the volume is given by the equation:

V = m/ρ

Substituting the values we get:

V = 10.0/1.10 cm³

Volume of dimethyl sulfoxide required:

V = 9.09 cm³ (3 significant digits)

Hence, the volume of dimethyl sulfoxide the student should pour out is 9.09 cm³.

To learn more about the dimethyl sulfoxide click the below link:

https://brainly.com/question/10914338

#SPJ11

The student should pour out approximately 9.09 mL of dimethyl sulfoxide for the experiment.

The student should pour out approximately 9.09 mL of dimethyl sulfoxide for the experiment. Dimethyl sulfoxide has a density of 1.10 g/cm³. To calculate the volume of 10.0 g of dimethyl sulfoxide, we can use the formula:

Volume = Mass / Density

Substituting the given values, we have:

Volume = 10.0 g / 1.10 g/cm³

Dividing the mass by the density, we find that the volume of dimethyl sulfoxide required is approximately 9.09 cm³ or mL.

To learn more about dimethyl sulfoxide refer:

https://brainly.com/question/33872389

#SPJ11

Is a salt obtained as a reaction between a base and an acid?

Answers

To answer if a salt is formed between the reaction of a base and an acid, we need to remember that, if we react a strong acid and a strong base, such as HCl and NaOH, two products will be formed: the appropriate salt and water.

In the example above, we can write the reaction as:

HCl + NaOH -> NaCl + H2O

where a strong acid and a strong base react to form a salt (NaCl) and water (H2O).

Thus, we can say that, yes, a salt is formed when an acid and a base react between each other.

How is a comet different from a star?

Answers

Explanation:

Bottom line: Most asteroids are rocky bodies that lie within the asteroid belt while comets are dirty snowballs from the Oort Cloud, with some objects acting like a hybrid of these two types.

Are the Nobel gases reactive?

Answers

Answer:

The noble gases are relatively nonreactive. In fact, they are the least reactive elements on the periodic table. This is because they have a complete valence shell. They have little tendency to gain or lose electrons.

Explanation:

Noble gases have a full valence shell, so they do not react with other elements.
Explanation:
As you may or may not know, atoms of elements take and give electrons in order to form bonds and, therefore, compounds. However, noble gases have a full valence shell (8 electrons in the valence shell).
Normally, in an atomic reaction, there is an instability in the atoms' valence shells. For example, oxygen has only 6 valence electrons. In order for an atom to be completely stable it needs to have 8 valence electrons. So, two hydrogen atoms with one electron each bond with the oxygen atom, creating a stabilization.
However, in the case of noble gases, their atoms already have a full valence shell, so there is no instability and no need to form bonds with other elements. In fact, noble gases got their name from their inactivity with other elements.

how to tell if a reaction is exothermic or endothermic from delta h

Answers

The sign of ΔH (change in enthalpy) can be used to determine whether a reaction is exothermic or endothermic.

If ΔH is negative (ΔH < 0), it indicates that the reaction is exothermic. In an exothermic reaction, the system releases heat to the surroundings. The reactants have a higher enthalpy than the products, resulting in a decrease in enthalpy during the reaction. The negative value of ΔH represents the energy being released.

On the other hand, if ΔH is positive (ΔH > 0), it signifies that the reaction is endothermic. In an endothermic reaction, the system absorbs heat from the surroundings. The reactants have a lower enthalpy than the products, resulting in an increase in enthalpy during the reaction. The positive value of ΔH represents the energy being absorbed.

Therefore, by considering the sign of ΔH, whether it is negative (exothermic) or positive (endothermic), one can determine the direction of heat flow and classify the reaction accordingly based on the energy changes involved.

To learn more about endothermic click here; brainly.com/question/13014923

#SPJ11

Select the set of reactants that will form a precipitate upon mixing.

Li2S(aq) + NiCl2(aq)

Na3PO4(aq) + H2SO4(aq)

NaClO4(aq) + Fe(NO3)2(aq)

NaCl(aq) + KBr(aq)

BaCl2(aq) + LiOH(aq)

Answers

A precipitate can be produced by the combination of lithium sulfide and nickel II chloride.

What is a precipitate?

The term precipitate has to do with a solid product that is obtained from an aqueous phase reaction. It is important to know that in this kind of reaction, we have two aqueous phase reactants but they combine to give an insoluble product.

In this case we have to look at the possible products of each of the reactants as we have them in the question. The question that we must ask ourselves is; which of these aqueous reactants can produce a solid product?

Learn more about solid product:https://brainly.com/question/11902631

#SPJ1

Consider the titration of 30. 0 mL of 0. 050 M NH3 with 0. 025 M. HCl. Calculate the PH after the following volumes of titrant have been added 0 ml 20 mL 59. 1 mL 60. 0 mL 71. 4 mL 73. 4 mL

Answers

The pH after the following volumes of titrant have been added 0 ml 20 mL 59. 1 mL 60. 0 mL 71. 4 mL 73. 4 mL are 11.89, 11.89, 8.45, 8.45, 7.98, 8.95 respectively.

The reaction between NH3 and HCl can be represented by the following equation: NH3 + HCl → NH4+ + Cl-

To calculate the pH after different volumes of titrant have been added, we need to determine the amount of titrant that has reacted with the analyte and the resulting concentration of the products.

A. 0 mL of titrant (initial state)

At the start, there is no titrant added to the analyte, so the concentration of NH3 is 0.050 M. NH3 is a weak base, so we can use the Kb expression to calculate the concentration of OH-:

Kb=[NH4+][OH]/[NH3]

1.8105=x2/(0.050x)

initial concentration of NH3 is much greater than the initial concentration of HCl, we can assume that the concentration of NH3 does not change significantly during the titration.

Kb=x2/0.050x=Kb0.050=1.3103M

The concentration of OH- is equal to 1.3103M, so we can calculate the pH:

pH=14pOH=14(log[OH])=11.89

Therefore, the pH at the start of the titration is 11.89.

B. 20 mL of titrant

After adding 20 mL of 0.025 M HCl, the volume of the solution is 50 mL (30 mL NH3 + 20 mL HCl). The moles of HCl added is:

moles of HCl = volume x concentration = 0.020 L x 0.025 mol/L = 5 x 10^-4 mol

Since the reaction is a 1:1 reaction, the moles of NH3 remaining is equal to the moles of HCl added.

concentration of NH3 = moles of NH3 / volume of NH3 = (0.050 mol/L x 0.030 L - 5 x 10^-4 mol) / 0.030 L = 0.048 mol/L

Since the concentration of NH3 has decreased, we need to recalculate the concentration of OH- using the new concentration of NH3:

Kb=[NH4+][OH]/[NH3]1.8105=x2/(0.048x)

Solving for x, we get:

x=1.3103M

The concentration of OH- is still x=1.3103M, so we can calculate the pH:

pH = 14 - pOH = 14 - (-log[OH-]) = 11.89

Therefore, the pH after adding 20 mL of titrant is still 11.89.

Similarly for  C. 59.1 mL of titrant

The pH after adding 59.1 mL of titrant is 8.45.

D. 60 mL of titrant

The pH after adding 60 mL of titrant is 8.45.

E. 71.4 mL of titrant

The pH after adding 71.4 mL of titrant is 7.98.

F. 73.4 mL of titrant

The pH after adding 73.4 mL of titrant is 8.95.

For more question on pH click on

https://brainly.com/question/12609985

#SPJ11

H2 gas at STP occupies 57L of space, how many moles of H2 are present?

Answers

57L * (1 mol / 22.4L) = 2.54mol

describe the trend in viscosity of hydrocarbon fuels

Answers

Answer:

Hydrocarbons are the chemical compound that contain the elements carbon and hydrogen only.

They are compounds that are obtained from the fossil fuel crude oil by a process called fractional distillation.

What is the Ka of a 0.0675 M
solution of carbonic acid
(H2CO3) with a pH of 5.19?
Ka = [ ? ] x 10
Help ASAP

Answers

Answer:

The Ka is 6.183 * 10^-10

Explanation:

The first thing to do here is to write the dissolution equation of carbonic acid in water.

H2CO3 + H20 ———> H30+ + HCO3-

After writing this, the next thing is to write the expression for Ka

Mathematically that would be ;

Ka = [H30+][HCO3-]/[H2CO3]

Next thing is to set up an ICE table

ICE table stands for initial, change and equilibrium.

For clarity sake, please check attachment for the ICE table for this chemical reaction

Mathematically by definition;

pH = -log [H3O+]

From the question, we were made to know that the pH is 5.19

Hence;

5.19 = -log [H3O+]

-5.19 = log [H30+]

[H3O+] = 10^-(5.19)

[H3O+] = 6.46 * 10^-6 M

So how does this relate to the ICE table?

From the ICE table, we can see that the equilibrium concentration of the hydroxonium ion equals x.

This means that the equilibrium concentration of the hydroxonium ion [H3O+] , demoted as x = 6.46 * 10^-6 M

Now according to the Ka equation;

Kindly recall that;

Ka = [H30+][HCO3-]/[H2CO3]

Now, using their equilibrium concentrations;

Ka = (x)(x)/(0.0675-x)

Ka= x^2/(0.0675-x)

Kindly substitute 6.46 * 10^-6 for x

Ka = (6.46 * 10^-6)^2/(0.0675-(6.46 * 10^-6)

Ka = 6.183 * 10^-10

What is the Ka of a 0.0675 Msolution of carbonic acid(H2CO3) with a pH of 5.19?Ka = [ ? ] x 10Help ASAP

Answer:

The answer is actually 6.18x10^-10

Explanation:

Fill in th box 6.18 and -10

True/False : Electrically neutral atoms have equal numbers of electrons and protons

Answers

Answer:

Electrically neutral atoms simply possess the same number of electrons as protons.

Explanation:

This gives the objects a balance of both type of charge. There are 11 electrons and 10 protons.

Final answer:

The statement is True. Electrically neutral atoms have an equal number of electrons and protons, balancing out the atomic charges and making the atom neutral.

Explanation:

The statement 'Electrically neutral atoms have equal numbers of electrons and protons' is True. In an electrically neutral atom, the number of protons in the nucleus is exactly balanced by the number of electrons surrounding the nucleus. This is due to the fact that the proton has a positive charge, and the electron has an equivalent but negative charge. So, when the number of protons equals the number of electrons, these charges cancel each other out and the atom as a whole is neutral.

Learn more about Electrically neutral atoms here:

https://brainly.com/question/33440812

#SPJ6

pls help ASAP I am literally so tired I hate this so much

pls help ASAP I am literally so tired I hate this so much

Answers

a still lake . Is your answer

VERY URGENT 100 POINTS

During baking, the rods in an oven heat up and turn red. This is an example of an object emitting (blank) as its (blank) is above 0°C.

Options:
temperature
radiation
conduction
thermal boundary layer

give simple answer PLS i dont need a whole paragraph (I know that sounds rude but I don't mean it like that :) )

Answers

Answer: An object emitting radiation as its temperature is above 0°C.

Explanation:

this is based on the Stefan-Boltzmann law. Hence, when the rods in an oven heat up above absolute zero, they begin to start emitting radiation. It should be noted at this point that objects do not "emit" conduction and thus all options that involved "emitting conduction" are subsequently wrong.

If the following elements were to form ions, they would attain the same number of electrons as which noble gas?

a. He
b. Ne
c. Ar
d. Kr

Answers

The elements that form anions will have the electronic configuration similar to the noble gas that is in their period and those that form cations will have a configuration similar to that of the noble gas in the previous period.
He: Be
Ne: F, Al
Ar: Ca, P
Kr: Rb, Se
Other Questions
Rigorous testing mandates at the district, state, and national levels often have a huge impact on how teachers teach and assess. In light of this mandated testing, teachers should: Robert is hoping to buy an oceanfront vacation/retirement home and figures he will need $188,289 for the down payment and closing costs. He earns 9.96 percent on his investments compounded annually. If he can save $4,198 at the beginning of each year, how long will it take him to reach his goal? Which of the following is the correct order of the layers of the cutaneous membrane?A) epidermis, hypodermis, dermisB) dermis, epidermis, hypodermisC) epidermis, dermis, hypodermisD) hypodermis, dermis, epidermisE) dermis, hypodermis, dermis Which statement best reflects how the culture setting influences Sigismkndos attitude in the excerpt fromThe City Lost in the Snow? Radii of the two circles are 8 cm. and 3 cm. (diagram is not to the scale). Use = 3.14 What is the present value of $500 to be received 13 years fromnow discounted back to the present at 11 percent? Lily needs to order some new supplies for the restaurant where she works. The restaurant needs at least 420 spoons. There are currently 159 spoons. If each set on sale contains 6 spoons, write and solve an inequality which can be used to determine s, the number of sets of spoons Lily could buy for the restaurant to have enoughspoons 1 Which texture below best represents the igneous rock granite? Not yet answered Select one: Marked out of 5.0 O a. Glassy O b. Aphanitic Flag question O c. Phaneritic Question 2 Which texture best represents the igneous rock obsidian? Not yet answered Select one: Marked out of 5.0 O a. Phaneritic O b. Aphanitic P Flag question O c. Porphyritic O d. Glassy O e. Liquid Question 3 If quartz is present in an igneous rock, what composition must it be? Not yet answered Select one: Marked out of 5.0 O a. Ultramafic O b. Mafic Flag question O c. Intermediate O d. Felsic Assume Call and Put options on IBM Stock have a strike of $82 have premia of $3 and $4 respectively. If at maturity the spot is $76.65, what is the payoff (per share) from the option that is in the money?