Let i^,j^andk^ be the unit vector along the three positive coordinate axes. Let a=3i^+j^k^,b=i^+b2j^+b3k^,b2,b3R,c=c1i^+c2j^+c3k^,c1,c2,c3R
be three vectors such that b2b3>0,ab=0 and (0c3c2c30c1c2c10)(1b2b3)=(3c11c21c3)
Then which of the following is true

(1)ac=0(2)bc=0(3)|b|>10(4)|c|11

Let [tex] \rm\hat{i}, \hat{j} \: And \: \hat{k} [/tex] Be The Unit Vector Along The Three Positive Coordinate

Answers

Answer 1

Computing the matrix product in the last condition gives a system of linear equations in the components of c,

{c1+b3c2b2c3=3b3c1+c2+c3=1b2c1c2+c3=1

and is easily solvable to get

c1=62b32+b22+b32,c2=2+3b32+b22+b32,c3=93b32+b22+b32

or, using the condition ab=3+b2b3=0,

c1=2b211+6b2+2b22,c2=11+3b211+6b2+2b22,c3=3b211+6b2+2b22

• (1) is false, since

ac=112+b22+b320

because b22+b3200<ac112.

• (2) is true.

bc=(3+b2b3)(2+3b3)2+b22+b32=(ab)(2+3b3)2+b22+b32=0

• (3) is false. The magnitude of b could be smaller than √10.

Since ab=0, we have

b=1+b22+(3+b2)2=10+6b2+2b22

and

2b22+6b2=2(b22+3b2+94)184=2(b2+32)29292

which is to say, b1092=112.

• (4) is true.

We have

c=11116b3+2b322+b22+b32

In terms of b2 alone,

c=1111+6b2+2b2211+6b2+2b22=1111+6b2+2b22

Now,

11+6b2+2b22=2(b2+32)2+132132

which means

c1111+13211


Related Questions

Gary studied for a total of 6 3/4 hours during the three days before her math test. If he study for the same amount of time each day how much time did he spent studying each day?

Answers

Answer:

Step-by-step explanation:

answer as a Fraction:9/4

answer as a Decimal: 2.25

answer as a mixed number: 2 1/4

A rectangular prism has a width of x2 inches and a length of xy2 inches and a height of xy inches.

Which expression represents the volume of the rectangular prism in cubic inches?


2x^2y^2


2xy^3 + 2x^2y


2x^4y^3


x^3y^2

Answers

x^3y^3 is the answer
The volume of a rectangular prism is given by the formula V = lwh, where l, w, and h are the length, width, and height of the prism, respectively.

In this case, the width is x^2 inches, the length is xy^2 inches, and the height is xy inches.

Substituting these values into the formula, we get:

V = (xy^2)(x^2)(xy)

Simplifying, we get:

V = x^4y^3

Therefore, the expression that represents the volume of the rectangular prism in cubic inches is x^4y^3.

help me plzzzzzzzzzzzzzzzzzzzzzzzzzzz

help me plzzzzzzzzzzzzzzzzzzzzzzzzzzz

Answers

ST=SM+MT
ST=x+12+8x-2
ST=9x+12-2
ST=9x+10

Hope my answer helped u :)

Maria bought 5 tickets for $20 each. Each ticket had a $2 fee. Write an expression that shows how much Maria paid for the tickets. plssss help will give 10 points :)

Answers

The expression to illustrate the information when Maria bought the tickets is C = (5 × $20) + ($2 × 5) and the total amount paid is $110.

How to illustrate the information?

Mathematical expressions consist of at least two numbers or variables, at least one arithmetic operation, and a statement. A mathematical expression shows the value of something by combining numbers, variables, and operators. It's possible to multiply, divide, add, or subtract with this mathematical operation.

Mathematical operators like addition, subtraction, multiplication, and division are used to create expressions in writing. For instance, the mathematical equation for "4 added to 2" will be 2+4.

From the information, Maria bought 5 tickets for $20 each. Each ticket had a $2 fee.

The expression that can be used to illustrate this will be:

C = (5 × $20) + ($2 × 5)

where C = Total cost

C = $100 + $10

C = $110

Therefore the expression to illustrate the information when Maria bought the tickets is C = (5 × $20) + ($2 × 5) and the total amount paid is $110.

Learn more about expressions on:

brainly.com/question/25968875

#SPJ1

Solve the problem.
A leather jacket originally costs $150. If it goes on sale for 1/3 off, how much will a
customer save?

$_______

Answers

Answer:

$50

Step-by-step explanation:

The amount saved will be:

= 1/3 × $150

= $50

if an object is projected horizontally from a height of 5m with an initial velocity of 7 m/s what is the value of V0y?​

Answers

The value of the final velocity before striking the ground will be 9.899 meters per second.

What is a vector?

The quantity which has magnitude, and direction, and follows the law of vector addition is called a vector.

If an object is projected horizontally from a height of 5m with an initial velocity of 7 m/s.

We know that if the object is projected horizontally, so initially the object has a vertical speed is zero. Then it increases due to acceleration due to gravity.

The speed of the object before striking the ground is given as,

v² - u²= 2gh

v² - 0² = 2 × (9.8) × (5)

v² = 98

v = 9.899 meters per second

The value of the final velocity before striking the ground will be 9.899 meters per second.

More about the vector link is given below.

https://brainly.com/question/13188123

#SPJ9

4. which the following best describes the number of people who need glasses for reading by age 60? a.a small handful of people b.a few c.about half of people d.most people

Answers

The option that best describes the number of people who need glasses for reading by age 60 is d. most people

What is macular degeneration?

A condition known as age-related macular degeneration (AMD) affects a person's central vision. Although AMD can cause severe central vision loss, it rarely causes total blindness. Age 50 and older, smoking, having high blood pressure, and eating a diet high in saturated fat are all risk factors for AMD.

The 1960s and beyond are regarded as late adulthood. The process of physical change ends here. Skin elasticity continues to decline, as does reaction time and muscle strength. The senses of smell, taste, hearing, and vision that we had in our twenties start to deteriorate.

In this case, it should be noted that most people need glasses by 60 years and above. Therefore, the correct option is D.

Learn more about eyes on:

https://brainly.com/question/1835237

#SPJ1

I don't know the answer ccuh

I don't know the answer ccuh

Answers

Answer:

  minor arc

Step-by-step explanation:

This is a vocabulary question:

major arc: has a measure more than 180°minor arc: has a measure less than 180°semicircle: has a measure of exactly 180° (connects the ends of a diameter)

__

Arc EA is a minor arc.

_____

Additional comment

In general, unless the two named points are the ends of a diameter, the arc is a minor arc. A major arc will generally be defined by designating a third point on the long arc connecting the same points on the circumference. For example, EDA, ECA, and EBA all designate the major arc connecting points E and A. (We can also use the descriptor, "major arc EA.") Without any of these extras designating the major arc, EA is considered to be the minor arc.

a certain wealthy horse-owner died, leaving in her will 17 fine thoroughbred racehorses, to be divided among her three children. The shares of Sarah, William, and Karen are in the ratio one half to one third to one ninth. How many horses should each get?

Answers

Sarah will get 9 horses, William will get 6 and Karen will get 2 horses according to the ratios.

How can three-way ratios be made simpler?

Divide all three of the numbers in the ratio by the same number until they cannot be divided exactly any further to simplify a ratio with three numbers. For instance, make the ratio simpler by using the numbers 20: 5: 10. 20, 5, and 10 can all be divided by 5 exactly. The 20:5:10 ratio can be expressed as 4:1:2. Using the equals sign to compare two ratios lets us know that the comparison is proportional. Divide them directly means "and."

Given ratio = 1/2 : 1/3 : 1/9

No. of horses = 17

Multiply all ratios by their denominator LCM

1/2(18) : 1/3(18)  : 1/9(18)

= 9 : 6 : 2

adding the ratios

9 + 6+ 2 = 17

Thus, Sarah will get 9 horses, William will get 6 and Karen will get 2 horses according to the ratios.

To know more about ratio visit:-

brainly.com/question/29467965

#SPJ1

A figure is shown, where lines CE and FD intersect at point B.

.








A figure is shown, where lines CE and FD intersect at point B.

.
Angle ABC is complementary to angle DBC.

What is the measure, in degrees of ?

Answers

Answer:

Step-by-step explanation:

Its 4.51

A basketball team played six games. In those games, the team won by 7 points, lost by 20, won by 8, won by 11, lost by 3, and won by 9. What is the mean amount by which the team won or lost over the six games?

Answers

Answer:

2

Step-by-step explanation:

Suppose we have two random variables X and Y . The one with a
higher coefficient of variation exhibits higher variability Is true, false or uncertain?

Answers

The statement that the one with a higher coefficient of variation exhibits higher variability is true.

How to explain this

The coefficient of variation expresses the proportionate level of variability present in a random variable and can be determined by dividing the mean by the standard deviation.

If the coefficient of variation is higher, it means that the random variable shows more variation in relation to its mean.

To illustrate, suppose that the average height of a set of males is 6 feet with a standard deviation of 2 inches.

The variance ratio would result in a coefficient of variation of 0. 033 Suppose that a group of females has an average height of 5 feet with a standard deviation of 1 inch.

The women's coefficient of variation is calculated to be 0. 02 The variance of men's height in relation to their average height is indicated by their higher coefficient of variation.

Read more about random variables here:

https://brainly.com/question/14356285

#SPJ1

Nadia has $1.35 in nickels. How many nickels
does she have?

Answers

Answer:

27 Nickels

Step-by-step explanation:

Divide 1.35 by 0.05

= 27

Evaluate the numerical expression: 44
The second 4 is an exponent

Answers

its 256.............................

The length of a rectangle is 3 ft less than twice the width, and the area of the rectangle is 44 ft squared. find the dimensions of the rectangle

Answers

The dimensions of the rectangle are 4 ft by 5 ft.

Given that the length of a rectangle is 3 ft less than twice the width, and the area of the rectangle is 44 sq.ft. We have to find the dimensions of the rectangle. Let's consider the width of the rectangle as x ft.Length of the rectangle = (2x - 3) ftArea of the rectangle = Length x Width44 = (2x - 3) x x44 = 2x^2 - 3x44 = x (2x - 3)2x^2 - 3x - 44 = 0To solve for x, we will factorize the equation by splitting the middle term.2x^2 - 8x + 5x - 20 = 0Factorize2x(x - 4) + 5(x - 4) = 0(x - 4) (2x + 5) = 0x = 4 ft (since the width of a rectangle can't be negative)or 2x = -5This gives us an invalid value, so x = 4 ftNow that we have the width of the rectangle, we can calculate the length as follows:Length of the rectangle = (2x - 3) ftLength of the rectangle = (2 * 4) - 3Length of the rectangle = 8 - 3Length of the rectangle = 5 ft.

For more such questions on rectangle

https://brainly.com/question/28049884

#SPJ8

A grocery store sells a bag of 3 oranges for $2.43. What is the unit cost?​

Answers

Answer:

$0.81

Step-by-step explanation:

We know

A grocery store sells a bag of 3 oranges for $2.43.

What is the unit cost?​

We take

2.43 / 3 = $0.81

So, the answer is $0.81

اور مدنی
Sin A /1-cosA= cot1/2
عورت سے​

Answers

Please re-explain? I don’t understand.?

6. Two linear equations are shown in the graph.
*(0.6)
(6,5),
COD).
(6.0)
dat
35344
tett
What are the coordinates of the point where the two lines intersect?
A. (-2, 3)
B. (3, 0)
C.(-3.3)
D. (3, 3)
Mark for review (Will be highlighted on the review page)
Alaviation

6. Two linear equations are shown in the graph.*(0.6)(6,5),COD).(6.0)dat35344tettWhat are the coordinates

Answers

Answer:

(3,3)

Step-by-step explanation:

Linear equations of lines are given in the form:

y = mx + b;

where m is the slope of the line, b is the y intercept and x, y are variables.

From the graph, we can see that line 1 passes through (0,6) and (6,0) while line 2 passes through (0, 1) and (6, 5).

The equation of line 1 is given as:

yy1=y2y1x2x1(xx1)y6=0660(x0)y=x+6   (1)

The equation of line 2 is given as:

yy1=y2y1x2x1(xx1)y1=5160(x0)y=23x+1   (2)

Solving equation 1 and 2 simultaneously by subtracting equation 1 from 2 gives:

(5/3)x - 5 = 0

(5/3)x = 5

x = 3

Put x = 3 in equation 1:

y = -3 + 6 = 3

Therefore the two lines meet at (3, 3).

IF UR GOOD IN GEOMETRY THIS QUESTION IS FOR YOU !! PLEASE HELP I SUCK AT MATH !

IF UR GOOD IN GEOMETRY THIS QUESTION IS FOR YOU !! PLEASE HELP I SUCK AT MATH !

Answers

Answer:

(2,3 is dilated to 8,12 by a scale factor of 4)

Step-by-step explanation:

multiply 2,3 by numbers until it gets to 8,12, once you multiply by 4 you get 8,12 which means the answer is a scale factor of 4

Write the equation of the line that goes through the points A(3,-2) and B(5,4)

Answers

Answer:

y = 3x - 11

Step-by-step explanation:

(3, -2) and (5, 4)

m = 4+2/5-3

m = 6/2

m = 3

y = 3x + b

4 = 3(5) + b

4 = 15 + b

b = -11

y = 3x - 11

Find the domain of the inverse function w-1 (x) . Express your answer as in inequality

Answers

Answer:

ANSWER

Step-by-step explanation:

Without knowing the specific function w(x), it is impossible to determine the domain of the inverse function w^-1(x). However, in general, the domain of an inverse function is the range of the original function, and vice versa.

If we assume that w(x) is a one-to-one function (which is necessary for it to have an inverse function), we can determine the range of w(x) and use it to find the domain of w^-1(x).

For example, if we know that w(x) is a function that takes all real numbers except x=2, then the range of w(x) is (-∞,2) U (2,∞). The domain of w^-1(x) is then the same as the range of w(x), which is (-∞,2) U (2,∞). Therefore, the domain of w^-1(x) is x ≠ 2.

Without more information about w(x), we cannot determine the domain of w^-1(x) more precisely.

Use the limx0sinxx=1 to determine limx0xcos5xsin5x.

Answers

Rewrite the limit as

limx0xcos(5x)sin(5x)=limx05xsin(5x)limx0cos(5x)5

Then using the known limit,

limx0sin(x)x=11limx0sin(x)x=limx0xsin(x)=1

it follows that

limx0xcos(5x)sin(5x)=1cos(0)5=15

Comparing two proportions

Answers

Answer:

How to Compare Two Population Proportions

Calculate the sample proportions. for each sample. ...

Find the difference between the two sample proportions,

Calculate the overall sample proportion. ...

Calculate the standard error:

Divide your result from Step 2 by your result from Step 4.

Step-by-step explanation:

Which measure is equivalent to 126 in.?



1 ft = 12 in.

1 yd = 3 ft



3 yd
3.5 yd
10.5 yd
31.5 yd

Answers

Answer:

3.5yd

Step-by-step explanation:

Given: 1 ft = 12 in & 1 yd = 3 ft

3yd=9ft, 9ft=108in 3.5yd=10.5ft, 10.5ft=126in10.5yd=31.5ft, 31.5ft=378in31.5yd=94.5ft, 94.5ft=1134in

Which solid has a greater volume?

Which solid has a greater volume?

Answers

Answer: B

Step-by-step explanation:

Step-by-step explanation:

C - equation for a cylinder is as follows V=πr2h Wich equals the same as the equation for a cone which is V=πr2h/3 and totals 235.62

select the spreadsheet formula that would correctly calculate the average (mean) of the following values: 25, 50, and 75.

Answers

The spreadsheet formula that would correctly calculate the average (mean) of the given values is: (25 + 50 + 75) / 3 = 50.

What is an average?

An average is a single number taken as representative of a list of numbers, generally the sum of the numbers divided by how many numbers are in the list (the arithmetic mean).

What is the formula to calculate the average?

The formula to calculate the average of given numbers is equal to the sum of all the values divided by the total number of values. Average = Sum of Values / Number of Values.

So, in this case:

Values: 25, 50, 75

Number of Values: 3

Thus, the average:

Sum of Values / Number of Values = (25 + 50 + 75) / 3 = 50

Hence, the spreadsheet formula that would correctly calculate the average (mean) of the given values is: (25 + 50 + 75) / 3 = 50.

Learn more about average at: https://brainly.com/question/15397049

#SPJ4

Raul can ride his unicycle 2.5 miles in 30 minutes. If he maintains the constant speed, what number of total miles can he travel in 90 minutes.​

Answers

Answer:

Raul would ride 18 miles.

Step-by-step explanation:

60/10 =6

3x6=18

Answer:

18 miles is your answer

For a 7 1/2 hour day, Ed makes $90. How much does he make in 1 hour?

Answers

Answer:

he makes $12 an hour

Step-by-step explanation:

Ed makes $6 in one hour.

To find out how much Ed makes in one hour, we can divide the total amount he makes in a 7 1/2 hour day by the number of hours in a day.

First, let's convert 7 1/2 hours to a mixed fraction.

7 1/2 hours = 7 + 1/2 = 14/2 + 1/2 = 15/2 hours.

Now, we can calculate how much Ed makes per hour by dividing the total amount he makes ($90) by the number of hours (15/2):

Amount per hour = $90 ÷ (15/2) = $90 × (2/15) = $6.

Therefore, Ed makes $6 in one hour.

Learn more about divide here

https://brainly.com/question/2492834

#SPJ2

PLEASE HURRY AND ANSWER!!!!​

PLEASE HURRY AND ANSWER!!!!

Answers

The probability that that arrow will land on the part labelled C after the first spin would be = 1/5.

How to calculate the probability of the chosen event?

To calculate the probability of the chosen event, the formula for probability should be used which is given as follows:

Probability = possible outcome/ sample space

Where possible outcome = 2

sample space = A,B,B,B,C,C,D,D,D,E = 10

Therefore the probability that the arrow will land on the part labelled C after the first spin = 2/10 = 1/5.

Learn more about probability here:

https://brainly.com/question/30657432

#SPJ1

A certain disease has an incidence rate of 0.9%. If the false negative rate is 6% and the false positive rate is 3%, compute the probability that a person who tests positive actually has the disease.



Give your answer accurate to at least 3 decimal places

Answers

At least 3 decimal places, the probability that a person who tests positive actually has the disease is approximately 0.002482.

Bayes' relates the conditional probabilities of two events A and B as follows:

P(A | B) = P(B | A) × P(A) / P(B)

P(A) is the prior probability of A, P(B | A) is the conditional probability of B given A, P(B) is the marginal probability of B and P(A | B) is the conditional probability of A given B.

Let's define the following events:

D: the person has the disease

T: the person tests positive

We are interested in finding P(D | T) the probability that a person who tests positive actually has the disease.

We are given that:

P(D) = 0.009 (the incidence rate of the disease)

P(T | D') = 0.03 (the false positive rate, i.e., the probability of testing positive given that the person does not have the disease)

P(T' | D) = 0.06 (the false negative rate, i.e., the probability of testing negative given that the person has the disease)

We can compute the marginal probability of testing positive as follows:

P(T) = P(T | D) × P(D) + P(T | D') × P(D')

= (1 - P(T' | D)) × P(D) + P(T | D') × (1 - P(D))

Plugging in the given values, we get:

P(T) = (1 - 0.06) × 0.009 + 0.03 × (1 - 0.009)

≈ 0.0325

Now we can use Bayes' to compute P(D | T):

P(D | T) = P(T | D) × P(D) / P(T)

Plugging in the given values and the computed value of P(T), we get:

P(D | T) = (1 - P(T' | D)) × P(D) / P(T)

≈ (1 - 0.06) × 0.009 / 0.0325

≈ 0.002482

For similar questions on probability

https://brainly.com/question/251701

#SPJ11

Other Questions
fill in the blank question. when a company has low fixed costs and flexible manufacturing technologies are not available, it would be (less or more?) likely to manufacture at one facility. If triangle DEF is congruent to triangle XYZ. Name all 6 corresponding pieces that are congruent.That is you are naming the three sets of corresponding angles and three sets of corresponding sides that are congruent. You rent an apartment that costs $800 per month during the first year, but the rent is set to go up $70 per year. What would be the monthly rent during the 11th year of living in the apartment? You should complete/fill this information for my homework. you can randomlyPersonal nformation:Activities:Favourite Sports:Favourite TV show:Favourite magazine:Favourite Subject:Favourite movie characters:Favourite singer:Thank you::::=)))) Companies who aim to have efficient supply chains select their suppliers based on their speed, flexibility, and quality.T/F Abraham maslow thought that once needs at one level of his hierarchy were met: effect of drug addiction on individual family and society. PLS ANSWEE!B.Two angles that share a common vertex and side. Geometry vocab How many air-conditioning units can Germany produce if it builds 2,000 railroad engines?A.) about 160,000B.) about 140,000C.) about 120,000D.) about 180,000E.) about 100,000 which of the following best represents the actions of photoautotrophs? question 2 options: a) convert chemical energy to solar energy b) produce thermal energy to be used by other organisms c) produce, and use, both oxygen and carbon dioxide d) produce oxygen and use carbon dioxide 17. What is the perimeter of a square whose area in 196 square inches? PLEASE HELP, DUE IN AN HOUR compare and contrast the relocations and outcomes for the navajo and nz percs (a) Explain the problems of adverse selection and moral hazard caused by asymmetric information. How can financial intermediaries alleviate those problems? (b) Explain the Diamond model of delegated monitoring. ENGLISH 3 100 Points! I have 2616 points so I can repost if this question answers are baloney. I will report bad answers though. Good answers will get a 5 stars on all their answers.Kristin completed her introduction to her literary analysis of syntax and diction in Ernest Hemingway's short story "The Old Man and the Sea." Read her introduction. Then answer the question that follows. [1]According to the Rolling Stones, "You can't always get what you want." [2]Life is full of disappointments, some of which feel as though they are too much to bear. [3]Literature often reflects this truth and teaches us that sometimes there is a triumph in the struggle, even if it is unsuccessful. [4]In this essay, I will explain how Hemingway makes effective use of short syntax and monotonous diction to evoke a mood of empathy in The Old Man and the Sea.Which sentence in Kristin's essay should be revised for errors in formal tone and academic language?A) 1B) 2C) 3D) 4 look at picture below (if you troll I will get you banned) 20 points! A wire in a circuit carries a current of 0.9 A.Calculate the quantity of charge that flows through the wire in 50 s.Give the correct unit with your answer.Use the equation: charge = current x time how many grams of oxygen are required to react with 14.0 grams of octane ( c8h18 ) in the combustion of octane in gasoline? a stock quote indicates a stock price of $94 and a dividend yield of 4%. the latest quarterly dividend received by stock investors must have been per share. In the diagram below, GD = 10.1,EF 28.1, and EG 16.9. Find the length==of FC. Round your answer to the nearest tenthif necessary. Write a complete sentence to answer each of the questions below. Spell out the suggested timesin letters.(GIVING BRAINLIEST)MODLEOn a chimie quelle heure? (11h30)On a chimie onze heures et demie.1. Tu as cours quelle heure? (8h15)2. Nous avons EPS quelle heure? (18h30)3. On a biologie quelle heure? (14h00)4. On va au caf quelle heure? (20h15)5. On va la teuf quelle heure? (10h15)6. Rachid coute la musique au concert quelle heure? (24h00)7. Maman regarde la tlvision la maison quelle heure? (11h00)8. On va au centre commercial quelle heure? (13h00)