Lab partners Vera and Bill Confuzzens attempted to use Trials 5 and 8 to show the affect that a doubling of force has upon the acceleration. Explain why these two tribals cannot be used to show the affect upon acceleration

Answers

Answer 1

Newton's second law is also called as F=ma or a=F/m. The goal of this research was to show that, with one limits m must not change—a should be doubled as F is twice. M was not kept equal in round 5 and 8, though.

What are example and force?

There are several instances of forces in daily life, including: heft and vigor (i.e. the weight of something) the force a bat applies to a ball. the pressure that a hair brush applies to hair when brushing it. the pressure your foot applies to the pedal when you're riding a bike.

A force cannot be negative:

Force has both a direction and a magnitude because it is an vector quantity. A force that is negative suggests that it is acting there in opposite direction of a reference direction. The strength of a force, however, cannot be negative.

To know more about Force visit:

https://brainly.com/question/8106035

#SPJ4

The complete question is-

Lab partners Vera and Bill Confuzzens attempted to use Trials 5 and 8 to show the affect that a doubling of force has upon the acceleration. Why can't these trials be used to show this?

Trial 5:

Applied Force - 80 N

Mass - 2 kg

Net Force -  80 N

Acceleration - 40m/s²

Trial 8:

Applied Force - 40 N

Mass - 3 kg

Net Force - 40 N

Acceleration - 13.333m/s²


Related Questions

which of the following is found in vinegar? group of answer choices nitric acid formic acid propionic acid butyric acid acetic acid

Answers

According to the question the correct answer is e. compound found in vinegar is acetic acid.

Vinegar is a dilute solution of acetic acid in water, typically containing between 5-8% acetic acid by volume. Acetic acid is a weak organic acid with the chemical formula CH₃COOH. It is produced by the fermentation of ethanol by acetic acid bacteria, and is responsible for the sour taste and pungent smell of vinegar. While other acids such as formic acid, propionic acid, and butyric acid may also be present in vinegar, acetic acid is the main acid responsible for its acidity.

Therefore, the correct option is E.

To learn more about acetic acid
https://brainly.com/question/15231908
#SPJ11

Will the excited electron tay thi way? Why, why not? Ue your knowledge of attraction, electron and proton to explain what will happen next

Answers

By producing light, the electrons let off part or all of their extra energy.But an electron and a proton are attracted to one another.Another way to put it is that opposite charges attract each other whereas the same or "like" charges repel one another.

What takes place when protons and neutrons combine?

Smaller subatomic particles make up protons and neutrons.Protons and neutrons exchange particles (mesons) when they are sufficiently close to one another, which fuses them together.When they are tied, it takes a lot of energy to unbind them.

A proton and an electron can they collide?

No, I cannot.Because protons and electrons are separate species, this is the case.A proton and an electron can both annihilate with just an anti-proton (positron), but not the other way around.

To know more about electron tay thi visit:

https://brainly.com/question/7507941

#SPJ4

Fill in the blank, please help. (55 points)

Fill in the blank, please help. (55 points)

Answers

The answer would be evaporation takes place at the surface of an ocean, lake, stream, or other body of water

Which of the following is NOT a true statement?
The amount of solar radiation emitted by the Sun varies during different Earth

seasons. UV rays are blocked by Earth’s ozone layer.

The top several meters of the ocean is the greatest absorber of solar radiation on Earth.

Snow has a greater albedo than a rain forest.

Answers

Answer:

The amount of solar radiation emitted by the Sun varies during different Earth seasons

Explanation:

will lead (ii) chloride be less soluble in 0.10 m mgcl2 or in 0.10 m nacl?

Answers

Chloride (PbCl2) will have the same solubility in 0.10 M MgCl2 and 0.10 M NaCl solutions.

To determine the relative solubility of lead (II) chloride (PbCl2) in 0.10 M MgCl2 and 0.10 M NaCl, we need to consider the common ion effect.

The common ion effect states that the solubility of a salt is decreased when a common ion is present in the solution. In this case, both MgCl2 and NaCl are sources of chloride ions (Cl-), which is a common ion for PbCl2.

Comparing the two solutions, we can see that both solutions have the same concentration of chloride ions (0.10 M). Since the solubility of PbCl2 is primarily determined by the concentration of chloride ions, the solubility of PbCl2 will be the same in both solutions.

Therefore, lead (II) chloride (PbCl2) will have the same solubility in 0.10 M MgCl2 and 0.10 M NaCl solutions.

To know more about chloride ions refer to

https://brainly.com/question/32108518

#SPJ11

which of the following is an example of a lewis acid-base reaction? select the correct answer below: an ammonium ion combines with a chloride ion to form a salt. metallic potassium reacts violently in oxygen to form potassium oxide. zinc(ii) replaces copper(ii) as the cation in a chloride salt. a molecule of ammonia combines with a proton to form the complex ion known as ammonium.

Answers

The correct answer to the question is the fourth option, where a molecule of ammonia combines with a proton to form the complex ion known as ammonium. This is an example of a Lewis acid-base reaction, where ammonia acts as a Lewis base and accepts a proton from a Lewis acid, forming a new compound. The other options do not involve Lewis acid-base reactions. For example, the first option involves an ionic bond formation between an ammonium ion and a chloride ion, and the second option involves a redox reaction between metallic potassium and oxygen. The third option involves a single displacement reaction between zinc and copper ions in a chloride salt.

A Lewis acid is a molecule or an ion that can accept an electron pair, while a Lewis base is a molecule or an ion that can donate an electron pair. In a Lewis acid-base reaction, a Lewis acid accepts an electron pair from a Lewis base to form a new compound.

Among the given options, the fourth option is an example of a Lewis acid-base reaction. In this option, a molecule of ammonia (NH3) acts as a Lewis base and accepts a proton (H+) from a Lewis acid to form the complex ion known as ammonium (NH4+). Here, the proton acts as a Lewis acid by accepting the electron pair from the nitrogen atom in ammonia.
To know more about Lewis acid visit -

brainly.com/question/22126064
#SPJ11

Name this element.
i need the answer like now

Name this element.i need the answer like now

Answers

Si aka silicon. hope this helps:))))))

Suppose you have an ice cube with mass of 8.00 g at a temperature of 295 K. If that ice cube is heated until it is completely converted to steam at 373 K how many joules of heat must be added ?

Answers

Explanation:

In order to be able to answer this question, you must know the value of water's enthalpy of fusion, ΔHfus

based on the following balanced equation, 4nh3(g) 5o2(g) → 4no(g) 6h2o(l) how many moles of excess reactant will be left when 4.0mol nh3 react with 3.0 mol o2 ?

Answers

1.6 moles of reactant will be in excess .

What is reactant?
A reagent, also known as an analytical reagent, is a substance as well as compound that is added to a system in order to trigger a chemical reaction or determine whether one has already occurred. Although the words "reagent" and "reactant" are frequently used interchangeably, "reactant" refers to a substance that is consumed during a chemical reaction. Even though they are part of the reaction's mechanism, solvents aren't typically referred to as reactants. Catalysts aren't reactants either because they aren't used up in the reaction. Reactants are frequently referred to as substrates in biochemistry, particularly in relation to enzyme-catalyzed reactions.


By using stoichiometric ratio
5 moles of o2 required to react with 4 moles of nh3
1 moles of o2 required = 4/5 moles of nh3

Here,
When we have 3 moles of o2
then 3 moles of o2 required =  4/5 x 3
                                              = 12/5 moles
                                              = 2.4 moles
then excess of moles of nh3 will be 4 - 2.4 = 1.6.

learn more about reactant
https://brainly.com/question/26283409
#SPJ4

What is the percent by volume of ethanol in gasohol when 95 ml of ethanol is added to sufficient gasoline to make 1.0 l of gasohol?

Answers

The percentage of volume of ethanol is 9.5%.

What is volume by volume percentage?

Volume/volume percentage (v/v% or percent v/v) is a unit used to express how much of a material is present in a solution. It is defined as the volume of the solute divided by the sum of the volumes of the solution, multiplied by one hundred. Examples: The average alcohol concentration (v/v%) of wine is 12 percent.

The formula used to get the volume of ethanol in percentages is

Percent of volume of ethanol = (volume of solute / total volume) *  100

Percent volume of Ethanol = (volume of ethanol  / total volume)  * 100

                                            =  95mL  / 1000mL  *  100

                                            = 9.5%

to know more go to - https://brainly.com/question/14589084

#SPJ4

why does mueller-hinton agar used for the kirby-bauer test have a lower agar concentration than we normally use (for example in tsa)?

Answers

The agar concentration of the Mueller-Hinton agar used for the Kirby-Bauer test has a lower concentration than other agar media used in microbiology.

The reason why Mueller-Hinton agar used for the Kirby-Bauer test have a lower agar concentration than we normally use is to maintain the ideal depth of 4 mm.

The depth of the agar is critical to the test's accuracy.

The Kirby-Bauer test is a laboratory technique that assesses the efficacy of antibiotics.

The test's sensitivity and specificity are determined by a range of variables, including the depth of the agar, the inoculum density, and the type of medium used.

Kirby-Bauer test uses the Mueller-Hinton agar, which is a nonselective medium, unlike some agar media such as MacConkey agar. The Mueller-Hinton agar is perfect because it's hard enough to allow consistent diffusion of the antibiotics and provides nutrients for the bacterial growth.

The depth of the agar is essential for the test's accuracy because the antibiotic's diffusion capacity and microbial growth will be affected by the agar's depth.

Hence, to maintain the ideal depth of 4mm, the agar concentration must be lowered. A lower agar concentration guarantees that the depth of the agar remains at 4mm.

Therefore, the agar concentration of the Mueller-Hinton agar used for the Kirby-Bauer test has a lower concentration than other agar media used in microbiology.

Learn more about microbiology with the given link,

https://brainly.com/question/13022613

#SPJ11

How much 4-mEq/mL sodium chloride must be drawn up for a 28-mEq dose?

A 6.7 mL

B. 6.8 mL

C. 7.0 mL

D. 8.6 mL

Answers

To draw up a 28-mEq dose of sodium chloride at a concentration of 4-mEq/mL, you would need to draw up C" 7.0 mL.

To determine the amount of sodium chloride needed, you can use the formula:

Volume = Dose / Concentration

In this case, the dose is 28 mEq and the concentration is 4 mEq/mL. By substituting these values into the formula, we get:

Volume = 28 mEq / 4 mEq/mL = 7 mL

Therefore, you would need to draw up 7.0 mL of the 4-mEq/mL sodium chloride solution to obtain a 28-mEq dose.

Option C is the correct answer.

You can learn more about sodium chloride  at

https://brainly.com/question/24878544

#SPJ11

consider the cell: pb(s) | pbso4(s) | so42–(aq, 0.60 m) || h (aq, 0.70 m) | h2(g, 192.5 kpa) | pt if e° for the cell is 0.36 v at 25°c, write the nernst equation for the cell at this temperature.

Answers

The Nernst equation for the given cell at 25°C can be written as follows:

E = E° - (RT/nF) * ln(Q)

In this equation, E represents the cell potential, E° is the standard cell potential (0.36 V in this case), R is the ideal gas constant, T is the temperature in Kelvin, n is the number of moles of electrons transferred in the balanced equation, F is the Faraday constant, and Q is the reaction quotient. To calculate the Nernst equation for this cell, you would need to determine the values of R, T, n, F, and Q, and then plug them into the equation to find the cell potential at the given conditions. It's important to note that the specific values of R, T, and F depend on the units used.

To learn more about Nernst equation click here: brainly.com/question/31593791

#SPJ11

The Pourbaix diagram for a metal X has four regions comprising X,XO,X2+,HXO2−. Which of these could be a passivation layer? HXO2− ,XO ,x ,X2+

Answers

A passivation layer is a protective layer that forms on the surface of a metal, inhibiting further reaction with the environment. In the given Pourbaix diagram, the passivation layer is typically represented by the stable oxide region (XO) where the metal is in an oxidized state.

Therefore, in the provided options, **XO** could be a passivation layer. It indicates the presence of a stable oxide layer on the surface of the metal X, which acts as a barrier against corrosion. The other regions mentioned, **HXO2−** (hydroxide) and **X2+** (cation), are not typically associated with passivation layers. HXO2− represents a hydroxide species, while X2+ refers to the metal cation, both of which do not form stable protective layers on the metal's surface.

The option **x** is not clear and does not provide information about any specific species or region in the Pourbaix diagram, so it cannot be determined if it could be a passivation layer.

To know more about passivation layer, click here:-

https://brainly.com/question/30928443

#SPJ11

(d) The equation can be written in particulate form. Using the following key, draw the correct products above their formulas.
Key
H = O
O
For F-=
HF(aq)
+
OH(aq)
F (aq)
+
H2O()

Answers

The complete reaction equation, using the lowest number of coefficients possible is;  HF(aq)  +  OH^-(aq)  ----> F^-(aq) + H2O(l)

The reaction equation here shows the reaction between hydrogen fluoride and the the hydroxide ion from a base. This is a neutralization reaction as shown.

The reaction can fully be represented as;

HF(aq)  +  OH^-(aq)  ----> F^-(aq) + H2O(l)

This is the full reaction equation using the lowest number of coefficients possible in the reaction equation.

Learn more: https://brainly.com/question/12108425

5. In Part 2, how did the temperature of the water change when you added the ice?
Why? Explain how you know that thermal energy was transferred between water and
ice when you mixed them. Explain the molecular process that occurs in this thermal
energy transfer.

Answers

A)The temperature of the water drops when ice is added to it. This happens as a result of a heat transfer that is brought on by the ice absorbing thermal energy from the water.

B) The temperature drop that was noticed is how we know that thermal energy was transferred from the water to the ice.

C)Heat is transferred when the more energetic water molecules collide with the colder ice molecules in a process known as heat conduction.

D)The ice melts and the water temperature drops as a result of the energy transfer, which causes the ice molecules to gain energy and the water molecules to lose energy.

The temperature of the water dropped when you added ice to it. The reason for this temperature change is that the ice absorbs thermal energy from the water, causing the water's temperature to drop.

Based on the laws of heat transfer and the observation of temperature change, we can deduce that thermal energy was exchanged between the water and the ice. Until equilibrium is attained, thermal energy constantly transfers from an object with a higher temperature to one with a lower temperature.

In this instance, the water is initially warmer than the ice. Heat is transferred from the water to the ice when the ice is introduced, and this continues until both have reached the same temperature. As a result, the temperature of the water drops, signaling a thermal energy transfer from the water to the ice.

Heat conduction is the term for the molecular process behind this thermal energy transfer. Water molecules' kinetic energy causes them to move constantly at the molecular level. The water molecules close to the ice come into contact with the cooler ice molecules when the ice is introduced.

The ice molecules, which have lower kinetic energy, get thermal energy from the more energetic water molecules through molecular collisions. The average kinetic energy (temperature) of the water molecules decreases as a result of this energy transfer.

The ice molecules gain thermal energy and start to melt as a result of these collisions and energy transfers, whilst the water molecules lose thermal energy and the temperature drops.

For more such questions on thermal energy

https://brainly.com/question/19666326

How many milliliters of H2 gas at STP are required to fully hydrogenate 1.68 g of C6H8N2 (adiponitrile) according to the following hydrogenation reaction scheme?

C6H8N2(l)+4H2(g)C6H16N2(s)

Answers

Answer:

The answer is

21.5 L

.

So, start with the balanced chemical equation for the decomposition of hydrochloric acid

2

HCl

H

2

+

Cl

2

Notice that you have a

2:1

mole ratio between

HCl

and

Cl

2

, which means that every 2 moles of the former will produce 1 mole of the latter. The number of moles of

HCl

you have is.

Explanation:

I don't know if that is but I try my best just correct me if I'm wrong thank you!!

what are unicellular organism?​

Answers

Answer:

Single celled organism

Explanation:

They fall under two categories:

Eukaryotes and prokaryotes.

Eukaryotes: Evolved from prokaryotes, they are larger and more complex. Unlike prokaryotes, they have a nucleus. Can be single celled or multicellular.

Prokaryotes: Oldest cell type, small and simple. They do not have a nucleus. Open unit with no compartments.

¿De que dependen las propiedades del grafeno?


¿De que ha dependido el rapido avance en el desarollo de nuevos materiales basados en formas alotropicas del carbon?

POR FAVOOR ES URGENTEEEEE

Answers

Answer:

di ko maintindihan anggulo ng isinulat

a 25.0 ml sample of a saturated c a ( o h ) 2 solution is titrated with 0.028 m h c l , and the equivalence point is reached after 38.1 ml of titrant are dispensed. based on this data, what is the concentration (m) of c a ( o h ) 2 ?

Answers

Titration is a neutralization reaction with an acid and a base. The concentration of calcium hydroxide Ca(OH)₂ in the reaction is 0.04267 M

How to calculate the concentration reaction?

Given:

Concentration HCl : M₁ = 0.028 M

Volume HCl = V₁ = 38.1 mL

Volume Ca(OH)₂: V₂ = 25.0 mL

Asked:

Concentration Ca(OH)₂: M₂ = ?

Answer:

Formula to answer this question → M₁V₁ = M₂V₂

0.028 x 38.1 = M₂ (25.0)

M₂ = 1.0668/25.0

M₂ = 0.04267 M

So, the concentration of calcium hydroxide in the reaction is 0.04267 M

Learn more about molarity at https://brainly.com/question/24209221

#SPJ4

How many liters of H2 are equal to 11.1 g of H2 gas at STP?

Answers

Answer

V = 123.3 L

Explanation

Given:

mass of H2 = 11.1 g

At STP

Required: Volume of H2

Solution

At STP 1 mole =22.4 L

Step 1: Calculate the number of moles of H2

n = m/M

n = 11.1g/2.016g/mol

n = 5.5 mol

Step 2: Calculate the volume

1 mole =22.4 L

5.5 mole = x liters

V = 123.3 L

explain why the troposphere has a larger total mass in the stratosphere even though the stratosphere so much bigger

Answers

Answer:

The troposphere is the lowest layer of Earth's atmosphere, and is also where nearly all weather conditions take place. It contains 75% of the atmosphere's mass and 99% of the total mass of water.

Explanation:

Carbon cycle – What are the main reservoirs
of the carbon cycle? Where do the inorganic and organic carbon
cycles interact? What are the major differences and similarities
between the inorganic and organic carbon?

Answers

The main reservoirs of the carbon cycle are the atmosphere, oceans, land (including vegetation and soils), and fossil fuels. In these reservoirs, carbon exists in both inorganic and organic forms.

The inorganic carbon cycle involves the exchange of carbon dioxide (CO2) between the atmosphere and oceans through processes like photosynthesis and respiration.

Organic carbon, on the other hand, is found in living organisms, dead organic matter, and soil organic matter. It is cycled through processes such as decomposition and consumption by organisms. The interactions between the inorganic and organic carbon cycles occur primarily in the biosphere, where photosynthesis converts inorganic carbon into organic carbon compounds. While inorganic carbon is primarily in the form of CO2, organic carbon is present in complex organic molecules. Both forms of carbon play crucial roles in energy transfer, nutrient cycling, and climate regulation.

Learn more about Carbon Cycle

brainly.com/question/13729951

#SPJ11

which transition state is more stable and why? select an answer and submit. for keyboard navigation, use the up/down arrow keys to select an answer. a the transition state that produces the markovnikov product is more stable because a partial positive charge is forming on tertiary carbon your answer b the transition state that produces the markovnikov product is more stable because a partial positive charge is forming on primary carbon c the transition state that produces the anti-markovnikov product is more stable because a partial positive charge is forming on tertiary carbon d the transition state that produces the anti-markovnikov product is more stable because a partial positive charge is forming on primary carbon

Answers

Answer:

The closer the transition state to the product, the more stable it is. It is because this transition state is closest to the final form of the product, which is usually stable

I WILL GIVE A LOT OF EXTRA POINTS. PLEASE ANSWER ALL OF THEM ​

I WILL GIVE A LOT OF EXTRA POINTS. PLEASE ANSWER ALL OF THEM

Answers

75 for all

Explanation:

Answer:

Explanation: Li= Lithium, Na= Sodium, K= Pottasium, Rb= Rubdium Cs= Cesiuna, Fr= Fransium

6. Energy levels increases as if you move down a group during the number of electrons increases again.

7. A charge with higher and effective nuclear charge makes greater attractions to the electrons, pulling the electrons cloud closer to the nucleus makes it in a smaller atomic radius.

8. Ge= Germanium, He= Helium, O=Oxygen, Barium

What is the pH of the solution obtained during the reaction of sodium with water?
1;3;7;14

Answers

the alkali metals react with water produced hydrogen gas and the metal hydroxide

2Na(s) + 2H₂O(l) → 2NaOH(aq) + H₂(g)

NaOH : strong base, pH> 7

so the pH of the solution could be 14

Sulphur is the element represented in the diagram. If protons are represented by subatomic particle X, what is subatomic particle Y, the other type of particle in the nucleus?

Sulphur is the element represented in the diagram. If protons are represented by subatomic particle X,

Answers

Answer: It will be C. neutron.

Explanation:

What is the [HF] in a solution with a pOH of 12.5?

Answers

The concentration of the HF solution is  0.03.

What is the concentration?

We know that the concentration has to do with the amount of the substance that is present in the system. We know that what we have is an acid hence we can only talk about the concentration of the acid if we can obtain the amount of the hydrogen ion.

We know that the acid is defined as any substance in which there is the presence of the hydrogen ion is what we call and acid. Since the hydrogen fluoride does have the hydrogen, we can say that the substance that we are dealing with here is an acid.

Thus;

pH = 14 - pOH

pOH = hydroxide ion concentration

pH = hydrogen ion concentration

pH = 14 - 12.5

= 1.5

[HF]  = Antilog (-1.5)

= 0.03

The acid would have a concentration of  0.03.

Learn more about pH:https://brainly.com/question/15289741

#SPJ1

What does the pH of a solution indicate
O A i tells what the dissodation constant is,
B. I tells how acidic or basic a solution is
C. It tells what ions are dissolved in solution
OD. I tells what the conjugate add base pair is

Answers

I think it’s B because I just know

If 7.34 mol of O2 reacts, calculate the grams of CO2 produced.CH4 + 2O2—> CO2 + 2H2O

Answers

Answer:

161.48 g

Explanation:

Here, we want to get the mass of carbon (iv) oxide produced

From the question, we have the balanced chemical reaction stating that 2 moles of oxygen molecule produced 1 mole of carbon (iv) oxide molecule

The number of moles of carbon (iv) oxide produced from 7.34 mol oxygen is thus:

7.34×12 = 3.67 moles

1 mole of carbon (iv) oxide contains 44 g

The mass in 3.67 moles will be:

44×3.67= 161.48 g

Other Questions
choose the correct equation please 2/3 , 2/6, 2/4 Which is the least? Which principle of government is the idea that the government gets its power from the people? A popular sovereignty B judicial review C separation of powers D checks and balances 9. the skills you have that allow you to do something 10. the basic part of something, on which everything depends 11. something that you consider likely to be true even though no one has told you directly or you have no proof 12. very dirty b. Use some of the key words above to complete these sentences. 1. The surface water made the road 2. This study is the 3. It's unfair to make 4. As well as one 5. The children were completely 6. You should never in the sea. for drivers. of the whole research programme. about teenagers being lazy and untidy. a further 17 people were injured. after playing in the mud. your ability or strength when swimming The following programs were all part of the original Social Security Act of 1935: which of the following is not a power or responsibility of the president established by the u.s. constitution? a commander-in-chief of the armed forces b veto legislation (but subject to override by congress) c oversee the economy d negotiate treaties (with the advice and consent of the senate) your answer e power to pardon those convicted of federal offenses f receive representatives of foreign nations g nominate federal judges, including supreme court justices, as well as other federal officials h make appointments to fill military and diplomatic posts i call congress into session when needed j all of the above are powers or responsibilities of the president established by the u.s. constitution Which statement could help explain the change in water temperature?Higher turbidity allows water to absorb more sunlight, causing a decrease in temperature.ureHigher turbidity allows water to absorb less sunlight, causing a decrease in temperature.Higher turbidity allows water to absorb more sunlight, causing an increase in temperature.Higher turbidity allows water to absorb less sunlight, causing an increase in temperature. A class consisting of 3 undergraduate students and 9 graduate students is randomly divided into three groups of 4. What is the probability that each group includes an undergraduate student Jenny intends to measure the effects of color on mood. She decides to put participants in a room that has pink wallpaper or blue wallpaper, and then have them complete a questionnaire asking about their mood. Using the wallpaper and the questionnaire are examples of which stage of the HOMER method which of the following is not a risk associated with a global strategy? multiple choice a firm with only one manufacturing location must export its product, sometimes at great distance from the operation. the geographic concentration of any activity may also tend to isolate that activity from the targeted markets. a firm with only one manufacturing location must import its product. concentrating an activity in a single location makes the rest of the firm dependent on that location. Does the variance of a sum equal the sum of the variances? What people did Hernando de Soto come into contact with when his expedition arrived in Georgia?Athe Cherokee peopleBthe Creek peopleCthe Mississippian peopleDthe Seminole people sal con otras personas porque no quieres ser un blanco Please help asap!!! 2(h + 3.5) = -11 whats h? the principle in accounting relates to making judgments and estimates that result in lower profits and asset valuation estimates rather than higher profits and asset valuation estimates. Josef says, It was like they were invisible people chose not to see them. How does this simple statement reflect his experience on the train in Nazi Germany? Why do people ignore them? Compare his experience To Mahmouds when he says, They only see us when we do something they dont want us to do. REFUGEE NOVEL The mean and standard deviation of a random sample of n measurements are equal to and , respectively. a. Find a % confidence interval for if n. b. Find a % confidence interval for if n. c. Find the widths of the confidence intervals found in parts a and b. What is the effect on the width of a confidence interval of quadrupling the sample size while holding the confidence coefficient fixed? There are twelve general types of actors in healthcare. True or false c is opposite___ACAC and BC