Answer:
Plates
Explanation:
The Earth's crust is broken up into sections called plates. Tectonic plates are on the mantle which allow them to move.
What type of reaction is 2NaBr+Cl2-NaCl+Br2
Answer:
An anionic single replacement reaction.
Explanation:
Hope this helps!!!
Answer:
Substitution or Displacement maybe?
Determine E° for a galvanic (voltaic) cell if ∆G° = -6.3 kJ/mol and n = 3. (F = 96,500 J/(V・mol))
The E° for a galvanic cell is 0.000217 volts if ∆G° = -6.3 kJ/mol and n = 3. (F = 96,500 J/(V・mol).
A galvanic cell or voltaic cell, named after the scientists Luigi Galvani and Alessandro Volta, respectively, is an electrochemical cell in which an electric current is generated from spontaneous Oxidation-Reduction reactions. A common apparatus generally consists of two different metals, each immersed in separate beakers containing their respective metal ions in solution that are connected by a salt bridge or separated by a porous membrane.
E°=ΔG°/-nF= -6.3/-3×96500=0.000217 V.
Learn more about galvanic cell,here:
https://brainly.com/question/30268944
#SPJ1
I will give brainly IF CORRECT.
What describes an electrolyte?
Question 1 options:
Substances that prohibit electricity from traveling across a solvent
Substance that gives out ions when dissolved in water, which are able to conduct electricity
A chemical used to combust flames in a laboratory setting
A type of current that is utilized to determine if there is a blockage anywhere in the system
Substance that gives out ions when dissolved in water, which are able to conduct electricity describes an electrolyte.
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Which equation is balanced?
O 2Fe +02 → 2Fe2O3
O 3Fe +302 → 3Fe2O3
O 4Fe +302 → 2Fe2O3
O Fe +0₂ Fe₂O3
Answer:
C) 4Fe + 3O2 → 2Fe2O3
Explanation:
For this question, first you would go through all the options and make sure that there is an equal amount of elements on each side.
For the first option: 2Fe +02 → 2Fe2O3
You have only 2Fe atoms and 2O atoms on your reactant side and 4Fe and 6O atoms on your product side. This is not balanced.
For option b: 3Fe +302 → 3Fe2O3
You have 3Fe and 6O atoms on your reactant side while on your product side you have 6Fe and 6O atoms. This is not balanced.
For option c: 4Fe +302 → 2Fe2O3
You have 4Fe and 6O atoms on your reactant side and 4Fe and 6O atoms on your product side. This is balanced!
For option d: Fe +0₂ → Fe₂O3
You have 1Fe and 2O atoms on your reactant side and 2Fe and 3O atoms on your product side. This is not balanced.
***Remember to multiply the subscript of an element by their coefficient (number in front of molecule) if there is any.
the electron configuratiom for hellium (He) is shown below
1s²
which diagram shows the correct distribution of electrons in the electrom shells of a helium atom
The diagram that shows the correct distribution of electrons in the shells of a helium atom would be the first diagram.
Electron configuration of elementsThe electron configuration of elements is a structure that shows how the electrons present in the atoms of elements are distributed in the shells of orbitals in the atom.
The distribution of electrons in the orbitals follows certain established rules:
Lower energy levels orbitals are filled first before higher energy level orbitalsIn orbitals with multiple degenerates, electrons are singly filled before pairing starts.Thus, following these rules, Helium has 2 electrons in its atoms. The 2 electrons will occupy the lowest energy orbital or shell in the atom. This lowest energy shell can take a maximum of 2 electrons.
Thus, the second image is the correct representation of the electron configuration of a helium atom.
More on electron configurations can be found here: https://brainly.com/question/29757010
#SPJ1
A chemist combine did 3.50g of potassium level with chlorine gas to yield 6.6 7g of potassium for it. Assuming all the potassium was consumed, and that potassium chloride was the only product that formed, what mass of chlorine reacted?
Answer: mass of chlorine reacted is 3.18 g
Explanation:
2 K + Cl2 = 2KCl
no. of moles of K = mass / molar mass
= 3.50 / 39
= 0.0897
no. of moles of KCl = mass / molar mass
= 6.67 / 74.5
= 0.0895
no. of moles of Cl2 required = number of moles of KCl / 2
= 0.0895 / 2
= 0.0448 moles
mass of Cl2 required = no. of moles of Cl2 required x molar mass
= 0.0448 x 71
= 3.1808 g ≈ 3.18 g
Therefore mass of chlorine reacted is 3.18 g
*SCIENCE*
A nebula contains large amounts of dust and clouds. What role does gravity play inside of nebulae?
0 The gravitational pull between the gas and dusť matter leads to the formation of new galaxies.
0 The gravity pulls the gas and dust apart, leading to the formation of a larger nebula.
0 The gravitational pull between the gas and dust matter leads to the formation of new stars and planets.
0 There is no gravity inside nebulae because each dust particle is so small.
Answer:
The gravitational pull between the gas and dust matter leads to the formation of new galaxies
Explanation:
My teacher went over the answers and said that one was correct.
A nebula contains large amounts of dust and clouds. The gravitational pull between the gas and dusť matter leads to the formation of new galaxies does gravity play inside of nebulae. Therefore, option A is correct.
What is gravity ?Gravity is the force that pulls objects toward the center of a planet or other body. The gravitational force keeps all the planets in orbit around the sun.
Gravity pulls you toward the ground because all objects with mass, such as our Earth, actually bend and curve the fabric of the universe, known as spacetime. Gravity is the curvature of the earth.
A nebula is densely packed with dust and clouds.The gravity play a role inside nebulae, The gravitational pull between gas and dus matter leads to the formation of new galaxies.
Thus, option A is correct.
To learn more about the gravity, follow the link;
https://brainly.com/question/4014727
#SPJ6
Based upon the context clues of the lesson, what do you think will be the relationship between Charles and his parents
O it will be deceitful and confusing
It will be apathetic and non-caring
It will be wonderful and loving
o it will be full of anger and fighting
Answer:
It is the first or second one. The other two didn't work for me.
Explanation:
Hope this helps :)
Answer:
It will be apathetic and non-caring
Explanation:
When zinc reacts with copper sulfate solution, zinc sulfate solution and copper are formed.(i) An experiment was carried out to measure the temperature change when zinc powder reactswith copper sulfate solution.initial temperature of copper sulfate solution = 20 °Cfinal temperature of mixture after the reaction = 46 °CExplain what the temperature readings show about the type of heat change that occurs duringthis reaction.
The temperature increase from 20 °C to 46 °C indicates that the reaction between zinc and copper sulfate solution is exothermic, with heat being released into the surroundings.
In the given reaction between zinc and copper sulfate solution, the temperature change can provide insights into the type of heat change occurring during the reaction. Based on the provided information, the initial temperature of the copper sulfate solution was 20 °C, and the final temperature of the mixture after the reaction was 46 °C.
The temperature increase observed in this reaction indicates an exothermic heat change. An exothermic reaction releases heat energy into the surroundings, resulting in a temperature rise. In this case, the reaction between zinc and copper sulfate solution is exothermic because the final temperature is higher than the initial temperature.
During the reaction, zinc displaces copper from copper sulfate to form zinc sulfate and copper metal. This displacement reaction is known as a single displacement or redox reaction. Zinc is more reactive than copper and therefore replaces copper in the compound.
The formation of new chemical bonds during the reaction releases energy in the form of heat. This energy is transferred to the surroundings, leading to an increase in temperature. The heat released is greater than the heat absorbed, resulting in a net increase in temperature.
The exothermic nature of this reaction can be explained by the difference in bond energies between the reactants and products. The breaking of bonds in the reactants requires energy input, while the formation of new bonds in the products releases energy.
In this case, the energy released during the formation of zinc sulfate and copper metal is greater than the energy required to break the bonds in copper sulfate and zinc.
For more such question on temperature visit:
https://brainly.com/question/4735135
#SPJ8
base and? The carbonate buffer is responsible for the pH regulation of the extracellular environment. A carbonic acid-hydrogencarbonate is prepared in a ratio 1.25:1. The Ka is 4.5 x 10^-7 what is the concentration of t hydrogen carbonate ion if the physiological pH = 7.35 what is the concentration of H₂CO₂ lon
The concentration of the hydrogen carbonate ion ([HCO₃⁻]) is approximately 3.15 x 10⁷ and the concentration of the carbonic acid ([H₂CO₃]) is approximately 2.52 x 10⁷.
The carbonate buffer system plays a crucial role in maintaining the pH balance of the extracellular environment. In this system, carbonic acid (H₂CO₃) and hydrogen carbonate (HCO₃⁻) act as a conjugate acid-base pair. Given that the ratio of carbonic acid to hydrogen carbonate is 1.25:1, we can assume that the initial concentration of carbonic acid is higher. Let's denote the initial concentration of carbonic acid as [H₂CO₃] and the concentration of hydrogen carbonate as [HCO₃⁻]. The dissociation of carbonic acid can be represented by the equation: H₂CO₃ ⇌ H⁺ + HCO₃⁻. The equilibrium constant (Ka) for this reaction is given as 4.5 x 10⁻⁷. At physiological pH (7.35), the concentration of H⁺ is determined by the dissociation of carbonic acid and is tightly regulated. To calculate the concentration of hydrogen carbonate ion ([HCO₃⁻]), we need to make use of the Henderson-Hasselbalch equation:
pH = pKa + log([HCO₃⁻]/[H₂CO₃])
Substituting the given values, we have:
7.35 = -log(4.5 x 10⁻⁷) + log([HCO₃⁻]/[H₂CO₃])
Rearranging the equation, we find:
log([HCO₃⁻]/[H₂CO₃]) = 7.35 + log(4.5 x 10⁻⁷)
Taking antilog of both sides, we get:
[HCO₃⁻]/[H₂CO₃] = 10^(7.35 + log(4.5 x 10⁻⁷))
Simplifying the right-hand side, we have:
[HCO₃⁻]/[H₂CO₃] ≈ 3.15 x 10⁷
Since the initial ratio of H₂CO₃ to HCO₃⁻ is 1.25:1, we can set up the equation:
[HCO₃⁻] = 1.25 x [H₂CO₃]
Substituting the value of [HCO₃⁻]/[H₂CO₃] from above, we find:
1.25 x [H₂CO₃] = 3.15 x 10⁷
Solving for [H₂CO₃], we get:
[H₂CO₃] ≈ 2.52 x 10⁷
Therefore, the concentration of the hydrogen carbonate ion ([HCO₃⁻]) is approximately 3.15 x 10⁷ and the concentration of the carbonic acid ([H₂CO₃]) is approximately 2.52 x 10⁷.
For more question on concentration
https://brainly.com/question/28564792
#SPJ8
I’ll mark you brainliest
Answer:
D.
Explanation:
For the following questions state the oxidation number of the element in the given compound.
1. sul fur in Li2SO#3
2. chlorine in MgCl2
3.Silicon in SiO2
4.sul fur in H2SO4
5.Sulfur in SO4^2-
6. manganese in MnO4^-
7. Cr in Cr2O7^2-
in the periodic tables
elements in the same column have the same charge
in a compound oxidation numbers have to equal 0
1.
sulfur in Li2SO3
charges :
Li = +1 S = +4 O = -2
multiply the charge with the subscripted number next to the element
Li = +1
Li2 = +2
O = -2
O3 = -8
in a compound oxidation numbers have to equal 0
+2 S -6 = 0
S -4 = 0
S = +4
Sulfur = +4
2.
MgCl2
Mg = +2
+2 Cl2 = 0
Cl2 = -2
Cl by itself = -2 divided by 2 = -1
Chlorine = -1
3.
SiO2
Silicon = +4
4.
Sulfur in H2SO4
H: +1 S: +6 O: -2
H2SO4
H2 : +2 O4: -8
+2 +S -8 = 0
S - 6 = 0
S = +6
Sulfur = +6
5.
Sulfur in SO4^2-
Sulfur in SO4
Sulfur = +4
6.
Manganese in MnO4^-
Manganese in MnO4
Manganese = +4
7.
Cr2O7^2-
Dichromate
Cr in Cr2O7^2- or Cr2O7-2-
Cr: +6 O: -2
How many grams of NaOH are needed to make 100. mL of solution with a concentration of 1.5 M?
To create 100 mL of solution with a concentration of 1.5 M, 6.00 grams of NaOH are required.
The amount of NaOH needed to make 100. mL of solution with a concentration of 1.5 M can be calculated using the formula:
mass = molarity x volume x molar mass
where:
molarity = 1.5 M (given)
volume = 100. mL = 0.1 L (given)
molar mass of NaOH = 40.00 g/mol (from periodic table)
Substituting the values, we get:
mass = 1.5 mol/L x 0.1 L x 40.00 g/mol
mass = 6.00 g
Therefore, 6.00 grams of NaOH are needed to make 100. mL of solution with a concentration of 1.5 M.
To know more about the Solution, here
https://brainly.com/question/14296204
#SPJ1
Copper is a metal with the ability to conduct electricity, so copper wires are often used in small household appliances. The ability to
conduct electricity is a drag and drop answer here property of copper. Iron, on the other hand, reacts with oxygen to form iron oxide, also
known as rust. The ability of iron to rust is a drag and drop answer here property of the metal As scientists characterize certain metals, they
investigate physical properties like drag and drop answer here and chemical properties like drag and drop answer here.
Answer:
physical property
Chemical property
melting point
Reactivity with a strong acid
Explanation:
The ability to conduct electricity is a physical property of copper. Most electrical cables are made of copper owing to its high electrical conductivity.
The rusting of iron is a chemical reaction. Rust is actually hydrated iron III oxide. Hence it is a chemical property of iron.
The melting points of metals can be used to classify them. The greater the density of metals, the higher their melting point.
The ability of metals to react with acids separates metals into highly reactive, moderately reactive and unreactive metals.
Copper shows physcal property & iron shows chemical property.
What are physical and chemical properties?Physical properties are those properties which are seen by the eye due to change in the outermost appearance, whereas chemical properties are those which are shown due to change in the internal composition.
In the question, it is given that copper metal has a ability to conduct electricity and this property of metal is the physical property, as due to conduction their identity is not changing.
It is also given that iron is showing rusting due to the formation of iron oxide, so it a chemical property as identity of iron changes.
So, scientists characterize certain metals, they investigate physical properties like melting point, conductivity, density, etc. and chemical properties like reactivity with acid, base, oxygen, etc.
Hence, the ability to conduct electricity is a physical property of Cu and the ability of iron to rust is a chemical property.
To learn more about physical and chemical properties, visit the below link:
https://brainly.com/question/3143681
You want to make a photo album for your friend. In three to five sentences, describe at least one advantage and one disadvantage of choosing a digital photo album rather than a physical one. Analyze a potential solution to the disadvantage
Because digital data can be lost so easily, Atomic Theory it is essential for photographers to have at least 1 backup of each shot they intend to save for the long term.
What are digital photography's drawbacks?Higher Initial Cost: Compared to roll film cameras, greater, fully-loaded digital cameras can be a little more expensive. Battery Consumption: With digital cameras, the battery runs out more quickly. This necessitates having a few spare batteries on hand, especially while taking numerous photos.
How do you recognise probable remedies?The process of finding solutions is iterative: Start by formulating theories for potential solutions to your problem. Create a how map by structuring these hypotheses. Next, prior to performing the actual testing, choose which hypothesis you wish to test first.
To know more about Atomic Theory visit:
https://brainly.com/question/28853813
#SPJ1
what is the strength of alloys and what is the solubility of alloys please answer this simple question within 12 hours will mark brainliest for sure
Answer:Features very high tensile strength and toughness. Titanium alloys are light in weight, have superior corrosion resistance properties and can withstand extreme temperatures. ... Titanium alloys are heat-treated to increase their strength in terms of fracture toughness, fatigue strength and high temperature strength.35 grams is the sollubility.
Explanation:
Milk of magnesia, which is an aqueous suspension of magnesium hydroxide, is used as an antacid in the reaction below. How many molecules of HCl would have to be present to form 34.52 g of MgCl₂?
Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)
Approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.
To determine the number of molecules of HCl required to form 34.52 g of MgCl₂, we need to use the molar mass and stoichiometry of the balanced equation:
Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)
The molar mass of MgCl₂ is 95.21 g/mol.
First, we need to calculate the number of moles of MgCl₂ formed:
Moles of MgCl₂ = mass of MgCl₂ / molar mass of MgCl₂
Moles of MgCl₂ = 34.52 g / 95.21 g/mol
Moles of MgCl₂ = 0.363 mol
According to the balanced equation, the stoichiometric ratio between HCl and MgCl₂ is 2:1. Therefore, the moles of HCl required can be calculated as follows:
Moles of HCl = 2 * Moles of MgCl₂
Moles of HCl = 2 * 0.363 mol
Moles of HCl = 0.726 mol
To calculate the number of molecules, we need to use Avogadro's number, which is approximately 6.022 x 10^23 molecules/mol.
Number of molecules of HCl = Moles of HCl * Avogadro's number
Number of molecules of HCl = 0.726 mol * 6.022 x 10^23 molecules/mol
Number of molecules of HCl = 4.37 x 10^23 molecules
Therefore, approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.
For more such questions on molecules
https://brainly.com/question/1351818
#SPJ8
15.Which of the following is always equal on each side of a balanced chemical equation?Select one:a. The total number of ions.b. The total number of molecules.c. The total number of atoms of each element.d. The total number of different chemical compounds.
Answer:
\(C\)Explanation:
Here, we want to get what would be equal on both sides of the chemical equation
For the balancing, the number of atoms of each of the element is what we are balancing
Thus, what we have equal on both sides of the reaction is the total number of elements
Which element on the periodic table is the lowest mass in period 4??
Answer:
potassium I believe is the correct answer
Explanation:
Potassium is the period four element with the lowest mass; its average mass is 39.0983amu.
The fourth period of the periodic table is where potassium has its lowest atomic mass.
What is atomic mass?Atomic mass is defined as the combined mass of an atom's protons, neutrons, and electrons. The term "atomic mass" refers to the weight of an atom or molecule. To determine the average mass of elements and molecules as well as to resolve stoichiometry issues, the atomic mass is used.
An electrically neutral atom has an equal number of protons and electrons. As a result, using any of the two formulas, we may calculate the atomic mass of an element. The atomic mass of an element grows as we move from left to right in a period of the periodic table. In the fourth period of the current periodic table, Krypton has the highest atomic mass and potassium has the lowest.
Thus, the fourth period of the periodic table is where potassium has its lowest atomic mass.
To learn more about atomic mass, refer to the link below:
https://brainly.com/question/17067547
#SPJ2
A researcher observes a reaction and gathers the data in the table below. Observations Mass decreased after reaction Energy is released during reaction New substance is formed Which piece of evidence best identifies they type of reaction as nuclear or chemical? 1. Chemical, because energy is released during the reaction. 2.Nuclear, because energy is released during the reaction. 3.Nuclear, because the mass decreased after the reaction. 4.Chemical, because a new substance is formed.
The piece of evidence that best identifies the type of reaction as nuclear or chemical is: Chemical, because a new substance is formed. Option 4
In this scenario, the observation that a new substance is formed is a key characteristic of a chemical reaction. Chemical reactions involve the rearrangement of atoms to form different substances with distinct properties. The formation of a new substance indicates a chemical change has occurred.
The other pieces of evidence listed do not necessarily point to a nuclear reaction:
Chemical, because energy is released during the reaction: Energy can be released in both nuclear and chemical reactions, so this observation alone is not sufficient to determine the type of reaction.
Nuclear, because energy is released during the reaction: While energy can be released in nuclear reactions, it is not exclusive to them. Chemical reactions can also release energy, such as in exothermic reactions.
Nuclear, because the mass decreased after the reaction: This observation suggests a change in mass, which could be indicative of a nuclear reaction. However, it is important to consider that chemical reactions can also involve changes in mass, such as the formation of gases or dissolution of a solid.
Overall, the most conclusive evidence to identify the type of reaction is the formation of a new substance, which aligns with a chemical reaction.
Option 4
For more such questions on Chemical visit:
https://brainly.com/question/29886197
#SPJ8
Which of the following structural adaptation helps an oraganism obtain food
The internal energy of 10 moles of helium (a monatomic gas) is 15 kJ. What is the rms speed of the molecules? (The molar mass of helium is 4.00 g/mole.)
Answer:
\(v_{rms}=866.32m/s\)
Explanation:
Hello,
In this case, since the rms speed of the molecules is computed by:
\(v_{rms}=\sqrt{\frac{3RT}{M} }\)
Whereas the absolute temperature is computed from the internal energy (by using the Cp of helium (3.1156 J/g*K) as shown below:
\(U=nCvT\\\\T=\frac{U}{nCv}=\frac{15kJ*\frac{1000J}{1kJ} }{10mol*\frac{4.00g}{1mol} *3.1156\frac{J}{g*K} } \\\\T=120.36K\)
Thereby, the rms speed results:
\(v_{rms}=\sqrt{\frac{3*8.314\frac{kg*m^2}{s^2*mol*K}*120.36K}{4.00\frac{g}{mol}*\frac{1kg}{1000} } } \\\\v_{rms}=866.32m/s\)
Regards.
Between which two objects is gravitational attraction the greatest?
between the penny and the small pot
between the book and the cereal box
between the small pot and the book
between the paper clip and the penny
Answer:
Between the small pot and the book
Explanation:
Since gravitational force is influenced by the mass of an object, the higher the mass of two objects, the stronger the gravitational force.
Thus, the force between the pot and the book is strongest, since the two have the highest mass.
Have a nice day!
How does the atomic radius change going down and across the periodic table? (1 point)
Answer:
Larger atomic radius as you go down a column.
Smaller atomic radius as you go across a period.
Explanation:
Going down the periodic table, the atomic radius increases because each new period adds a new energy level/electron shell. New orbitals must be added outside of the pre-existing orbitals, expanding the atomic radius. For instance, the third period introduces the third energy level (3s) versus the fifth period which introduces the fifth energy level (5s).
Going across the periodic table, the atomic radius decreases because the number of protons within the nuclei increases. When there are more positively-charged protons, they have a greater pull on the negatively-charged electrons, thus brining them closer to the nucleus and shrinking the atomic radius. For instance, the atomic radius of chlorine (17 protons) is smaller than the atomic radius of the elements which lie to its left, such as phosphorus (15 protons) and sulfur (16 protons).
gold is used for making ornaments give reason
Answer:
Because looks good for a Christmas tree.
Explanation:
Gold ornaments look pretty shiny and cool to look at.
Hope I helped!
!Please help! Will give brainliest to correct answer!!
A student collected the data shown in the table below during an experiment.
Liquid Characteristics
Liquid Characteristics
Boiling Point Freezing Point Color Rate of Evaporation
Mercury 357 °C −39 °C shiny silver gray negligible
Alcohol 78 °C −115 °C colorless rapid
Based on the data, which of the following conclusions can be made about the use of mercury and alcohol thermometers?
An alcohol thermometer can measure the freezing point of a liquid that freezes at −80 °C.
An alcohol thermometer can measure a wider range of temperatures in a laboratory.
An alcohol thermometer is more reliable to measure the temperature of a liquid in a beaker that is 80 °C.
An alcohol thermometer is better to measure the boiling points of colorless liquids.
Answer:
its D
Explanation:
I took the test its right
The data can lead us to conclude that an alcohol thermometer can measure the freezing point of a liquid that freezes at −80 °C..
Liquid in glass thermometersThe liquid in glass thermometers are those thermometers whose thermometric substance is a liquid. Usually the best liquids to be used are those that have a long liquid range.
The data can lead us to conclude that an alcohol thermometer can measure the freezing point of a liquid that freezes at −80 °C..
Learn more about thermometers: https://brainly.com/question/365923
Did all the silver ions get consumed in the reaction? The molar mass of silver is 107.87 g/mol. Justify your answer.
This problem is asking for the consumption of silver ions when silver nitrate is reacted with copper. In such a case, since no masses are given, we can use the following from similar problems:
Mass of empty beaker: 110.000 g
Mass of beaker with silver nitrate (after all additions) and copper: 331.634 g.
Mass of beaker with silver: 113.395 g.
This means we can write the following chemical equation:
\(Cu+2AgNO_3\rightarrow Cu(NO_3)_2+2Ag\)
And thus calculate the mass of silver nitrate that will produce the following mass of silver:
\(m_{Ag}^{produced}=113.395g-110.000g=3.395g\)
Next, we use the 2:2 mole ratio of silver to silver nitrate (silver ions source):
\(3.395gAg*\frac{1molAg}{107.87gAg}*\frac{2molAgNO_3}{2molAg} *\frac{169.87gAgNO_3}{1molAgNO_3} = 5.35gAgNO_3\)
The step will be defined for the given mass of available silver nitrate which will be compared to 5.35 g (consumed mass) to see if they are the same (all consumed) or different (partial consumption).
Learn more:
https://brainly.com/question/22031122https://brainly.com/question/2607181https://brainly.com/question/16965188What types of reactions are these 3 chemical equations?-
*2Kl+Pb(NO3)2=PbI2+2KNO3
*2Al+3CuSO4=Al2(SO4)3+3Cu
*C2H5OH+3O2=2CO2+3H2O
Answer:
*2Kl+Pb(NO3)2=PbI2+2KNO3: double replacement.
*2Al+3CuSO4=Al2(SO4)3+3Cu: single replacement.
*C2H5OH+3O2=2CO2+3H2O: combustion.
Explanation:
Hello there!
In this case, according to the required, it turns out necessary for us to recall the five types of reactions, combination, decomposition, single and double replacement and combustion as shown on the attached figure.
In such a way, since the first reaction follows the pattern AB+CD-->AD+CB we infer it is double replacement; the second reaction follows the patter A+BC-->AC+B and therefore it is single replacement; and the last one follows the pattern of combustion reaction due to the presence of CO2 and H2O on the products side.
Regards!
1 point
Convert 3.79 x 10^24 atoms of sodium to grams.
Answer:
is easy to poiling
Explanation:
also is dificult to melting