According to the given reaction, 2 moles of NO are produced.
Using the molecular mass of NO we can find the mass produced:
\(2molNO\cdot\frac{30gNO}{1molNO}=60gNO\)It means that when 60g of NO are produced the heat absorbed is 171KJ.
Use this ratio to find the heat absorbed when 2.3 grams are produced:
\(2.3gNO\cdot\frac{171kJ}{60gNO}=6.555kJ\)It means that the correct answer is 6.5kJ.
A city’s water supply is fluoridated by adding NaF. The desired concentration of F– is 1.6 ppm. How many milligrams of NaF should be added per gallon of treated water if the water supply already is 0.2 ppm in F–?
The concentration of a solution can also be expressed in parts per million (ppm). The milligrams of NaF should be added per gallon of treated water is 0.82 mg.
What is ppm?The term ppm is used to express the concentration when solute is present only in traces of the solution. The number of parts of that component in million parts of the solution is ppm.
c(ppm) = [ w₂ / w soln] × 10⁶
Mass of fluoride = 1.6 ppm - 0.2 ppm = 1.4 ppm
1 L = 0.264 galloon
m = 1.4 mg / L × 0.264 L / gal
= 0.37 mg/gal
Molar mass of 'F' = 18.998 g/mol
n = 0.00037 g / 18.998 g/mol = 1.9 × 10⁻⁵ mol
Molar mass of NaF = 41.988 g/mol
m = 1.9 × 10⁻⁵ mol × 41.988 g/mol
m = 0.00082 g
Thus we need to add 0.82 mg of NaF.
To know more about concentration, visit;
https://brainly.com/question/30462414
#SPJ9
compare this ratio to the experimental number of moles computed above. The limiting reactants is/are
Answer: copper II chloride
Explanation:
Answer:
copper II chloride
hope this helps !
Pls help with the problem attached:
Mg 2+(aq) + 2NO2 -(aq) ⇒ Mg(NO2)2 (aq)
What is enthalpy?
In a thermodynamic system, energy is measured by enthalpy. Enthalpy is a measure of a system's overall heat content and is equal to the system's internal energy plus the sum of its volume and pressure.
The amount of heat released or absorbed during a reaction that takes place under constant pressure is referred to as the enthalpy change. The sign for it is H, which can be read as "delta H." If the system's enthalpy drops relative to the reaction, the reaction is preferred. A balanced chemical equation is followed by and on the same line as the enthalpy change for the reaction.
To learn more about enthalpy change use link below:
https://brainly.com/question/15174388
#SPJ1
Which molecule is most polar?
A) CH3CHO
B)CO2
C)CH3Cl
D)C2H6
E)NONE
the answer is none
Explanation:
Water
Water is the most polar molecule because a bond between oxygen and hydrogen has the most difference out of the atoms listed. Although the oxygen has two hydrogens bonded, this does not decrease the electronegativity of oxygen, but oxygen unfairly shares sets of electrons from both hydrogens, making it more polar still
There are two types of molecule in chemistry, one is polar molecule and other is non polar molecule. Therefore, among all the given option none is polar molecule. The correct option is option D.
What is polar molecule?A polar molecule is a type of chemical compound where there is an uneven distribution of electrons among the covalently bound atoms. The term "polarity" refers to how unlike two molecules' electrical poles are from one another. If they are quite dissimilar, the species is said to be a highly polar molecule.
Dipole moment tells about the extent of polarity in a molecule. It is measured in units of Debye. It can be calculated by multiplying charge and the separation between these two charges. Among all the given option none is polar molecule.
Therefore, among all the given option none is polar molecule. The correct option is option D.
To know more about polar molecule, here:
https://brainly.com/question/1581321
#SPJ2
Why do scientists classify organisms?
A It places organisms into groups which proves to be slower/takes more time.
B It makes them easier to study.
We're bringing Latin back.
D It complicates things.
Answer:
B
Explanation:
Please give brainliest
Calculate the mass of water produced by metabolism 84.0 g of glucose
The amount of water that will be produced is 50.36 grams
Stoichiometric problemsThe metabolism of glucose is represented by the following equation:
\(C_6H_1_2O_6(s)+6O_2(g)--- > 6CO_2(g)+6H_2O(g)\)
The mole ratio of glucose metabolized to the water produced is 1:6.
Mole of 84.0 g glucose = 84/180.156 = 0.4662 moles
Equivalent mole of water = 0.4662 x 6 = 2.7975 moles
Mass of 2.7975 moles water = 2.7975 x 18 = 50.36 grams
More on stoichiometric problems can be found here: https://brainly.com/question/14465605
#SPJ1
Which of the following is an incorrect representation for a neutral atom?
36Li
613C
3063Cu
1530P
This representation suggests that the element is phosphorus (P) with a mass number of 30, which is incorrect. The correct mass number for phosphorus is approximately 30.97. The incorrect representation for a neutral atom is 36Li
To determine the correct representation for a neutral atom, we need to consider the atomic number (Z) and mass number (A) of the element. The atomic number represents the number of protons in the nucleus, while the mass number represents the sum of protons and neutrons.
Let's analyze the given representations:
36Li:
This representation suggests that the element is lithium (Li) with a mass number of 36, which is incorrect. The correct mass number for lithium is approximately 6.94.
613C:
This representation suggests that the element is carbon (C) with a mass number of 13, which is correct. Carbon has different isotopes, and 13C represents one of its stable isotopes.
3063Cu:
This representation suggests that the element is copper (Cu) with a mass number of 63, which is correct. Copper has different isotopes, and 63Cu represents one of its stable isotopes.
1530P:
This representation suggests that the element is phosphorus (P) with a mass number of 30, which is incorrect. The correct mass number for phosphorus is approximately 30.97.
Therefore, the incorrect representation for a neutral atom is 36Li, as it does not match the known properties of lithium.
For more question on atom
https://brainly.com/question/26952570
#SPJ8
In each test, iron(II) sulfate and iron(III) nitrate were combined with the same substance or substances. However, the sulfate and nitrate parts of the compounds didn’t participate in any of the chemical reactions; only the iron ions reacted. Comparing the results for each pair of tests, what can you conclude about the iron(II) and iron(III) ions?
The reason behind this is that
Both Nitrate and sulphate are ions .So they stayed unchangedThere are various kind of reaction like combustion reaction, displacement reaction. So to solve this problem we must be knowing the displacement reaction. Displacement reaction is taking place over here
What is displacement reaction?Displacement reaction is a reaction in which one atom replaces other atom from a molecule on the basis of reactivity strength. The element which on the top of reactivity series displace the element that is lying below to that reactive element
According to our question the balanced equation is
FeSO₄+Zn\(\rightarrow\) ZnSO₄+Fe(II)
Fe(NO₃)₂+Zn \(\rightarrow\) Zn(NO₃)₂+Fe(II)
In both reaction Zn is more reactive than Fe(II) and Fe(III) that is why Zn replace or displace iron ion from its compound of sulfate and nitrate. Metal displace metals. anions are displaced by anions. So, here metal is displaced by zinc.
Thus we can conclude that zinc is more reactive than iron Fe(II) and Fe(III). Displacement reaction is taking place over here
To learn more about displacement reaction, here:
https://brainly.com/question/20690229
#SPJ5
N⁻³ and Na⁺ have same
A Atomic no.
B Mass No.
C No. of electrons
D No. of neutrons
Answer:
C.) No. of electrons
Explanation:
A.) is incorrect. The atomic number represents the number of protons in an element. Nitrogen (N) and sodium (Na) always have a differing amount of protons.
B.) is incorrect. The mass number represents the number of protons and neutrons in an element. The number of neutrons and protons are specific to each element (disregarding isotopes). When elements ionize, these amounts are not altered.
C.) is correct. When an element becomes an ion, the number of electrons change. When nitrogen gains 3 electrons and sodium loses 1 electron, they end up having the same number of electrons (10).
D.) is incorrect. When elements ionize, the number of neutrons does not change. The only way two different elements could have the same number of neutrons is if at least one of the elements is an isotope. Isotopes are two or more atoms of the same element that differ in their amounts of neutrons.
Barbara is converting 78°F to degrees Celsius. First, she subtracts 32 from 78. What is the next step?
Answer:
Now she multiplies by 0.5556
Explanation:
How many of the 7 traits of living things have
Answer:
What do you mean by this?
Explanation:
The force of gravity pulls down on your house with a total force of 300,000 newtons. The force of gravity pulling down on your house would be exactly twice as much if your house: a Had twice as much mass b Was twice as tall c Had twice as much volume d Covered twice as much area
Answer: B. Was twice as tall
Explanation: The strength of the gravitational force between two objects depends on two factors, mass and distance. If the distance is doubled, the force of gravity is one-fourth as strong as before.
The force of gravity pulling down on your house would be exactly twice as much if your house was twice as tall. Hence option b is correct.
What is gravity?Gravity is defined as a basic interaction that pulls everything with mass or energy in the same direction. All objects with mass, including our Earth, really bend and curve spacetime, which is what causes gravity to pull you toward the ground. The moon is maintained in its orbit around Earth by gravity, as are the planets in their orbits around the sun.
The force of gravity, which is directly dependent on the masses of the two objects, is inversely correlated with the square of the distance between two objects. This translates to an increase in gravity force with mass but a decrease in gravity force with increasing distance between objects. The force between two objects doubles if the mass of one thing doubles.
Thus, the force of gravity pulling down on your house would be exactly twice as much if your house was twice as tall. Hence option b is correct.
To learn more about gravity, refer to the link below:
https://brainly.com/question/4014727
#SPJ2
densityy of a cube that is 2" and weighs 444.5 g
The density (in g/cm³) of a cube of metal that is 2 inches on a side and weighs 444.5 grams is 3.4 g/cm³ (1st option)
How do i determine the density of the metal?First, we shall obtain the volume of the metal. Details below:
Length (L) = 2 in = 2 × 2.54 = 5.08 cmVolume =?Volume = L³
Volume = 5.08³
Volume = 131.1 cm³
Finally, we shall obtain the density of the metal. Details below:
Volume of metal = 131.1 cm³ Mass of metal = 444.5 gramsDensity of metal = ?Density = mass / volume
Density of metal = 444.5 / 131.1
Density of metal = 3.4 g/cm³
Thus, we can conclude from the above calculation that the density of the metal is 3.4 g/cm³ (1st option)
Learn more about density:
https://brainly.com/question/13275926
#SPJ1
Complete question:
What is the density (in g/cm³) of a cube of metal that is 2 inches on a side and weighs 444.5 grams?
3.4 g/cm³
8.89 g/cm³
55.56 g/cm³
0.180 g/cm³
What is the final temperature after 840 Joules is absorbed by 10.0g of water at 25.0
C?
The final temperature of the water is: T_final = 45.0°C
We can use the formula for the specific heat capacity of the water to solve this problem:
q = mcΔT
First, we can calculate the initial energy of the water:
q = mcΔT
q = (10.0 g) (4.184 J/g°C) (25.0°C)
q = 1,046 J
Next, we can calculate the final temperature after absorbing 840 J:
q = mcΔT
840 J = (10.0 g) (4.184 J/g°C) (ΔT)
ΔT = 20.0°C
Therefore, the final temperature of the water is:
T_final = T_initial + ΔT
T_final = 25.0°C + 20.0°C
T_final = 45.0°C
To know more about final temperature, here
brainly.com/question/11244611
#SPJ1
An excess of chromium metal is added to 500.0 mL of a 0.915 M AgNO3solution in a constant-pressure calorimeter. As a result of the reactionCr(s) + 2 AgNO3(aq)Cr(NO3)(aq) + 2 Ag(s)the temperature rises from 19.3 °C to 55.9 °C. Based on your previoustwo answers, calculate reaction (in J).Please help I don’t understand how i got it wrong :(
The enthalpy of the reaction is -164 kJ/mol.
What is the enthalpy of reaction?We know that the reaction that occurs between the chromium metal and the acid is an exothermic reaction thus there is an increase in the temperature of the system.
Number of moles of the silver nitrate solution is obtained from;
Volume * concentration
500/1000 L * 0.915 M = 0.46 moles
We can now assume that the density of the solution is 1 g/mL hence the mass of the solution is 500g. Let the specific heat capacity of the solution be 4.18 J/Kg/°C.
Then;
H = mcdT
H = Heat lost in the reaction
m = mass of the solution
c = specific heat capacity
dT = temperature change
H = 500 * 4.12 * ( 55.9 - 19.3)
= 75.4 kJ
The heat of reaction = 75.4 kJ/0.46 moles
= -164 kJ/mol
Let us recall that the negative simply means that heat was lost in the reaction.
Learn more about enthalpy:https://brainly.com/question/13996238
#SPJ1
Describe how to make a 0.24% w/w solution of NaOH in water
Answer:
Explanation:
Determine the quantity of solution you need to prepare. Let's assume you want to make 100 grams of the solution.
Calculate the mass of NaOH needed to make the solution. Since we want a 0.24% w/w solution, it means we want 0.24 grams of NaOH for every 100 grams of the solution.
Mass of NaOH = (0.24/100) * 100 = 0.24 grams
Measure out 0.24 grams of NaOH using an accurate weighing scale.
Add the measured NaOH to an appropriate container.
Add distilled water to the container, gradually while stirring, until the total mass of the solution reaches 100 grams. The water should be added in a controlled manner to ensure complete dissolution of NaOH.
Continue stirring until the NaOH is fully dissolved in the water, and the solution is homogeneous.
Once the NaOH is completely dissolved, the 0.24% w/w NaOH solution is ready for use.
Remember to handle NaOH with caution as it is a strong base and can cause harm. Use appropriate protective equipment, such as gloves and goggles, when handling NaOH.
Write and balance the equation for the combustion of the fatty acid lauric acid, (C12H24O2)
.
Express your answer as a chemical equation. Identify all of the phases in your answer.
The combustion of lauric acid is shown as CH3(CH2)10COOH(s) + 18O2(g) -----> 12H20(l) + 12CO2(g)
What is combustion?In a combustion reaction, a substance is burnt in oxygen. If the substance is an organic compound a the case is here, the products are carbon dioxide and hydrogen.
No the equation of the combustion of lauric acid is shown as;
CH3(CH2)10COOH(s) + 18O2(g) -----> 12H20(l) + 12CO2(g)
Learn more about combustion:https://brainly.com/question/15117038?
#SPJ1
d) Would the following molecules be attracted to a magnet? Briefly explain i. B ii. C iii. HCI Tutorial Roo to be handed in Monday 9th May 2022 b 16.00
The field of magnetic materials research and development is frequently reinvented.
Thus, Work on permalloys, ferrites, transport processes, and magnetic resonance in bulk and thin film samples dominated the magnetic material.
Magnetic "bubble films"—perpendicularly magnetized domains that could store and alter information—and the quick advancements in amorphous magnetic alloys drew a lot of attention in the 1970s.
The introduction of Fe-Nd-B permanent magnets and the dramatic acceleration of activity in magnetic thin films and surfaces, as well as continuous advancements in amorphous magnetic alloys, were all seen in the 1980s.
Thus, The field of magnetic materials research and development is frequently reinvented.
Learn more about Magnetic material, refer to the link:
https://brainly.com/question/31728739?
#SPJ1
sample gas has a pressure of 6.8 kPa at 539K. If the temperature decreases to 211K, then what will be the new pressure?
Gay-Lussac's Law-
\( \:\:\:\:\:\:\star\longrightarrow \underline{\sf \boxed{\sf \dfrac{P_1}{T_1}=\dfrac{P_2}{T_2}}}\)
\( \:\:\:\:\:\:\star\longrightarrow \sf \underline{P_2=\dfrac{P_1 \:T_2}{T_1}}\)
Where-
P₁ is the initial pressure.T₁ is the initial temperatureP₂ is the final pressure.T₂ is the final temperatureAs per question, we are given -
P₁ = 6.8 KPaT₁ =539 KT₂= 211KNow that we are given all the required values, so we can put them into the formula and solve for P₂:-
\( \:\:\:\:\:\:\:\:\:\:\:\:\longrightarrow \sf P_2=\dfrac{P_1 \:T_2}{T_1}\\\)
\( \:\:\:\:\:\:\:\:\:\:\:\:\longrightarrow \sf P_2=\dfrac{6.8\times 211}{539}\\\)
\(\:\:\:\:\:\: \:\:\:\:\:\:\longrightarrow \sf P_2 = \dfrac{1434.8}{539}\\\)
\( \:\:\:\:\:\:\:\:\:\:\:\:\longrightarrow \sf P_2 = 2.661966.........\\\)
\(\:\:\:\:\:\: \:\:\:\:\:\:\longrightarrow \sf\underline{ P_2 = 2.7 \:KPa}\\\)
Therefore, If the temperature decreases to 211K, then the new pressure will become 2.7 KPa.
A change in direction in a wave when it passes through an opening is called
Answer:
Refraction
Explanation:
the change in direction of waves that occurs when waves travel from one medium to another. ... Diffraction is the bending of waves around obstacles and openings. The amount of diffraction increases with increasing wavelength
Answer:
A change in direction in a wave when it passes through an opening is called diffraction.
I hope this helps
In Thomas Cole's The oxbow who is the one figure depicted in the landscape and what is he doing
Answer:
In Thomas Cole's painting "The Oxbow," Thomas Cole, the artist, shows himself sitting in the landscape while painting it.
Explanation:
In the painting called "The Oxbow" by Thomas Cole, the artist actually put himself in the picture. He's sitting right in the middle of the landscape, just like he placed himself in the painting, as if taking a selfie while working on it. It's like he took a snapshot of himself while he was working on the painting. This shows how much he cared about creating the artwork and how he felt a personal connection to the beautiful scenery. It's really fascinating because it gives us a glimpse into how he saw himself as an artist and how he wanted to capture the incredible beauty of nature through his art.
Write the electron configuration for a silicon anion with a charge of -1.
Answer:
\(\lbrack Si^-\rbrack=1s^22s^22p^63s^23p^3\)
Explanation:
Before we write the electronic configuration, we need to know the number of electrons that the neytral atom of silicon has
Silicon has an atomic number of 14. What that means is that the number of protons in its nucleus is 14
For a neutral atom, the number of electrons is same as the number of protons. This is in place so as to preserve the electronic neutrality of the said neutral atom
For anionic silicon with a charge of -1, it means that the silicon atom has received an extra electron, and that brings the total count of electrons it has to 15
This means anionic silicon has the electronic configuration of neutral phosphorus since they have the same number of electrons
Finally, we can write the electronic configuration in the expanded form as follows:
\(\lbrack Si^-\rbrack=1s^22s^22p^63s^23p^3\)The system below was at equilibrium in a 23.0 L container. What change will occur for the system when the container is shrunk to 14.2 L?
In conclusion, the particular reaction and equilibrium constant involved will determine the change that will take place for the system when the container is shrunk from 23.0 L to 14.2 L.
Calculation-The equilibrium will move towards the side with fewer moles of petrol if the reaction is exothermic and the container's volume is reduced. This is due to the fact that the pressure is increased as the volume decreases, favouring the reaction's side with fewer moles of gas. In contrast, if the reaction is endothermic, reducing the container's volume will result in a shift in the equilibrium in favour of the side with more gas molecules. This is so because a smaller volume lowers pressure, which benefits the side of the reaction that contains more gas molecules.
The reaction is not a gas-phase reaction?In general, if the capacity of the container is reduced, the concentration of all species inside the container will rise. Depending on the stoichiometry of the reaction, this can change the equilibrium position.
to know more about equilibrium here:
brainly.com/question/30807709
#SPJ1
What are the reactant in the following chemical equation 2h2o o2 +2h2
Answer:
In Explanation
Explanation:
The reactants in the following chemical equation:
2H2O + O2 → 2H2 + 2O2
are H2O and O2. They are substances that are present at the beginning of the reaction and are consumed during the reaction to form the products. In this case, 2 water molecules (H2O) and 1 molecule of Oxygen (O2) are the reactants.
How many grams are in 4.2 × 10²² atoms of iron?
Answer:0.226 gram
Explanation:you can get the answer in two steps calculate 3.40 . 10^22 atoms =
Answer:
4.2 × 10²² ÷ 6.022× 10²³
4.2 × 10²² equals 0.069 moles (approx)
weight of 1 mole of iron = 56g
therefore, 0.069 moles = 56 × 0.069 = 3.9 g
Sorry for lazy work.. :P
Is ginger ale good for gas pains?
Answer:
Search it up. It says it on this link:
determine the amount of time it takes for 3/4 of a radioactive sample of an isotope of bromine to decay. The half-life of the isotope is 16.5 hours.
Based on the given half-life, the amount of time it takes for 3/4 of a radioactive sample of an isotope of bromine to decay is 33 hours.
What is the half-life of a radioactive isotope?The time needed for a quantity to decrease to half of its initial value is known as the half-life. In nuclear physics, the phrase is frequently used to indicate how rapidly unstable atoms decay radioactively or how long stable atoms last.
Any substance that contains unstable atoms that release ionizing radiation during their natural decay is considered radioactive material.
Given the half-life of the radioactive sample of an isotope of bromine to be 16.5 hours. The amount of time it takes for 3/4 of a radioactive sample of an isotope of bromine to decay is calculated as follows:
After one half-life, half of the sample remains, and half decays
After two half-lives, 1/4 of the sample remains, and 3/4 decays
The time for two half-lives = 16.5 hours * 2
The time for two half-lives = 33 hours.
Learn more about half-lives at: https://brainly.com/question/1160651
#SPJ1
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
The quantity of antimony in a sample can be determined by an oxidation–reduction titration with an oxidizing agent.
A 5.85 g sample of stibnite, an ore of antimony, is dissolved in hot, concentrated HCl(aq) and passed over a reducing agent so that all the antimony is in the form Sb3+(aq). The Sb3+(aq) is completely oxidized by 26.6 mL of a 0.125 M aqueous solution of KBrO3(aq). The unbalanced equation for the reaction is:
BrO3-(aq) + Sb3+(aq) ------> Br-(aq) + Sb5+(aq) (unbalanced)
(A) Calculate the amount of antimony in the sample and its percentage in the ore.
Answer:
The percentage is k \(= 20.8\)%
Explanation:
From the question we are told that
The mass of the stibnite is \(m_s = 5.86 \ g\)
The volume of KBrO3(aq) is \(V = 26.6 mL = 26.6 *10^{-3} \ L\)
The concentration of KBrO3(aq) is \(C = 0.125 M\)
Now the balanced ionic equation for this reaction is
\(BrO_3 ^{-}+ 3Sb^{3+} + 6H^{+} \to Br^{1-} + 3Sb^{5+} + 3H_2O\)
The number of moles of \(BrO_3 ^{-}\) is
\(n = C *V\)
substituting values
\(n = 26.6*10^{-3} * 0.125\)
\(n = 0.003325 \ mols\)
from the reaction we see that 1 mole of \(BrO_3 ^{-}\) reacts with 3 moles of \(Sb^{3+}\)
so 0.003325 moles will react with x moles of \(Sb^{3+}\)
Therefore
\(x = \frac{0.003325 * 3}{1}\)
\(x = 0.009975 \ mols\)
Now the molar mass of \(Sb^{3+}\) is a constant with a values of \(Z = 121.76 \ g/mol\)
Generally the mass of \(Sb^{3+}\) is mathematically represented as
\(m = x * Z\)
substituting values
\(m = 1.215 \ g\)
The percentage of Sb(antimony) in the overall mass of the stibnite is mathematically evaluated as
k \(= \frac{1.215}{5.85 } * 100\)
k \(= 20.8\)%
Answer:
Explanation:
Step 1: Data given
Mass of stibnite (Sb2S3) = 5.85 grams
The Sb3+(aq) is completely oxidized by 26.6 mL of a 0.125 M aqueous solution of KBrO3(aq).
Step 2: The balanced equation
BrO3-(aq)+ 3Sb^3+(aq) + 6 H+ → Br-(aq) + 3Sb^5+(aq) + 3H2O (l)
Step 3: Calculate moles KBrO3
Moles KBrO3 = molarity * volume
Moles KBrO3 = 0.125 M *0.0266 L
Moles KBrO3 = 0.003325 moles
Step 4: Calculate moles Bro3-
in 1 mol KBrO3 we have 1 mol K+ and 1 mol BrO3-
In 0.003325 moles KBrO3 we have 0.003325 moles BrO3-
Step 5: Calculate moles Sb
For 1 mol BrO3- we need 3 mol Sb^3+ to produce 1 mol Br- and 3 mol Sb^5+
For 0.029085 moles BrO3- we need 3*0.003325 = 0.009975 moles Sb
Step 6: Calculate mass Sb
Mass Sb = moles Sb * molar mass Sb
Mass Sb = 0.009975 moles * 121.76 g/mol
Mass Sb = 1.21 grams
Step 7: Calculate the percentage of Sb in the ore
% Sb = (mass Sb / total mass) * 100%
% Sb = (1.21 grams / 5.85 grams) * 100 %
% Sb = 20.76 %
20.76 % of the ore is antimonyPlease help ASAP!!!!!!!
Answer:
ok
Explanation:
just use to the amu constant and interprete the calculation