In the reaction shown,
Ni(s) + CuCl₂(aq) → Cu(s) + NiCl₂(aq)
A Ni; causes reduction
B
is the oxidizing agent because it
CuCl2; causes reduction
CuCl₂; gets reduced
D) NiCl₂; gets reduced
E
Ni; gets reduced

Explanation:

decrease T = eq shifts left, because youre taking energy from the system and this is an endothermic reaction, it needs energy to make products = co2 concentration decreases

add CO = eq shifts right, because you're adding reactants in the equilibrium = i2o5 concentration decreases

increase i2o5 = same = can't affect T

decrease co2 = eq shifts right, because by

decreasing co2 you'll have less of this product than you normally have in the equilibrium, then eq will shift toward making more product = both reactants, CO and I2O5 decrease their concentration because they're being used to shift equilibrium right

YOU SUCK YOUR MOMS CHIVKEN NUGGA              YOU WHODDDDDDD :))))))))) \\\

This is the element Silicon.

=========================================================

Explanation:

First convert each percentage to its decimal form.

For example, 92.2297% converts to 0.922297 after moving the decimal point two spots to the left.

After doing that, multiply those decimal values with their respective atomic mass unit (amu) values.

Then we add up the results

25.8030109393 + 1.357027448 + 0.9253511536 = 28.0853895409

That rounds to about 28.085

Then look at the periodic table to see the atomic mass of Cobalt (Co), Aluminum (Al), Nickel (Ni) and Silicon (Si). The mass values listed in the periodic table are weighted averages of all the isotopes. The units for the mass are still in amu.

We have a match with silicon, showing that choice D is the final answer.

Answer:

hydrogen + oxgen = nitrogen

We can see here that the compound can be obtained with the help of the Wittig reaction in the following:

The Wittig reaction is a powerful synthetic method used to convert a carbonyl compound into an alkene using a phosphorus ylide.

The reaction mechanism involves the following steps:

Learn more about Wittig reaction on https://brainly.com/question/30611258

#SPJ1

Answer:

1)Mixture is the combination of substance

2)There are two types of mixture such as heterogeneous mixture and homogeneous mixture

3)foreg=Salt solution ,sedimentation

Pure substance

1)Pure substances are also called elements

2)They are made up of small atoms

3)for eg= oxygen,Venadium ,Iron,Oxygen

There is no reason to run these solutes at the 20 MWCO because they are both much smaller than the MWCO of the membrane.

The MWCO (molecular weight cut off) is the molecular weight of a solute at which it will be retained by a membrane during a process such as ultrafiltration or dialysis. If a solute has a molecular weight higher than the MWCO of a membrane, it will be retained and not pass through the membrane. If the molecular weight of a solute is lower than the MWCO, it will pass through the membrane.

In this case, glucose has a molecular weight of 180 g/mol (6 carbons x 12 g/mol per carbon + 6 oxygens x 16 g/mol per oxygen) and albumin has a molecular weight of approximately 81,942 g/mol (607 amino acids x 135 g/mol per amino acid). Both of these solutes have molecular weights that are much lower than 20,000 g/mol, which is a typical MWCO for ultrafiltration or dialysis membranes.

They would both easily pass through the membrane and be lost during the process. Instead, a membrane with a much lower MWCO would be needed if we wanted to retain these solutes during a process such as ultrafiltration or dialysis.

Learn more about glucose here:

https://brainly.com/question/2396657

#SPJ1

ANSWER

Option B

EXPLANATION

The IUPAC name of butyl propyl ether is given below as

Therefore, the correct answer is option B

Answer:

Copper Copper Copper Copper

The false statement about the gas expansion process is "∆S(system)=0".

When the gas expands into the vacuum, it undergoes an irreversible process. The gas molecules move from a region of high concentration to a region of low concentration, and as a result, there is an increase in entropy (∆S) of the gas.

According to the Second Law of Thermodynamics, the entropy of an isolated system will always increase for an irreversible process. Therefore, the entropy of the system, in this case, the gas, increases as it expands into the vacuum. The false statement about the gas expansion process is "∆S(system)=0". The other statements are true for this process. Since there is no temperature difference between the gas and the surroundings, the change in temperature is zero (∆T=0). The change in internal energy (∆E) is also zero since the gas is expanding against no external pressure. Finally, since there is no heat transfer between the system and the surroundings, the work done (∆PE + ∆KE) is equal to the heat transfer (w = q).

for more questions on gas
https://brainly.com/question/25736513
#SPJ11

Answer:

The balanced reactions are:

C₂ + 2B → B₂C₂

Ag₄ + 2SO₂ → 4AgO + S₂

Explanation:

The Law of Conservation of Matter postulates that "the mass is not created or destroyed, only transformed." This means that the reagents interact with each other and form new products with physical and chemical properties different from those of the reagents because the atoms of the substances are ordered differently. But the amount of matter or mass before and after a transformation (chemical reaction) is always the same, that is, the quantities of the masses involved in a given reaction must be constant at all times, not changing in their proportions when the reaction ends. In other words, then the mass before the chemical reaction is equal to the mass after the reaction.

In other words, the law of conservation of matter states that since no atom can be created or destroyed in a chemical reaction, the number of atoms that are present in the reagents has to be equal to the number of atoms present in the products.

Then, you must balance the chemical equation. For that, you must first look at the subscripts next to each atom to find the number of atoms in the equation. If the same atom appears in more than one molecule, you must add its amounts .

The coefficients located in front of each molecule indicate the amount of each molecule for the reaction. This coefficient can be modified to balance the equation, just as you should never alter the subscripts.

By multiplying the coefficient mentioned by the subscript, you get the amount of each element present in the reaction.  

You have:

C₂ + B → B₂C₂

Left side: 2 C and 1 B.

Right side: 2 C and 2 B.

Carbon C is balanced since you have the same amount of the element on each side of the reaction, but boron B is not balanced. So, balancing the reaction:

C₂ + 2B → B₂C₂

Left side: 2 C and 2 B.

Right side: 2 C and 2 B.

Now you have the same amount of each element on each side of the reaction, so the reaction is balanced.

Now you have:

Ag₄ + SO₂ → AgO + S₂

Left side: 4 Ag, 1 S and 2 O.

Right side: 1 Ag, 2 S and 1 O.

Balancing the Ag:

Ag₄ + SO₂ → 4AgO + S₂

Left side: 4 Ag, 1 S and 2 O.

Right side: 4 Ag, 2 S and 4 O.

Balancing the O:

Ag₄ + 2SO₂ → 4AgO + S₂

Left side: 4 Ag, 2 S and 4 O.

Right side: 4 Ag, 2 S and 4 O.

You have the same amount of each element on each side of the reaction, so the reaction is balanced.

Diene: These compounds have a double bond that is conjugated. Dienophile: At least one pi bond exists in these compounds. And occasionally, these pi bonds joined together after some electron withdrawal.

The field of chemistry known as stereochemistry is concerned with "the study of the various spatial configurations of atoms in molecules." The methodical presentation of a particular area of science and technology, known as stereochemistry, typically necessitates a little detour into the past.

a discipline of chemistry that examines the spatial configuration of atoms and groups in molecules, as well as how that configuration relates to the attributes of a substance.

To know more about stereochemistry visit:

https://brainly.com/question/13266152

#SPJ4

According to the given statement Na of the atoms listed below has the largest radius.

An atom is made up of a core nucleus and one or even more electrons with negative charges that orbit it. The positively charged, comparatively hefty protons and neutrons that make it up the nucleus may be present. The fundamental building components of matter are atoms.

Atoms are made up of a nucleus in the center that is surrounded by protons, neutrons, and electron. Uranium is divided into smaller atoms during the fission process, creating new atoms. The creation or atoms in enormous numbers can be seen in the Big Bang and Supernova phenomena.

To know more about Atoms visit:

https://brainly.com/question/1566330

#SPJ13

Answer:

Not to sure! I think energy from the pan is transferred to the food? Maybe.

Explanation:

Answer:

0.3529moles

Explanation:

no of moles =mass ÷molar mass

molar mass =17+17

=34

12÷34

=0.3529moles

According to the mole concept, the number of moles of molecules in a 12.0-gram sample of Cl₂ is equal to 0.169  moles.

Mole is defined as the unit of amount of substance . It is the quantity measure of amount of substance of how many elementary particles are present in a given substance.

It is defined as exactly 6.022×10²³ elementary entities. The elementary entity can be a molecule, atom ion depending on the type of substance. Amount of elementary entities in a mole is called as Avogadro's number.

It is widely used in chemistry as a suitable way for expressing amounts of reactants and products.For the practical purposes, mass of one mole of compound in grams is approximately equal to mass of one molecule of compound measured in Daltons. Molar mass has units of gram per mole . In case of molecules, where molar mass  in grams present in one mole  of atoms is its atomic mass.Number of moles is mass/molar mass= 12/70.90=0.169 moles.

Learn more about mole,here:

https://brainly.com/question/20486415

#SPJ6

Answer:

7.56 atm

Explanation:

Boyle's law states that the pressure and volume of a gas are proportional to each other

The formular for Boyle's law is

P1V1=P2V2

According to the question above, the values given are

P1=1.50 atm

P2= ?

V1=12.60 litres

V2= 2.50 litres

Let us make P2 the subject of formular

P2= P1V1/V2

P2= 1.50×12.60/2.50

P2= 18.9/2.50

P2= 7.56 atm

Hence when the volume of a gas is 2.50 litres then it's pressure is 7.56 atm

Cuz D is cyclo-thingy molecule and its a sugar

(i think A is fatty acid or other molecules and C is hydrocarbon. B dont have oxygen)

Monosaccharides are the group of carbohydrates that are the simplest form of sugar. Option D. galactose is a monosaccharide sugar.

Monosaccharides are simple sugars and are the fundamental unit of carbohydrates. The general structural formula for the monosaccharides is \(\rm (CH_{2}O)_{n}.\)

The structure of the monosaccharide sugar contains carbon, oxygen, and hydrogen molecules in their structure. Option A. is a fatty acid molecule, and option B. lacks an oxygen molecule, and hence they are not monosaccharides.

Option C. is a hydrocarbon chain that lacks oxygen molecules and option D. is a galactose that is a simple sugar with six carbon atom rings.

Therefore, option D. galactose is the monosaccharide.

Learn more about monosaccharides here:

https://brainly.com/question/5282729

Answer:

\(NiHSO_{4}\)

Explanation:

We're using nickel with a charge of 2, as indicated by the "(II)" in the name, and bisulfate refers to HSO\(_{4}\), which has a charge of 2-, so they are in a 1:1 ratio.

The rate constant for the reaction is either 7.14×10−3 s−1 or 2.50×10−3 s−1, depending on which rate was used to calculate it.

The rate of the reaction is given by the equation:

Rate = -k[A]

where k is the rate constant and [A] is the concentration of the reactant.

Rate at t=140 s:

Rate = (8.00×10−2 M - 0 M) / (140 s - 0 s)

= 5.71×10−4 M/s

Rate at t=400 s:

Rate = (4.00×10−2 M - 0 M) / (400 s - 0 s)

= 1.00×10−4 M/s

Since this is a zero-order reaction, the rate of the reaction is constant, and we can use either rate to calculate the rate constant:

k = Rate / [A]

Using the rate at t=140 s:

k = 5.71×10−4 M/s / 8.00×10−2 M = 7.14×10−3 s−1

Using the rate at t=400 s:

k = 1.00×10−4 M/s / 4.00×10−2 M

= 2.50×10−3 s−1

The rate constant for the reaction is either 7.14×10−3 s−1 or 2.50×10−3 s−1.

Learn more on zero-order reaction https://brainly.com/question/21663229

#SPJ1

Answer:

H₂O = 3.56 moles

MgCl₂ = 1.78 moles

Explanation:

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

you will taste the flavour of the food

Answer:

To calculate the number of British thermal units (BTUs) per hour required to heat the air, you will need to use the following formula:

BTUs per hour = flow rate (in cubic feet per minute) * temperature change (in degrees Fahrenheit) * specific heat of air * density of air

Plugging in the values provided in the question, we get:

BTUs per hour = 12000 cu ft/min * (115 F - 75 F) * 0.24 BTU/lb/F * (1/0.075 lb/cu ft)

Solving for BTUs per hour, we get:

BTUs per hour = 12000 cu ft/min * 40 F * 0.24 BTU/lb/F * (1/0.075 lb/cu ft)

= 12000 cu ft/min * 40 F * 0.24 BTU/lb/F * (1/0.075 lb/cu ft)

= 489600 BTUs per hour

Therefore, the grain drier requires 489600 BTUs per hour to heat the air from 75 F to 115 F.

Explanation:

Ketoacidosis is a potentially life-threatening condition that happens when the body begins breaking down fat at very fast rate. The fat is converted by the liver and causes the blood to become acidic and needs to be treated immediately.

Diabetes-related ketoacidosis (DKA) is a potentially fatal condition that affects diabetics. It happens when the body begins breaking down fat at an abnormally fast rate. The fat is converted by the liver into a fuel called ketones, which causes the blood to become acidic.

Diabetic ketoacidosis symptoms frequently appear suddenly, sometimes within 24 hours. High blood sugar levels and high ketone levels in urine are some of the first signs for DKA.

Learn more on Diabetic Ketoacidosis (DKA) here: https://brainly.com/question/28096487

#SPJ1

Answer: I think so.. (sorry if i am wrong)

Explanation:  Familiar examples of physical properties include density, color, hardness, melting and boiling points, and electrical conductivity. A physical property is a characteristic of matter that is not associated with a change in its chemical composition.

The enthalpy change for the reaction \(C2H4(g) + H2(g) → C2H6(g)\) is -137.15 kJ/mol.

Given:C2H4(g) + H2(g) → C2H6(g)The enthalpy of formation of C2H6(g) is -84.68 kJ mol-1The enthalpy of formation of C2H4(g) is 52.47 kJ mol-1The enthalpy of formation of H2(g) is 0 kJ mol-1Hence, using Hess's Law, the enthalpy change for the reaction \(C2H4(g) + H2(g) → C2H6(g)\) can be calculated by considering the formation of reactants and products from their respective elements. It can be given as:

\($$C_2H_4 + H_2 → C_2H_6$$$$\Delta H = H_f(C_2H_6) - [H_f(C_2H_4) + H_f(H_2)]$$$$\Delta H = -84.68 - [52.47 + 0]$$$$\Delta H = -84.68 - 52.47$$$$\Delta H = -137.15 kJ/mol$$.\)

for more such questions on enthalpy

https://brainly.com/question/826577

#SPJ8

Answer:

0.101 M

0.1 mol/kg

0.644

Explanation:

To calculate the molarity, molality, and mole fraction of Na2SO4 in a solution, you need to know the moles of Na2SO4 in the solution and the volume or mass of the solution.

A) Molarity: Molarity (M) is defined as the number of moles of solute per liter of solution. To calculate molarity, we need to divide the number of moles of Na2SO4 by the volume of the solution in liters.

First, calculate the number of moles of Na2SO4:

mass of Na2SO4 = 755 g

molecular weight of Na2SO4 = 142 g/mol

number of moles = mass/molecular weight = 755 g / 142 g/mol = 5.34 moles

Next, calculate the volume of the solution:

mass of water = 53,100 g

density of water = 1 g/mL

volume of water = mass/density = 53,100 g / 1 g/mL = 53,100 mL = 53.1 L

Finally, calculate the molarity:

molarity = number of moles / volume of solution = 5.34 moles / 53.1 L = 0.101 M

B) Molality: Molality (m) is defined as the number of moles of solute per kilogram of solvent. To calculate molality, we need to divide the number of moles of Na2SO4 by the mass of the solvent in kilograms.

mass of water = 53,100 g

mass of solvent in kilograms = mass in grams / 1000 g/kg = 53,100 g / 1000 g/kg = 53.1 kg

Finally, calculate the molality:

molality = number of moles / mass of solvent = 5.34 moles / 53.1 kg = 0.1 mol/kg

C) Mole fraction: The mole fraction (X) is defined as the ratio of the number of moles of solute to the total number of moles of solute and solvent in a solution. To calculate the mole fraction of Na2SO4, we need to divide the number of moles of Na2SO4 by the total number of moles of Na2SO4 and water.

number of moles of Na2SO4 = 5.34 moles

number of moles of water = 53.1 kg * 1000 g/kg / 18.015 g/mol = 2.96 moles

total number of moles = number of moles of Na2SO4 + number of moles of water = 5.34 moles + 2.96 moles = 8.30 moles

Finally, calculate the mole fraction:

mole fraction of Na2SO4 = number of moles of Na2SO4 / total number of moles = 5.34 moles / 8.30 moles = 0.644

The molarity of Na2SO4 in the solution is 0.101 M, the molality is 0.1 mol/kg, and the mole fraction of Na2SO4 is 0.644.