Answer:
Fluorine
Explanation:
Fluorine has 9 total electrons. The first two are in the 1s level, and the remaining electrons are on the outer level of the atom, with 2 in the s level and 5 in the p level. The electron configuration is 1s2 2s2 2p5.
What is the wavelength of a microwave that has a frequency of 4.2 x 10^8 Hz
Answer:
0.714 m (app.)
Explanation:
use ∧ = c/f
here, ∧ = wavelength
c = velocity of light = 3 × 10^8 m/s
f = frequency = 4.2 × 10^8 Hz
Please I need help thank you
Answer:
its sodium hydroxide
Explanation:
embalming authorization may be given by all of the following except the? Bailee, next of kin, spouse, or decedent
The correct answer is "decendent." Embalming authorization may be given by the bailee, next of kin, or spouse, but not by the decedent.
When is the authorization given?
The term "decedent" refers to the person who has died; they are unable to give consent for embalming or any other post-mortem procedures. According to legal and cultural customs, the choice to embalm is often taken by the designated representative, such as the bailee (person in charge of the body), next of kin, or spouse.
Hence, embalming authorization may be given by the bailee, next of kin, or spouse, but not by the decedent.
Learn more about embalming:https://brainly.com/question/30163437
#SPJ1
Who is the Chief of GTOCP
Answer:
???
Explanation:
A 15.0 mL portion of a 0.400 M solution of acetic acid is to be titrated with a standarized 0.250 M solution of KOH. What is the expected volume of the KOH solution needed to reach the phenolphthalein end point?
b.9.38 ml.The volume of KOH required to neutralize the acetic acid is:9.38ml
The equation for the reaction between acetic acid (CH3COOH) and potassium hydroxide (KOH) is:
CH3COOH + KOH → CH3COO- + K+ + H2O
The titration of acetic acid with potassium hydroxide can be used to determine the concentration of the acetic acid solution. The volume of KOH required to neutralize the acetic acid can be calculated using the equation:
Volume (KOH) =\(\frac{ (Molarity of acetic acid) * (Volume of acetic acid) }{(Molarity of KOH)}\)
In this problem, the volume of KOH required to neutralize the acetic acid is:
Volume (KOH)
\(\frac{(0.400 M) * (15.0 mL) }{ (0.250 M)}\\= 9.38 mL\)
Therefore,It takes 9.38 ml of KOH to neutralise 1 g of acetic acid.
learn more about acetic acid Refer:brainly.com/question/15202177
#SPJ1
Complete question:A 15.0 mL portion of a 0.400 M solution of acetic acid is to be titrated with a standarized 0.250 M solution of KOH. What is the expected volume of the KOH solution needed to reach the phenolphthalein end point?
a.22.50 ml
b.9.38 ml
c.6.00 ml
d.3.75 ml
e.24.00 ml
I figured it out no problem
Answer:
good job ;0
Explanation:
What type of chemical reaction requires oxygen gas as reactant and releases heat?
Answer:
A combustion reaction is a reaction in which a substance reacts with oxygen gas, releasing energy in the form of light and heat.
what is the mole ratio of O2 (g) to CO2 (g)?
Answer:
O2=1
CO2=2
1:2
aah its the answer
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Where do stars form?
Stars form in large, dense regions of gas and dust known as molecular clouds. These clouds are located primarily in the spiral arms of galaxies, where they are exposed to intense radiation from nearby stars. As the gas and dust in these clouds are subjected to this radiation, they begin to collapse under their own gravity. As the collapse continues, the cloud becomes denser and denser, and eventually a protostar forms at its center. Over time, this protostar continues to contract and heat up, eventually reaching the point where nuclear fusion can begin in its core. At this point, the protostar becomes a fully-fledged star, and the process of star formation is complete.
TL;DR: Within the clouds of dust and scattered throughout most galaxies.
Sulfuric acid (see chemical formula below) is a strong acid and is a type of acid rain. What happens to the pH of water when five drops of sulfuric acid are added to a sample of water?
1. Adding sulfuric acid to water will not have any effect on the pH of water.
2. Adding sulfuric acid to water will increase the pH dramatically.
3. Sulfuric acid does not reaction with water.
4. Adding sulfuric acid to water will decrease the pH dramatically.
Adding sulfuric acid to water will decrease the pH dramatically.option 4.
Sulfuric acid is a strong acid and is a type of acid rain. When five drops of sulfuric acid are added to a sample of water, the pH of water will decrease dramatically. This is because sulfuric acid is a strong acid that is capable of dissociating completely in water, producing a high concentration of hydrogen ions (H+) and sulfate ions (SO4²-). This increase in hydrogen ion concentration lowers the pH of water and makes it more acidic.Acid rain is a type of rain that has a pH lower than 5.6, which is the normal pH of rainwater. The acidity of acid rain is caused by the presence of strong acids like sulfuric acid and nitric acid. These acids are produced when sulfur dioxide (SO2) and nitrogen oxides (NOx) are emitted into the atmosphere by human activities like burning fossil fuels and industrial processes.When these gases react with water, they form sulfuric acid and nitric acid, respectively, which then fall to the ground as acid rain.
Acid rain can have harmful effects on the environment, including the acidification of lakes and rivers, the degradation of forests and soils, and the corrosion of buildings and monuments.To conclude, when five drops of sulfuric acid are added to a sample of water, the pH of water will decrease dramatically.option 4.
for such more questions on acid
https://brainly.com/question/27915098
#SPJ8
If in Part II, you mixed (carefully measured) 25.0 mL of 0.81 M NaOH with 65.0 mL of 0.33 M HCl, which of the two reagents is the limiting reagent for heat of reaction
Answer:
NaOH is the limiting reactant.
Explanation:
Hello there!
In this case, according to the given information, it turns out firstly necessary to write out the chemical reaction between NaOH and HCl:
\(NaOH+HCl\rightarrow NaCl+H_2O\)
Thus, since they react in a 1:1 mole ratio; we can now calculate the moles of each substance by using their volumes and molarities:
\(n_{NaOH}=0.0250L*0.81mol/L=0.02025molNaOH\\\\n_{HCl}=0.0650L*0.33mol/L=0.02145molHCl\)
Now, since NaOH is in a fewer proportion, we infer just 0.02025 moles of HCl are consumed so that 0.0012 moles of this acid remain unreacted; in such a way, we infer that the NaOH is the limiting reactant for this reaction.
Regards!
Calculate the heat needed to convert 25.0 grams of solid silver from 950.°C to liquid silver at 972°C. The specific heat of solid silver is 0.235 J/g C, for liquid silver it's 0.278 J/gºC. 3 steps
The heat required is 2347 J
What is the heat required for change of state?The heat required for a change of state depends on the substance, the amount of the substance, and the specific change of state involved.
When a substance undergoes a change of state, such as melting or boiling, heat is added or removed to cause the particles in the substance to gain or lose energy and rearrange themselves into a new physical state. The amount of heat required to effect this change is known as the heat of transformation, or the heat of fusion
We know that;
H1 = 25.0 * 0.235 * (962 - 950)
= 70.5 J
H2 = 25 g * 88 J/g
= 2200 J
H3 = 25 * 0.278 * (972 - 962)
=76. 5 J
Then we have that;
70.5 J + 2200 J + 76. 5 J
=2347 J
Learn more about heat:https://brainly.com/question/1429452
#SPJ1
Write a persuasive essay stating which you believe is the most important Amendment to the U.S. Constitution: Amendment One, Four, or Six. Include three reasons to support your thesis.
Title: The First Amendment: Safeguarding Fundamental Freedoms
While all amendments are crucial, the First Amendment holds unparalleled significance in upholding the principles of liberty, equality, and democracy.
The First Amendment to the U.S. Constitution is undoubtedly the most important amendment as it safeguards fundamental freedoms that form the bedrock of a democratic society.
This amendment, which encompasses the rights of freedom of speech, religion, press, assembly, and petition, plays a vital role in protecting individual liberties and ensuring a just and inclusive society. There are three key reasons why the First Amendment stands out as the cornerstone of our democracy.
Firstly, freedom of speech allows citizens to express their ideas, opinions, and criticisms, fostering a robust marketplace of ideas essential for progress and social change. This right empowers individuals to challenge authority, hold public officials accountable, and engage in meaningful dialogue that drives societal progress.
Secondly, freedom of religion guarantees individuals the right to practice their faith without interference from the state. This principle promotes religious tolerance, diversity, and pluralism, creating a society where individuals can freely worship and live in accordance with their beliefs.
Lastly, freedom of the press ensures an informed citizenry by safeguarding independent journalism. A free press acts as a check on governmental power, exposes corruption, and provides essential information necessary for a functioning democracy.
For ore such questionns on Amendment visit:
https://brainly.com/question/28383565
#SPJ8
How many atoms of oxygen are in 30.5 grams of Fe2O3?
Answer: Atoms of oxygen in 30.5 grams of Fe2O3 = 7.65 x 10^22 atoms
Explanation: To determine the number of atoms of oxygen in 30.5 grams of Fe2O3, we first need to calculate the number of moles of Fe2O3, and then use the mole ratio between Fe2O3 and O atoms to calculate the number of O atoms.
The molecular weight of Fe2O3 can be calculated by adding the atomic weights of two Fe atoms and three O atoms:
Molecular weight of Fe2O3 = (2 x atomic weight of Fe) + (3 x atomic weight of O)
= (2 x 55.85 g/mol) + (3 x 16.00 g/mol)
= 159.69 g/mol
So, 30.5 g of Fe2O3 is equal to:
Number of moles = Mass / Molecular weight
= 30.5 g / 159.69 g/mol
= 0.191 moles
The mole ratio between Fe2O3 and O atoms is 3:2. This means that for every 3 moles of Fe2O3, there are 2 moles of O atoms. Therefore, the number of moles of O atoms in 0.191 moles of Fe2O3 is:
Number of moles of O atoms = 2/3 x 0.191 moles
= 0.127 moles
Finally, we can use Avogadro's number to convert the number of moles of O atoms into the actual number of O atoms:
Number of O atoms = Number of moles x Avogadro's number
= 0.127 moles x 6.022 x 10^23 atoms/mol
= 7.65 x 10^22 atoms
Therefore, there are 7.65 x 10^22 atoms of oxygen in 30.5 grams of Fe2O3.
Write the equilibrium constant expression for this reaction: 2H+(aq)+CO−23(aq) → H2CO3(aq)
Answer:
Equilibrium constant expression for \(\rm 2\; H^{+}\, (aq) + {CO_3}^{2-}\, (aq) \rightleftharpoons H_2CO_3\, (aq)\):
\(\displaystyle K = \frac{\left(a_{\mathrm{H_2CO_3\, (aq)}}\right)}{\left(a_{\mathrm{H^{+}}}\right)^2\, \left(a_{\mathrm{{CO_3}^{2-}\, (aq)}}\right)} \approx \frac{[\mathrm{H_2CO_3}]}{\left[\mathrm{H^{+}\, (aq)}\right]^{2} \, \left[\mathrm{CO_3}^{2-}\right]}\).
Where
\(a_{\mathrm{H_2CO_3}}\), \(a_{\mathrm{H^{+}}}\), and \(a_{\mathrm{CO_3}^{2-}}\) denote the activities of the three species, and \([\mathrm{H_2CO_3}]\), \(\left[\mathrm{H^{+}}\right]\), and \(\left[\mathrm{CO_3}^{2-}\right]\) denote the concentrations of the three species.Explanation:
Equilibrium Constant ExpressionThe equilibrium constant expression of a (reversible) reaction takes the form a fraction.
Multiply the activity of each product of this reaction to get the numerator.\(\rm H_2CO_3\; (aq)\) is the only product of this reaction. Besides, its coefficient in the balanced reaction is one. Therefore, the numerator would simply be \(\left(a_{\mathrm{H_2CO_3\, (aq)}}\right)\).
Similarly, multiply the activity of each reactant of this reaction to obtain the denominator. Note the coefficient "\(2\)" on the product side of this reaction. \(\rm 2\; H^{+}\, (aq) + {CO_3}^{2-}\, (aq)\) is equivalent to \(\rm H^{+}\, (aq) + H^{+}\, (aq) + {CO_3}^{2-}\, (aq)\). The species \(\rm H^{+}\, (aq)\) appeared twice among the reactants. Therefore, its activity should also appear twice in the denominator:
\(\left(a_{\mathrm{H^{+}}}\right)\cdot \left(a_{\mathrm{H^{+}}}\right)\cdot \, \left(a_{\mathrm{{CO_3}^{2-}\, (aq)}})\right = \left(a_{\mathrm{H^{+}}}\right)^2\, \left(a_{\mathrm{{CO_3}^{2-}\, (aq)}})\right\).
That's where the exponent "\(2\)" in this equilibrium constant expression came from.
Combine these two parts to obtain the equilibrium constant expression:
\(\displaystyle K = \frac{\left(a_{\mathrm{H_2CO_3\, (aq)}}\right)}{\left(a_{\mathrm{H^{+}}}\right)^2\, \left(a_{\mathrm{{CO_3}^{2-}\, (aq)}}\right)} \quad\begin{matrix}\leftarrow \text{from products} \\[0.5em] \leftarrow \text{from reactants}\end{matrix}\).
Equilibrium Constant of ConcentrationIn dilute solutions, the equilibrium constant expression can be approximated with the concentrations of the aqueous "\((\rm aq)\)" species. Note that all the three species here are indeed aqueous. Hence, this equilibrium constant expression can be approximated as:
\(\displaystyle K = \frac{\left(a_{\mathrm{H_2CO_3\, (aq)}}\right)}{\left(a_{\mathrm{H^{+}}}\right)^2\, \left(a_{\mathrm{{CO_3}^{2-}\, (aq)}}\right)} \approx \frac{\left[\mathrm{H_2CO_3\, (aq)}\right]}{\left[\mathrm{H^{+}\, (aq)}\right]^2\cdot \left[\mathrm{{CO_3}^{2-}\, (aq)}\right]}\).
A compound with the formula C6H14 was reacted with Cl2/light to give a mixture of 5 different monochlorinated products (not including stereoisomers). What is the name of the initial compound
Answer:
Hexane.
Explanation:
Hello!
In this case, since the general reaction of the compound C4H14 with chlorine is:
\(C_6H_{14}+Cl_2\rightarrow C_6H_{13}Cl+HCl\)
Which stands for a substitution chemical reaction in which one chlorine is able to replace one hydrogen and therefore hydrogen chloride gives off; we infer that the initial compound, C4H14, shows off the \(C_nH_{2n+2}\) formula characteristic of alkanes; in such a way, as it has six carbon atoms, we infer it is hexane.
Best regards!
What element has the noble gas configuration [Ne]3s23p??
Answer:
Sulfur
Explanation:
The first ten electrons of the sodium atom are the inner-shell electrons and the configuration of just those ten electrons is exactly the same as the configuration of the element neon (Z = 10).
...
Noble Gas Configurations.
Element Name Sulfur
Symbol S
Atomic Number 16
Noble Gas Electron Configuration [Ne]3s23p4
what is inside an atom
Why are metals so ductile?
Answer:
throughout the metallic structure allowing the atoms to slide past each other. This sliding is why metals are ductile and malleable. Ionic compound must break bonds to slide past one another, which causes the ionic material to split and crack.
Explanation:
Hope this helps loves mark me brianlest x
What is similar between seeing an object and seeing a shadows
The similarity between seen an object and seeing a shadow is their shape.
The shape of shadow of an object is always similar with object.
If object is in standing position, its image also is in standing position. The size of the shadow sometime greater than the object or less than the object. It never same.
If object is in sitting position, its image also is in sitting position.
If the source of light is on the back side, the shadows formed is in our front side and always act opposite to our activity.
For example, if we raise your left hand, the shadow appear to be raise right hand.
If the source of light is on the front side, the shadows formed is in back side and always act similar like us.
For example: if we raise your left hand, the shadow also appear to be raise left hand.
Everything changes at different position of source of light but shape never changes.
Thus, we concluded that similarity between seen an object and seeing a shadow is their shape.
learn more about images:
https://brainly.com/question/12629638
#SPJ9
How many valance electrons does He need to get to 8
Answer:
Any element in group 18 has eight valence electrons (except for helium, which has a total of just two electrons
if I put elephant toothpaste in a back yard what would happen? I need help on this pls!!! also if you answered this ty!!
Answer:
the elephant toothpaste would go everywhere
A 20.0 L container at 303 K holds a mixture of two gases with a total pressure of 5.00 atm. If there are 2.00 mol of Gas A in the mixture, how many moles of Gas B are present?
Explain why some nuclei cannot experience magnetic resonance and give two examples.
Answer:
Any nucleus that has an overall spin quantum number of zero (I=0) is NMR inactive
Explanation:
A wide range of nuclei are found to be NMR active. NMR is the acronym for nuclear magnetic resonance. It is a powerful spectroscopic tool which uses radio waves. The nuclear spin is described by the nuclear quantum number I and can take on values of; 0,1/2, 1, 3/2,2,5/2 etc.
Any nucleus that has an overall spin quantum number of zero (I=0) is NMR inactive e.g Carbon-12 and Oxygen-16 nuclei.
Commonly, all NMR active nuclei posses I ≥ 1/2, Hydrogen -1 , Carbon-13 and boron-11 are common examples of NMR active nuclei.
2Mg + O2 → 2MgO How many grams of MgO are produced when 40.0 grams of O2 react completely with Mg?
Answer:
101 g
Explanation:
M(O2) = 2g*16.0 = 32.0 g/ mol
M(MgO) = 24.3 + 16.0 = 40.3 g/mol
2 Mg + O2 → 2MgO
from reaction 1 mol 2 mol
from reaction 1 mol*32.0 g/mol 2 mol*40.3 g/mol
given 40 g x g
1 mol*32.0 g/mol --- 2 mol*40.3 g/mol
40 g --- x g
x = (40*2*40.3)/(1*32.0) = 100.75 g ≈ 101 g
- Answer the following about a molecule with the molecular formula: C18H20N1406:
a. What is the molar mass of this compound?
b. What is the empirical formula?
c. What is the percent composition of nitrogen in this molecule?
Which of these pairs would form an ionic bond? K and Br, C and H, H and O, Cu and Cu.
K and Br
Explanation:Ionic bonds form through the transfer of electrons.
Ionic Bonds
Ionic bonds form when 2 atoms or molecules transfer electrons between each other. This transfer of electrons changes the atoms into ions. Ions are charged particles, and where ionic bonds get their name from. In an ionic bond, one atom will lose electrons and become positively charged; this particle is known as a cation. The atom that gains electrons and becomes negatively charged is known as an anion.
Identifying Ionic Bonds
One of the easiest ways to identify an ionic bond is by identifying the types of atoms that are bonding. In most cases, when a metal and nonmetal bond, an ionic bond will form. This is due to the large difference in electronegativity between metals and nonmetals. This leads to the metal being a cation and the nonmetal being an anion. Since K (potassium) is a metal and Br (bromine) is a nonmental, they will form an ionic bond.
To find metals and nonmetals we can look at the periodic table. Metals are on the left side of the table and make up the majority of the elements. Nonmetals are on the right side of the table.
How many electrons are located in the outermost orbit in the Bohr model of a boron atom?
A. 1
B. 2
C. 3
D. 4
According to the electronic configuration of boron, there are three electrons in the Bohr model of a boron atom.
What is electronic configuration?Electronic configuration is defined as the distribution of electrons which are present in an atom or molecule in atomic or molecular orbitals.It describes how each electron moves independently in an orbital.
Knowledge of electronic configuration is necessary for understanding the structure of periodic table.It helps in understanding the chemical properties of elements.
Elements undergo chemical reactions in order to achieve stability. Main group elements obey the octet rule in their electronic configuration while the transition elements follow the 18 electron rule. Noble elements have valence shell complete in ground state and hence are said to be stable.
Learn more about electronic configuration,here:
https://brainly.com/question/13497372
#SPJ2
Which of the following do omnivores eat?
A. only
B. plants and meat
C. meat only
D. they make their own food
Answer:
(B. Plants and meat)
Explanation: