Answer:
1) Ecosystem 1 has more abundant and consistent resources.
2) The rate of decrease in the number of species in ecosystem two reflects a disruption of the food web.
3) Ecosystem one has a broad range of trophic levels providing more stability.
4) Ecosystem two has fewer ecological niches which limits the ability of species to adapt to change.
Explanation:
Answer:
A.Ecosystem 1 has more abundant and consistent resources.
B.The rate of decrease in the number of species in ecosystem two reflects a disruption of the food web.
C.Ecosystem one has a broad range of trophic levels providing more stability.
D.Ecosystem two has fewer ecological niches which limits the ability of species to adapt to change.
Explanation:
Hope This Helps??
Please Mark Me Brainly!!
which of these increases with catabolism?
The reaction that increases with catabolism is A, ΔG known as the free energy change.
What is free energy change?Catabolism is a type of metabolic pathway that breaks down complex molecules into simpler molecules. This process releases energy, which can be used by the cell to perform other functions. The ΔG of a reaction is a measure of the free energy change that occurs during the reaction.
A negative ΔG indicates that the reaction is spontaneous and will occur without any input of energy. A positive ΔG indicates that the reaction is non-spontaneous and will not occur without an input of energy.
Find out more on catabolism here: https://brainly.com/question/24754418
#SPJ1
According to EPA guidelines, solid waste
LEGALLY can be found in all of the
following states of matter EXCEPT
A. gas
B. solid
C. liquid
D. plasma
According to environmental protection agency guidelines, solid waste legally can be found in all of the following states of matter except liquid. Therefore, option C is correct.
What is EPA and its purpose?EPA stands for environmental protection agency. The environmental protection agency aims to inform and educate the public about its policies and initiatives as part of its mission to safeguard human health and the environment.
This involves publishing documents like interpretive memos, policy statements, manuals, bulletins, and advisories that could be broadly regarded as "guidance."
Solid waste legally can not be found in a liquid state of matter, according to the environmental protection agency guidelines. Therefore, option C is correct.
Learn more about EPA, here:
https://brainly.com/question/30735371
#SPJ9
assume that the kinetics of a phosphorylation reaction carried out by a kinase can be appropriately described by the michaelis-menten relationship. competitive inhibition of this kinase by a drug molecule will
Competitive inhibition of a kinase by a drug molecule will increase the Km value and have no effect on the Vmax value, while non-competitive inhibition will decrease the Vmax value and have no effect on the Km value.
Assuming that the kinetics of a phosphorylation reaction carried out by a kinase can be appropriately described by the Michaelis-Menten relationship, competitive inhibition of this kinase by a drug molecule will lead to an increase in the Michaelis-Menten constant (Km) and no change in the maximum reaction rate (Vmax).
Competitive inhibition occurs when a drug molecule binds to the active site of the enzyme, preventing the substrate from binding and therefore inhibiting the reaction. This leads to an increase in the Km value, as more substrate is required to achieve the same reaction rate. However, the Vmax remains unchanged, as the maximum reaction rate can still be achieved if enough substrate is present to outcompete the inhibitor.
In contrast, non-competitive inhibition occurs when a drug molecule binds to a site other than the active site, causing a conformational change in the enzyme and reducing its activity. This leads to a decrease in the Vmax value, as the maximum reaction rate is reduced, but no change in the Km value.
Learn more about phosphorylation : https://brainly.com/question/7465103
#SPJ11
PlsHelp!!!!!!!!!!!!!!!!!!!!!!!!!
Answer:
#male gametes are formed
#generative nucleus divides
#fertilization takes place
#pollen tube grows
# zygote is formed
#embryo is formed
Answer:
1. male gametes are formed
2. generative nucleus divides
3. fertilization takes place
4. pollen tube grows
5. zygote is formed
6. embryo is formed
An amino acid's unique characteristics is defined by the ________.
hypothesis why parts of a plant such as the leaves are green but other parts such as the roots are not
Answer:
Because roots get more water then the stem does, it absorbs at least 60% of the water, and if you use a nail that goes into water, it rusts, so that means that it's darker than others.
Explanation:
If you take a nail and place it under water, that means its getting 100% of the water, so it's the same thing with plants. Another reason that this is happening is that its a sign that a plant is unhealthy. So make sure to give it a lot of water( but not too much or it will drown) so it stays a healthy and happy plant. Hope this helps :3
Which statement best describes how auxin molecules act to cause plant tropisms?
They stop being produced when the stimulus is present.
They congregate on the side away from the stimulus.
They disperse equally through the plant.
They congregate on the side toward the stimulus.
Ionic compounds form because charges attract
The formation of ionic compounds is due to when opposite charges attract and like charges repel, the attraction of opposite charges makes ionic bonds in the compounds.
What are ionic bonds?It is the kind of bonding in which electrostatic attraction happens, through which ionic compounds are formed.
Ionic bonds set the chemical connection in which one atom loses valence electrons and which are gained by another atom, the atoms involved in this connection form the more stable noble gas electrical state.
This bonding is different from covalent bonding, in covalent bonding there is sharing of the pairs of electrons making it more strong than ionic.
Therefore, ionic compounds form because opposite charges attract each other, leading to ionic bonding.
Learn more about ionic, here:
https://brainly.com/question/19633125
#SPJ6
Natural selection does not
a. Produce the mutations
b. Select those mutations that give an organism an advantage
Natural selection does not produce the mutations that are in option A, as natural selection is the process by which certain advantageous traits become more common in a population over time because individuals with those traits are more likely to survive and reproduce.
Natural selection does not produce the mutations themselves. Mutations are random changes that occur in an organism's DNA and can happen for various reasons, such as exposure to radiation or mistakes during DNA replication. Natural selection acts on the variation already present in a population, selecting for traits that confer advantages in a given environment and allowing those traits to become more prevalent over time.
Learn more about mutation and natural selection here.
https://brainly.com/question/31800539
#SPJ1
What performs more functions human cells or bacterial cells and why
Answer:
It is human cells
Explanation:
What is land breeze and sea breeze? If you can please do this in your own words.
Land breeze blows during the night from land to sea and the land becomes cooler faster than the sea. The air above the sea becomes less dense (i.e. warmer) and rises. The cooler air from the land moves in to take its place. Sea breeze: Sea breeze blows during the day and the land heats up faster than the sea
Does the pharynx of human respiratory system have cartilage and epithelium?
Answer:
There is no cartilage but there is epithelium
Explanation:
The pharynx of the human respiratory system does not contain cartilage.
The pharynx, part of the human respiratory system, is a muscular tube that connects the nasal cavity and mouth to the larynx and esophagus. It serves as a passage for air and food. The gorge is made up of several regions, each with its own distinctive features.
The nasopharynx, the top part of the throat, contains no cartilage. Instead, it is lined with pseudostratified ciliated epithelium.This special epithelium helps to trap and transport mucus along with any particles or pathogens in the digestive system for elimination.
These regions also lack cartilage but are lined with stratified squamous epithelium. This type of epithelium provides protection from mechanical stress and potential abrasion caused by the passage of food and other substances down the pharynx.
to learn more about pharynx
https://brainly.com/question/3350759
The goal of a pressure injury risk assessment is:
A. To identify patients who are susceptible to developing a pressure injury
B. To identify the level of risk
C. To identify the type of risk
D. A and B
E. All of the above
A pressure injury risk assessment seeks to identify patients who are at risk for pressure injuries and to estimate the degree of risk.
How can the risk of pressure injury in a patient be assessed?Examine your skin for localised hot spots, oedema, red patches that do not blanch, and wound induration. Since pressure, friction, and shearing forces can more easily inflict pressure injuries on bony prominences, more care should be taken.
Which patient risk factor is most likely to cause a pressure injury to manifest?If you find it challenging to move and can't quickly shift positions while seated or in bed, your chance of developing bedsores is higher. A risk factor is inactivity. Inadequate health, spinal cord damage, and other factors could be to blame for this.
To know more about injury visit:-
https://brainly.com/question/28450125
#SPJ1
Which of the following transport processes do NOT require energy (i.e. are passive transport processes)?
[mark all correct answers]
a. simple diffusion
b. membrane pumps
c. endocytosis
d. phagocytosis
e. osmosis
f. facilitated diffusion
Transport processes that do not require energy include simple diffusion, osmosis, and facilitated diffusion.
Simple diffusion is a type of passive transport that, as the name implies, is simply the movement of a solute when the electrochemical potentials on opposite sides of a permeable barrier differ.Simple diffusion, like all other passive transport mechanisms, involves the movement of molecules along a concentration gradient until the concentration of solute on either side is uniform. Osmosis is the movement of a solvent (such as water) through a semipermeable membrane (such as that of a living cell) into a solution with a higher solute concentration, which tends to equalize the solute concentrations on both sides of the membrane. a process of absorption or diffusion suggestive of the flow of osmotic action (see DIFFUSION sense 3a). Facilitated diffusion is a type of facilitated transport that involves the passive movement of molecules along a concentration gradient that is guided by the presence of another molecule, typically an integral membrane protein that forms a pore or channel.
To learn more about Simple diffusion:
https://brainly.com/question/14852229
#SPJ4
a child recieves an x chromesome from its mother and a y chromosome from its father. what is true about this child?
Answer: The Child Is A Normal child..
Explanation: A chromosome is a Part of DNA So the child will have some DNA from His mother and some from his dad
An animal cell lacking oligosaccharides on the external surface of its plasma membrane would likely be impaired in which function ?
Answer:
This question lacks options, the options are:
A) transporting ions against an electrochemical gradient
B) cell-cell recognition
C) maintaining fluidity of the phospholipid bilayer
D) attaching to the cytoskeleton
E) establishing the diffusion barrier to charged molecules
The answer is B
Explanation:
Generally, oligosaccharides are short chains of polysaccharides/carbohydrates. They make up the structure of membranes including the plasma membrane. Oligosaccharides attached to the protein content of the cell membrane to form a substance called GLYCOPROTEIN. The attached oligosaccharides functions in the ability for a cell to recognize another cell.
According to this question, if an animal whose cell is lacking oligosaccharides on the external surface of its plasma membrane, the most likely impairment would be that of CELL-CELL recognition.
Oligosaccharides are a type of carbohydrates that contain the combination of a few monosaccharides. The are also found as part of the components of the membrane.
If an animal cell lacks this type of carbohydrates (oligosaccharides), the function impaired would be the cell-cell communication function.
Oligosaccharides performs various functions as part of the component of the plasma membrane. It functions in cell to cell recognition and binding and communication. They usually contain 3-10 sugar units (monosaccharides).Learn more: https://brainly.com/question/22301340
What is the term for the remains, imprints, or traces of living things from a previous geological age?(1 point) sedimentary rocks sedimentary rocks strata strata radioactive decay radioactive decay fossils
please help.
Answer:
the answer is fossils
Explanation:
hope this helps
Why do teens tend to make riskier decisions than adults?
A culture of bacteria growing at 37°C was shifted to 25°C. How would you expect this shift to alter the fatty acid composition of the membrane phospholipids? Explain.
The fatty acid composition of the membrane phospholipids is altered due to
Due to the fact that cholesterol is an inflexible plannar molecule which is massive in size. Its presence will additionally make the membrane permeable and fluid.
Fatty acid composition of the membrane phospholipids AlterationWhether the ambient temperature decreases, the permeability and fluidity of plasma membrane additionally decreases. Therefore to repair returned the regular permeability and fluidity level, greater quantity of unsaturated fatty acids are synthesized and integrated into the membrane. This bended look does no longer allowed them to pack tightly with every different and consequently their presence makes the plasma membrane loose. This helps in restoring again the permeability to regular level.
Therefore, Due to the fact that cholesterol is an inflexible plannar molecule which is massive in size. Its presence will additionally make the membrane permeable and fluid.
For more on Chemicals visit
https://brainly.com/question/6876669
Increasing salinity causes the density of water to-
Aincrease
Bdecrease
Cremain the same
Dfirst increase, then drastically decrease
the number of cell layers and the shape of the superficial cells are two criteria used to classify epithelial
the number of cell layers and the shape of the superficial cells are two criteria used to classify epithelial tissue.
Simple epithelial tissue is composed of a single layer of cells, whereas stratified epithelial tissue is made up of many layers of cells. Based on the morphology of the cells present and the quantity of cell layers present, epithelial tissue is categorised. The number of cell layers and the structure of the cells are used to categorise epithelial tissue. Squamous, cuboidal, and columnar cell types Simple (one layer), stratified cell layers (multiple layers). When there are numerous layers, the form classification is determined by the surface cell layer with the thinnest thickness (apical domain). Endocrine Tissue: The three main categories that apply to epithelial cells are as follows.
To know more about epithelial tissue refer :
brainly.com/question/13404204
#SPJ4
I need help with this practice problem solving In your own words answer my pic below all
Answer:
Kudzu was intentionally introduced to North America by the Soil Erosion Service and Civilian Conservation Corps in the 1930s for the purpose of controlling soil erosion in the American Southeast.
Membranes consist of many different types of fatty acids, which confer different properties, including membrane fluidity. Which of the following fatty acids is the LEAST adaptive to maintaining a fluid membrane at cold temperatures?
a)Myristoleic CH3(CH2)3CH=CH(CH2)7COOH
b)Arachidonic CH3(CH2)4CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH2)3COOH
c) Caprylic CH3(CH2)6COOH
d) Linoleic CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH
The correct answer is Myristoleic CH3(CH2)3CH=CH(CH2)7COOH
Factors affecting membrane fluidity are:
The mosaic structure: The essential lipids and proteins are independent but loosely bound molecules that are present in the membrane.The phospholipids: The phospholipid tails' fatty acids are in their saturated form, which is devoid of double bonds between nearby carbon atoms and saturated with attached hydrogen atoms. As a result, the tails are mostly straight. Unsaturated fatty acids, in comparison, do not have the greatest amount of hydrogen atoms, but they do include some double bonds between nearby carbon atoms; a double bond causes the string of carbons to bend by around 30 degrees. Therefore, if straight-tailed saturated fatty acids are squeezed by lowering temperatures, they press in on each other to create a dense and reasonably rigid membrane. When unsaturated fatty acids are squeezed, the "kinks" in their tails push nearby phospholipid molecules apart, preserving some distance between them. At temperatures where membranes containing saturated fatty acid tails in their phospholipids would "freeze" or "solidify," this "elbow room" aids in maintaining fluidity in the membrane.In a chilly climate, the relative fluidity of the membrane is crucial. Membranes made primarily of saturated fatty acids are often compressed in a cold environment, becoming less fluid and more prone to rupturing.Thus, the correct answer is Myristoleic.
Learn more about membrane fluidity here:
brainly.com/question/14317962
#SPJ9
What is binomial nomenclature?
Answer:
a system of naming plants and animals in which each species is given a name consisting of two terms of which the first names the genus and the second the species itself.
Explanation:
hope this helps ^w^
Answer:
In biology, there is a system for naming species called binomial nomenclature. It consists of two Latin names, the first of which designates the genus and the second of which designates the species that belongs to that genus. The first letter of a species name is not capitalised, whereas the first letter of a genus name is always capitalised. Italics are always used to denote the species name.
Explanation:
Carl Linnaeus, a Swedish naturalist, developed the binomial nomenclature, which is still in use today. This methodology offers a consistent method for naming species and enables straightforward communication among scientists as well as across national boundaries and linguistic barriers.
For example, the domestic cat's scientific name is Felis catus. Felis, the first term, refers to the genus, and catus, the second name, to the species found in that genus.
To learn more about binomial nomenclature visit: https://brainly.com/question/11006238
Which was present in the unknown? starch lipids nucleic acids proteins
To test for the presence of starch, you can use iodine solution, which turns blue-black in the presence of starch. Lipids can be identified using a Sudan III or Sudan IV test, where lipids will appear as red or orange-stained spots.
Nucleic acids can be detected through tests like the diphenylamine test or the biuret test.
The diphenylamine test produces a blue color in the presence of DNA, while the biuret test results in a purple color in the presence of RNA.
Proteins can also be identified using the biuret test, as proteins will cause the solution to turn purple.
Learn more about lipids nucleic acids at:
https://brainly.com/question/24407333
#SPJ1
What is created by a large pressure difference in air fronts?
A. Density
B. Dewpoint
C. Wind
D. Isobars
Answer:
A. density.
Explanation:
At a front, the two air masses have different densities,
based on temperature, and do not easily mix. One air mass is lifted above the
other, creating a low pressure zone. If the lifted air is moist, there will be
condensation and precipitation. Winds are common at a front.
what is the typical flow of energy throughout organisms?
starts with sunlight and photosynthesis if you are talking about plants
How are the shapes of red blood cells and the shapes of nerve cells related to their functions? Thank you!
Answer:
How is the shape and size of red blood cells related to their function?
This biconcave shape allows the cells to flow smoothly through the narrowest blood vessels. Gas exchange with tissues occurs in capillaries, tiny blood vessels that are only as wide as one cell. Many RBCs are wider than capillaries, but their shape provides the needed flexibility to squeeze through.
Explanation:
Study the reactions below:
1. PEP + ADP → Pyruvate + ATP ∆G = -14.8 kcal/mol
2. ATP + H2O → ADP + Pi ∆G = -7.3 kcal/mol
3. Glutamic acid + NH3 → Glutamine ∆G = +3.4 kcal/mol
Which reaction is non-spontaneous?
The spontaneity of a reaction is determined by the change in Gibbs free energy (∆G) of the reaction. If ∆G is negative, the reaction is spontaneous (i.e., it can occur without an external input of energy), whereas if ∆G is positive, the reaction is non-spontaneous (i.e., it requires an external input of energy to occur).
From the given reactions:
PEP + ADP → Pyruvate + ATP ∆G = -14.8 kcal/mol (Negative ∆G)ATP + H2O → ADP + Pi ∆G = -7.3 kcal/mol (Negative ∆G)Glutamic acid + NH3 → Glutamine ∆G = +3.4 kcal/mol (Positive ∆G)We see that reactions 1 and 2 both have negative ∆G values, indicating that they are spontaneous reactions. However, reaction 3 has a positive ∆G value, indicating that it is a non-spontaneous reaction.
Therefore, reaction 3 (Glutamic acid + NH3 → Glutamine) is the non-spontaneous reaction among the given reactions.
Learn more about Gibbs free energy (∆G):
https://brainly.com/question/13765848
#SPJ11
Which is not a characteristic of plants, autotroph, unicelluar, eukaryotic, cell walls
Answer:
Unicellular
Explanation:
All plants are multicellular, unicellular plants do not exist.
Hope this helps dude