If you are not sure about what to do during a lab activity, what should you do?
Ask someone else at your table.
Use your best judgement.
Watch to see what everyone else isdoing.
Ask the teacher.

Answers

Answer 1

Answer:

ask a teacher is the correct answer.

Explanation:

You must ALWAYS ask a teacher if you are not sure about what to do during a lab activity.

Answer 2

Answer:

It's important to ask the teacher, lab safety policies all state that if you're confused about instructions it's always good to ask the teacher to clarify them.


Related Questions

What would make oppositely charged objects attract each other more?increasing the positive charge of the positively charged object and increasing the negative charge of the negatively charged objectdecreasing the positive charge of the positively charged object and decreasing the negative charge of the negatively charged objectincreasing the distance between the positively charged object and the negatively charged objectmaintaining the distance between the positively charged object and the negatively charged object

Answers

Answer:

increasing the positive charge of the positively charged object and increasing the negative charge of the negatively charged object would make the oppositely charged objects attract each other more.

A crystal of table salt (NaCl) is dissolved in water. Which of the following statements explains why the dissolved salt does not recrystallize as long as the temperature and the amount of water stay constant?

Answers

A crystal of table salt (NaCl) is dissolved in water. Which of the following statements explains why the dissolved salt does not recrystallize as long as the temperature and the amount of water stay constant?

Na+ and Cl- ions lose their charges in the water.

Water molecules surround the Na+ and Cl- ions.

Na+ and Cl- ions leave the water through vaporization.

Water molecules chemically react with the Na+ and Cl- ions.

Your answer: -

Answer: B - Water molecules surround the Na+ and Cl- ions.

How many atoms are in 12 g of Carbon-12 (12C)?

Answers

There are approximately 6.022 × 10^23 atoms in 12 grams of Carbon-12 (12C).

The number of atoms in a given amount of a substance can be calculated using Avogadro's number, which represents the number of atoms or molecules in one mole of a substance. Avogadro's number is approximately 6.022 × 10^23.

Carbon-12 is a specific isotope of carbon, with an atomic mass of 12 atomic mass units (amu). One mole of Carbon-12 has a mass of 12 grams. Since one mole of any substance contains Avogadro's number of particles, in the case of Carbon-12, it contains 6.022 × 10^23 atoms.

Therefore, if we have 12 grams of Carbon-12, which is equal to one mole, we can conclude that there are approximately 6.022 × 10^23 atoms in this amount of Carbon-12.

In summary, 12 grams of Carbon-12 contains approximately 6.022 × 10^23 atoms. Avogadro's number allows us to relate the mass of a substance to the number of atoms or molecules it contains, providing a fundamental concept in chemistry and enabling us to quantify and understand the microscopic world of atoms and molecules.

for such more questions on atoms

https://brainly.com/question/6258301

#SPJ8

PLZ HELP THIS IS DUE TODAY!!!!!!

Which statement BEST describes the motion of the molecules of a solid object

A They vibrate in place within a fixed volume.
B They move around freely within a fixed volume.
C They vibrate in place and take the shape of a container.
D They move around freely and take the shape of a container.

Answers

It would be letter C, because the molecules of solids can have a little vibration in their places.
The first one is for gas, so it's wrong. The second one is for liquids. And finally, the third one is right.

Calculate the maximum amount of product that can be formed and the amount of unreacted excess reagent when 3.1 mol of SO2 reacts with 2.7 mol of O2 according to the equation: 2SO2(g) + O2(g)->2SO3(g)

I found out that the maximum amount of product that can be produced is 248 g SO3, how can I find the mass of the excess reagent?

Answers

the maximum amount of product that can be formed is 124.39 g SO₃, and there will be 36.8 g of excess O₂ left over.

To find the amount of excess reagent, you need to first determine which reactant is limiting and which is in excess.

Determine the limiting reagent:

Use stoichiometry to determine how much product can be formed from each reactant:

mol SO2:

2 SO₂ + O₂ -> 2 SO₃

2 mol SO₃/2 mol SO₂ = 1 mol SO₃/mol SO₂

1 mol SO₃ = 80.06 g SO₍₃₎

From 2.7 mol O₂

2 SO₂ + O₂ -> 2 SO₃

1 mol SO₃/1 mol O₂ = 1 mol SO₃/mol O₂

1 mol SO₃ = 80.06 g SO₃

2.7 mol O₂ x (1 mol SO₂/1 mol O₂) x (80.06 g SO₂/mol SO₂) = 216.45 g SO₂

Since the amount of SO₂ produced from 3.1 mol of SO₂ is less than the amount produced from 2.7 mol of O₂, SO₂ is the limiting reagent.

Calculate the amount of excess reagent:

To find the amount of excess O₂, use the balanced equation to determine how much O₂ is required to react with all of the SO₂:

2 SO₂ + O₂ -> 2 SO

3.1 mol SO2 x (1 mol O₂/2 mol SO2) = 1.55 mol O₂

Subtract the amount of O₂ used from the initial amount of O₂:

2.7 mol O₂ - 1.55 mol O2 = 1.15 mol O₂

Finally, convert the excess O₂ to mass:

1.15 mol O₂ x 32.00 g/mol = 36.8 g O₂

Learn more about stoichiometry here:

https://brainly.com/question/30215297

#SPJ1

Complete each nuclear fission reaction.

Answers

Nuclear fission is a process where a heavy atomic nucleus is split into two or more lighter nuclei, releasing a large amount of energy.

1.Uranium-235 fissioned by neutron:

U-235 + neutron → Kr-92 + Ba-141 + 3 neutrons + energy

2.Plutonium-239 fissioned by neutron:

Pu-239 + neutron → Sr-95 + Zr-139 + 2 neutrons + energy

3.Californium-252 fissioned by neutron:

Cf-252 + neutron → 2 Sm-126 + 3 neutrons + energy.

Nuclear fission is a process in which a heavy atomic nucleus (such as uranium-235, plutonium-239, or californium-252) is split into two or more lighter nuclei (such as krypton-92 and barium-141), along with the release of a large amount of energy in the form of radiation and kinetic energy of the resulting particles. This process is typically initiated by the absorption of a neutron by the heavy nucleus, which causes it to become unstable and split apart.

In the fission reaction, the mass of the products is slightly less than the mass of the reactant nucleus, due to the conversion of some mass into energy according to Einstein's famous equation E=mc2, where E is the energy released, m is the mass lost, and c is the speed of light.

The energy released in nuclear fission reactions is much greater than that released in chemical reactions, making nuclear fission an attractive source of energy for power generation. However, fission reactions can also be dangerous if not properly controlled, as the released energy can cause explosions or release dangerous radiation.

Learn more about Nuclear fission here:

https://brainly.com/question/913303

#SPJ1

Milk of magnesia, which is an aqueous suspension of magnesium hydroxide, is used as an antacid in the reaction below. How many molecules of HCl would have to be present to form 34.52 g of MgCl₂?
Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)

Answers

Approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.

To determine the number of molecules of HCl required to form 34.52 g of MgCl₂, we need to use the molar mass and stoichiometry of the balanced equation:

Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)

The molar mass of MgCl₂ is 95.21 g/mol.

First, we need to calculate the number of moles of MgCl₂ formed:

Moles of MgCl₂ = mass of MgCl₂ / molar mass of MgCl₂

Moles of MgCl₂ = 34.52 g / 95.21 g/mol

Moles of MgCl₂ = 0.363 mol

According to the balanced equation, the stoichiometric ratio between HCl and MgCl₂ is 2:1. Therefore, the moles of HCl required can be calculated as follows:

Moles of HCl = 2 * Moles of MgCl₂

Moles of HCl = 2 * 0.363 mol

Moles of HCl = 0.726 mol

To calculate the number of molecules, we need to use Avogadro's number, which is approximately 6.022 x 10^23 molecules/mol.

Number of molecules of HCl = Moles of HCl * Avogadro's number

Number of molecules of HCl = 0.726 mol * 6.022 x 10^23 molecules/mol

Number of molecules of HCl = 4.37 x 10^23 molecules

Therefore, approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.

For more such questions on molecules

https://brainly.com/question/1351818

#SPJ8

1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5​

Answers

1. The IUPAC name of N is nitrogen.

2. Nitrogen dioxide

3.The IUPAC name of O is oxygen

4.The IUPAC name of OH is hydroxyl.

The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.

IUPAC names for the given compounds are:1.1. N: Nitrogen

The IUPAC name of N is nitrogen.

It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide

Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.

The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen

Explanation: The IUPAC name of O is oxygen.

It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.

X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.

Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.

It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.

for more question on electronic configuration

https://brainly.com/question/26084288

#SPJ8

Note: The complete question is given below

Provide the IUPAC names for the following compounds:

CH3CH2CH(CH3)CH2CH2CH2CH3

C6H5CH(CH3)2

H2NCH2CH2CH2CH2CH2NH2

CH3CH2CH2CH2CH2OH

CH3CH2CH2CHOHCH3

6) The density of ammonia gas (NHs) in a 6.0 L container at a pressure of 820 mm Hg and a g/L.

Answers

The density of ammonia gas in the 6.0 L container at a pressure of 820 mm Hg is approximately 0.805 g/L.

To determine the density of ammonia gas (NH3) in a 6.0 L container at a pressure of 820 mm Hg, we need to use the ideal gas law equation, which relates pressure, volume, number of moles, and temperature for a given gas.

The ideal gas law equation is:

PV = nRT

Where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature in Kelvin.

Since we are given the pressure (820 mm Hg), volume (6.0 L), and assuming standard temperature and pressure (STP), we can use the values for R (0.0821 L·atm/(mol·K)) and convert the pressure to atm by dividing by 760 (1 atm = 760 mm Hg).

820 mm Hg / 760 mm Hg/atm = 1.08 atm

Now we can rearrange the ideal gas law equation to solve for density (d):

d = (P * M) / (RT)

Where M is the molar mass of ammonia (NH3), which is approximately 17.03 g/mol.

Substituting the values, we have:

d = (1.08 atm * 17.03 g/mol) / (0.0821 L·atm/(mol·K) * 298 K)

Simplifying the equation, we find:

d ≈ 0.805 g/L

Therefore, the density of ammonia gas in the 6.0 L container at a pressure of 820 mm Hg is approximately 0.805 g/L.

For more question on density

https://brainly.com/question/26364788

#SPJ8

In a given type of chemical substance, the elements never combine in
the same proportions by mass.
TRUE
FALSE

Answers

Answer:

I think its true

hope it helps

Define matrer?

a)Electrical conductivity
b)Anything that takes Iness and space
c) Something that doesn't take up space.​

Answers

Answer:

if you are asking matter then

Explanation:

Matter is defined as anything that has mass and takes up space (it has volume).

what is the PH scale of 0.02m of hydrochloric acid​

Answers

Answer:

Explanation:

The pH of 0.02 M hydrochloric acid is approximately 1.7.

THANKS

IF THE ANSWER IS CORRECT , THEN MARK ME AS BRAINLIST

The pH scale is a measure of the acidity or alkalinity of a solution. It ranges from 0 to 14, where pH 7 is considered neutral, values below 7 are acidic, and values above 7 are alkaline or basic.

To determine the pH of a hydrochloric acid solution, we need to know its concentration. You mentioned a concentration of 0.02 M (molar), which refers to 0.02 moles of hydrochloric acid dissolved in 1 liter of solution.

Hydrochloric acid (HCl) is a strong acid that dissociates completely in water, meaning all HCl molecules release their hydrogen ions (H+) into the solution. Since the concentration is given as 0.02 M, it means there are 0.02 moles of H+ ions in 1 liter of the solution.

To calculate the pH, we can use the formula:

pH = -log[H+]

In this case, [H+] represents the concentration of hydrogen ions in moles per liter. Since hydrochloric acid is a strong acid and it dissociates completely, the concentration of hydrogen ions is equal to the concentration of HCl, which is 0.02 M.

pH = -log(0.02) ≈ 1.70

Therefore, a hydrochloric acid solution with a concentration of 0.02 M would have a pH of approximately 1.70, indicating it is strongly acidic.

two uses of sodium carbonate ​

Answers

Sodium carbonate, also known as washing soda or soda ash, has a wide range of applications. Sodium carbonate can be naturally occurring or synthetically produced through various methods, including the Solvay process, which is the most common method of industrial production.

Sodium carbonate, also known as washing soda or soda ash, has many uses, including:

1) Cleaning agent: Sodium carbonate is an effective cleaning agent due to its alkaline nature. It is used in laundry detergents and household cleaners to remove stains and grease from clothes and surfaces.

2) Industrial applications: Sodium carbonate is used in a variety of industrial applications. It is used in the production of glass, pulp and paper, and soaps and detergents. It is also used as a water softener and pH regulator in chemical processes.

Learn more about Sodium Carbonate at

brainly.com/question/31344166

#SPJ1

The stage in which the hair begins to destroy itself as it disconnects from the
papilla is called?

Answers

A food worker has an earache he is scheduled to work.

UESTION 14nsider the compound XF. Which of the following is true about the compound?A. If XF is covalent, X could be a metal.B. If XF is ionic, X could be a nonmetal.C. If XF is covalent, the name uses prefixes.D. If XF is covalent, X has a charge of +1.QUESTION 15What are the values of x and y in the compound Agx(CO3)y?O AX= 1, y = 2B. x = 3, y = 1OC. x = 3, y = 2O D.X = 2, y = 1

UESTION 14nsider the compound XF. Which of the following is true about the compound?A. If XF is covalent,

Answers

a. If XF is covalent, X couldn't be a metal. Because covalent bonding occurs between nonmetals. So this alternative is False.

b. If XF is ionic, X could be a nonmetal. Also False. Ionic bonding occurs between a metal and a nonmetal. In this case, we already have a nonmetal, which is F.

c. If XF is covalent, the name uses prefixes. True. When we have a covalent compound, the name of the nonmetal on the left has a prefix indicating the number of atoms of it.

d. If XF is covalent, X has a charge of +1. False. This would happen if it was ionic.

Answer: Alternative "C"

When completing an electron configuration, which of the following rules/principals show that you cannot label two electrons as having the same quantum numbers?

a
Law of Configuration
b
Aufbau Principle
c
Pauli Exclusion Principle
d
Hund's Rule

Answers

Answer:

C. Pauli Exclusion Principle

Explanation:

Pauli's exclusion basically suggests that you cannot label two electrons as having the same quantum numbers.

The principle is stated as "no two electrons in an atom can have the same set of four quantum numbers".

It indicates that no two electrons can spin in the same way. This limits the number of electrons that can reside in an orbital to two and with opposite spin.

What mass of Ca(OH), is present in a sample if it is titrated to its equivalence point with 44.02 mL of 0.0885 M HNO3? The balanced chemical equation is as follows:

2HNO3+Ca(OH)2 ➠Ca(NO3)2+2H20​

Answers

A mass of 0.141 g Ca(OH) is present in a sample if it is  titrated to its equivalence point with 44.02 mL of HNO3.

What is titration and how the mass comes out to be 0.141 g?Given 44.02 mL of 0.0885 M HNO3 , when divided by 1000 will be equal to 0.0038 moles.Two moles required to neutralize one mole of calcium hydroxide.Dividing 0.0038 by 2 , since they are followed by two mole we get 0.0019. Finally when we come to calculate the hydroxide.Its mass equals 0.141g. Now titration is a familiar word we have read in the practicals of chemistry.Titration actually is a phenomena to figure out the amount of substance present in a liquid by figuring out the further amount of it needed for the reaction.

To know more about titration visit:

https://brainly.com/question/2728613

#SPJ9

If a chemical reaction produces product at a steady rate of 5.2 x 1022 molecules per second, how
long will it take for the reaction to produce 6.0 x 1023 molecules of product? Express your
answer in seconds using the correct number of significant figures. Do not enter your answer
using scientific notation.

Answers

The time taken for the reaction to produce 6.0 x 10²³ molecules is determined as 11.54 seconds.

What is chemical reaction rate?

The rate of a chemical reaction is the change in concentration over the change in time. It can also be said as, the rate at which molecules are produced.

Time taken for the reaction to produce 6.0 x 10²³ molecules

time = number of molecules / rate of reaction

time = (6 x 10²³) / (5.2 x 10²²)

time = 11.54 seconds

Thus, the time taken for the reaction to produce 6.0 x 10²³ molecules is determined as 11.54 seconds.

Learn more about rate of chemical reaction here: https://brainly.com/question/24795637

#SPJ1

Given a volume of 47.8 mL of gas at STP, _______________ moles of O2 exist

Answers

At STP, a mole of any gas occupies 22.4 L. So given 48.7 mL—or 0.0487 L—of O2 gas at STP, the number of moles of O2 that exist is 0.00217 moles.

The combustion of octane, C8H18, proceeds according to the reaction shown.

2C8H18(l)+25O2(g)⟶16CO2(g)+18H2O(l)

If 354 mol of octane combusts, what volume of carbon dioxide is produced at 15.0 ∘C
and 0.995 atm?

Answers

The concept ideal gas equation is used here to determine the volume of the carbondioxide. Combustion reactions are generally highly exothermic reactions. The volume of CO₂ is

A combustion is a chemical reaction in which a fuel undergoes oxidation as a result of the reaction with an oxidizing agent which causes the release of energy in the form of heat.

15.0 °C = 288 K

The ideal gas equation is:

PV = nRT

V = nRT / P

V = 354 × 0.0821 × 288 / 0.995 = 8412.3 L

To know more about combustion, visit;

https://brainly.com/question/14335621

#SPJ1

which of the following compounds are arrhenius bases? multiple select question. hno3 nabr ca(oh)2 koh ch3cooh

Answers

The common examples of Arrhenius base include NaOH (sodium hydroxide), KOH (potassium hydroxide), Ca (OH)2 (calcium hydroxide), Mg (OH)2 (magnesium hydroxide), NH4OH (ammonium hydroxide), etc.

Svante Arrhenius, a Swedish scientist, developed the Arrhenius acid-base theory. It represented the concept of acid and base in a modern context. This theory is straightforward and helpful. The chemical that raises the concentration of H+ or proton in aqueous solution, according to Arrhenius theory, is an acid. The proton or H+ ion that is released coexists with the water molecule to produce the hydronium ion (H3O+), which is not a free-floating proton. Hydrochloric acid, sulfuric acid, nitric acid, and other acids are typical examples of Arrhenius acids. According to Arrhenius, bases are hydroxide compounds that give OH ions upon dissociation in water, whereas acids are hydrogen-containing compounds that give H+ ions or protons upon dissociation in water.

To learn more about Arrhenius visit here;

https://brainly.com/question/9936252

#SPJ4

How is heat transferred from one object to another? A. Heat moves from warmer objects to cooler objects. B. Heat moves from cooler objects to warmer objects. c. Heat moves between objects of the same temperature. D. Heat moves back and forth between two objects.​

Answers

Answer: I believe the answer is A, heat moves from warmer objects to cooler objects. I know for sure it isn’t C or D though so A

The heat is transferred from one object to another as heat moves from warmer objects to cooler objects. The correct option is A.

What is the transfer of heat?

There are three ways to transfer heat. They are conduction, convection, and radiation. Heat travels from one body to another body. If the temperature of two objects is different, then the heat travels from higher temperature to lower temperature.

Conduction is the transfer of energy when two objects ate in contact with each other. Convection is a transfer between object and environment. Radiation is when transferred by emission of electromagnetic radiation.

Thus, the correct option is A. Heat moves from warmer objects to cooler objects.

Learn more about the transfer of heat, here:

https://brainly.com/question/13433948

#SPJ5

Use the theoretical yield you calculated in the question above.
You collect 8.0 L of ammonia(NH3) in actual yield in excess hydrogen.
What is the percent yield of the reaction?
Percent Yield actual yield/theoretical yield x 100%
10%
8%
20%
80%

Answers

Based on the actual yield and the theoretical yield, the percent yield of the reaction is 80%.

What is the percent yield of the reaction?

The percent yield of a reaction is the ratio of the actual yield of a reaction and the theoretical yield of a reaction expressed as a percentage.

Percent yield = actual yield/ theoretical yield * 100%

The theoretical yield of the ammonia is obtained from the equation of the reaction:

N₂ + 3 H₂ ----> 2 NH₃

The theoretical yield of the ammonia is 10.0 L

The actual yield = 8.0 L

Percent yield = 8.0 / 10.0 * 100%

Percent yield = 80%

Learn more about percent yield at: https://brainly.com/question/2451706

#SPJ1

Saccharin (C7H5NO3S) is sometimes dispensed in tablet form. Ten tablets with total mass of 0.5795 g were dissolved in water. They were oxidized to convert all the sulfur to sulfate ion, which was precipitated by adding an excess of barium chloride solution. The mass of BaSO4 obtained was 0.5240 g. What is the average mass of saccharin per tablet

Answers

The dissolution of a substance in another is a kind of chemical reaction.0.4575 g of saccharine is present in the ten tablets of saccharine dissolved in water.

From the information in the question, the sulfur in saccharin (C7H5NO3S) was completely converted to sulfate ion (SO4^2-). This ion was now reacted with excess  barium chloride to form barium sulfate BaSO4. This later reaction occurs as follows;

SO4^2-(aq) + Ba^2+(aq) --------> BaSO4(s)

Number of moles of BaSO4 obtained = 0.5240 g/233 g/mol

= 0.0025 moles

Since the reaction is 1:1, 0.0025 moles of sulfate ions from saccharine reacted.

Molar mass of saccharine = 7(12) + 5(1) + 14 + 3(16) + 32

= 84 + 5 + 14 + 48 + 32 = 183 g/mol

Mass of saccharine in the tablet = 0.0025 moles × 183 g/mol

= 0.4575 g

Learn more: https://brainly.com/question/1527403

Plz help ASAP
Plz and ty

Plz help ASAP Plz and ty

Answers

Answer:

It's circulatory system

Hope it's help ^_^

Answer: circilutory

Explanation:

Density of gold is 19.3g/cm^3 what is the density in lbs/in^3 units

Answers

The density in lbs/in³ units : 0.697

Further explanation

Given

Density of gold is 19.3 g/cm³

Required

Conversion to  lbs/in³

Solution

Density is a quantity derived from the mass and volume  

Density is the ratio of mass per unit volume  

Density formula:  

\boldρ = mV

Conversion factor

1 g =  0,00220462 lbs

1 cm³ = 0,0610237 in³

So the density :

19.3 g1 cm3×cm30.0610237 in3×0.00220462 lbs1 g=0.697 lbs/in3

PLZ HELP ASAP WILL GIVE BRAINLIST

2AlCl3 + 2Al + 3Cl2
If 20.0 g of aluminum chloride are decomposed, how many molecules of chlorine gas are produced?
A )6.63 x 1022 molecules CI
B )2.70 x 1023 molecules Cl2
C )1.35 x 1023 molecules Cl2
D )9.42 x 1023 molecules Cl2

Answers

Explanation:

Molar mass of AlCl3 = 133.34g/mol

Moles of AlCl3 used

= 20.0g / (133.34g/mol) = 0.150mol

Mole Ratio of AlCl3 to Cl2 = 2 : 3,

Moles of Cl2 produced

= 0.150mol * (3/2) = 0.225mol

We know that 1 mole of any gas has

6.023 * 10²³ molecules.

Hence, number of molecules in Cl2

= 0.225mol * (6.023 * 10²³/mol)

= 1.35 * 10²³ molecules. (C)

Why would Magnesium Phosphate (Mg3(PO4)2) not make an aqueous solution?

Please help!

Answers

Answer:

Almost all phosphates are insoluble

Explanation:

For magnesium phosphate to make an aqueous solution, it must be soluble in water.

Let's check the solubility rules. There are many different lists and versions, but it should mention a rule about phosphates.

All phosphates are insoluble except Na₃PO4 (sodium phosphate), K₃PO4 (potassium phosphate), and H₁₂N₃PO₄ (ammonium phosphate).

Magnesium phosphate is included in "all phosphates" so it is insoluble and can't become an aqueous solution.

Magnesium Phosphate (Mg₃(PO₄)₂) would not make an aqueous solution because it is insoluble in water.

A solution is a homogeneous mixture of one or more solutes dissolved in a solvent.

solvent: the substance in which a solute dissolves to produce a homogeneous mixture.solute: the substance that dissolves in a solvent to produce a homogeneous mixture.

According to the solubility rule, all phosphates are insoluble in water except sodium and potassium phosphates and thus magnesium phosphate does not form an aqueous.

Learn more about Solutions, here:

https://brainly.com/question/30665317

#SPJ6

Consider the precipitation reaction: BaCl 2 + 2 AgNO 3 → 2 AgCl + Ba(NO 3) 2. How many grams of AgCl are generated when 85 g of BaCl 2 reacts?

Answers

The grams of AgCl are generated when 85 g of BaCl₂ reacts is 10.86 g.

The balanced equation is given as :

BaCl₂    +    2AgNO₃   ----->   2AgCl   +   Ba(NO₃)₂

the mass of the BaCl₂ = 85 g

molar mass of BaCl₂  = 208.23 g/mol

moles of BaCl₂  = mass / molar mass

                          = 85 / 208.23

                          = 0.408 mol

1 mole of BaCl₂  produce 2 moles of AgCl

0.408 moles of BaCl₂  = 2 × 0.408

                                      = 0.816 mol of AgCl

moles of AgCl = 0.816 mol

mass of AgCl = moles × molar mass

                      = 0.816 g × 143.32 g/mol

                      = 10.86 g

Thus,  The grams of AgCl are generated when 85 g of BaCl₂ reacts is 10.86 g.

To learn more about moles here

https://brainly.com/question/26416088

#SPJ9

Nitrogen-13 has a half-life of 20 minutes. how much of a 100 mg sample would remain after 60 minutes?

Answers

The amount of nitrogen-13 sample that remained after 60 minutes has been 25mg.

Half-life can be described as the time required by the substance to reduce half of its initial concentration.

The half-life of Nitrogen-13 has been 20 minutes. In 20 minutes, the sample will be reduced to half of its concentration,

The total time has been 60 minutes.

The number of half-life experienced by the sample has:

Number of half life= Total time/half life

Number of half life cycles= 60/20=3

The number of half-life cycles = 3

The sample has been reduced to 50% in the first half-life cycle and reduced to 25% by the end of 2nd half-life cycle.

The sample remained = 25% of the initial concentration.

The sample remained =  25/100.100 mg

The sample remained = 25 mg

Therefore, the amount of nitrogen-13 sample that remained after 60 minutes has been 25mg.

To learn more about half-life from the given link.

https://brainly.com/question/1160651

#SPJ1

Other Questions
munication2 2.2.4 Quiz: Give an Informal TalkQuestion 3 of 10Justin is giving an informal talk on one of his favorite topics: trading cards.He has already grabbed his audience's attention, so he moves on to the nextpart of the talk, describing the people and companies that invented tradingcards and how the cards got more popular over time. What part of hisinformal talk is this?A. BodyB. ConclusionOC. ArgumentD. Introduction What is the difference between the biological meaning of adaptation and the common meaning. Three times a number decreased by 9 Read the excerpt from "The Most Dangerous Game, by Richard Connell.The dining room to which Ivan conducted him was in many ways remarkable. There was a medieval magnificence about it; it suggested a baronial hall of feudal times with its oaken panels, its high ceiling, its vast refectory table where twoscore men could sit down to eat. About the hall were mounted heads of many animalslions, tigers, elephants, moose, bears; larger or more perfect specimens Rainsford had never seen. At the great table the general was sitting, alone.The descriptive language presents a visual image of a room that is . What inductance must be put in series with a 100-kiloohm resistor at 1.0-MHz for a total impedanceof 150 kiloohm HELPPPPP MEEEEE PLZZZZZZZ!!!!!!! for 20 points :(( I need more help! ASAP pleaseWhich specialized structure do nocturnal primates use to see better at night?a tapetum luciduma grooming clawa fused jawa tooth comb You went to dinner at Applebees and your bill was 12.95 you want to leave your waitress and 18% tip when you combine your bill for your food with your tip what was the total amount of money you spent on dinner round your answer to the nearest penny a company acquires equipment by signing a note payable. if the note does not bear interest, the company should record the equipment a Write a java code to print Multiplication Table Till 20HINTS:public static void main(String[ ] args) {int multiplicationTable[ ][ ]=new int [21][11]; the best way for America to address racism? Frank borrowed $25,000 for a period of 4 years. His interest rate is 3%. How much interest will Frank pay in all? The sum of current and long-term assets reported on the balance sheet is referred to as? A snowboarder is sliding back and forth on a half pipe at one point she leaves the top of the half pipe and slides to the other side choose when kinetic energy increases during the snowboarders ride I'm desperate for help. Please help A liquid has mass of 10 kh and a density of 1.18g/cm. Calculate the volume of the liquid. Include suitable units perimeters and areas What is an example of a TV show that you watch today that is about the American Family? How have today's TV showsabout the "American Family changed and are much different in family structure compared to the list from above? Pleaserespond with at least 3-4 sentences. If the total revenue function for a blender is R(x) = 56x 0.01x2 where x is the number of units sold, what is the average rate of change in revenue R(x) as x increases from 11 to 22 units? $ per unit g convert 2x-y=-7 into slop-intercept form