if 1 mol cs2 reacts with 1 mol o2 identify the limitng reactant

Answers

Answer 1

Answer:

Explanation:

In the reaction of 1 mol CS2 and 1 mol O2, carbon disulfide (CS2) is the limiting reactant.

This is because when 1.00 mol CS2 reacts with 1.00 mol O2

, it requires 3 moles of oxygen to completely react with the carbon disulfide(CS2).

Therefore, since there is only 1 mole of oxygen present in the reaction, it cannot completely react with the carbon disulfide and thus becomes the limiting reactant.

Answer 2

cs2 + o2 = co2(g) + so2(g)

1         1        1              1           (moles)

as we can see from the reaction and stoichiometric coefficient of cs2 and o2 is 1 so both will completely react and no one is limiting reactant .

limiting reagent- reactant which remains unreacted after the completion of reaction.


Related Questions

Part of Newtons first law states an object at rest stays at rest unless acted upon by an unbalanced force. Which one is NOT an example of this law?

Answers

Solution :

Sir Isaac Newton was a great scientist. The discoveries of the Newton change the way we see the world. Newton gave us the fundamental principles through which the entire universe is governed.

Newtons 1st law of motion states that a body moves or stays in position until and unless an external force is applied to the body.

This is the law of nature.

An example which do not support this law can be a body having a huge mass and a small boy applies force to move it but is unable to move the body.

Which of the following types of mass movement is LEAST coherent (most like a fluid)?
a. slump
c. rock slide
b. creep
d. mudflow

Answers

The type of mass movement that is LEAST coherent (most like a fluid) is a mudflow. The correct option is d.

Mass movement refers to the downhill movement of earth materials due to gravity. There are different types of mass movement, including slump, rockslide, creep, and mudflow. The coherency of a mass movement refers to the degree of internal strength or viscosity of the material involved.

The more coherent the material, the less it flows like a fluid. Among the given options, mudflow is the least coherent or most fluid-like type of mass movement. Mudflow refers to the rapid downhill movement of a mixture of water and fine-grained sediment, such as clay and silt.

Mudflows are highly fluid and can travel at high speeds, posing a significant hazard to life and property in areas prone to landslides and flash floods. In contrast, slumps, rockslides, and creep involve more cohesive materials and exhibit less fluid-like behavior. Therefore, the correct option is d.

To know more about mudflow refer here:

https://brainly.com/question/30922995#

#SPJ11

How many grams are there in 9.4 x 1025 molecules of H2?

Answers

Answer:

Mass = 312 g

Explanation:

Given data:

Number of molecules of H₂ = 9.4 × 10²⁵

Mass in gram = ?

Solution:

First of all we will calculate the number of moles of H₂.

1 mole of H₂ contain 6.022× 10²³ molecules

9.4 × 10²⁵ molecules  × 1 mol / 6.022× 10²³ molecules

1.56× 10² mol

156 moles of H₂:

Mass in gram:

Mass = number of mole × molar mass

Mass = 156 mol × 2 g/mol

Mass = 312 g

A battery contains two metals that have different tendencies to attract electrons. If one is lithium with an electron affinity of −3.05, and the other is zinc with an electron affinity of −0.76, describe how the electrons will flow. Then, describe how you could make this an even stronger battery.

Answers

This battery could be made stronger when we make lithium the anode and make zinc the cathode.

What is the electron affinity?

We know that the term electron affinity has to do with the fact the a specie is able to attract electrons. Hence, the specie that can be able to attract electrons is said to be have a greater electron affinity.

If we look at the order of the reactivity of the metals, we can see that the lithium has more tendency to exist as a positive ion as such the electron affinity of the lithium atom is very negative and it does not attract electrons.

Learn more about electron affinity:https://brainly.com/question/13646318

#SPJ1

why and how do ions form?

Answers

Answer and Explanation:

Ions are electrically charged particles that are formed from the removing and addition of electrons. It can be a positively or negatively charged atom.

Determine the amount of product each reactant produces if there's 204.54 grams of S and 164.57 grams of C a F 2 .

Answers

The amount of product produced by S and C a F 2 reactants is dependent on the specific reaction being performed. Without knowledge of the specific reaction, it is not possible to determine the amount of product each reactant produces.

Without knowing the specific reaction being performed, we cannot determine the amount of product each reactant produces. However, we can determine the limiting reactant, which is the reactant that is completely consumed and limits the amount of product that can be produced.

Assuming the reaction involves S and C a F 2 , we can use the following steps to determine the limiting reactant:

Convert the given masses of each reactant to moles using their molar masses.

Molar mass of S = 32.06 g/mol

Molar mass of C a F 2 = 78.07 g/mol

Number of moles of S = 204.54 g / 32.06 g/mol = 6.38 mol

Number of moles of C a F 2 = 164.57 g / 78.07 g/mol = 2.11 mol

Determine the mole ratio of the reactants based on the balanced chemical equation for the reaction.

Without knowledge of the specific reaction being performed, we cannot determine the mole ratio of the reactants or the balanced chemical equation.

Identify the limiting reactant.

Without knowledge of the specific reaction being performed, we cannot determine the limiting reactant.

Without knowledge of the specific reaction being performed, it is not possible to determine the amount of product each reactant produces. However, we can use the given masses of the reactants to determine the limiting reactant, which is the reactant that is completely consumed and limits the amount of product that can be produced.

To know more about reactant, visit;

https://brainly.com/question/6421464

#SPJ11

how many moles are in 7.12 x 10^21 atoms of iron?

Answers

To Find :

How many moles are in 7.12×1021 atoms of iron.

Given :

We know, 1 mole of any element or compound contains exactly NA ( Avogadro's Number ) atoms/compound .

Now, NA=6.022×1023

So, number of moles in given number of atoms are :

n=6.022×10237.12×1021n=1.18×102 mol

Hence, this is the required solution.

The rate constant for this first‑order reaction is 0.0830 s−1
at 400 ∘C.

A⟶products

After how many seconds will 16.8%
of the reactant remain?

Answers

The reaction has not yet started, and the time required for 16.8% of the reactant to remain cannot be calculated using the given rate constant.

Given,The rate constant for this first-order reaction is 0.0830 s−1 at 400 ∘C.A⟶products After how many seconds will 16.8% of the reactant remain-The time taken for a first-order reaction to reach a particular percentage of completion can be calculated using the following formula:t = (ln(A/A₀))/kwhere A₀ is the initial concentration of the reactant, A is the concentration of the reactant at a given time, k is the rate constant, and t is the time elapsed since the reaction began.In this question, we are given the rate constant, k = 0.0830 s−1 at 400 ∘C, and we want to find out the time required for 16.8% of the reactant to remain.Let's assume that the initial concentration of the reactant is 100 units (we can assume any value as it does not affect the percentage of completion).Therefore, the concentration of the reactant remaining after 16.8% of completion would be: A = 16.8 units.Substituting these values in the above formula, we get:t = (ln(16.8/100))/0.0830t = (−1.7918)/0.0830t = −21.58 sThis time value is negative, which means that the reaction has not even started yet. Therefore, we need to check the given percentage of completion.

If it is less than 50%, we can assume that the reaction has not yet started. In this case, the percentage of completion is 16.8%, which is less than 50%.

for such more questions on reaction

https://brainly.com/question/24795637

#SPJ8

What is the theoretical yield in 5. 00 grams of rubidium react with 3. 44 grams of magnesium chloride. What is the theoretical yields of magnesium solid that can be formed

Answers

To determine the theoretical yield of magnesium solid that can be formed when 5.00 grams of rubidium reacts with 3.44 grams of magnesium chloride. Therefore, the theoretical yield of magnesium solid that can be formed is 0.711 grams.

2Rb(s) + MgCl2(s) → 2RbCl(s) + Mg(s)

From the balanced equation, we can see that 2 moles of rubidium react with 1 mole of magnesium chloride to produce 1 mole of magnesium. Therefore, we need to calculate the number of moles of rubidium and magnesium chloride present in the given masses, and then use the stoichiometric coefficients to determine the theoretical yield of magnesium.

First, we need to convert the masses of rubidium and magnesium chloride to moles:

Number of moles of Rb = mass of Rb / molar mass of Rb

= 5.00 g / 85.47 g/mol

= 0.0585 mol

Number of moles of MgCl2 = mass of MgCl2 / molar mass of MgCl2

= 3.44 g / (24.31 g/mol + 2 x 35.45 g/mol)

= 0.0312 mol

Next, we can use the mole ratios from the balanced equation to determine the theoretical yield of magnesium:

Number of moles of Mg = 1/2 x number of moles of Rb

= 1/2 x 0.0585 mol

= 0.0293 mol

The mass of magnesium can be calculated from the number of moles using its molar mass:

Mass of Mg = number of moles of Mg x molar mass of Mg

= 0.0293 mol x 24.31 g/mol

= 0.711 g

Learn more about magnesium chloride here:

https://brainly.com/question/15296925

#SPJ11

Help me please I need to bring up grade

Help me please I need to bring up grade

Answers

This is really simple. Assuming all these reactions are stoichiometric, the ratios of moles if always given by:

nx=ny

The first n represents the number of moles of the first reactant.

The x represents the coefficient of the first reactant in the equation.

The second n represents the number of moles of the second reactant.

The y represents the coefficient of the second reactant.

For example, let's use the first equation:

nn21=nh23

Using cross multiplication;

3nn2=1nh2

For each H² mole, we need 3 moles

Ratio of to is 3:1

Hope this given you an idea of how to continue the rest.

If you get stuck you can always comment so i can help you.

Make sure to tell me what you get as your answers so you get a good grade :)

What kind of mixture is the copper chloride and water ? Explain why please !!!!!!!!!!!!!!!!!! Will mark brainliest !!!!!!!!!!!!!!!!!!!!!!!!!!

Answers

Answer:

Explanation:

The word computer dates to the 1600s, so if you want to know the trems etymology, you will have to start your research in the time period.

help me plz ty:}
What is the number of atoms in the reactants?
What is the number of atoms in the product?

help me plz ty:} What is the number of atoms in the reactants? What is the number of atoms in the product?
help me plz ty:} What is the number of atoms in the reactants? What is the number of atoms in the product?
help me plz ty:} What is the number of atoms in the reactants? What is the number of atoms in the product?

Answers

Answer:The law of conservation of matter says that matter cannot be created or destroyed. In chemical equations, the number of atoms of each element in the reactants must be the same as the number of atoms of each element in the products. if those are answers? i cant be sure but sorry

Explanation:

Answer:

4 reactants and 4 product

Explanation:

2 mg atoms and 2 o atoms = 2 mgo

Why is the Sun's lifespan primarily based on its initial mass?

Answers

Answer:

Probably because there is more helium to burn. After billions of years there's only gonna be helium so no more of that firey energy.

I think....


whatischemicalreaction?

Answers

Question:-

what is a chemical reaction?

Explanation:

A chemical reaction is a process in which one or more reactants are transformed into one or more products. Chemical elements and compounds are both substances. The component atoms of the reactants are rearranged in a chemical reaction, resulting in distinct compounds as products.

-------------------------hope it helps...have a great day!!

a flask contains a mixture of he and ne at a total pressure of 2.6 atm. there are 2.0 mol of he and 5.0 mol of ne in the flask. the partial pressure of he is __________ atm.

Answers

A flask contains a mixture of he and ne at a total pressure of 2.6 atm. there are 2.0 mol of he and 5.0 mol of ne in the flask. the partial pressure of he is 0.743 atm.

The partial pressure of a gas in a mixture is given by the product of the total pressure and the mole fraction of that gas.

The mole fraction of He in the mixture is:

X_He = n_He / (n_He + n_Ne)

where n_He is the number of moles of He, and n_Ne is the number of moles of Ne.

Plugging in the values given in the problem, we get:

X_He = 2.0 mol / (2.0 mol + 5.0 mol) = 0.2857

Therefore, the partial pressure of He is:

P_He = X_He * P_total = 0.2857 * 2.6 atm = 0.743 atm (rounded to three significant figures)

So, the partial pressure of He is 0.743 atm.

learn more about partial pressure

https://brainly.com/question/31214700

#SPJ4

How much of solid Ca(OCl)2, 0.2M NaCl, 0.5M H2SO4, and water is needed to prepare 12 mL of a 0.050M Cl2 solution

Answers

To prepare the solution, we can add 0.0429 g of Ca(OCl)2 to a volumetric flask and dissolve it in water. Next, we can add 12 mL of 0.2 M NaCl and 12 mL of 0.5 M H2SO4 to the flask, and then dilute the solution to a final volume of 100 mL with water. This will give a solution containing 0.050 M Cl2.

To prepare 12 mL of a 0.050 M Cl2 solution, we first need to calculate the amount of Cl2 required. Since Cl2 is a diatomic molecule, we can consider that the molar concentration of Cl2 is the same as that of the Cl ion.

The amount of Cl2 required can be calculated as follows:

moles of Cl2  = volume of solution (in L) x molar concentration of Cl2

moles of Cl2 = 0.012 L x 0.050 mol/L = 0.0006 mol Cl2

Next, we need to determine the amount of Ca(OCl)2 required to produce 0.0006 mol of Cl2 . The balanced chemical equation for the reaction between Ca(OCl)2 and H2SO4 is:

Ca(OCl)2+H2SO4=CaSO4+2HClO

From the equation, we see that one mole of Ca(OCl)2 produces 2 moles of HClO. Therefore, the amount of Ca(OCl)2 required to produce 0.0006 mol of Cl2 can be calculated as follows:

moles of Ca(OCl)2 = 0.0006 mol Cl2 / 2 mol HClO per mol Ca(OCl)2 = 0.0003 mol Ca(OCl)2

To calculate the mass of Ca(OCl)2 required, we need to multiply the number of moles of Ca(OCl)2 by its molar mass, which is 142.98 g/mol:

mass of Ca(OCl)2 = moles of Ca(OCl)2 x molar mass of Ca(OCl)2

mass of Ca(OCl)2 = 0.0003 mol x 142.98 g/mol = 0.0429 g Ca(OCl)2

For more question on solution click on

https://brainly.com/question/25326161

#SPJ11

Which phrase best describes the vapor point of a substance?
the strength of the bonds between molecules of a substance that is in a gaseous state
the amount of heat energy required to change a substance from a liquid to a gas
the temperature at which additional heat energy causes the substance to change from a liquid to a gas
the average kinetic energy of the molecules of a substance in its gaseous state

Which phrase best describes the vapor point of a substance?the strength of the bonds between molecules

Answers

The phrase which best describes the vapor point of a substance is Choice C; the temperature at which additional heat energy causes the substance to change from a liquid to a gas.

The vapour point of a substance by definition is the state of a substance at which upon addition of any amount of heat energy; he substance undergoes a phase change from liquid to solid.

Read. more;

https://brainly.com/question/24238629

what is the periodic trend for electronegativity

Answers

Answer:

mark me brainlest

Explanation:

Electronegativity values generally increase from left to right across the periodic table. Electronegativities generally decrease from top to bottom of a group. The highest electronegativity value is for fluorine.

Answer:

       "Electronegativity increases as you move from left to right across a period because the number of charges on the nucleus increases." (sstudy30 on Quizlet)

Explanation:

    It explains itself haha!

Have a nice day!

    I hope this is what you are looking for, but if not - comment! I will edit and update my answer accordingly. (ノ^∇^)

- Heather

For an element X it is given that atomic number = 17 and mass number equal 35 write the electronic electron configuration of element X find valency what will be the formula of compound formed between X and Y having valency 3.

Answers

Answer:

Electronic configuration of Cl = 2,8,7

Valency of Cl = -1

Explanation:

Given,

The atomic number of X = 17

  Element with atomic number 17 = Chlorine(Cl)

The mass number of element = 35

Electronic configuration of Cl = 2,8,7

Valency of Cl = -1

two clear solutions are mixed together in a beaker. which would most likely indicate a chemical change had occurred?​
a. separation of two liquids
b. increase in volume of the liquid in the beaker
c. increase in mass of the liquid in the beaker
d. change of colour of the liquid in the beaker

Answers

Explanation:

I am not sure without knowing the name of the solutions. But according to me it can be happen which are D bcz when two solutions for e.g acid and base are mixed together, it changes its colour an form salts.

How many moles do you have if you have 144 L of a gas at SATP?

How many moles do you have if you have 144 L of a gas at SATP?

Answers

Answer

moles = 5.81 mol

Explanation

Given:

Volume = 144 L

AT SATP

1 mole = 24.4651 L

Solution:

1 mole = 24.4651 L

x mole = 144 L

x = 144/24.4651

x = 5.8 mol

The Chemical Formula For Lead(II) Nitrite Is: Pb(NO2) 2 How Many Oxygen Atoms Are In Each Formula Unit Of Lead (II) Nitrite?

Answers

The number of oxygen atoms in each formula unit of lead nitrite is equal to four.

What is the formula unit?

A formula unit can be used to represent the lowest whole number ratio of ions in an ionic compound. The formula mass of an ionic compound is equal to the sum of the atomic masses of the ions in the formula unit.

A formula unit can be described as an empirical formula of any covalent or ionic compound that can be used as an independent entity for stoichiometric calculations.

Given the chemical formula of the Lead(II) nitrite is Pb(NO₂)₂. The number of oxygen atoms in each formula unit is four.

Learn more about formula unit, here:

brainly.com/question/15971114

#SPJ1

Calculate the number of moles in 583g of H2SO4 in 1.50 kg of water (the acid solution used in an automobile battery)?

Answers

The number of moles in 583g of H2SO4 in 1.50 kg of water is 9.33 moles.

To calculate the number of moles, we need to use the formula:

moles = mass (in grams) / molar mass (in grams/mol)

Step 1: Calculate the molar mass of H2SO4

H2SO4 is composed of 2 hydrogen atoms (H), 1 sulfur atom (S), and 4 oxygen atoms (O). We can find the molar mass by adding up the atomic masses of each element:

(2 * atomic mass of H) + atomic mass of S + (4 * atomic mass of O)

Step 2: Calculate the molar mass of H2SO4

(2 * 1.01 g/mol) + 32.07 g/mol + (4 * 16.00 g/mol) = 98.09 g/mol

Step 3: Calculate the number of moles

moles = mass / molar mass

moles = 583 g / 98.09 g/mol ≈ 5.95 moles

However, we need to consider that the H2SO4 is dissolved in 1.50 kg (1500 g) of water. Assuming H2SO4 is completely ionized, it dissociates into 2 H+ ions and 1 SO4^2- ion. Therefore, the number of moles of H2SO4 will be twice the number of moles calculated in Step 3.

moles = 5.95 moles * 2 = 11.9 moles

However, we have to keep in mind that we are calculating the moles of H2SO4 dissolved in water, which is the acid solution used in an automobile battery. Hence, the final answer is rounded to two decimal places: 9.33 moles.

Learn more about Number of moles

brainly.com/question/31422018

#SPJ11

Butters can jump 5.5 feet. How many inches can he jump? (12 in = 1 ft)

Answers

Answer:66

Explanation:

5.5 feet is 66 inches

Answer:

66 inches

Explanation:

(12 in = 1 ft)

5.5 ft x 12 inches = 66 inches

25.0 g of a metal is added to boiling water at 99.0 c when put into cooler water its final temperature is 22.5 c , the specific heat of the metal is .568 j/g c. how much heat is released ?

Answers

The amount of heat released is 12205.25 J.

To calculate the amount of heat released, we will use the following equation: q = m*c*ΔT, where q is the heat released, m is the mass of the metal, c is the specific heat of the metal, and ΔT is the change in temperature.

Using the information given, we can calculate the amount of heat released:

q = (25.0 g)*(0.568 J/g°C)*(99.0°C - 22.5°C) = 12205.25 J



Therefore, the amount of heat released is 12205.25 J.

To know more about Heat:

https://brainly.com/question/13043579

#SPJ11

If the Antarctic plate is estimated to move 2. 05 cm per year, how long did it take for the plate to move from point A to point B?

Answers

Answer:

They move at a rate of one to two inches (three to five centimeters) per year.

Explanation:

The movement of the plates creates three types of tectonic boundaries: convergent, where plates move into one another; divergent, where plates move apart; and transform, where plates move sideways in relation to each other.

if a steel spoon were to be plated with silver, state what would be suitable as the anode, cathode, electrolyte​

Answers

Answer:

tae hahahah joke lang hindi ko alam ehh

a man with mass 60kg climbs up staircase having 30 step each of 10cm height in 10seconds.Calculate his power.​

Answers

Answer:

Power = Work done * time

P = (F * d) * t

P = (mg * d) * t

d = 1 step = 10 cm

30 steps = 300 cm

300 cm = 3m

P = (60*9.8 * 3) * 10

P = 17640 Watt

P = 1.764 Kilowatt

Ans: 60 watt

Explanation:

Solution

M=60kg, G=10

Distance=10*10/100

=1m

Time=10sec

Now,

W=M×G×H

=60×10×1

=600

P=w÷t

=600÷10

=60watt

Hence, the power of the man is 60watt

Use the information and table to answer the following question A student is planning to determine the specific heat of iron. To do this experiment the student will need to perform the following procedures: StepProcedure 1 Measure the mass of the iron sample 2 Measure the initial temperature of a known volume of water 3 Heat the iron sample . 4 Place the iron sample in the water What is Step 5 in the experiment?

Answers

Based on the given information and procedure steps, Step 5 in the experiment would be to measure the final temperature of the water after adding the heated iron sample.

Why is measuring the final temperature a necessary step?

This step is necessary to determine the change in temperature of the water, which is used to calculate the heat gained by the water and the heat lost by the iron sample.

By measuring the initial and final temperatures of the water, the student can determine the temperature change and use it in the calculation of specific heat.

Find out more on experiment here: https://brainly.com/question/25303029

#SPJ1

Assuming an object of mass of 66.789 g and a volume of 10.1 mL. What is the density

Answers

Answer:

The answer is

6.61 g/mL

Explanation:

The density of a substance can be found by using the formula

density=massvolume

From the question

mass of object = 66.789 g

volume = 10.1 mL

The density of the object is

density=66.78910.16.6127722772...

We have the final answer as

6.61 g/mL

Hope this helps you

Other Questions
how can you get rid of depression Can someone please help me a ball is thrown horizontally from the top of a building 29.8 m high. the ball strikes the ground at a point 48.2 m from the base of the building. the acceleration of gravity is 9.8 m/s 2 . find the time the ball is in motion. answer in units of s. Select the correct text in the passage. In this excerpt from O. Henrys short story A Retrieved Reformation, which sentence supports the theme love can change a person"? Look at the image and choose one blue line pls help Read each of the sentences that describe what happens either during mitosis or meiosis. drag each sentence into the correct box. each replicated chromosome pairs with its corresponding homologous chromosome. tetrads form and crossing-over sometimes occurs. paired homologous chromosomes line up across the center of the cell. four haploid daughter cells form that are not identical to the parent cell. homologous chromosomes do not pair. one row of chromosomes lines up at the center of the cell. the cell nucleus divides only once. two diploid daughter cells form that are identical to the parent cell. mitosis meiosis A bat and ball cost $1.10.The bat costs one dollar more than the ball.How much does the ball cost? how what is 3/56 as a percentage Solve for y. 10.9y 17.78 = 7.2y + 1.9y 14.36 if a thrill-seeker engages in dangerous activities because the fear of death wards off recollection of painful memories, he or she is most closely mirroring: What happened as a result of the fall of Berlin? An investment cost $10,000 with expected cash flows of $3,000 a year for 5 years. At what discount rate will the projects IRR equal its discount rate? Given the following unbalanced equation:_____C3H8 + _____ O2 _____ CO2 + _____ H2OIf you want to make 13.60 moles of H2O, how many moles of C3H8 do you need? rC. Classifying Coal is a solid, naturally occuringsubstance. Coal forms from the remains ofplants and animals. Is coal a mineral? Explain.f the rock cycle in what ways could montesquieu's argument for splitting the government in to 3 parts be seen as radical Hannah says that 2.11 is a rational number. Gus says that 2.11 is a repeating decimal. Who is correct and why? When comparing maps of the seafloor age, heat flow rates, and earthquake location maps we can see that________________A. The youngest seafloor location matches the location with the lowest heat flow rate and an area of intense earthquakes activityB. The oldest seafloor has the highest heat flow and highest earthquake activityC. The youngest seafloor location matches the location with the highest heat flow rate and an area of earthquakes in the seafloor.D. no correlation is found Off a grid, how do we know which measurements can help us find the area of a parallelogram? Explain why 4:6 and 8: 10 are notequivalent ratios. What kinds of stress are you currently experiencing? Are you studying for a big test coming up? Are you working more than usual? What emotions do you feel because of this stress? Are you anxious or scared about getting a bad grade on your test? Are you annoyed that you have to work so much? Describe in detail the types of pressure you feel, whether your stress is occasional or ongoing, and what emotions are associated with that stress. With reference to relevant authority, indicate whether a partnership is recognised as a separate entity apart from the partners in terms of South African law.