The only chiral center in the molecule is carbon 4 because is attached to four different atoms or groups.
What is a chiral center?The term chiral center refers to a carbon atom that is attached to four different atoms or groups. This kind of carbon atom is able to rotate the direction of plane polarized light.
We can see from the structure of the molecule that the only chiral center in the molecule is carbon 4 because is attached to four different atoms or groups.
Learn more about chiral center:https://brainly.com/question/13667509
#SPJ1
Rate 2021 so far
1/5
2/5
3/5
4/5
5/5
Answer:
Is this an actual question that you had for school?
Explanation:
Answer:
3/5. Its still really stressful but at least it's better than 2020.
15POINTS I NEED HELP WITH THIS QUESTION PLEASE!
Answer:
12.76 g
Explanation:
Step 1: Write the balanced equation
4 Fes + 7 O₂ ⇒ 2 Fe₂O₃ + 4 SO₂
Step 2: Calculate the moles corresponding to 11.15 g of O₂
The molar mass of O₂ is 32.00 g/mol.
11.15 g × 1 mol/32.00 g = 0.3484 mol
Step 3: Calculate the moles of SO₂ produced from 0.3484 moles of O₂
The molar ratio of O₂ to SO₂ is 7:4.
0.3484 mol O₂ × 4 mol SO₂/7 mol O₂ = 0.1991 mol SO₂
Step 4: Calculate the mass corresponding to 0.1991 moles of SO₂
The molar mass of SO₂ is 64.07 g/mol.
0.1991 mol × 64.07 g/mol = 12.76 g
How many moles of carbon atoms do you have if you have 48.4 g of carbon?
Answer:
4.03 moles
Explanation:
We know that the molar mass of Carbon is 12.011, thus we can solve for moles by dividing the grams given by the molar mass.
48.4 g / 12.011 g = 4.03 moles
exactly 149.6J will raise the temperature of 10.0g of a metal from 25.0C. what is the specific heat capacity of the metal
Exactly 149.6J will raise the temperature of 10.0g of a metal from 25.0C. The specific heat capacity of the metal is 5.984 J/g°C.
What is specific heat capacity?The heat capacity of a sample of a substance divided by the mass of the sample yields the specific heat capacity (symbol c), also known as massic heat capacity. Informally, it is the quantity of heat that must be added to one unit of a substance's mass in order to raise its temperature by one unit. The specific heat capacity unit in the SI is the joule per kelvin per kilogram, or Jkg⁻¹K⁻¹. For instance, the specific heat capacity of water is 4184 J kg⁻¹K⁻¹, or the amount of energy needed to raise 1 kilogram of water by 1 K.
The specific heat capacity of the metal can be calculated using the equation Q = m × c ×ΔT.
Q = 149.6J
m = 10.0g
ΔT = (final Temperature - initial Temperature) = (25°C - 0°C) = 25°C
Plugging these values into the equation, we get:
149.6J = 10.0g × c ×25°C
Solving for c, we get:
c = \(\frac{149.6J}{(10.0g *25C)}\)
c = 5.984 J/g°C
Therefore, the specific heat capacity of the metal is 5.984 J/g°C.
To know more about specific heat capacity, visit:
https://brainly.com/question/29766819
#SPJ1
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Select the correct answer. What type of relationship exists between the length of a wire and the resistance, if all other factors remain the same? A. Resistance is directly related to length. B. Resistance is directly related to the square of the length. C. Resistance is inversely related to the length. D. Resistance is inversely related to the square of the length.
Answer:
A
Explanation:
how many formula units of na2so4 are present in a 450 gram sample
Na₂SO₄ contains 1.90834 X 10²⁴ molecules or formula units in a 450 gram sample.
Formula unit- The chemical formula of an ionic compound that lists the ions in the smallest ratio that corresponds to a neutral electrical charge is known as a formula unit. Chemical formulae are used to describe the constituent parts of a compound in chemistry.
Na₂SO₄ molecular mass is 23x2+ 32+ 16X4.
= 142g/mol
Na₂SO₄ mass = 450g
Na₂SO₄ moles are equal to mass/molar mass.
450g/142g/mol = 3.170 mol.
6.02 X 10²³ mol is the Avogadro's number.
formula unit= moles * Avogadro's number
⇒3.17 X 6.02 X 10²³ molecules= 1.90834 X 10²⁴
Na₂SO₄ therefore contains 1.90834 X 10²⁴ molecules or formula units..
To learn more about formula unit refer- https://brainly.com/question/24529075
#SPJ4
which probing question lies within the scope of physics?
Physics is a vast field that addresses a wide range of questions about the nature of the physical world. Probing questions can help to explore this field and encourage critical thinking and deep exploration of its topics.
Probing questions are open-ended questions asked to gather information, encourage critical thinking and deep exploration of a particular topic. Physics is a natural science that studies matter and its motion through space-time. It is a branch of science that deals with the fundamental nature of the universe and seeks to explain how and why objects behave as they do in the physical world.The following are some examples of probing questions within the scope of physics:What is the nature of light-The nature of light is an important topic within the scope of physics. It refers to the dual nature of light, as both a wave and a particle. Light behaves as a wave when it is traveling through space and as a particle when it is interacting with matter.How do magnets work-Magnets are a common object in the world around us, and they have a broad range of applications. They work by producing a magnetic field, which can attract or repel other magnetic objects. This topic lies within the scope of physics.What is the relationship between energy and matter-Energy and matter are two fundamental concepts in physics. The relationship between them is described by Einstein's famous equation E=mc2, which states that matter and energy are two forms of the same thing and are interchangeable. The study of the relationship between energy and matter lies within the scope of physics.What is the nature of the universe?The study of the universe's nature is one of the most significant topics within the scope of physics. This question addresses the origins and properties of the universe, its components, and the laws that govern its behavior.
for such more questions on physical
https://brainly.com/question/1079154
#SPJ8
if two substance are at the same temperature, their enthalpy
Answer:
cannot be measure
Hope this helps :) !!!
What types of intermolecular bonds would you expect with each of the following? Which has a higher boiling point? Which has a higher vapor pressure? Why?
CH4 NH3
The types of intermolecular bonds in the given compounds are:
CH₄ - London dispersion forces (LDF), dipole- dipole interactionsNH₃ - London dispersion forces (LDF), dipole- dipole interactions, hydrogen bondsNH₃ has a higher vapor pressure because of the extra hydrogen bonding present.
What are intermolecular bonds?Intermolecular bonds are bonds that exist between the molecules of a substance.
The types of intermolecular bonds that exist between molecules of covalent compounds include:
London dispersion forcesdipole-dipole interactions, andhydrogen bonding.The higher the number of intermolecular bonds, the higher will be the vapor pressure of a compound.
Learn more about intermolecular bonds at: https://brainly.com/question/2193457
#SPJ1
What mass (grams) of antimony(III) chloride would be produced by reacting with 112 liters of chlorine measured at STP?
Answer:
radius = 16 in ; height = 27 in
Answer and I’ll give you brainliest!
What type of reaction is this *
N2 + H2 → NH3
O synthesis
O combustion
O decomp
O single
O double
We know that water is purified before it is supplied to our houses. Then why do we have filters installed in our houses? What do they serve?
Answer:
Water filters remove elements that cause drinking water to have an unpleasant taste and smell, such as lead, chlorine and bacteria. Home water filtration system will improve the overall purity, taste and smell of your drinking water. It also lowers the pH level of the water that you drink.
What percent of the compound is made of Silver? *
Silver Nitrate, AgNO3?
Approximately 63.5% of the compound AgNO3 is made of silver.
The atomic mass of silver (Ag) is 107.87 g/mol, and the atomic mass of nitrogen (N) is 14.01 g/mol, and the atomic mass of oxygen (O) is 16.00 g/mol.
The molecular weight of AgNO3 is:
AgNO3 = (Ag atomic mass) + (N atomic mass) + (3 x O atomic mass)
AgNO3 = (107.87 g/mol) + (14.01 g/mol) + (3 x 16.00 g/mol)
AgNO3 = 169.87 g/mol
The percent by mass of silver in AgNO3 can be calculated as:
Percent by mass of silver = (Mass of silver / Total mass of AgNO3) x 100
Since there is only one silver atom in one AgNO3 molecule, the mass of silver in one mole of AgNO3 is equal to the atomic mass of silver, which is 107.87 g/mol.
Therefore, the percent by mass of silver in AgNO3 is:
Percent by mass of silver = (107.87 g/mol / 169.87 g/mol) x 100
Percent by mass of silver = 63.5%
For more question on compound click on
https://brainly.com/question/26388921
#SPJ11
What is the definition of specific heat?
A. The heat needed to raise the temperature of 1 g of a substance
1°C
B. The total amount of energy contained within 1 mole of a
substance
C. The heat required to break the molecular bonds within a
substance
D. The temperature change between the melting and boiling points of
a substance
Answer:
A. The heat needed to raise the temperature of 1 g of a substance 1°C.
Explanation:
how this has helped you
Your little sister asks you a scientific question: "Does chocolate milk come from brown cows?" In order to answer the question, you decide to form a hypothesis.
Explain whether or not the following statements are effective hypotheses.
i. Brown cows produce chocolate milk.
ii. Brown cows never produce chocolate milk.
iii. Brown cows produce white milk.
A hypothesis is a proposed explanation or prediction based on limited evidence or observations, which can be tested through further investigation or experimentation. It should be specific, testable, and based on existing knowledge.
Now, let's evaluate each statement as a hypothesis:Brown cows produce chocolate milk.This statement can be considered an effective hypothesis as it proposes a relationship between the color of cows and the color of milk they produce. It is specific and testable, as one could observe and analyze the milk produced by brown cows to see if it is indeed chocolate milk. However, based on existing knowledge, we can confidently say that this hypothesis is not accurate, as the color of a cow does not determine the color of the milk it produces.Brown cows never produce chocolate milk.This statement can also be considered an effective hypothesis because it makes a specific claim that can be tested. However, based on existing knowledge, we can say that this hypothesis is not accurate. While the color of a cow does not determine the color of the milk, it is possible for chocolate milk to be produced by adding chocolate syrup or cocoa powder to regular white milk.Brown cows produce white milk.This statement is not an effective hypothesis as it is a general statement that aligns with existing knowledge. It does not propose any specific relationship or prediction to be tested. In the context of this question, the statement is not accurate as milk produced by cows is typically white, regardless of their coat color.For such more question on hypothesis
https://brainly.com/question/606806
#SPJ8
How many moles of MgS are in 1.00g MgS?
Answer:
24.31 g/mol.
Explanation:
moles =mass/molar mass
n=w/m
When a small piece of copper metal is added to a silver nitrate solution, the following reaction occurs:
2Ag+NO3+Cu → Cu (NO3)2+2Ag
This equation both represents both a single replacement reaction AND a(n) _______ reaction.
A. combustion
B. decomposing
C. neutralization
D. oxidation-reduction
Explanation:
Copper is more reactive than silver.
When copper reacts with AgNO3, Cu displaces Ag from AgNO3, forming Cu(NO3)2.
Chemical reaction -
\(Cu + 2AgNO_3 = 2Ag + Cu(NO3)_2\)
It's a displacement reaction as well as redox reaction.
Reasons are :
The Oxidation number of Cu changes from 0 to 2 so it's oxidized.
Oxidation number of Ag changes from 1 to 0 so it's reduced.
So, it's also a redox reaction.
The given chemical equation represents both single replacement as well as oxidation-reduction reaction as copper is getting oxidized and silver is getting reduced.
What is chemical equation?Chemical equation is a symbolic representation of a chemical reaction which is written in the form of symbols and chemical formulas.The reactants are present on the left hand side while the products are present on the right hand side.
A plus sign is present between reactants and products if they are more than one in any case and an arrow is present pointing towards the product side which indicates the direction of the reaction .There are coefficients present next to the chemical symbols and formulas .
The first chemical equation was put forth by Jean Beguin in 1615.By making use of chemical equations the direction of reaction ,state of reactants and products can be stated. In the chemical equations even the temperature to be maintained and catalyst can be mentioned.
Learn more about chemical equation,here:
https://brainly.com/question/28294176
#SPJ2
Are two atoms of the same element identical? pls answer asap need long definition
Atoms of the same chemical element do not always have the same mass because, although the number of protons in the nucleus is the same for all atoms of the same element, the number of neutrons is not. Most elements as they occur naturally on earth are mixtures of several isotopes
hope this will help
Answer:
NO two atom of the same element are typically not identical.EXPLANATION : First of all there is a range of possible states that the electron of an atom can occupy . Two atoms of the same element can be different ifif their electrons are in different states. here is the answer hope It help you please please mark as brainliestwhich action would most likely reduce water pollution ?
The action that would most likely reduce water pollution is A) initiating efforts to remove trash from the ocean.
Trash and plastic waste in the ocean pose a significant threat to marine life and ecosystems. Initiating efforts to remove trash from the ocean can help mitigate this problem and reduce water pollution. When plastic waste accumulates in oceans, it can break down into microplastics, which are ingested by marine organisms and can enter the food chain, causing harm to both marine life and humans.
By actively removing trash from the ocean, we can prevent it from further degrading and releasing pollutants. This can help protect marine habitats, reduce the risk of entanglement or ingestion by marine animals, and preserve the overall health of ocean ecosystems.
On the other hand, options B, C, and D would likely contribute to increased water pollution:
B) Eliminating laws and regulations on industrial waste would remove important safeguards and oversight, potentially allowing industries to discharge pollutants directly into water bodies, leading to increased water pollution.
C) Promoting the use of oil and gas can lead to oil spills, leakage, and contamination of water sources. This can have severe consequences for aquatic ecosystems and human health.
D) Removing the ban on chlorofluorocarbons (CFCs) would result in the release of these harmful substances, which deplete the ozone layer and can contaminate water sources when disposed of improperly.
In conclusion, initiating efforts to remove trash from the ocean is the most effective action to reduce water pollution, while the other options would likely exacerbate the problem. Therefore, Option A is correct.
Know more about water pollution here:
https://brainly.com/question/20380251
#SPJ11
Can someone please quickly answer this question?
Does it matter the order for an electronic configuration? So, like for the electronic configuration of Tin, can I either use [Kr]4d^105s^25p^2 or [Kr]5s^24d^1050^2
I’m just confused, when I look it up they show both so I don’t know which one is correct so I can use for my lab report?
Answer:
The difference between the two is:
\([Kr]4d^1^05s^25p^2\) is the Orbital Occupancy
\([Kr]5s^24d^1^05p^2\) is the Orbital Filling Order
Both are correct, I don't think your teacher will be so nit-picky to care.
I'm putting extra points on this. I really need help.
Answer:
18 c
19 b
20 a
21 a
Explanation:
18 LiOH is a powerful base citric acid is a weak acid so when we mix a powerful base with a weak acid mixture become basic
when we mix powerful base with a powerful acid it becomes neutral(need to take equal quantities)
when we mix powerful acid with weak base mixture becomes acidic
when we mix weak acid with weak base we cannot tell what happens to find this we need to do some calculations
19 when the ka value is high it becomes more acidic
20 A polyprotic acid is an acid that can donate more than one proton or hydrogen atom per molecule to an aqueous solution. In contrast, a monoprotic acid (e.g., HCl) can only donate one proton per molecule.
so here it has 3H so it can donate 3H+
in here we need to write the ionization of the acid in water
do the answer is a
21 A proton acceptor is another name for a base, which is the opposite of an acid. In the Broensted-Lowry definition, a base is a negatively charged ion that will react with, or accept, a positively charged hydrogen ion. Since a hydrogen ion is a proton, the base is called a proton acceptor.
an acid is any proton donor, and a base is any proton acceptor. The focus of this definition is on donating and accepting protons, and is not limited to aqueous solution. The Brønsted-Lowry definition of acids and bases is one of two definitions we commonly use
Compared to a Be2+ ion, a Be atom has
Answer:
More electrons
Explanation:
Compared to Be²⁺, a Be atom has more electrons in its atomic structure.
A positively charged ion implies that an atom has more protons than electrons in its atomic make up.
The difference in the amount of protons and electrons leaves a net positive charge on the ion.
A Be atom is a neutral state. It shows equal number of protons and electrons in an atom.
Therefore, Be has more electrons compared a Be²⁺ ion.
In a titration a 15.00 cm3 sample of H2SO4 required 36.42 cm3 of 0.147 mol dm–3 NaOH solution for complete neutralization. What is the concentration of the H2SO4?
We have a titration here between an acid and a base.
Base: NaOH
Acid: H2SO4
When we get to the equivalence point, we can use this formula:
C x V )1 = C x V )2
1 is referred to the acid and 2 is referred to the base.
C is concentration in mol/dm^3 (remember dm^3 = L)
V is the volume in cm^3
For H2SO4)
C1 = unknown value
V1 = 15.00 cm^3
For NaOH)
C2 = 0.147 mol/dm^3
V2 = 36.42 cm^3
Now, from C1 x V1 = C2 x V2, we clear C1
C1 = C2 x V2 / V1 = 0.147 mol/dm^3 x 36.42 cm^3 / 15.00 cm^3 = 0.357 mol/dm^3
Answer: C1 = 0.357 mol/dm^3 , concentration of the acid
What is internal pressure?
Questions
Q1.
Use the Periodic Table on page 2 to help you answer this question.
Give the name or symbol of
(a) the element in group 3 and period 4.
Gallium is the element that belongs to the group 3 and the fourth period. Ga is symbol of Gallium.
The element gallium has an atomic number of 31.While highly pure gallium is covered in a dazzling silvery colour, solid gallium is a blue-grey metal with an orthorhombic crystalline structure.It is a crucial part of numerous semiconductors. Due to its capacity to transform power into light, it is additionally used in red LEDs (light emitting diodes).Because of its high boiling point, it is perfect for recording temperatures that would cause a thermometer to vaporise.From iron pyrites, zinc blende, germanite, and bauxite, this metal can be readily removed as a byproduct.Because gallium is a corrosive chemical, it can cause serious skin and eye burns asse well as significant irritation.Learn more about semiconductors here
https://brainly.com/question/1918629
#SPJ9
How many grams of Aluminum Sulfate do you have if you have 2.837x10^26 atoms of Sulfur?
Apparently, the right answer is 5.373x10^4, but I do not know how to get there, please help.
The mass of Aluminum Sulfate is 5.373 grams if you have \(2.837*10^{26\) atoms of Sulfur .
The molecular formula of Aluminum Sulfate is \(Al_2(SO_4)_3.\) In one molecule of aluminum sulfate, there are 3 sulfur atoms. To calculate the mass of aluminum sulfate, follow the steps below:
Step 1: Calculate the molar mass of aluminum sulfate using the periodic table.Al = 27.0 g/molS = 32.1 g/molO = 16.0 g/mol
(2 × Al) + (3 × S) + (12 × O) = molar mass of \(Al_2(SO_4)_3.\) = 342.2 g/mol
Step 2: Find the number of moles of sulfur in the given number of atoms of sulfur.2\(2.837*10^{26\) atoms of sulfur × 1 mol S/\(6.022 * 10^{23\)atoms S = 0.0470 mol S
Step 3: Use the molar ratio of sulfur to aluminum sulfate to calculate the number of moles of aluminum sulfate.1 mol \(Al_2(SO_4)_3.\) / 3 mol S = 0.333 mol\(Al_2(SO_4)_3.\) per mol S0.0470 mol S × 0.333 mol \(Al_2(SO_4)_3.\)/mol S = 0.0157 mol \(Al_2(SO_4)_3.\)
Step 4: Calculate the mass of aluminum sulfate.0.0157 mol \(Al_2(SO_4)_3.\) × 342.2 g/mol\(Al_2(SO_4)_3.\)= 5.373 g\(Al_2(SO_4)_3.\)
Therefore, the mass of Aluminum Sulfate is 5.373 grams if you have \(2.837*10^{26\) atoms of Sulfur.
Know more about aluminum sulfate here:
https://brainly.com/question/28299913
#SPJ8
What is the volume of 11.2 g of O2 at 7.78 atm and 415 K?
Answer:
1.53 L
Explanation:
Step 1: Given data
Mass of oxygen (m): 11.2 gPressure (P): 7.78 atmTemperature (T): 415 KIdeal gas constant (R): 0.0821 atm.L/mol.KStep 2: Calculate the moles (n) corresponding to 11.2 g of oxygen
The molar mass of oxygen is 32.00 g/mol.
11.2 g × (1 mol/32.00 g) = 0.350 mol
Step 3: Calculate the volume of oxygen
We will use the ideal gas equation.
P × V = n × R × T
V = n × R × T / P
V = 0.350 mol × (0.0821 atm.L/mol.K) × 415 K / 7.78 atm
V = 1.53 L
Which of the following transition is considered the phase
change from water to steam?
Answer:
the transition from water to steam is call evaporation.
Explanation:
water evaporates or vaporizes and turns into steam this typically happens when heat meets with the water. an example would be if you boil water steam will release from the pot, or when it rains, snows, etc (precipitation) the water evaporates and the ground dries.
Please I need help thank you
Answer:
its sodium hydroxide
Explanation: