I need help with this

I Need Help With This

Answers

Answer 1
What is it you need help on? there is nothing here????

ANSWER:
Answer 2

Answer: B

Explanation: All you have to do to find out if an equation is balanced is count the number of atoms on each side. To be balanced, they must be equal.

In case you didn’t know: The number in front of an element or compound means that you will multiply. For instance, 2AlBr3 would have 2 Al atoms and 6 Br atoms. The subscript number just means how many atoms there are in that compound.


Related Questions

5.(08.02 MC)
A 0.0400 M NaCl solution was formed when 32.0 grams of NaCl was dissolved in enough water. What was the total volume of the solution formed? (5 points)
O 7.20 liters
9.80 liters
13.7 liters
18.1 liters

Answers

Answer:

13.7 liters

Explanation:

I took the test and got it right

The total volume of the NaCl solution whose molarity is 0.04 M is 13.7 liters.

What is molarity?

Molarity of any solution is define as the number of moles of solute present in per liter of the solution and it will be represented as:

M = n/V

Mass from moles will be calculated as:
n = W/M, where

W = given mass of NaCl = 32g

M = molar mass of NaCl = 58.44g/mol

mole = 32g / 58.44g/mol = 0.547 mol

Molarity of solution = 0.04 M

On putting values on the above equation, we get volume as:
V = 0.547 mol / 0.04mol/L

V = 13.67 L = 13.7L

Hence required value of volume is 13.7 L.

To know more about molarity, visit the below link:
https://brainly.com/question/489225

I’m the _____ state,volume and shape are both definite definite means that those characters and changeable in the _____ common volume and shape or both.

Answers

Answer:

I'm the constant, volume and shape are both definite. Constant means that those characters are not changeable in the same common volume and shape or both.

how many grams of sodium cholide are thee in 55.0 ml of a 1.90 m aqueous solution of sodium chioride

Answers

The aqueous solution of sodium chloride is 56.9g

Reason:

Given:

Molarity = 1.9M,

Volume = 55 mL,

Molar Mass NaCl = 58.44 = [ 22.99 + 35.45 ], 1.9M means 1.9 moles in 1000 mL

55mL -> (1.9)(55/1000) = 0.1045

Mass in g = (58.44)(0.1045) = 6.10698

Learn more about Sodium Chloride:

https://brainly.com/question/6649122

#SPJ4

as the temperature of a gas decreases is volume​

Answers

Answer:

it's volume also decrease

The Volumes decreases

Show that the equation x3 + x -3=0 has a solution between 1 and 2

Answers

To show that the equation x^3 + x - 3 = 0 has a solution between 1 and 2, we can use the Intermediate Value Theorem.

First, let's evaluate the equation at x = 1:

(1)^3 + 1 - 3 = -1

Next, let's evaluate the equation at x = 2:

(2)^3 + 2 - 3 = 9

We can see that the value of the equation at x = 1 is negative (-1) and the value of the equation at x = 2 is positive (9).

Since the equation is a continuous function, according to the Intermediate Value Theorem, if a continuous function takes on values of opposite signs within an interval, then it must have at least one root (solution) within that interval.

In this case, the equation x^3 + x - 3 = 0 changes sign from negative to positive between x = 1 and x = 2. Therefore, we can conclude that there exists at least one solution to the equation between 1 and 2.

To learn more about intermediate value theorem, click here:

https://brainly.com/question/30403106

#SPJ11

Which of the following is true about amplitude?
A. The smaller the amplitude, the greater the energy that is carried by the wave.
B. The larger the amplitude, the less the energy that is carried by the wave.
C. The larger the amplitude, the more the energy that is carried by the wave. 72​

Answers

Answer:

C.

Explanation:

The sound is perceived as louder if the amplitude increases, and softer if the amplitude decreases. ... As the amplitude of the sound wave increases, the intensity of the sound increases. Sounds with higher intensities are perceived to be louder. Relative sound intensities are often given in units named decibels (dB).

The correct statement about the amplitude of a wave is option C. Thus, the larger the amplitude, the more the energy that is carried by the wave.

What is amplitude?

Amplitude of a wave is a parameter describing the intensity of the wave. Amplitude of a transverse wave and sinusoidal waves are measured as the distance between from the central point of a crest to its top or the the distance from the central point of the trough in the line to its bottom part.

The amplitude of a wave is directly proportional to the frequency of the wave and the frequency in turn is directly proportional to the energy of the wave.

Therefore, The correct statement about the amplitude of a wave is option C. Thus, the larger the amplitude, the more the energy that is carried by the wave.

To find more on amplitude, refer here:

https://brainly.com/question/8662436

#SPJ2

Two reactant particles collide with proper orientation. The collision will be
effective if the particles have
(A) sufficient potential energy
(B) high activation energy
(C) high ionization energy
(D) sufficient kinetic energy
And explain why

Answers

Answer: D) Sufficient kinetic energy

Explanation:

Oddly shaped bones like your vertebrae and pelvis? a.irregular bones c. short bones b. flat bones d. long bones ​

Answers

A. irregular bones. Irregular bones are the ones that have short, flat, notched, or ridged surfaces.

(PLEASE HELP WILL MARK BRAINLIEST!!) A scientist wants to develop a new chemical. In one or two sentences, create a science question and a non-science question that the
scientist could consider when developing the new chemical.

Answers

Answer:

Science Question: What will the combination of the resources I use to make this new chemical do to different living organisms and non-living organisms around an environment?

Non-Science Question: What should we call this new chemical?

Explanation:

I hope this helps! If you don't like these questions I've got a few more that may work to your liking! :)

Elements that are in the same ________ have a tendency to have very similar chemical properties due to periodic trends. textbook period row compound group

Answers

Elements that are in the same group have a tendency to have very similar chemical properties due to periodic trends.

The periodic table is organized into groups (also known as families or columns) and periods (also known as rows). Elements within the same group share similar chemical properties because they have the same number of valence electrons. Valence electrons are the electrons in the outermost energy level of an atom and play a crucial role in determining an element's chemical behavior.

The periodic table is arranged in such a way that elements in the same group have the same number of valence electrons, leading to similar chemical properties. For example, elements in Group 1 (such as hydrogen, lithium, sodium, and potassium) all have one valence electron, which makes them highly reactive metals that readily lose that electron to form positive ions. Similarly, elements in Group 17 (such as fluorine, chlorine, bromine, and iodine) all have seven valence electrons, making them highly reactive nonmetals that readily gain one electron to achieve a stable electron configuration.

Periodic trends, such as atomic radius, ionization energy, and electronegativity, also contribute to the similarity of chemical properties within a group. These trends affect how atoms interact with each other during chemical reactions.

Elements that are in the same group of the periodic table tend to exhibit similar chemical properties due to their shared number of valence electrons. This similarity arises from the periodic trends and influences how elements interact with other substances, leading to the formation of compounds and the manifestation of specific chemical behaviors.

Learn more about  tendency ,visit;

https://brainly.com/question/32182452

#SPJ11

An atom has 11 protons, 12 neutrons, and 11 electrons. What is the identity of the element?

Answers

Answer:

It's a Sodium Atom

use a labelled diagram to show how high tides (spring tides) occur.

Answers

I feel chemistry wit spring tides I don’t show how high

calculate the density of radon at 327 k and 1.00 atm of pressure.

Answers

The density of radon at 327 K and 1.00 atm of pressure is approximately 83.36 g/L.

To calculate the density of radon at 327 K and 1.00 atm of pressure, we can use the Ideal Gas Law equation: PV = nRT. First, we need to rearrange the equation to solve for density (ρ). Density is mass per unit volume, so ρ = m/V. Since n = m/M (where M is the molar mass), we can rewrite the equation as PV = (m/M)RT. Rearranging for ρ, we get ρ = (m/V) = PM/RT.

Now we can plug in the given values:

P = 1.00 atmM (molar mass of radon) = 222 g/molR (gas constant) = 0.0821 L atm/(K mol)T = 327 K

ρ = (1.00 atm × 222 g/mol) / (0.0821 L atm/(K mol) × 327 K)

= 83.36 g/L

So, the density of radon at 327 K and 1.00 atm of pressure is approximately 83.36 g/L.

Learn more about density: https://brainly.com/question/18141898

#SPJ11

What is the structural formula of 4-methyl pentan-2-ol​

Answers

The 4-methyl pentane-2-ol (C6H14O) is an alcohol compound with a methyl group attached to the fourth carbon atom and a hydroxyl group attached to the second carbon atom in a five-carbon chain.

The structural formula of 4-methyl pentane-2-ol is C6H14O. This is an alcohol compound with six carbon atoms, fourteen hydrogen atoms, and one oxygen atom. The first part of the name, 4-methyl, indicates that there is a methyl group (CH3) attached to the fourth carbon atom in the chain. Pentan-2-ol tells us that there are five carbon atoms in the chain and that the hydroxyl group (OH) is attached to the second carbon atom. Therefore, the structural formula of 4-methyl pentane-2-ol can be written as CH3CH(CH3)CH(CH2OH)CH2CH3. This can be further simplified as CH3CH(CH3)CH(CH2OH)CH2CH3which represents the complete structural formula of 4-methyl pentan-2-ol.4-methyl pentane-2-oil is an organic compound with a wide range of applications, including as a solvent, in the manufacture of cosmetics and perfumes, and as a flavoring agent in food and beverages. Its unique structure and properties make it a valuable component in various chemical and industrial processes.

For more questions on methyl group

https://brainly.com/question/31238796

#SPJ8

consider a saturated solution of silver chloride in water. compared to the original concentrations of the silver ion and the chloride ion, how would the concentrations be different after some nacl is added to the solution?

Answers

The concentrations of the silver ion and chloride ion in the solution will not be affected by the addition of NaCl, as the solution is already saturated.

When a solution is saturated, it means that the maximum amount of solute (in this case, silver chloride) has been dissolved in the solvent (water) at a given temperature and pressure. Adding more solute (such as NaCl) will not cause any additional solute to dissolve, as the solution is already at its saturation point.

Therefore, the concentrations of the silver ion and chloride ion in the solution will not change as a result of adding more NaCl. It's important to note that adding more solvent (water) would decrease the concentration of the solute.

To learn more about NaCl visit: https://brainly.com/question/24878544

#SPJ4

Oxidation state of H in BaH2

Answers

Answer:

Hydrogen, H, has an oxidation number of +1 unless it is combined with metals, where it has the oxidation number -1. –Examples – LiH = Li+ H-, BaH2= Ba 2+ H-7. Oxygen usually has the oxidation number -2.

Explanation:

HF or HCl which can form the hydrogen bond? Explain your answer.​

Answers

Answer:

can only form one hydrogen bond each

Explanation:

can only form one hydrogen bond each

Calculate the volume that 140 g of H2 gas will occupy at 305 K and 8.2 atm.

Answers

Answejust put my mum said i didnt have to do this question

Explanation:

becuase im cool like that

If you travel east from 125 degrees west to 55 degrees east along the equator, how far will u travel in degrees

Answers

Answer:

180°

Explanation:

You are starting at 125° W and ending at 55° E.

It might be easier to find the distance travelled by using a number line.

Numbers west are negative and numbers east are positive.

Start at -125 and go in jumps of 10 until you reach +55.

You make 18 jumps of 10° each for a total of 180°.

You have travelled a distance of 180°.

What you have just done is equivalent to saying:

distance travelled = end - start = 55° - (-125°) = 55° + 125° = 180°  

 

If you travel east from 125 degrees west to 55 degrees east along the equator, how far will u travel

what is ∆h when 123.6 g octane (c8h18, molar mass = 114.2 g/mol) undergoes combustion according to the thermochemical equation below?

Answers

The ∆H when the 123.6 g octane that will undergoes the combustion to thermochemical equation is -250.40 kJ.

The Balanced chemical reaction:

2C₈H₁₈ (l) + 25O₂ (g) → 16CO₂ (g) + 18H₂O (l)

The mass of the octane, C₈H₁₈ = 123.6 g

The ΔH for the rxn  is as :

ΔHrxn = 16 ΔH°f (CO₂ (g)) + 18 ΔHf (H₂O (l))  -  (2 ΔHf (C₈H₁₈) (l) + 25 ΔHf O₂ (g))

-1.0940 × 10⁴ kJ = 16mol x (-393.5 kJ/mol) + 18mol x  (-285.8 kJ/mol) - 2(ΔHf(C₈H₁₈)(l) -1.094 x10⁴ kJ

= -6296 kJ + ( -5144.40 kJ ) - 2(ΔH°f(C₈H₁₈)(l)

-500.40 kJ/2 = ΔHf(C₈H₁₈)(l)

ΔHf(C₈H₁₈)(l) = -250.40 kJ

To learn more about combustion here

https://brainly.com/question/15563177

#SPJ4

The size of earthquakes is usually measured using the moment magnitude scale, which is a measure of the energy released.
A.True
B.False

Answers

Answer:True

Explanation: Moment magnitude is used by the USGS- it is based on the total moment release of the earthquake. Moment is a product of the distance and the force. The moment magnitude scale gives an esitmate of the total energy released from the earthquake

Metals can be protected from corrosion by applying a coating that protects the metal by acting as a barrier. Painting is one way of applying a coating. Give the other TWO.

Answers

The ways in which metals can be protected from corrosion include the following below:

Cathodic protectionCorrosion inhibitors.

What is Corrosion?

This is common with metals and is a process which occurs as a result of its exposure to the surroundings. This results in metals forming a stable oxide thereby leading to the deterioration of the material.

There are however several ways to protect them from corrosion such as painting and the use of corrosion inhibitors such as chromates etc which helps to coat it and prevent the oxidation process from occurring thereby making it the correct choice.

Read more about Corrosion here https://brainly.com/question/948980

#SPJ1

Explain why fluoride ion is smaller than chloride ion.​

Answers

Because the nucleus can't hold the 18 electrons in the Cl- ion as tightly as the 17 electrons in the neutral atom, the negative ion is significantly larger than the atom from which it forms. For the same reason, positive ions should be smaller than the atoms from which they are formed.

Which of the following is a lanthanide?
A.gold(au)
B.barium(ba)
C.europium(eu)
D.americium(am)

Answers

The correct answer is-C

Austin conducted a survey and he wants to organize his data so it is easy for him to read and analyze. What computer program should Austin use?

Group of answer choices

Excel Online

Graph Designer

Survey Organizer

Word Online

Flag this Question
Question 7

Answers

Graph Designer

Hope This Helped!!!:)

Answer:

it Exile Online

Explanation:

trust me i did it

Metals typically lose electrons and become cations lose electrons and become cations lose electrons and become anions lose electrons and become anions gain electrons and become anions gain electrons and become anions gain electrons and become cations

Answers

Answer:

Metals typically loose electrons and become cations

Explanation:

Metals are typically found towards the left hand side of the periodic table. They typically possess fewer electrons in their outermost shell compared to nonmetals.

As a result of this, when metals form chemical bonds with other elements, it is energetically more favourable for metals to loose electrons and form cations.

Which represents an empirical formula?
a)C2H4
b)B2H6
c)Al2O3
d)C6H6

Answers

Answer:

C. Al2O3

Explanation:

The empirical formula is an expression that represents the simplest proportion in which the atoms that form a chemical compound are present. It is therefore the simplest representation of a compound.

For options A, B and D the empirical formulas are as follows:

A. CH2

B. BH3

D. CH

1. bond polarity 1 pts 2req 2. dipole moments 1 pts question question question 2req 3. formal charge 1 pts 2req 4. adding lone pairs to lewis structures with formal charges 1 pts 2req 5. drawing structural formulas with formal charges 1 pts 6. resonance structures 1 pts 2req 7. drawing resonance structures 1 pts 8. acids and bases 1 pts 9. lewis acids and bases 1 pts 2req 10. hydrogen bonding 1 pts < progress: 4/10 groups due feb 20 at 11:55 pm question content area do the molecules below have a permanent electric dipole moment? a) no b) yes c) submit answerretry entire group

Answers

Yes, molecules can have permanent electric dipole moments if they contain polar bonds, or if they contain lone pairs of electrons that create a dipole moment.

The molecules below could have a permanent electric dipole moment depending on the relative arrangement of the atoms and their lone pairs of electrons.


a) CF4 has no permanent electric dipole moment as it has a tetrahedral geometry and the bond polarity vector cancel each other out.

b) H2S has a permanent electric dipole moment as it is a polar molecule. The electronegativity of sulfur is greater than that of hydrogen. As a result, the electron pair is displaced toward the sulfur atom. As a result, the molecule has a net dipole moment.

c) CH2Cl2 has a permanent electric dipole moment as it is a polar molecule. The polarity of the bond is determined by the difference in electronegativity. The bond dipoles are not balanced due to the asymmetrical shape of the molecule. As a result, the molecule has a net dipole moment.

d) CO2 has no permanent electric dipole moment as it is a linear molecule with two polar bonds. The direction of each dipole moment is the same, but they cancel each other out as they are opposite in direction.

For more such questions on Dipole moment.

https://brainly.com/question/14725839#

#SPJ11

The equation shows cellular respiration. During cellular respiration, glucose combines with oxygen to form carbon dioxide, water, and ATP. Uppercase C 6 uppercase H 12 uppercase O 6 6 uppercase O 2 right-arrow 6 uppercase C uppercase 0 2 6 uppercase H 2 uppercase 0 A T P What happens to the energy in the bonds in glucose?.

Answers

The energy in the bonds in glucose will be broken down and transferred to ATP molecules.

CELLULAR RESPIRATION:

Cellular respiration is the process by which living organisms obtain energy by breaking down food molecules in their cells.

The equation for cellular respiration is as follows:

C6H12O6 + 6O2 → 6CO2 + 6H2O + ATP

Based on the illustration using the above equation, the energy stored in the bonds of glucose molecule is broken down and used to synthesize ATP molecules.

Learn more about cellular respiration at: https://brainly.com/question/12671790

PLEASE HELP THANKS:))))))
explain how phytomining is used to extract copper from low grade ores. Full explanation

Answers

Explanation:

-plants that can absorb copper ions are grown on soil with low grade copper ores.

-the plants are burned and the copper compounds are within the Ash.

-copper ions can be leached from the Ash by adding sulphuric acid, this makes a solution of copper sulphate

-the displacement of scrap iron makes pure copper metals.

Plant Extraction (Plant Mining)

crops are grown in soil containing low-grade ore. Plants take up metal ions from the roots and concentrate these ions on the cells. The plants are harvested and burned. The remaining ash contains metal compounds.

How is phytomining used to extract copper?

Plants absorb metal ions from their roots in a process called plant mining. It removes toxic metals from contaminated soil-eg around old mines. In the future, when high-grade ore is depleted, it may extract metals by burning plants to produce ash.

How to extract copper from low-grade copper?

How to extract copper from low-grade copper ore? Copper is extracted from low-grade copper ore by hydrometallurgy. Cu is treated with cast iron or H2 and leached by acid.

For more information on plant extraction (plant mining), please visit

https://brainly.com/question/14600662

# SPJ2.

Other Questions
What is the nature of the solution set to the following system of equations?4x + 3y = 23x 2y = 10 The value of a professional basketball player's autograph rose 30% in the last year. It is now worth $351.00. What was it worth a year ago? which of the following statements is true of design for manufacturing (dfm) methods? group of answer choices they help firms identify potential failures in a system and classify them according to their severity. they lengthen the development cycle time of products. they facilitate integration between engineering and manufacturing and bring issues of manufacturability into the design process as early as possible. they introduce design rules that increase the complexity of the product designs, thus making them harder to manufacture, which ultimately increases the unit costs. En qu momentos es necesario reescribir nuestras vidas?Qu crees que se puede ganar al hacerlo? this circle is centered at the origin, and the length of its radius is 4. what is the equation of the circle?HELP PLEASE LIKE YALL MFS TRY AND HELP ASAPPPP How long would it take sound waves traveling through air that is 68F to travel 1,372 meters? Use an equation to solve the problem. followers oftentimes become passive and inactive around toxic leaders because ______. Suppose a 2.5um wide slit produces its first minimum for 405nm light. A) Calculate the angle at which this occurs for the 405nm light in degrees. B) where is the first minimum in degrees for 740nm light? Hi there~Explain the meaning of insomnia. Suppose that y varies directly as the square root of x, and that y = 29 when x = 100. What is y when x = 123? Round your answer to two decimal places if necessary Pls help plz thank you Simplify the expression:Two-thirds divided by (negative 4) minus (one-sixth minus StartFraction 8 over 6 EndFraction)1StartFraction 29 over 24 EndFractionStartFraction negative 24 over 17 EndFractionStartFraction 23 over 24 EndFraction Which numbers are possible solutions to the inequality... (SELECT ALL THAT APPLY)-5x + 10 < 30 Select the two sentences from the text that best support the conclusion NASA did not always build rockets that they used Huryyyy!!!!!! worth 20 points!!!!1 part a which event is part of the complicating incident of this story? samara goes to the library to find out how to open a park in pine grove. samara sees children playing tag on a small plot of land between houses. samara identifies the plot on cedar avenue as a possible park location. samara is nervous about her presentation for the town zoning board. The varsity club wants to make 1000 dollars for a NYC trip. They are selling t-shirts for 9.00 dollars each. The fee for printing lancers logos is 30 dollars if the number of t-shirts is represented by x write and solve an inequality to find the number of t-shirts they have to sell in order to reach their goal find net force and acceleration What do these amendments reveal about the political system in the United States?A. The Constitution was written to define the established practices for elections.B . The Constitution was designed to meet the changing needs of society.C. The Constitution encourages membership in political parties.D .The Constitution requires changes of political leadership. Which system of equations does this graph represent? In a paragraph, please explain the following. what is self-government and why did the founding fathers believe it is necessary for having a free country.