I need help please. The top question.

I Need Help Please. The Top Question.

Answers

Answer 1

Answer:

i cant see anything lol sorry

Explanation:


Related Questions

Two asteroids are 75,000 m apart one has a mass of 8 x 10^7 N what is the mass of the other asteroid

Answers

The mass of the asteroid is C. 1.2 x 1012 Kg

To find the mass of the other asteroid, we can rearrange the equation for the gravitational force between two objects:

F = (G * m1 * m2) / r2

where F is the force of gravity, G is the gravitational constant, m1 and m2 are the masses of the two asteroids, and r is the distance between them.

Given that the distance between the asteroids is 75000 m, the force of gravity between them is 1.14 N, and one asteroid has a mass of 8 x 107 kg, we can substitute these values into the equation and solve for the mass of the other asteroid (m2):

1.14 N = (6.67430 × 1011 N m2/Kg2 * 8 x 107 kg * m2) / (75000m)2

Simplifying and solving the equation, we find that the mass of the other asteroid (m2) is approximately 1.2 x 1012 kg. Therefore, Option C is correct.

The question was incomplete. find the full content below:

Two asteroids are 75000 m apart one has a mass of 8 x 107 kg if the force of gravity between them is 1.14 what is the mass of the asteroid

A. 3.4 x 1011 kg

B. 8.3 x 1012 kg

C. 1.2 x 1012 kg

D. 1.2 x 1010 kg

Know more about gravitational force here:
https://brainly.com/question/72250

#SPJ8


Can someone answer those fast plsssss

Can someone answer those fast plsssss

Answers

Considering the reaction of different concentrations of dilute hydrochloric acid with calcium carbonate, the independent variable is the concentration of hydrochloric acid.

What is the reaction of dilute hydrochloric acid with calcium carbonate?

The reaction of dilute hydrochloric acid with calcium carbonate is given by the chemical equation below:

2 HCl + CaCO₃ ---> CaCl₂+ H₂O + CO₂

Considering the reaction to determine the effect of the concentration of acid on the rate of this reaction:

The dependent variable is the rate of reactionThe independent variable is the concentration of hydrochloric acidThe time taken for a given volume of carbon dioxide to be produced is used to measure the dependent variable.Two variables, blessing must control is the volume of hydrochloric acid and surface area of the calcium carbonate.

Learn more about the rate of reaction at: https://brainly.com/question/12904152

#SPJ1

Complete question:

Dilute hydrochloric acid reacts with calcium carbonate.

Blessy plans an investigation to find out the effect of the concentration of acid on the rate of this reaction.

(a) (i) Identify the independent variable in this investigation.

(ii) Describe how Blessy measures the dependent variable in this investigation.

dependent variable

how it is measured

(iii) Identify two variables that Blessy must control.

A student conducts an experiment to see how music affects plant growth. The student obtains four identical plants. Each one is potted in the same type of soil and receives the
same amount of sunlight and water each day. Plant A listens to classical music for three hours each day. Plant B listens to rock music for three hours each day. Plant C listens to
country music for three hours each day. Plant D does not listen to any music at all.

2. Based on the experiment in the scenario, which visual aid would be most helpful in showing the change in the plants' heights over time?
O A. A timeline
OB. A line graph
OC. A pie chart
D. A bar graph

Answers

Answer:

The type of music each plant listens to.

Explanation:

A variable is any factor or condition whose value is changing in an experiment. A variable can occur in different types or quantity, and three types of variable (independent, dependent, and controlled) can be found in an experiment. In the experiment described above, "the type of music each plant listens to" is the variable. It is an independent variable whose value is changing because it exists in different types and it is the one that the student is observing its effect on the plant’s growth. In this experiment, this variable which differ will also produce different results (or effects).

A mixture of 0.600 mol of bromine and 1.600 mol of iodine is placed into a rigid 1.000-L container at 350°C.
Br2(g) + I2(g) ↔ 2IBr(g)
When the mixture has come to equilibrium, the concentration of iodine monobromide is 1.190 M. What is the equilibrium constant for this reaction at 350°C?
Show step-by step explanation.

A) 3.55 × 10^3
B) 1.24
C) 1.47
D) 282
E) 325

Answers

The equilibrium constant of the reaction is 282. Option D

What is equilibrium constant?

The term equilibrium constant refers to the number that often depict how much the process is able to turn the reactants in to products. In other words, if the reactants are readily turned into products, then it follows that the equilibrium constant will be large and positive.

Concentration of bromine = 0.600 mol /1.000-L = 0.600 M

Concentration of iodine = 1.600 mol/1.000-L =  1.600M

In this case, we must set up the ICE table as shown;

              Br2(g) + I2(g) ↔ 2IBr(g)

I          0.6            1.6           0

C      -x                -x             +2x

E    0.6 - x         1.6 - x       1.190

If 2x = 1.190

x = 1.190/2

x = 0.595

The concentrations at equilibrium are;

[Br2] = 0.6 -  0.595 = 0.005

[I2] =   1.6 - 0.595 = 1.005

Hence;

Kc = [IBr]^2/[Br2] [I2]

Kc = ( 1.190)^2/(0.005) (1.005)

Kc = 282

Learn more about equilibrium constant:https://brainly.com/question/15118952

#SPJ1

How should scientists set up the control group in this experiment?

Answers

Answer:

Please show a file so I can answer your question or tell me which experiment.

Explanation:

Definition:The control group (sometimes called a comparison group) is used in an experiment as a way to ensure that your experiment actually works. It's a way to make sure that the treatment you are giving is causing the experimental results, and not something outside the experiment.

How many moles of CaCl₂ would there be in 42 mL of 2.09 M aqueous CaCl₂ solution?
3 significant figures

Answers

Answer:

0.0878 moles CaCl₂

Explanation:

To find the amount of moles of CaCl₂, you need to

(1) convert the volume from mL to L (1,000 mL = 1 L)

(2) calculate the amount of moles (M = moles / L)

It is important to arrange the conversions in a way that allows for the cancellation of units.

(Step 1)
   

  42 mL CaCl₂                    1 L
------------------------  x  ----------------------  =  0.042 L CaCl₂
                                       1,000 mL

(Step 2)

Molarity (M) = moles / volume (L)                <----- Molarity ratio

2.09 M = moles / 0.042 L                            <----- Insert values

0.0878 = moles                                           <----- Multiply both sides by 0.042 L

oxidation of 3-methyl-2-pentanol

Spell out the full name of the compound.

Answers

The product of oxidation of 3-methyl-2-pentanol is 3-methyl-pentan-2-one.

The oxidation of alcohol produces aldehyde and ketones.

What is oxidation of alcohol?

Alcohols are a class of substances that have one, two, or more hydroxyl (-OH) groups bonded to the single alkane bond. These substances all have the generic formula R-OH. They play a crucial role in organic chemistry since they can be altered or transformed into other chemicals, including aldehydes and ketones, among others. There are two distinct sorts of alcohol reactions. These reactions have the ability to break the R-O bond or even the O-H bond.

The oxidation process transforms the alcohols into aldehydes and ketones. One of the most significant reactions in the study of organic chemistry is this one.

To know more about Alcohols, visit;

https://brainly.com/question/14229343

#SPJ9

You kick a soccer ball with a mass of 1.8 kg, and it moves at a velocity of 15 m/s. What type of energy does it have and how much?

Answers

Answer:

27 energy

Explanation:

you just multiply each number

Baking soda (NaHCO3, 84.0 g/mol) requires acids from other ingredients to generate the carbon dioxide needed to make bread rise. The following equation describes this reaction, where HB is some unspecified acid. If 20.4 g of baking soda are used in a recipe and enough acid is present for a complete reaction, how many moles of carbon dioxide are generated?
HB + NaHCO3 ⟶ H2O + CO2 + NaB
a. 0.243 mol
b. 0.204 mol
c. 0.334 mol
d. 0.232 mol
e. 0.464 mol

Answers

0.122283884747646362672 mol

What is the median reaction of second end point in HCL and NaOH titration

Answers

The median reaction at the second end point in the HCl and NaOH titration is: HCl + NaOH → NaCl + H2O

In a titration between hydrochloric acid (HCl) and sodium hydroxide (NaOH), the reaction involved is the neutralization reaction between an acid and a base. The balanced equation for this reaction is:

HCl + NaOH → NaCl + H2O

In this reaction, one mole of HCl reacts with one mole of NaOH to form one mole of NaCl (sodium chloride) and one mole of water.

During the titration process, the reaction occurs gradually as the base is added to the acid solution.

The first end point of the titration is reached when the moles of HCl and NaOH are stoichiometrically equivalent, meaning they react in a 1:1 ratio. At this point, all the HCl has been neutralized by the NaOH, and no excess of either reagent remains.

However, if the titration is continued beyond the first end point, the reaction between HCl and NaOH can still occur, albeit in a different ratio.

The second end point refers to the point where the moles of NaOH added exceed the stoichiometrically required amount to neutralize the HCl completely. As a result, any excess NaOH added after the second end point reacts with the excess HCl in a 1:1 ratio.

Therefore, the median reaction at the second end point in the HCl and NaOH titration is:

HCl + NaOH → NaCl + H2O

For more such question on  median reaction visit:

https://brainly.com/question/14189499

#SPJ8

Please help 40 points can be made.
List the important characteristics of organisms that are true of a single-celled organism.

Answers

Answer:

The characteristics of unicellular organisms are as follows:

The unicellular organisms usually reproduce by asexual means.

They can be eukaryotes or prokaryotes.

They are found in almost all habitats, from hot springs to frozen tundra.

They possess whip-like structures for movement.

The nutrients enter or leave the cell by the process of diffusion.

Explanation:

Answer:

involved in recycling

Makes oxygen we breathe

Explanation:

A catalyst can speed up the rate of a given
chemical reaction by
A increasing the equilibrium constant in favor of
products.
B. lowering the activation cnergy required for the
reaction to occur.
C. raising the temperature at which the reaction
occurs.
D. increasing the pressure of reactants, thus
favoring products.

Answers

A catalyst can speed up the rate of a given chemical reaction by lowering the activation energy required for the

reaction to occur.

CATALYST:

A catalyst is a substance that regulates the rate at which a chemical reaction occurs. A catalyst can either inhibit or promote a chemical reaction.

A catalyst is characterized by being involved in a chemical reaction but not being used up. A catalyst increases the rate of a chemical reaction by lowering the activation energy, which is the energy required for the reaction to start.

Learn more about catalysts at: https://brainly.com/question/17052831?referrer=searchResults

Question 1 of 10What does the second quantum number (1) describe?O A. Which sublevel the electron is inB. Which energy level is being occupiedOC. What spin a specific electron hasOD. The specific orbital within a sublevel

Answers

Explanation:

The second quantum number also called the orbital quantum number describes the type of orbital or shape of it.

Answer: D. The specific orbital within a sublevel.

Answer: A. Which sublevel the electron is in

Explanation:

Question 1 of 10What does the second quantum number (1) describe?O A. Which sublevel the electron is

The equilibrium constant _____________. For an ___________ reaction, heat is a reactant. An increase in temperature and heat favors the ____________ reaction and the value of K c _____________.

Answers

Answer:

The equilibrium constant change. For an endothermic reaction, heat is a reactant. An increase in temperature and heat favors the forward reaction and the value of Kc increases.

Explanation:

Hello.

In this case, regarding reactions in equilibrium in which heat is a reactant as those exemplified by:

Heat+ReactantsProducts

We infer that the heat of reaction is positive since the reactants have more energy in their ground state than the products making them endothermic. Moreover, since the Le' Chatelier's principle states that increasing the reaction temperature in endothermic reactions, the forward reaction (towards products) is favored because endothermic reactions absorb heat in the form temperature raise, the required statement is:

The equilibrium constant change. For an endothermic reaction, heat is a reactant. An increase in temperature and heat favors the forward reaction and the value of Kc increases.

Regards.

Answer:

The equilibrium constant increases. For an endothermic reaction heat is a reactant. An increase in temperature and heat favours the forward reaction and the value of KC increases.

Explanation:

Look at the structure of ethane below and answer the following questions:

A. Calculate the electronegativity difference between the C and H atoms using the table below.

B. Where would the partial + and - changes be?

C. Is the ethane molecule more or less polar than water? Why or why not?

D. If the oceans were filled with ethane rather than water how might they be different? (Hint: think about hydrogen bonding)

Look at the structure of ethane below and answer the following questions:A. Calculate the electronegativity

Answers

The Electronegativity Difference between the C and H atoms in ethane would be 0.35.

The structure of ethane is as follows:A) Electronegativity of Carbon (C) is 2.55, and Hydrogen (H) is 2.20.  Electronegativity Difference (ΔEN) = 2.55 - 2.20 = 0.35B) There would be a partial negative charge on the Carbon atom, and there would be a partial positive charge on the Hydrogen atoms.C) The ethane molecule is less polar than water. This is because the electronegativity difference between the Carbon and Hydrogen atoms is low (0.35) in ethane, whereas the difference between the Oxygen and Hydrogen atoms is high (1.4) in water. Due to the high electronegativity difference in water, it creates a dipole moment, making it a polar molecule. Whereas ethane has no dipole moment and is considered a nonpolar molecule.D) If the oceans were filled with ethane instead of water, then there would be no hydrogen bonding. As a result, many of the physical properties of the ocean would be different.

For example, the freezing point of the ocean would be much lower because of the weak intermolecular forces between ethane molecules. Due to the absence of hydrogen bonding, the viscosity of the oceans would be less than that of water, leading to easier movement of organisms.

for such more questions on Electronegativity

https://brainly.com/question/24977425

#SPJ8

What was the average speed of Tim (dog) in the edpuzzle movie

Answers

Answer:

I think it was 1.7 or 1.9

Explanation:

The sun is 93 million miles from the earth approximately how many years would it take to travel from earth to the sun if a person flew in a spaceship at 55 miles an hour?

(Hint:begin by dividing the distance by the speed to determine the number of hours it would take. Round your answers the the nearest whole number.)

Answers

Answer:

it would take 2 years

Explanation:

93/55=1.69--->1.70------>2

Balance the following equation using oxidation Numbers. Show all steps.
KMnO4(aq)+ H2SO4(aq) +H2O2(l)-> K2SO4(aq) +MnSO4(aq) +
02(g) + H2O(l)

Answers

2 KMnO4 (aq) + 5 H2O2 (aq) + 3 H2SO4 (aq) → 5 O2 (g) + 2 MnSO4 (aq) + K2SO4 (aq) + 8 H2O (l)

]All organic compounds contain the element carbon but, not all compounds containing the element “carbon”are organic .Justify this statement.​

Answers

The statement "All organic compounds contain the element carbon, but not all compounds containing the element 'carbon' are organic" can be justified based on the definition and characteristics of organic compounds.

Organic compounds are compounds primarily composed of carbon and hydrogen atoms, often with other elements like oxygen, nitrogen, sulfur, and phosphorus. These compounds are typically associated with living organisms and are known for their unique properties and behavior, including the ability to form complex structures, exhibit covalent bonding, and undergo organic reactions.

On the other hand, there are compounds that contain carbon but are not classified as organic. One notable example is carbon dioxide (CO2), which is a simple inorganic compound composed of carbon and oxygen. Carbon dioxide does not possess the characteristic properties of organic compounds, such as the ability to form long chains or undergo organic reactions.

Additionally, there are inorganic compounds like carbonates (such as calcium carbonate) and carbides (such as calcium carbide) that contain carbon but are not considered organic. These compounds have distinct chemical and physical properties different from those of organic compounds.

In summary, while all organic compounds contain carbon, not all compounds containing carbon are organic. The classification of a compound as organic or inorganic depends on its overall molecular structure, bonding, and characteristic properties.

Know more about molecular structure here:

https://brainly.com/question/27789666

#SPJ8

A balloon is filled with gas at 27.2 degrees Celsius until its volume is 2,160 mL. The balloon is then placed into an industrial freezer for twenty-four hours before being remeasured. If the final temperature of the gas in the balloon is -24.1 degrees Celsius, what is the final volume of the balloon? Round your answer to the nearest 1 mL.

Answers

answer and explanation

we can use the following equation to find the new volume

V1/T1 = V2/T2

V1 = 2.160 mL = 0.002160 L

T1 = 27.2 +273.15 = 300.35

T2 = -24.1 +273.15 = 249.05k

v2 = ?

V2 = V1T2/T1

= (0.002160 x 249.05) / 300.35

= 0.5379/300.05

= 0.00179L

= 1.79 mL

= 2 mL

Which portion of a molecule of F2O has partial positive charge?
Question 3 options:

A)

The F atoms

B)

The central O atom

C)

The partial charge on each atom is zero

D)

The partial charge on each atom is negative

Answers

The partial charges on each fluorine atom are negative. Option B) The central O atom is the correct answer. Option B

The partial charges in a molecule are determined by the electronegativity values of the atoms involved. Electronegativity is the ability of an atom to attract electrons towards itself in a chemical bond. In the case of F2O, fluorine (F) is more electronegative than oxygen.

Fluorine is the most electronegative element on the periodic table, meaning it has a high ability to attract electrons. Oxygen is also relatively electronegative but less so than fluorine. When fluorine atoms bond with oxygen, the shared electrons will be pulled more towards the fluorine atoms, creating a polar covalent bond.

In F2O, each fluorine atom will pull the shared electrons towards itself, resulting in a higher electron density around the fluorine atoms. This creates a region of partial negative charge around the fluorine atoms.

Conversely, the oxygen atom will have a region of lower electron density and, therefore, a partial positive charge. This is because the shared electrons spend more time around the fluorine atoms due to their higher electronegativity.

Option B

For more such question on partial charges visit:

https://brainly.com/question/29974793

#SPJ8

The following reaction represented oxidation of organic matter (CH2O) using nitrate ions.
If G° = -118.7Kj/mol at 25°C, calculate E°CELL and the equilibrium constant for this
reaction:
14 CH20 + 1/5 NO3 +1/5 H
= CO2 + 1/10 N2 +7/20 H2O
[5]

Answers

sorry but i don't know again sorry!

Two metal samples, X and Z, of the same mass and initially at 25.0 degrees Celsius, are heated so that each metal receives the same amount of thermal energy. Which metal will have the highest final temperature? Specific heat capacity of X = 0.350 J/g⁰C and specific heat of Z = 0.895 J/g⁰C

Answers

Answer:

X = 27.86°C

Y = 26.11°C

Explanation:

Hello,

To solve this question, we'll need to relate heat energy with specific heat capacity

Q = mc∇T

Q = heat energy

M = mass of substance

C = specific heat capacity of substance

∇T = T2 - T1 = change in temperature of the substance.

For X,

Q = mc∇T

Assuming m = 1 g and Q = 1J

T = 25°C

Q = mc(T2 - T1)

1 = 1 × 0.350 × (T2 - 25)

1 = 0.350T2 - 8.75

8.75 + 1 = 0.350T2

Solve for T2

T2 = 9.75 / 0.350

T2 = 27.86°C

For Z

Assuming Q = 1J and M = 1g

Q = mc∇T

Q = mc(T2 - T1)

1 = 1 × 0.895 (T2 - 25)

1 = 0.895T2 - 22.375

22.375 + 1 = 0.895T2

23.375 = 0.895T2

Solve for T2

T2 = 23.375 / 0.895

T2 = 26.11°C

Since both X and Z have equal mass and same energy was passed through them, the final temperature of X = 27.86°C and Z = 26.11°C

As a general observation, whenever comparing two specific heat capacities of different metals, the metal with the greater value of specific heat capacity would have the lower final temperature while the metal with the lower specific heat capacity would have the higher temperature.

share the imporatant lesson that you have learned in organic chem

Answers

We study the reactions that chemists utilise to create bizarre carbon-based structures in organic chemistry.

The study of the makeup, properties, and responses of organic compounds including organic materials, or matter in any of its many forms that contains carbon atoms, is the subject of the branch of science known as organic chemistry. Their structural formula is determined by study of structure.

We will study the reactions that chemists utilise to create bizarre carbon-based structures in organic chemistry, in addition to the analytical techniques used to characterise them. We'll also consider the molecular reaction mechanisms that are driving those reactions.

To know more about organic chemistry, here:

https://brainly.com/question/14623424

#SPJ1

What is the total number of peaks due to singly charged ions in the complete mass
spectrum of chlorine, Cl2
?
A Two
B Three
C Four
D Five

Answers

Five is the total number of peaks due to singly charged ions in the complete mass spectrum of chlorine, Cl2

How many peaks do Cl2's molecular ions have?

The mass spectra of compounds with a single chlorine atom show two molecular ion peaks. This is because there are two isotopes of chlorine, 35Cl and 37Cl.

The molecular ion and fragment ions will both have peaks in the mass spectrum. When a mass spectrum is interpreted, a specific molecule can be located, confirmed, or its quantity can be calculated. the base summit of a mass spectrum's tallest (strongest) peak, caused by the ion with the highest relative abundance

To learn more about chlorine atom use:

brainly.com/question/30861877

#SPJ1

Five is the total number of peaks due to singly charged ions in the complete mass spectrum of chlorine, Cl2.

How many peaks do 's molecular ions have?

The mass spectra of compounds with a single chlorine atom show two molecular ion peaks. This is because there are two isotopes of chlorine, 35Cl and 37Cl.

The molecular ion and fragment ions will both have peaks in the mass spectrum. When a mass spectrum is interpreted, a specific molecule can be located, confirmed, or its quantity can be calculated. the base summit of a mass spectrum's tallest (strongest) peak, caused by the ion with the highest relative abundance

To learn more about chlorine atom use:

brainly.com/question/30861877

#SPJ1

1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5​

Answers

1. The IUPAC name of N is nitrogen.

2. Nitrogen dioxide

3.The IUPAC name of O is oxygen

4.The IUPAC name of OH is hydroxyl.

The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.

IUPAC names for the given compounds are:1.1. N: Nitrogen

The IUPAC name of N is nitrogen.

It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide

Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.

The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen

Explanation: The IUPAC name of O is oxygen.

It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.

X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.

Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.

It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.

for more question on electronic configuration

https://brainly.com/question/26084288

#SPJ8

Note: The complete question is given below

Provide the IUPAC names for the following compounds:

CH3CH2CH(CH3)CH2CH2CH2CH3

C6H5CH(CH3)2

H2NCH2CH2CH2CH2CH2NH2

CH3CH2CH2CH2CH2OH

CH3CH2CH2CHOHCH3

A 250.0-mL flask contains 0.2500 g of a volatile oxide of nitrogen. The pressure in the flask is 760.0 mmHg at 17.00°C. How many moles of gas are in the flask?

Answers

Answer:

0.0104 moles of gas in the flask.

Explanation:

To calculate the number of moles of gas in the flask, you can use the ideal gas law equation: PV = nRT. Where P is pressure, V is volume, n is the number of moles, R is the ideal gas constant and T is temperature.

First, you need to convert the pressure from mmHg to atm and the temperature from Celsius to Kelvin. The pressure in atm is 760.0 mmHg / 760 mmHg/atm = 1 atm. The temperature in Kelvin is 17.00°C + 273.15 = 290.15 K.

Next, you need to convert the volume from mL to L. The volume in L is 250.0 mL / 1000 mL/L = 0.2500 L.

Now you can plug all the values into the ideal gas law equation and solve for n: (1 atm)(0.2500 L) = n(0.08206 L·atm/mol·K)(290.15 K). Solving for n gives n = 0.0104 mol.

So there are approximately 0.0104 moles of gas in the flask.

Scientists have shown that in our solar system, the planets orbit the sun. Which of the following BEST explains why the planets orbit the sun? A. The sun is larger in size and has a greater mass than each of the planets. B. The sun is smaller in size and has a greater mass than each of the planets. C. The sun is larger in size and has a smaller mass than each of the planets. D. The sun is smaller in size and has a smaller mass than each of the planets.

Answers

Answer:

A

Explanation:

The sun is larger than the planets in our solar system and has far more mass and gravity than the planets.

What is true of a Lewis base?
A. A Lewis base donates electron pairs.
B. A Lewis base donates H* ions.
C. A Lewis base donates a salt in solution.
D. A Lewis base donates OH ions.

Answers

The statement that is true of a Lewis base is that a Lewis base donates electron pairs (option A).

What is a Lewis base and acid?

A Lewis base is any nucleophylic compound that can donate a pair of electrons and form a coordinate covalent bond.

On the other hand, a Lewis acid is any electrophylic compound that can accept a pair of electrons and form a coordinate covalent bond.

This means that a Lewis base can donate a pair of electrons to a Lewis acid to form a product containing a coordinate covalent bond. This product is also referred to as a Lewis adduct.

Therefore, option A is correct about Lewis base

Learn more about Lewis base at: https://brainly.com/question/24076507

#SPJ1

Photoelectric effect will occur only if frequency of light striking an electron in a metal is above a certain threshold frequenci

Answers

The statement is correct. The photoelectric effect refers to the phenomenon where electrons are ejected from the surface of a material when it is exposed to light. The frequency of light striking an electron in a metal must be above the threshold frequency in order for the photoelectric effect to occur.

The statement is correct. The photoelectric effect refers to the phenomenon where electrons are ejected from the surface of a material when it is exposed to light. However, for the photoelectric effect to occur, the frequency of the incident light must be above a certain threshold frequency.

The threshold frequency is the minimum frequency of light required to dislodge electrons from the material. Below this threshold frequency, regardless of the intensity or duration of the light, no electrons will be emitted.

This behavior can be explained by the particle-like nature of light, where light is composed of discrete packets of energy called photons. The energy of a photon is directly proportional to its frequency. Only photons with energy greater than or equal to the binding energy of the electrons in the material can dislodge them.

Therefore, the frequency of light striking an electron in a metal must be above the threshold frequency in order for the photoelectric effect to occur.

For more question on photoelectric

https://brainly.com/question/1458544

#SPJ8

Other Questions
In rabbits, spotted coat ( S) is dominant to solid color ( s) and black ( B) is dominant to brown ( b).A true-breeding black spotted rabbit is mated to a true-breeding brown solid rabbit to produce a heterozygous F 1 generation. Two F 1 individuals are mated, and you do not see a 9:3:3:1 (black spotted: black solid: brown spotted: brown solid) ratio of offspring, but instead see that almost all offspring are a non-recombinant phenotype. This tells you that On awaking, my first thought was to observe the intensity of the light. I was possessed with an apprehension lest the electric light should grow dim, or fail altogether. But there seemed no reason to fear. The shadow of the raft was clearly outlined upon the surface of the waves. Truly this sea is of infinite width. It must be as wide as the Mediterranean or the Atlantic--and why not? My uncle took soundings several times. He tied the heaviest of our pickaxes to a long rope which he let down two hundred fathoms. No bottom yet; and we had some difficulty in hauling up our plummet. But when the pick was shipped again, Hans pointed out on its surface deep prints as if it had been violently compressed between two hard bodies. I looked at the hunter. "Tander," said he. I could not understand him, and turned to my uncle who was entirely absorbed in his calculations. I had rather not disturb him while he is quiet. I return to the Icelander. He by a snapping motion of his jaws conveys his ideas to me. "Teeth!" I cried, considering the iron bar with more attention. Yes, indeed, those are the marks of teeth imprinted upon the metal! The jaws which they arm must be possessed of amazing strength. Is there some monster beneath us belonging to the extinct races, more voracious than the shark, more fearful in vastness than the whale? I could not take my eyes off this indented iron bar. Surely will my last night's dream be realized? These thoughts agitated me all day, and my imagination scarcely calmed down after several hours' sleep. What effect does the word infinite have on the readers understanding of the events in the plot? the nurse is evaluating the complete blood count of a 7-year-old child with a suspected hematological disorder. which finding is associated with an elevated mean corpuscular volume (mcv)? Find a vector parameterization for the line passing through the origin and perpendicular to the xz-plane? (Use f for the parameterized variable.) In Northern California, Oceana's scientists tested 89samples of fish labeled as snapper, and 38 came backas rockfish. What's the experimental probability of buyingsnapper mislabeled as rockfish? which statement best explains the privileges and immunities clause of article iv of the constitution? brainly question.5. People who want to maintain their weight should strive for their caloricintake tothe number of calories they burn in a day.A. be doubleB. be less thanC. exceedD. equalMark for review (Will be highlighted on the review page)>Review My Answers PLEASE HELP. FIND THE DOMAIN. WILL MARK BRAINLIEST. Assume that the situation can be expressed as a linear cost function Find the cost function in this case Marginal cost $50, 140 items cost $9500 to produce. The linear cost function is C(x)=0Previous question heres The 2nd photo of question 4 That features The 4th paragraph A student designed a flag for the school's Gaming Club. The design is rectangular with vertices at (3, 7), (11, 9), and (3, 9). Find the missing vertex and the area of the flag in square inches? The missing vertex is (9, 7) with an area of 16 in2. The missing vertex is (7, 11) with an area of 16 in2. The missing vertex is (9, 11) with an area of 128 in2. The missing vertex is (11, 7) with an area of 128 in2 Find each unit rate. Round answers to hundreds3) $57 for 6 hours of work The statement that the united states has an unemployment rate that is too high is a? Which are the very small particles that make up matter? The astrometry technique is useful in finding the _______________________ . (select all that apply) Aaron and Boone are splitting up the number of apples they picked the number each has can be described in the equation b+2=2a Which statement correctly describes the relationship between a and b in the equation A. twice a is 2 more than bB. twice b is 2 more than aC. twice a is 2 less than b D. twice b is 2 less than a Equity investors in a private company usually plan to realize a return on their investment by selling their stock when that company is acquired by another firm or sold in the public in a public offering....TRUE OR FALSE?????? Chipwich Summer Camp surveyed 100 campers to determine which lake activity was their favorite. The results are given in the table.Lake Activity Number of CampersKayaking 15Wakeboarding 11Windsurfing 7Waterskiing 13Paddleboarding 54If a circle graph was constructed from the results, which lake activity has a central angle of 46.8? Kayaking Wakeboarding Waterskiing Paddleboarding Someone Please help with precalc 1. Let A = (-4,0), B = (0,6), and C = (6.0). (a) Find equations for the three medians of triangle ABC. (b) Show that the three medians are concurrent, by finding coordinates for their common point. The point of concurrence is called the centroid of triangle ABC. 2. How large a square can be put inside a right triangle whose legs are 5 cm and 12 cm? 3. Robin is mowing a rectangular field that measures 24 yards by 32 yards, by pushing the mower around and around the outside of the plot. This creates a widening border that surrounds the unmowed grass in the center. During a brief rest, Robin wonders whether the job is half done yet. How wide is the uniform mowed border when Robin is half done? 4. Triangle ABC is isosceles, with AB = BC, and angle BAC is 56 degrees. Find the remaining two angles of this triangle. 5. Let A = (0,0), B = (4,3), C = (2, 4), P = (0,4), and Q = (-2, 4). Decide whether angles BAC and PAQ are congruent, and give your reasons.