how to calculate 100 ton/h to kmol/h​

Answers

Answer 1

You just need to calculate the following to go from kg/hour to kmol/s: For instance, 1 kmol/h should represent 36 kg with 1 kg/s should equal 1/36 kmol/h if there was 3 kmol in 1 kilogram and 12 seconds in 1 hour.

Is mol the same as KMOL?

1000 moles make up one kilomole. 1 Mole: Denotes the quantity of a chemical compound that has the same number of atoms as there are in Twelve grams of natural carbon-12. 103 moles are equivalent to one kilogram, or one kilomole, in the SI system of measurement (metrology).

A Kmol contains how many mmol?

mmol↔kmol 1000000 mmol make up 1 kmol.

To know more about kmol visit:

https://brainly.com/question/13346207

#SPJ1


Related Questions

You have two solutions of chemical A. To determine which has the highest concentration of A (molarity), which of the following must you know (there may be more than one answer)?a. the mass in grams of A in each solutionb. the molar mass of Ac. the volume of water added to each solutiond. the total volume of the solution

Answers

Answer:

a, b and c

Explanation:

To calculate molarity the number of moles and volume in dm3 is needed. So with the mass and molar mass the number of moles can be gotten and hence the molarity when dividing the number of moles by the volume in dm3.

During complete oxidation of the fatty acid CH3(CH2)14COOH, ________ molecules of acetyl-CoA are produced, and the fatty acid goes through the β-oxidation cycle ________ times

Answers

Answer:

During complete oxidation of the fatty acid CH3(CH2)14COOH, eight molecules of acetyl-CoA are produced, and the fatty acid goes through the β-oxidation cycle seven times.

Explanation:

In the β-oxidation of fatty acids, an acetyl-CoA molecule is removed from the fatty acid chain after every β-oxidation cycle that the fatty acid undergo, leaving behind a fatty acyl-CoA molecule shortened by two cabon atoms..

The removal of the acetyl-CoA molecule starts from the carboxyl end and shortens the fatty acid molecule by two carbon units. Successive β-oxidation cycles results in the complete oxidaton of the fatty acid molecle to acetyl -CoA molecules.

The compound CH3(CH2)14COOH, is a 16-carbon saturated fatty acid molecule known as palmitic acid.. It undergoes seven passes through the β-oxidation cycle to yield eight molecules of acetyl-CoA with each cycle yielding an acetyl-CoA molecule and a fatty acyl-CoA shortened by two carbon atoms. Finally, the seventh step yields two acetyl-CoA molecules.

During complete oxidation of CH3(CH2)14COOH, eight (8) molecules of acetyl-CoA are produced, and the fatty acid goes through the β-oxidation cycle seven (7) times.

Cellular respiration refers to a series of metabolic reactions by which aerobic cells use the energy stored in the chemical bonds of foods and oxygen to produce ATP and carbon dioxide.

Cellular respiration has three stages: glycolysis, the Krebs cycle  (also called TCA or tricarboxylic acid cycle) and oxidative phosphorylation.

During the TCA cycle, a fatty acid containing a hydrocarbon tail of N atoms of carbons undergoes an amount of (N/2)−1 rounds of β-oxidation to be oxidized.

Palmitic acid [chemical formula: CH3(CH2)14COOH] is a fatty acid with 16 carbon atoms in which 7 successive rounds of oxidation must take place to produce 8 acetyl-CoA molecules.

In conclusion, during complete oxidation of CH3(CH2)14COOH, eight (8) molecules of acetyl-CoA are produced, and the fatty acid goes through the β-oxidation cycle seven (7) times.

Learn more in:

https://brainly.com/question/13254687

When 7.524 is rounded to 3 sig figs it will be

Answers

When 7.524 is rounded to 3 significant figures, it will be 7.52.

The process of changing a number to a nearby number with fewer significant digits is known as rounding.

Rounding can be done to the nearest integer, the nearest tenth, the nearest hundredth, and so on.

Here are some pointers on rounding numbers to a certain number of significant digits:If the digit following the last significant digit is less than 5, simply drop it and all following digits.

(round down)For example, 2.832 rounded to two significant digits is 2.8 since the 3 is followed by a 2 which is less than 5.

If the digit following the last significant digit is greater than 5, add 1 to the last significant digit, then drop all of the digits that follow it.

(round up)For example, 4.673 rounded to two significant digits is 4.7 since the 3 is followed by a 7 which is greater than 5.

If the digit following the last significant digit is exactly 5, the preceding digit is odd, and no other digits follow, increase the last significant digit by 1.

If the digit following the last significant digit is exactly 5, the preceding digit is even, and no other digits follow, simply leave the last significant digit alone.

For example, 2.875 rounded to two significant digits is 2.9 since the 5 is followed by an odd number, which means that the 8 should be rounded up, while 2.765 rounded to two significant digits is 2.8 since the 5 is followed by an even number, which means that the 6 should be left alone.

For more such questions on rounding

https://brainly.com/question/17396482

#SPJ8

please help me out with this. I was told me to show how you crossed something to get the answer i dont know but anything helps thank you ​

please help me out with this. I was told me to show how you crossed something to get the answer i dont

Answers

Here are the chemical formulas for the given ionic compounds:

Rubidium fluoride: RbFAluminum chloride: AlCl₃Calcium oxide: CaOSilver nitrate: AgNO₃Barium acetate: Ba(C₂H₃O₂)₂Nickel(II) chloride: NiCl₂Ammonium bromide: NH4BrLithium carbonate: Li₂CO₃Sodium sulfite: Na₂SO₃Mercury(I) phosphite: Hg₃(PO₃)₂Chromium(II) dichromate: Cr₂(Cr₂O₇)₃

How to convert name to formula?

To convert Name to Formula:

Identify the cation and anion in the compound. The cation is the positively charged ion, and the anion is the negatively charged ion.Determine the charges of the cation and anion using the periodic table. You can find the charge of the cation based on its group number, while the charge of the anion is determined by its position in the periodic table and the number of electrons it gains or loses.Balance the charges of the cation and anion so that they add up to zero.Write the chemical formula by writing the symbol of the cation followed by the symbol of the anion, with subscripts indicating the number of each ion needed to balance the charges.

Learn more on chemical formulas here: https://brainly.com/question/11574373

#SPJ1

Rank the relative nucleophilicity of the indicated species in ethanol. CH3OH CH3S- CH3COOH CH3O- CH3COO-

Answers

From highest to lowest, the relative nucleophilicity of ethanol is CH3O-, CH3S-, CH3COO-, CH3COOH, and CH3OH. In a substitution process, a nucleophile's capacity to oust a leaving group is referred to as nucleophilicity.

The capacity of a species to give electrons to an electrophilic centre determines its nucleophilicity. The ranking order of the given species' relative nucleophilicity in ethanol is as follows:

CH3O- (methyl oxide ion) (methyl oxide ion)

CH3S- (methyl sulphide ion) (methyl sulphide ion)

CH3COO- (methyl acetate ion) (methyl acetate ion)

CH3COOH (methyl acetic acid) (methyl acetic acid)

CH3OH (methanol) (methanol)

The most nucleophilic species among them is the methyl oxide ion (CH3O-), which can readily give electrons thanks to its negatively charged oxygen atom. Due to oxygen's strong electronegativity, the carboxylate ion (CH3COO-), which is similarly negatively charged, is less nucleophilic than CH3O- and CH3S-. Methyl acetic acid (CH3COOH) is less nucleophilic and has a less acidic character than the negatively charged species. The least nucleophilic species is neutrally charged methanol (CH3OH).

learn more about nucleophilic here:

https://brainly.com/question/29563504

#SPJ4

Please help!

Hydrochloric acid is a strong acid whereas acetic acid is a weak acid.
i. How would the pH of a 0.01M acetic acid compare to pH value for 0.01M HCl?
(Explain in your own words without calculating)

ii. Calculate the pH of a 0.01 M acetic acid.

Please help!Hydrochloric acid is a strong acid whereas acetic acid is a weak acid.i. How would the pH

Answers

Because HCl is a stronger acid than acetic acid, the pH of 0.01M acetic acid has greater value than the pH of 0.01M HCl. 2.88 is the  pH of a 0.01 M acetic acid.

What is acid?

Any hydrogen that comprises a material capable of giving a proton (a hydrogen ion) to another chemical is defined as acid. A base is indeed a molecule or ion that can receive a hydronium ion from just an acid.

1)Because HCl is a stronger acid than acetic acid, the pH of 0.01M acetic acid has greater value than the pH of 0.01M HCl. The pH value of stronger acid is lower.

2)CH\(_3\)COOH + H\(_2\)O  ⇄ CH\(_3\)COO⁻+  H\(_3\)O⁺

 0.01             0               0

 -x              +x                +x

 0.01-x           +x        +x

Ka=[ CH\(_3\)COO⁻][H\(_3\)O⁺]/[CH\(_3\)COOH]

1.8×10⁻⁵ = [x][x ]/[  0.01-x ]

x=1.34×10⁻³

pH = -log[H⁺]

     =  -log[1.34×10⁻³]

     =2.88

Therefore, because HCl is a stronger acid than acetic acid, the pH of 0.01M acetic acid has greater value than the pH of 0.01M HCl. 2.88 is the   pH of a 0.01 M acetic acid.

To learn more about acid, here:

https://brainly.com/question/29775793

#SPJ9

Part C In this experiment, you’ll perform three trials. Follow these steps to proceed with the first trial: Fill one of the two bowls with very warm water, between 45°C and 49°C (113°F and 120°F). Use the thermometer to measure the temperature of the water in degrees Celsius, and record it in the provided table. Stay safe! To avoid burns, do not use water hotter than 49°C. Fill the other bowl with ice water. The temperature of the water in this bowl should be between 5°C and 10°C (41°F and 50°F). Use the thermometer to measure the temperature of the water in degrees Celsius, and record it in the table. With the bottle uncapped, hold the bottle in the bowl of warm water. The bottle should be mostly under water, but the mouth of the bottle should be above the water so that water doesn’t enter the bottle. Hold the bottle in this position for three minutes, using the stopwatch to track the time. The air inside the bottle will come to the same temperature as the water in the bowl. Cap the bottle tightly, and then remove it from the warm water.

Answers

You will perform the first test in Part C of the experiment to find out how the air inside the bottle changes in temperature when exposed to different temperatures of water.

To perform the operation, fill a bowl with very hot water (between 45° and 49°C) and another bowl with ice water (between 5° and 10°C). A thermometer is used to gauge the temperature of both water sources, which is then documented in the table provided. The uncapped bottle is placed in hot water, being careful to keep the mouth above the surface to prevent water from entering it.

The bottle should be kept in this position for three minutes so that the air can adjust to the temperature of the hot water. After the allotted time has elapsed the bottle is securely closed and taken out of the hot water. You can complete the first test of the experiment by following these instructions and gathering information about the initial temperature, the equilibrium temperature of the air inside the bottle, and the change in temperature of the air when it comes in contact with the hot water. These observations will be used to investigate how variations in air and water temperatures are related to each other.

Learn more about temperature, here:

https://brainly.com/question/7510619

#SPJ1

2 C2H2(g) + 5 O2(g) yields 4 CO2 (g) + H2O (g) How many grams of water can be produced by the reaction of 4.8 moles of C2 H2 with 14.8 moles of O2 if the percentage yield is 75% how many grams of water was produced

Answers

Taking into account definition of percent yield, the amount of water produced is 32.4 grams.  

Reaction stoichiometry

In first place, the balanced reaction is:

2 C₂H₂ + 5 O₂ → 4 CO₂ + H₂O

By reaction stoichiometry (that is, the relationship between the amount of reagents and products in a chemical reaction), the following amounts of moles of each compound participate in the reaction:

C₂H₂: 2 moles O₂: 5 molesCO₂: 4 molesH₂O: 1 mole

Limiting reagent

The limiting reagent is one that is consumed first in its entirety, determining the amount of product in the reaction. When the limiting reagent is finished, the chemical reaction will stop.

Limiting reagent in this case

To determine the limiting reagent, it is possible to use a simple rule of three as follows: if by stoichiometry 5 moles of O₂ reacts with 2 moles of C₂H₂, 14.8 moles of O₂ reacts with how many moles of C₂H₂?

\(moles of C_{2} H_{2} =\frac{14.8 moles of O_{2}x 2 moles of C_{2} H_{2}}{5 moles of O_{2}}\)

moles of C₂H₂= 5.92 moles

But 5.92 moles of C₂H₂ are not available, 4.8 moles are available. Since you have less moles than you need to react with 14.8 moles of O₂, C₂H₂ will be the limiting reagent.

Percent yield

The percent yield is the ratio of the actual return to the theoretical return expressed as a percentage and it is calculated as the experimental yield divided by the theoretical yield multiplied by 100%:

percent yield= (actual yield÷ theorical yield)× 100%

where the theoretical yield is the amount of product acquired through the complete conversion of all reagents in the final product, that is, it is the maximum amount of product that could be formed from the given amounts of reagents.

Theorical mass of H₂O formed

Considering the limiting reagent, the following rule of three can be applied: if by reaction stoichiometry 2 moles of C₂H₂ form 1 mole of H₂O, 4.8 moles of C₂H₂ form how many moles of H₂O?

\(moles of H_{2} O=\frac{4.8 moles of C_{2} H_{2} x1 mole ofH_{2} O }{2moles of C_{2} H_{2}}\)

moles of H₂O= 2.4 moles

The molar mass of water is 18 g/mole. Then, the theorical mass of water formed can be calculated as: 2.4 moles ×18 g/mole= 43.2 grams

Actual mass of H₂O formed

In this case, you know:

percent yield= 75%actual yield= ?theorical yield= 43.2 grams

Replacing in the definition of percent yields:

75%= (actual yield÷ 43.2 g)× 100%

Solving:

75%÷100%= actual yield÷ 43.2 g

0.75= actual yield÷ 43.2 g

0.75× 43.2 g= actual yield

32.4 g= actual yield

In summary, the amount of water produced is 32.4 grams.  

Learn more about

the reaction stoichiometry:

brainly.com/question/24741074

brainly.com/question/24653699

percent yield:

brainly.com/question/14408642

#SPJ1

I NEED HELP ASAP!!!!



ITS DUE IN A FEW MINUTES!!!!

I NEED HELP ASAP!!!!ITS DUE IN A FEW MINUTES!!!!

Answers

Answer:

The Sun and the planets were born from a cloud of gas and dust called the solar nebula 4.6 billion years ago. The collapse of the solar nebula was most likely triggered by a shock wave from a nearby supernova explosion. The Sun formed in the center, with the planets surrounding it in a thin disk.

Explanation:

A 300.0 mL quantity of hydrogen is collected over water at 19.5 C and a total atmospheric pressure of 750. mm Hg. The partial pressure of water at this temperature is 17.0 mm Hg

Answers

The partial pressure of hydrogen in the collected gas sample is 733.0 mm Hg (calculated by subtracting the partial pressure of water, 17.0 mm Hg, from the total atmospheric pressure, 750.0 mm Hg).

When a gas is collected over water, the presence of water vapor affects the total pressure observed. In this case, the total atmospheric pressure is given as 750.0 mm Hg, and the partial pressure of water vapor at 19.5°C is 17.0 mm Hg.

To determine the partial pressure of hydrogen, we need to subtract the partial pressure of water vapor from the total atmospheric pressure. Partial pressure refers to the pressure exerted by an individual gas component in a mixture. In this scenario, the collected gas is primarily hydrogen, with water vapor being the other component.

By subtracting the partial pressure of water vapor (17.0 mm Hg) from the total atmospheric pressure (750.0 mm Hg), we can find the partial pressure of hydrogen:

Partial pressure of hydrogen = Total atmospheric pressure - Partial pressure of water vapor

Partial pressure of hydrogen = 750.0 mm Hg - 17.0 mm Hg

Partial pressure of hydrogen = 733.0 mm Hg

Therefore, the partial pressure of hydrogen in the collected gas sample is 733.0 mm Hg.

Know more about hydrogen here:

https://brainly.com/question/24433860

#SPJ8

Magnesium hydroxide reacts with chlorine to form magnesium chloride,
magnesium chlorate and water. How many grams of magnesium hydroxide is
needed to yield 8.00 moles of magnesium chlorate?
77.8 g Mg(OH)2
9178.1 g Mg(OH)2
2799.6 g Mg(OH)2
.823 g Mg(OH)2
How many grams of sodium sulfato pro

Answers

The grams of magnesium hydroxide needed to yield 8.00 moles of magnesium chlorate is approximately 466.64 g. None of the options provided match the calculated value of 466.64 g.

To determine the grams of magnesium hydroxide (Mg(OH)2) needed to yield 8.00 moles of magnesium chlorate (Mg(ClO3)2), we need to consider the balanced chemical equation for the reaction between magnesium hydroxide and chlorine.

The balanced equation is as follows:

2 Mg(OH)2 + 6 Cl2 → 2 Mg(ClO3)2 + 2 H2O

From the balanced equation, we can see that 2 moles of Mg(OH)2 react with 6 moles of Cl2 to produce 2 moles of Mg(ClO3)2.

Therefore, the stoichiometric ratio is 2 moles of Mg(OH)2 : 2 moles of Mg(ClO3)2.

To calculate the grams of Mg(OH)2 needed, we can use the stoichiometric ratio and the given moles of Mg(ClO3)2.

Given:

Moles of Mg(ClO3)2 = 8.00 moles

Using the stoichiometric ratio, we have:

8.00 moles Mg(ClO3)2 × (2 moles Mg(OH)2 / 2 moles Mg(ClO3)2) = 8.00 moles Mg(OH)2

To convert moles to grams, we need to multiply by the molar mass of Mg(OH)2.

The molar mass of Mg(OH)2 = (24.31 g/mol) + (2 * 16.00 g/mol) = 58.33 g/mol

Grams of Mg(OH)2 = 8.00 moles Mg(OH)2 × 58.33 g/mol = 466.64 g

Therefore, the grams of magnesium hydroxide needed to yield 8.00 moles of magnesium chlorate is approximately 466.64 g.

For  more such questions on magnesium chlorate

https://brainly.com/question/12358640

#SPJ11

What mass of water is formed in the reaction of 4.16g H with excess oxygen gas.

Answers

Answer:

Explanation:

Start with a balanced equation.

2H2 + O2 → 2H2O

Calculate mole H2 using the formula: n = m/M, where:

n = mole

m = mass (g)

M = molar mass (g/mol)

Calculate molar mass of H2.

M H2 = 2 × 1.008 g/mol = 2.016 g/mol

Calculate moles H2.

n H2 = 4.16 g H2/2.016 g/mol = 2.063 mol H2

Calculate moles H2O by multiplying moles H2 by the mole ratio between H2O and H2 from the balanced equation, so that moles H2 cancel.

2.063 mol H2 × (2 mol H2O/2 mol H2) = 2.063 mol H2O

The mass of water will be calculated by rearranging the n = m/M formula to isolate m;

m = n × M

Calculate the molar mass H2O.

M H2O = (2 × 1.008 g/mol) + (1 × 15.999 g/mol) = 18.015 g/mol

Calculate the mass H2O.

m = n × M = 2.063 mol H2O × 18.015 g/mol = 37.2 g H2O

4.16 g H2 with excess O2 will produce 37.2 g H2O.

8. Match the following:
1.Warp
2. Retting
3.Ginning
4.Weft
a. Removal of gunny matter from the stem of a flax or jute plant by bacterial action in stagnant water.
b. The length wise yarn in the loom.
c. The cross wise yarn in the loom. d.. Removal of seeds from cotton​

Answers

Answer:

c

Explanation:



Which two chemical equations model double-replacement reactions?
A. HC2H2O2 + LIOH - LIC H302 + H20
B. CH4 + 202 - 2H2O + CO2
C. AgNO3 + LICI - AgCl + LINO,
D. 2Na+ MgCl2
2NaCl + Mg

Answers

Answer:

C. AgNO3 + LICI - AgCl + LINO3

Explanation:

Here the chemical equation for double displacement reaction is

AgNO3 + LICI - AgCl + LINO3

The reaction in which two compounds react together to form two other compounds by mutual exchange of their ions is called double displacement reaction.

Hope it will help :)

A chemical equation is a symbolic representation of a chemical reaction in terms of the symbols and formulae. Among the given equations, AgNO₃ + LICI  → AgCl + LINO₃. The correct option is C.

What is a double displacement reaction?

A double displacement reaction is a kind of reaction in which one part of the reactant is replaced by another part of the reactant. In this reaction the positive and negative ions of two ionic compounds exchange places to form two new compounds.

The double displacement reaction is generally found between the substances in aqueous solution. A precipitate formation occurs in this reaction where the cations of one reactant combines with the anions of the other reactant to form insoluble compound.

The general form of the double displacement reaction is:

AB + CD → AD + CB

Here the double displacement reaction is:

AgNO₃ + LICI  → AgCl + LINO₃

Thus the correct option is C.

To know more about double displacement reaction, visit;

https://brainly.com/question/20038776

#SPJ5

what is your experience about water pollution​

Answers

Answer:

water pollution is a process in which water gets polluted due to discharge of city sewage and industrial waste. I was suffering through the water born disease when I drank the contaminated water. The sources of water becomes dirty. It makes environment unbalanced. People suffer from different water born disease when they drink polluted water.

What is the new temperature when 10 L at 5 K is compressed to 4.00 L?25 K2 K0.5 K20 K

Answers

We use Charles's law to solve the exercise

Volume and temperature have a directly proportional relationship when pressure is constant.

\(\text{V}_1\text{T}_2\text{ }=\text{ V}_2\text{ T}_1\)

Where

V1=10L

T1=5K

V2=4L

Solving for T2

\(\text{ T}_2\text{ = }\frac{\text{ V}_2\text{ T}_1}{\text{ V}_1}=\frac{4\text{ L }\times\text{ 5K}}{10\text{ L}}=2\text{ K}\)

The answer is 2K

Zoe left her water bottle capped and in her bedroom. She came back some time later to realize that the bottle was “sweating” and left a ring of liquid on her nightstand


Explain thoroughly the science behind why Zoe’s water bottle is sweating

Answers

Answer:

Condensation

Explanation:

Zoe is quite keen to have noticed what we call condensation. Air contains many components, one of those being water vapor. Like how sugar is soluble in water, water can be said to be "soluble" in air. Water will evaporate into the air to a certain extent. The higher the temperature of the air, the more water the air can hold. If the air has more water that it can hold (potentially because of a temperature decrease), the extra water will come out of the air. Zoe's water bottle was cold, and because the air around Zoe's bottle had cooled down, the air can not hold as much water as it could when it was warm, so the air deposited the extra water in the form of liquid water onto the bottle, giving the illusion that her bottle was sweating.


4- The standard potential of cell: Sn/Sn²+||Cr³+/Cr is −0.60V.what is the standard
reduction potential of the Cr³+/Crelectrode? Es = -0.14V
Sn²+
(b) +0.74V
(c) -0.88V
(d) -0.74V
(a) +0.88V

Answers

The standard reduction potential of the Cr³+/Cr electrode is -0.46V. None of the option is correct.

To determine the standard reduction potential of the Cr³+/Cr electrode, we can use the Nernst equation, which relates the standard reduction potential to the cell potential under non-standard conditions. The Nernst equation is given by:

E = E° - (0.0592/n) * log(Q)

where E is the cell potential, E° is the standard reduction potential, n is the number of electrons transferred in the half-reaction, and Q is the reaction quotient.

In this case, we have the standard potential of the cell as −0.60V. We know that the standard reduction potential of the Sn/Sn²+ electrode is -0.14V. Therefore, the reduction potential of the Cr³+/Cr electrode can be calculated as:

E = -0.60V - (-0.14V)

E = -0.60V + 0.14V

E = -0.46V

Therefore, the standard reduction potential of the Cr³+/Cr electrode is -0.46V.

For more such question on standard reduction potential visit;

https://brainly.com/question/31482299

#SPJ8

Amanda is sending away hair samples to be tested for DNA. What is the BEST sample she can send to the lab for testing?

A.
hair from the telogen stage

B.
hair that has naturally shed

C.
hair with exposed follicular tissue

D.
hair that has been dyed

Answers

The sample of hair with exposed follicular tissue is the BEST sample she can send to the lab for DNA testing (Option C).

What is a DNA sample?

A DNA sample is any tissue that can be used to extract DNA and therefore it is multipurpose because it can be used to identify an organism, identify polymorphisms, find gene variants associated with a phenotype of interest., etc.

Therefore, with this data, we can see that the sample of a follicular tissue contains DNA which can be used for different purposes such as the identification of an individual.

Learn more about the DNA samples here:

https://brainly.com/question/17133167

#SPJ1

Write the equilibrium expression for the following reaction. CaO(s) + CH₄(g) + 2H₂O(g) —> CaCO₃(s) + 4H₂(g)

Answers

The equilibrium expression can be written as follows:

K = [CaCO₃] × [H₂]⁴

------------------

[CaO] × [CH₄] × [H₂O]²

In this equilibrium expression, the square brackets represent the concentrations of the species involved in the reaction, and the coefficients of the balanced equation indicate the stoichiometric coefficients of the corresponding species.

The concentration of a pure solid (CaCO₃ in this case) is not included in the equilibrium expression, as it remains constant throughout the reaction.

The equilibrium constant (K) represents the ratio of the product concentrations to the reactant concentrations at equilibrium, each raised to the power of their respective stoichiometric coefficients. The specific values of these concentrations depend on the initial conditions, and K remains constant as long as the temperature is unchanged.

It is important to note that the equilibrium constant expression is written based on the balanced chemical equation. The stoichiometric coefficients determine the relationship between the concentrations of reactants and products, allowing us to express the equilibrium state quantitatively using the equilibrium expression.

For more such question on equilibrium. visit :

https://brainly.com/question/30843966

#SPJ8

What is the vapor pressure of SiCl4
in mmHg
at 33.0 ∘C
? The vapor pressure of SiCl4
is 100 mmHg
at 5.4 ∘C
, and ΔHvap
= 30.2 kJ/mol
.

Answers

The vapor pressure of the SiCl₄ in the mmHg at the 33.0 °C is the 312 mmHg.

The Clausius - Clapeyron equation is as :

ln ( P₂ / P₁ ) = ΔHvap / R ( 1 / T₁ - 1 / T₂ )

P₂ = P₁eˣ

Where,

The temperature, T₁  = 5.4 °C = 278.55 K

The temperature, T₂  = 33.0 °C= 306 K

The pressure, P₁ = 100 mmHg

ΔHvap is the heat of the vaporization = 30.2 kJ /mol = 30200 J/mol

The gas constant, R = 8.314 J / mol K

x = ΔHvap / R ( 1 / T₁ - 1 / T₂ )

x = 30200 / 8.314 ( 1/ 278.55 - 1/ 306 )

x = 1.05

P₂ = 100 \(e^{1.05}\)

P₂ = 312 mmHg

The vapor pressure of the  SiCl₄ is 312 mmHg.

To learn more about vapor pressure here

https://brainly.com/question/29659130

#SPJ1

What is the mass of 8.12 ×10^23

Answers

Answer:

59.3g

Explanation:

Mole = no. Molecules/6.02×10^23

Mole = (8.12×10^23)/(6.02×10^23)

Mole = 1.35mole

Molar mass of CO2 = 12+ 2(16)

Molar mass= 12 + 32= 44g/mol

Mole = mass/molar mass

Mass = Mole × molar mass

Mass = 1.35× 44

Mass= 59.35g

What is the mass of 8.12 10^23

For the reaction shown, find the limiting reactant for each of the initial quantities of reactants.
4Al(s) + 302(g) —> 2Al2O3(s)
Express your answer as a chemical formula.

1 mol Al; 1 mol O2
4 mol Al; 2.5 mol O2
12 mol Al; 10 mol O2
15.4 mol Al; 10.7 mol O2

Answers

Answer:

1 mol Al; 1 mol O2

Explanation:ol Al; 10 mol O2

15.4 mol Al; 10.7 mol O2

or the reaction shown, find the limiting reactant for each of the initial quantities of reactants.

4Al(s) + 302(g) —> 2Al2O3(s)

Express your answer aor the reaction shown, find the limiting reactant for each of the initial quantities of reactants.

4Al(s) + 302(g) —> 2Al2O3(s)

Express your answer as a chemical formula.

1 mol Al; 1 mol O2

4 mol Al; 2.5 mol O2

12 mol Al; 10 mol O2

15.4 mol Al; 10.7 mol O2

Hold on, our servers are swamped. Wait for your answer to fully load.s a chemical formula.

About how many harvests of bamboo can be collected during the time it takes to fully grow one pine tree?

Answers

Answer:

bamboo can grow 910 mm (36 in) within a 24-hour period,at a rate of almost 40 mm (1 1⁄2 in) an hour (a growth around 1 mm every 90 seconds, or 1 inch {2.54 centimeters} every 40 minutes).

Explanation:

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

When comparing a prokaryotic cell to a eukaryotic cell, an important difference is that the prokaryotic cell-
is simple, performing limited functions.
is relatively small in size and unorganized.
has its genetic information stored in the nucleus.
has no structures that allow it to store food.

Answers

a thermometer to measure the heat inside the cell.
a graduated cylinder to find the volume of the cell.
a triple-beam balance to find the mass of the cell.
a microscope to determine if the cell has a nucleus.

In the combustion of hydrogen gas, hydrogen reacts with oxygen from the air to form water vapor. hydrogen+oxygen⟶water

If you burn 46.2g of hydrogen and produce 413g of water, how much oxygen reacted?

mass of oxygen:

Answers

Answer:

ok, here is your answer

Explanation:

AI-generated answer

To find the mass of oxygen that reacted, we need to use the Law of Conservation of Mass, which states that in a chemical reaction, the mass of the reactants equals the mass of the products.

First, we need to find the number of moles of hydrogen that reacted:

Molar mass of hydrogen (H₂) = 2.016 g/mol

Number of moles of H₂ = mass/molar mass = 46.2 g/2.016 g/mol = 22.92 mol

Next, we need to use the balanced chemical equation to find the number of moles of water produced:

hydrogen + oxygen → water

2H₂ + O₂ → 2H₂O

From the equation, we can see that for every 2 moles of H₂, 1 mole of O₂ is required to produce 2 moles of H₂O. Therefore, the number of moles of O₂ required to produce 22.92 moles of H₂O is:

Number of moles of O₂ = 1/2 x 22.92 mol = 11.46 mol

Finally, we can find the mass of oxygen that reacted by using its molar mass:

Molar mass of oxygen (O₂) = 32.00 g/mol

Mass of oxygen = number of moles x molar mass = 11.46 mol x 32.00 g/mol = 366.72 g

Therefore, the mass of oxygen that reacted is 366.72 g.

mark me as brainliest

which element in period 3 has the greatest tendency to lose an electron?

Answers

The element in period 3 that has the greatest tendency to lose an electron is Sodium (Na)

Sodium is the first element in the period 3. In the periodic table, atomic size or atomic radius decreases from left to right.

We know that, higher the atomic radius higher the tendency to lose an electron by the element.  In addition to that, sodium has only one valence electron in their outermost orbitals which would be easily lost to attain a stable state.

Thus, Sodium (Na) with higher atomic radius in period 3 and one valence electron in their outermost orbitals would have the higher tendency to lose an electron.

To know more about Atomic size

https://brainly.com/question/1127028

#SPJ1

given 1 in=2.54cm how many centimeters are in an average hand (9.50)?

Answers

If an average hand is 9.50 inches, the number of centimeters in an average hand would be 24.035 centimeters.

Unit conversion

The problem here is about converting from one unit to another.

We have been given that: 1 in = 2.54 cm

We were also given that an average hand measured 9.50 inches long. The average length of hand would be the sum of the length of all the hands in the population and the total number of hands whose lengths were measured.

Thus:

If 1 in = 2.53 cm

  9.50 in = 9.50 x 2.53

              = 24.035 cm

Thus, if 9.50 inches is 24.035 centimeters, it means an average hand will also be 24.035 centimeters long.

More on unit conversion can be found here: https://brainly.com/question/19420601

#SPJ1

A thermally insulated system consists of 1.00 mol of a diatomic gas at 148 K and 2.00 mol of a solid at 178 K that are separated by a rigid insulating wall. Find the equilibrium temperature of the system after the insulating wall is removed, assuming that the gas obeys the ideal-gas law and that the solid obeys the Dulong-Petit law. HINT: the gas does no work during the expansion, so Qgas = AEint = nc', AT. K Submit

Answers

169.2K is the equilibrium temperature of the system after the insulating wall is removed.

What is equilibrium?

Generally speaking, a condition of equilibrium is one in which nothing is changing. A body in equilibrium won't undergo any energy exchanges, either positive or negative. Equilibrium is defined significantly differently in biology, physics, and chemistry.

Yet the underlying idea is the same. A body in balance will be least affected by outside influences. Even when external pressures are present, the opposing forces often have a balanced impact on the item under consideration.

for gas, n1=1mol

               T1= 148K

for solid,n2=2mol

            T2=178K

for conservation of energy, ΔQ= Qgas+ Qsolid=0

Q= CvΔT

0=Cvgas(Teql-148) + Cvsolid(Teq-178)

0= 5/2×1×R(Teql-148) + 3×2×R(Teq-178)

Tequi= 169.2K

Therefore, 169.2K is the equilibrium temperature of the system after the insulating wall is removed.

To learn more about equilibrium, here:

https://brainly.com/question/16989820

#SPJ1

Other Questions
please help. thanks :))) What is the y-intercept of a line that has a slope of -3 and passes through point (-5, 4)?-17-117 19 What is the value of x?2 units3 units5 units8 units 1. The author probably wrote this passage toconvince her audience to boycott the arts festival in protest.complain that she won't be able to afford to buy gifts at this year's fest.inform readers that the City Arts street fair is about to begin.Correct answer: express her opinion that excluding students from the festival is wrong2. Which sentence best reveals the author's attitude toward whale hunting? Today, whaling is strictly regulated by the International Whaling Commission (IWC), but some environmental groups believe that all whale hunting should be banned.They also think whale hunting is immoral because the methods used to kill whales are cruel and inflict intense suffering on the animals.Native peoples in Alaska and Siberia, where growing crops is not an option, rely on whale meat to feed themselves.correct answer: For every argument one side makes, the other side has a counter-argument, and this controversy is not likely to be resolved in the near future.3. Which of the following inferences is supported by the story?correct answer: Dr. Dillinger created the explosive device.Tess hid Dr. Dillinger from the vigilante.Tony is worried about his family's safety.Meeks was injured by the burning car.4. Which sentence from the story supports the inference that Detective Trueheart and Meeks have worked together before?"She tried breathing through her mouth as she walked over to the burnt car.""There was no point in maintaining formalities after all these years.""Did you bring those pictures of your new baby like you promised?"correct answer: "There is only one person with the technical knowledge to construct it."The author most likely organized this passage in chronological order tocorrect answer: show the progression of a sport over time.explain the decline in popularity of a sport.create a sense of suspense in the passage.Selecteddescribe the lives of wheelchair curling players. using concrete words that appeal to one of our five senses helps decrease your chances of the audience misunderstanding your message. group of answer choices true false What is a number that whenyou multiply it by 4 and add 5 tothe product, you get 7? The hardness of water is expressed as ppm of calcium carbonate (CaCO3). In a sample analysis of water from a spring, a hardness between 80 and 100ppm of CaCO3 was reported. What would be the equivalence of these values, expressed as a percentage of CaCO3? Discuss the input-process-output model as it relates to program development. Explain the purpose of each step and how that information is used in each step. What would be the impact on overall program performance if one of these steps was not included? What makes Python a good choice for crafting malicious scripts for an attack Given the formula y = -1/2x - 4, what is the slope and y-intercept of the graph? PLEASE HELP! Why did different flower morphologies develop throughout evolution? Match the given characteristics to the theories of motivation. humanistic theory of motivation arousal theory of motivation drive theory of motivation intrinsic theory of motivation when a person feels the need to inspire himself when a person realizes the importance of taking care of his family when a person feels hurt when he is rudely spoken to when a person feels the need to rest after an exhausting day at work Organizing is the process of grouping resources and activities efficiently and effectively toaccomplish an end result.(A) True(B) False What is an example of good communication? A. Deciding to ignore a mean comment directed at you B. Pretending like your feelings are not hurt so that your partner stays happy C. Asking your partner to clarify something you are unsure aboutone or the other es de lengua y literatura ayudaaaACTIVIDAD QUE SER EVALUADA COMO EXAMEN QUIMESTRALComo el objetivo del proyecto es comprender que trabajar por un mundo mejor, implica la prctica de derechos y obligaciones, promoviendo la igualdad, la equidad, la solidaridad, la comunicacin asertiva para una convivencia pacfica, vamos a producir un texto donde se evidencien las acciones o justificaciones necesarias para una convivencia armnica.Siga el proceso de la escritura.PLANIFICACIN Elija el tema del cual va a hablar: Cmo es para ti un mundo ms justo? y cmo podras contribuir a su construccin? Establezca la intencin comunicativa de su texto. A qu pblico va dirigido.. A travs de la lluvia de ideas genere una lista de ideas principales para que escriba su texto:REDACCIN. Organice y jerarquice las oraciones de la lluvia de ideas.. Escriba el primer borrador.REVISIN Revise la ortografa y la puntuacin Revise la coherencia y el orden lgico de las oraciones. Revise si su texto expresa lo que realmente pretenda manifestar Which part of the excerpt contains a paradox? . . . I know perfectly well whom she will place me next to . . . She will place me next Mary Farquhar, who always flirts . . . It is simply washing ones clean linen in public. Besides, now that I know you to be a confirmed Bunburyist . . . the balance in the prepaid insurance account, before adjustment at the end of the year, is $11,500. journalize the adjusting entry required under each of the following alterna- tives for determining the amount of the adjustment: (a) the amount of insurance ex- pired during the year is $8,750; (b) the amount of unexpired insurance applicable to future periods is $2,750. Read the two passages. What can you conclude about James in the second passage based on the biblical context from the first passage? A. James was very good in academic studies but spent little time on other interests. B. James was adopted by Mr. E. Warring when he was young. C. James felt burdened by the unrealistic expectations set by his father. What is Orwell's main message? CAN SOMEONE PLS HELP WITHT HSI ASAP