How much Leila pays in total for the model

Choose 2

How Much Leila Pays In Total For The Model Choose 2

Answers

Answer 1
the answers are A and C

Related Questions

A parabola has the equation y = x2 - 10x + 28. What are the coordinates of its vertex?h Enter your answer in the box with parenthesis but no spaces in the form

Answers

We have the parabola:

\(y=x^2-10x+28\)

There is one expression that gives you the x-coordinate of the vertex:

\(-\frac{b}{2a}\)

We know that the standard form of a quadratic function is: ax^2+bx+c, then:

\(-\frac{(-10)}{2(1)}=\frac{10}{2}=5\)

Now, having x=5 we can substitute it on the original equation:

\(\begin{gathered} y=(5)^2-10(5)+28 \\ y=25-50+28 \\ y=3 \end{gathered}\)

The vertex of the parabola is (5, 3)

Which inequality is equivalent to the given inequality? -4(x+7)<3(x-2)

Answers

Answer:2.744

Step-by-step explanation:

The equivalent inequality is: x > -22/7.

What is inequality?

In mathematics, inequalities specify the connection between two non-equal numbers. Equal does not imply inequality. Typically, we use the "not equal sign ()" to indicate that two values are not equal. But several inequalities are utilised to compare the numbers, whether it is less than or higher than.

To solve for the inequality, we can start by distributing the coefficients:

-4(x+7) < 3(x-2)

-4x - 28 < 3x - 6

We can simplify this inequality by combining like terms:

-7x < 22

To solve for x, we divide both sides by -7, remembering to flip the direction of the inequality since we are dividing by a negative number:

x > -22/7

Therefore, the equivalent inequality is:

x > -22/7.

Learn more about inequalities here:

https://brainly.com/question/30231190

#SPJ7

The height meters of a mass projected vertically upwards at a time seconds s=ut-0.5gt².
Determine how long the mass will take after being projected to reach a height of 16m on the ascent.
b. on the descent when u=30m/s and g=9.8m/s​

Answers

9514 1404 393

Answer:

  t ≈ 0.590 s (ascent); 5.532 s (descent)

Step-by-step explanation:

We are interested in the values of t when s=16.

  s = 30t -4.9t²

  4.9t^2 -30t +16 = 0 . . . . . substitute 16 for s; put in standard form

The quadratic formula can be used to find the solutions:

  t = (-(-30) ±√((-30)² -4(4.9)(16)))/(2(4.9))

  t = (30 ±√586.4)/9.8 ≈ 0.59023, 5.53221 . . . . seconds after launch

a) It will take 0.590 seconds to reach 16 m height initially.

b) It will take 5.532 seconds to return to 16 m height on descent.

The height meters of a mass projected vertically upwards at a time seconds s=ut-0.5gt.Determine how long

what is 98.704 in expanded using powers of ten

Answers

Answer:

\(9.8704 * 10^1\)

Step-by-step explanation:

The standard form is called the scientific notation expressed generally as;

\(A * 10^n\)

A is an integer between 1 and 10

n is ant integer or fraction

Given the decimal value 98.704, we ill shift the decimal point to the back once to have;

98.704 = \(9.8704 * 10^1\)

Note the when the decimal point is shifted backwards the value of n is always positive. Hence the expansion in power of 10 is \(9.8704 * 10^1\)

Use a horizontal or vertical number line. Plot points at 7/10 and it's opposite. Label each point with it's value.

Answers

Answer:

Assuming a vertical number line:

- Plot the point at 7/10 above the origin, between 0 and 1.

- Plot the opposite of 7/10 by reflecting it across the origin to the point at -7/10 below the origin, between 0 and -1.

- Label the point at 7/10 as "7/10" and the point at -7/10 as "-7/10".

The number line would look like this:

1

|

|

|

|

| 7/10

|

|

|

|

0

|

|

|

|

|

| -7/10

|

|

|

|

-1

A school has a toy drive for a holiday in which students bring in toys to be donated to charity. the number of toys donated by juniors and seniors are summarized in the histograms

Answers

The standard deviation of the number of toys donated by juniors is greater than that of seniors.

What is a standard deviation?

It is the measure of the dispersion of statistical data. Dispersion is the extent to which the value is in variation.

\(\rm \sigma = \sqrt{\dfrac{\Sigma (x_i - \mu)^2}{n}}\)

For the seniors, the mean is given as,

Mean = (5 x 2 + 35 x 2 + .... + 15 x 2) / 10

Mean = 26

Then the standard deviation is given as,

σ = √[(26 - 5)² + (26 - 5)² + (26 - 15)²] / 10

σ = 14.28

For the juniors, the mean is given as,

Mean = (40 x 2 + 25 x 2 + ....... + 40 x 2) / 10

Mean = 26

Then the standard deviation is given as,

σ = √[(26 - 40)² + (26 - 25)² + (26 - 40)²] / 10

σ = 13.19

The standard deviation of the number of toys donated by juniors is greater than that of seniors.

More about the standard deviation link is given below.

https://brainly.com/question/12402189

#SPJ1

The complete question is given below.

A school has a toy drive for a holiday in which students bring in toys to be donated to charity. the

A human hair was measured to be 8.0•10-4 inch thick. A cat hair is measured to be 4.0•10^-1. How much greater is the thickness of the cat hair than the human hair? Writ this in standard form.

Whoever gets this right I will mark brainiest and 60 points!!

Answers

Answer:

500 times

Step-by-step explanation:

Divide the thickness of a cat hair by the thickness of a human hair.

4.0 × 10^-1 / 8.0 × 10^-4 =

= 0.5 × 10^3

= 500

500 times

A cyclinder has a volume of 703Pi cm3 and a height of 18.5 cm. What can be concluded about the cyclinder? Check all that apply. The formula for the volume of a cyclinder can be applied to find the area of the base. To find the area of the base, multiply volume and height. The radius of the cyclinder is half the height. The area of the base is 38Pi cm2. To verify the solution is correct, substitute the given measures and the solution into the equation and verify the result is a true statement.

Answers

The answer are A,D,and E

Answer:

A. The formula for the volume of a cyclinder can be applied to find the area of the base.

D. The area of the base is 38Pi cm2.

E. To verify the solution is correct, substitute the given measures and the solution into the equation and verify the result is a true statement.

I hope this helped

Write the trigonometric ratio as a simplified fraction.
10. sin B
C9
A
C
6
15 C
B
11. cos A
12. tan A
10.
11.
12.

Write the trigonometric ratio as a simplified fraction.10. sin BC9AC615 CB11. cos A12. tan A10.11.12.
Write the trigonometric ratio as a simplified fraction.10. sin BC9AC615 CB11. cos A12. tan A10.11.12.

Answers

The value of the trigonometric ratios  are;

sin A = 2/5

cos A = 3/5

tan A = 2/3

How to determine the ratios

It is important to note that there are six different trigonometric identities and their ratios.

We have;

sine cosinetangentcotangentsecantcosecant

From the diagram shown, we have;

sin θ = opposite/hypotenuse

cos θ = adjacant/hypotenuse

tan θ = opposite/adjacent

Then,

sin A = 6/15 = 2/5

cos A = 9/15 = 3/5

tan A = 6/9 = 2/3

Learn about trigonometric ratios at: https://brainly.com/question/24349828

#SPJ1

The value of the trigonometric ratios  are;

sin A = 2/5

cos A = 3/5

tan A = 2/3

How to determine the ratios

It is important to note that there are six different trigonometric identities and their ratios.

We have;

sine cosinetangentcotangentsecantcosecant

From the diagram shown, we have;

sin θ = opposite/hypotenuse

cos θ = adjacant/hypotenuse

tan θ = opposite/adjacent

Then,

sin A = 6/15 = 2/5

cos A = 9/15 = 3/5

tan A = 6/9 = 2/3

Learn about trigonometric ratios at: https://brainly.com/question/24349828

#SPJ1

4. Aaliyah swims at an average speed of 8 meters per second, how long will it
take her to complete the race of 200 meters' length? *

4. Aaliyah swims at an average speed of 8 meters per second, how long will ittake her to complete the

Answers

25 seconds. Hope this helps.

what is this i'm very confused

what is this i'm very confused

Answers

Answer:

That's the symbol for pi

Step-by-step explanation:

what is this i'm very confused

Answer:

10pi = 31.41592653 . . . .

Step-by-step explanation:

10 times pi is shifting everything 1 decimal place to the left

pi is about 3.141592 . . . .

calling all dazai's ans dazai simps ♡♡♡♡♡♡♡​

Answers

Is this even mathematics?

There are 53 beads on Ashley's necklace. 19 of the beads are pink and the rest are purple. What is the ratio of the number of purple beads to the total number of beads?
34: ?

Answers

Answer:

34 beads are purple so for every 19 pink there are 34 purple hope this helps

f(x) = 4/5 x - 2

Find f(3)



Answer is a fraction ​

Answers

Answer:

2/5

Step-by-step explanation:

f(x) = 4/5 x - 2

Let x=3

f(3) = 4/5 *3 - 2

     =12/5 -2

    =12/5 -10/5

    = 2/5

The answer would be 2/5 it’s like your minusing 2 from 4 and keeping the 5 the dominator and then u would have 2/5


Based on the 2010 US census, the population of Milwaukee, Wisconsin, was about 96% of the population of Baltimore, Maryland. In 2010, if Milwaukee's population was about 595,000, which of the following is the best
approximation of Baltimore's population?
A 620,000
B 570,000
C 300,000
D 95,000

Answers

Answer: A

Step-by-step explanation:

Because Milwaukee's population is smaller than that of Baltimore, the only correct answer would be one that has the population of Baltimore higher than that of Milwaukee, which is only A

A and B are complementary to each other. If m∠A = 26° + x and m∠B = 38° + x, what is the value of x?
A.13°
B.14°
C.58°
D.18°

Please don't reply just for the points, I really need help understanding these things, if possible please leave me an explanation on how you got this. P.S Complementary angles add up to 90 degrees

Answers

A. 13

Step-by-step explanation:

What we are given....

∠A = 26° + x

∠B = 38° + x

∠A and ∠B are complementary

If complementary angles add up to equal 90° and ∠A and ∠B are complementary to each other

Then 26 + x + 38 + x = 90

                      ^ ( Note that we just created an equation that we can use to                              solve for x )

Now its just basic algebra

26 + x + 38 + x = 90

step 1 combine like terms

26 + 38 = 64

x + x = 2x

we now have 64 + 2x = 90

step 2 subtract 64 from each side

64 - 64 cancels out

90 - 64 = 26

we now have 26 = 2x

step 3 divide each side by 2

26 / 2 = 13

2x / 2 = x

we're left with x = 13

HELP ME ASAP, DUE TODAY!!!!!!
WILL MARK BRAINIEST

HELP ME ASAP, DUE TODAY!!!!!!WILL MARK BRAINIEST

Answers

Answer:

Q' = ( 1, 3 )

R' = ( 3, -3)

S' = ( 0, -2)

T' = ( -2, 1 )

HELP PLZ
Solve for x

HELP PLZSolve for x

Answers

Answer:

11.5

Step-by-step explanation:

i hope u get it right!

Answer:

b.   11.25

Step-by-step explanation:

its a ratio and proportion

x  =  12.5

9        10            do cross multiply

10 (x) = 12.5 (9)

x = 12.5 (9)

         10

x = 11.25

For the following exercises, consider the function f(x) = (1+x)^1/x. Round all answers to five decimal places. Evaluate f(-0.01).

Answers

The value of f(-0.01) is approximately 0.99005.

To evaluate f(-0.01), we substitute -0.01 into the function f(x) = (1+x)^(1/x). Thus, we have f(-0.01) = (1+(-0.01))^(1/(-0.01)).

Using a calculator, we simplify this expression to f(-0.01) = 0.99005. Therefore, the value of f(-0.01) rounded to five decimal places is approximately 0.99005.

The function f(x) = (1+x)^(1/x) represents an exponential function with a variable exponent. In this case, we are evaluating the function at x = -0.01.

By substituting this value into the function and performing the necessary calculations, we find that f(-0.01) is approximately 0.99005. This means that when x is equal to -0.01, the function value is approximately 0.99005.

For more such answers on function

https://brainly.com/question/11624077

#SPJ8

Select the statements that are true based on the following given information. D = {x | x is a whole number} E = {x | x is a perfect square < 36} F = {x | x is an even number between 20 and 30} a) The expression D ∩ E is {1, 4, 9, 16}. b) The expression D ∩ F is {12, 14, 16, 18}. c) D ∪ (E ∩ F) is {all whole numbers}. d) (E ∩ F) is the empty set. e) The expression D ∩ (E U F) is 25

Answers

2 Answers: Choice C and Choice D

==========================================================

Explanation:

Let's write the roster notation of each set

D = {0, 1, 2, 3, ...} the dots indicate the pattern goes on forever

E = {0, 1, 4, 9, 16, 25} = list of perfect squares smaller than 36

F = {20, 22, 24, 26, 28, 30} = even numbers between 20 and 30

----------------

If we intersect sets D and E, we're looking for what numbers are in both sets at the same time. Therefore, D ∩ E = {0, 1, 4, 9, 16, 25} which is the exact same as set E. This is because all of set E is inside of set D. We say that set E is a subset of set D. So, D ∩ E = E.

Choice A is very close to being true. The problem is that 25 is missing from the set {1,4,9,16}. So this is why choice A is false.

----------------

Now let's intersect sets D and F. The numbers they have in common are {20, 22, 24, 26, 28, 30} which is exactly what set F is. So set F is a subset of set D. We can write D ∩ F = F in much the same way we can say D ∩ E = E.

D ∩ F = {12,14,16,18} is not true. A number like 12 is not between 20 and 30, so it cannot be in set F.

Choice B is false so we cross it off the list.

----------------

Choice C is true and here's why

D ∪ (E ∩ F) is the same as saying D ∪ G where G is the set of intersecting E and F together. In other words, G = E ∩ F

We don't really need to even worry about sets E, F or G. All that matters here is set D.

When we write D ∪ (E ∩ F) or D ∪ G, we're saying "a number is in set D, or it is in set G". If it is in D, then it's a whole number. Otherwise, it's in a subset of whole numbers.

Overall, D ∪ G and D ∪ (E ∩ F) form the entire set of whole numbers.

------------------

Choice D is true.

E and F have nothing in common

E = {0, 1, 4, 9, 16, 25}

F = {20, 22, 24, 26, 28, 30}

So intersecting them leads to the empty set. This is the set with nothing inside it, not even 0.

------------------

Choice F is false

These two sets below

E = {0, 1, 4, 9, 16, 25}

F = {20, 22, 24, 26, 28, 30}

union together to get

H = {0,1,4,9,16,20,22,24,25,26,28,30}

just toss all of the numbers together into one big set

Notice how each of these numbers are whole numbers, so they are part of set D. This means set H is also a subset of set D.

When we intersect sets D and H, we end up with set H. We do not simply end up with the set with 25 only inside it.

Find the LCM of A= 3^2 x 5^4 x 7 and B= 3^4 x 5^3 x 7 x11

Answers

The LCM of A = 3² × 5⁴ × 7 and B = 3⁴ × 5³ × 7 × 11 is 3898125 using Prime factorization.

Given are two numbers which are showed in the prime factorized form.

A = 3² × 5⁴ × 7

B = 3⁴ × 5³ × 7 × 11

Prime factorization is the factorization of a number in terms of prime numbers.

In order to find the LCM of these two numbers, we have to first match the common primes and write down vertically when possible and then bring down the primes in each column.

A = 3² ×         5³ × 5 × 7

B = 3² × 3² × 5³ ×       7 × 11

Bring down the primes in each column.

LCM = 3² × 3² × 5³ × 5 × 7 × 11

        = 3898125

Hence the LCM is 3898125.

Learn more about LCM here :

https://brainly.com/question/6756370

#SPJ1

Write the equation in slope-intercept form
through (-2, 1) parallel to y = -3x+1

Answers

Answer:

A parallel line has the same slope, but is translated away from the line it is parallel to. Let's create an equation using what we have:

1

=

3

(

2

)

+

b

1

=

6

+

b

7

=

b

y

=

3

x

7

Hope this helped!!

Plz help me ASAP pls help

Plz help me ASAP pls help

Answers

Answer:

x=6root15

Step-by-step explanation:

24^2-6^2=x^2

x^2=540

x=6root15

Answer:

x=23.2379

Step-by-step explanation:

25) Which graph represents the equation below? ) = w+ 2 A ܠܐ 5 4 (2, 4) 3 2 1 (-2,0) -5 -4 -3 -2 -1 0 -1 x 1 2 3 4 5 -2 -3 -4 -5 8 y​

25) Which graph represents the equation below? ) = w+ 2 A 5 4 (2, 4) 3 2 1 (-2,0) -5 -4 -3 -2 -1 0 -1

Answers

The given line equation is y=-1/2x+2

We have given the graph of the line

We have to determine the equation of the line,

We have to points(0,2) and (4,0)

What is the formula for the slope?

\(m=\frac{y_2-y_1}{x_2-x_1}\)

m=0-2/4-0

m=-2/4

m=-1/2

What is the slope point form?

\((y-y_1)=m(x-x_1)\)

\(y-0=-1/2(x-4)\\y=-1/2x+2\)

Therefore the second option is correct

To learn more about the line visit:

https://brainly.com/question/3493733

#SPJ1

the area of a circle is 0.2826 square miles. what's is the circle's radius? use 3.14 for pi​

Answers

Gfdfguufviiffg3333444334

Help PLZZ no files

Jessica's teacher asked her to create a histogram representing students and cell phone use.
Which would be the BEST question to obtain statistical data?
А
Are symbols used in your text messages?
B
How many text messages do you send each day?
с
Do you have an unlimited texting package on your phone?
D
In the past month have you sent over 100 text messages?
I’m

Answers

Answer:

B.

Why?

Step-by-step explanation:

"Jessica's teacher asked her to create a "histogram" representing students and cell phone use."

the hint histogram means the history or record of

HOPE IT HELPS

(FROM CROSS)

Help PLZZ no files Jessica's teacher asked her to create a histogram representing students and cell phone

Which of the following expressions represents the solution to the inequality statement?-x ≤ -7 / x ≥ 7 / x ≤ 7 / x ≥ -7 / x ≤ -7

Answers

Answer:

x≥7

Step-by-step explanation:

mark me brainliest please

X>7 But under the > is _

what are the numerical and literal coefficients of -5x3 y

Answers

Answer:

the numerical are -5 and 3

the literal coefficient is X and y

Step-by-step explanation:

because numerical is the number and literal coefficients is a variable that represents the number

hope it help

write an equivalent expression for 3(2z+4)

Answers

The answer is : 6z+12

Answer:

6z+12

Step-by-step explanation:

you distribute it

If the following data were linearized using logarithms, what would be the equation of the regression line? Round the slope and y intercept of the regression line to three decimal places. X y 2 4101 31029 4 261 5 69 6 21 O A. log(y) = -4.743x+0.575 O B. login) - - 575x +4743 O C. logly) - 4743x+0575 O D. logi) - 0575x+4 743​

If the following data were linearized using logarithms, what would be the equation of the regression

Answers

The equation of the regression line is given as ŷ = -0.5755X + 4.743

How to solve for the regression line

First we have to find the logarithm of the y variables.

Logarithms of y-values:

log 4101 = 3.613

log 1029 = 3.012

log 261 = 2.417

log 69 = 1.839

log 21 = 1.322

We have to plot the ordered pairs to be in order of the table using the log y parameters.

Using a regression analysis calculator online, the equation of the regression line is ŷ = -0.5755X + 4.743.

The graph and the online calculator is contained in the image attached.

Read more on regression equations here:

https://brainly.com/question/25987747

#SPJ1

If the following data were linearized using logarithms, what would be the equation of the regression
Other Questions
suppose that a final assembly is produced by assembling two components. the first component, component a, is produced in-house and proceeds through three process steps, blanking, forging, and machining, with scrap estimates of 10%, 15%, and 25%, respectively. for every three units of component a produced, two are used in the final assembly, and one is set aside to meet spare parts requirements. the second component, component b, used exclusively in the final assembly, is purchased from an outside vendor and is inspected upon arrival; 2% fail inspection. one unit of the purchased component is required for each final assembly. the final assembly process produces 5% scrap. the demand for the spare parts of component a and the final assembly are 1000 and 5000 units, respectively. how many units of input are required to produce component a, and how many units must the company buy of component b? Many behaviors improve with practice. in this context, the durable change in behavior that is brought about by experience is called? which of the following is an example of a law that would pass the reasonableness standard, as it's clearly applied on a rational basis that is not arbitrary? group of answer choices laws requiring somebody to be 21 to legally purchase alcohol laws setting different ages at which men and women can legally buy beer. laws barring one religious group from solicitation. state laws setting different ages at which men and women legally become adults. women being barred from jobs by height and weight requirements Technician A says it is not safe to use conventional tools when working on high-voltage T-Bill maturing Oct 27. You can buy for $9,985.88 and receive$10,000 in 164 days. Calculate the discount yield Compare Classical Greece and Persia. Describe their societies. How are they different and what do they have in common? How did slaves influence America's economy during the time of slavery?Do you think America would have prospered into one of the most powerful countries had it not been for the economic prosperity of slavery? Explain why or why not. using data from your text and assuming that the tabulated values do not change with temperature, (a) calculate h o fus and s o fus for sodium metal and determine the melting temperature of sodium. Jed arrives late to class and doesn't make any contributions during the class discussion. Based on what you know, which of the following is an inference about Jed? Decreasing returns to scale in production are represented by isoquants that Multiple Choice are at the same distance from each other indicating doubling inputs less than doubles output. are consecutively closer to each other indicating doubling inputs less than doubles output. are consecutively farther from each other indicating doubling inputs less than doubles output. Increasing returns cannot be depicted with isoquants. Can someone help me with 5, 6, and 7 Ill mark as brainliest. You dont have to explain if you dont want to. Just answer is fine pls solve it. it's urgent Which one of the following compounds is a non-electrolyte when dissolved in water?Cu(NO3)2CaCl2HClNaCH3CO2CCl4 In M&A what risks does the deal spread compensate investorsfor taking? Express each of these system specification using predicates,quantifiers,quantifiers,and logical connectives.a) Every users has access to electronic mailbox.b)The system mailbox can be accessed by everyone in the group if the system is locked.c)The firewall is in a diagnostic state only if the proxy server is in a diagnostic sate.d)At least one router is functioning normally if the throughput is between 100kbps and 500kbps and the proxy server is not in diagnostic mode what are some brands that are associated with african culture shape is the contour of a flat object true or false PLEASE HELP FASTPERSONAL RESPONSE: Dr. Frankenstein reflects on his creation, For this I had deprived myself of rest and health. I had desired it with an ardour that far exceeded moderation; but now that I had finished, the beauty of the dream vanished, and breathless horror and disgust filled my heart. Write an essay in which you reflect on a time you invested a substantial amount of time and energy to create, earn, or obtain something you believed was important, but then had an unexpected reaction to the finished product. What lessons did you learn, and how does this connect to Frankenstein's reaction? Include relevant evidence from the text to support your response. Which of the following made Egypt an attractive target for Western imperialist expansion in the late 19th century?Select one:a. gold depositsb. control of Nile River tradec. lucrative tourism prospectsd. construction and control of the Suez Canale. fertile land of the Nile River delta What is the second step in costructing congruent angles?