How many structural isomers are possible with the molecular formula C6 H14?
A. 4
B. 5
C. 6
D. 7

Answers

Answer 1

The molecular formula C6H14 represents a saturated hydrocarbon with six carbon atoms and 14 hydrogen atoms. To determine the number of structural isomers, we need to consider the different ways in which these atoms can be arranged in a molecule while maintaining the same molecular formula.

One way to approach this problem is to start with the straight-chain structure of n-hexane, which has all six carbon atoms in a row with each carbon atom bonded to two hydrogen atoms. This isomer is called the n-isomer or normal hexane. The other isomers can be obtained by branching or rearranging the carbon chain.The first branched isomer is 2-methylpentane, which has a five-carbon chain with a methyl (CH3) group attached to the second carbon atom. The second branched isomer is 3-methylpentane, which has a five-carbon chain with a methyl group attached to the third carbon atom. The third branched isomer is 2,2-dimethylbutane, which has a four-carbon chain with two methyl groups attached to the second carbon atom.The fourth isomer is 2,3-dimethylbutane, which has a four-carbon chain with one methyl group attached to the second carbon atom and another methyl group attached to the third carbon atom. The fifth isomer is 2,4-dimethylpentane, which has a five-carbon chain with one methyl group attached to the second carbon atom and another methyl group attached to the fourth carbon atom.Therefore, the answer is B. 5, there are five structural isomers possible with the molecular formula C6H14.

Learn more about hydrocarbon here

https://brainly.com/question/29318707

#SPJ11


Related Questions

If you decide to place the dialysis bag in 4.0 l of distilled water for 12 h the final concentration of the salt would be:________

Answers

The final concentration of the **salt** in the dialysis bag, after placing it in 4.0 L of distilled water for 12 hours, would be: **diluted**.

When a dialysis bag is immersed in a solution, the process of diffusion occurs, allowing solutes to pass through the semipermeable membrane. In this case, since the dialysis bag is placed in distilled water, which has a lower concentration of solutes, the solutes within the bag will diffuse out into the surrounding water. Over the course of 12 hours, the concentration of the salt within the bag will decrease due to this diffusion process. The final concentration of the salt will depend on its initial concentration and the rate of diffusion. However, without knowing the initial concentration of the salt, it is not possible to determine the exact final concentration. Nonetheless, it can be concluded that the salt concentration would be **diluted** after the process.

Learn more about dialysis bag here:

https://brainly.com/question/33807655

#SPJ11

how can we separate the sugar from sugar solution​

Answers

The process of distillation

When you walk barefoot across a hot sidewalk, you feel the heat on your feet. Explain what’s happening with the molecules in both the sidewalk and your feet , and which direction thermal energy is moving

Answers

When you walk over a sidewalk with barefoot, your feet make contact with the surface, which conducts heat to your feet.Convection drives the majority of heat energy in the atmosphere.

Walking barefoot on warm sand causes what kind of heat transfer?

Conduction transfers heat from heated sand to a bottoms of your feet.Heat is transferred by conduction when two items come into contact.Heat energy passes from the warmer to the colder of two materials when their temperatures differ.

What kind of heat transmission involves direct contact?

conduction Three methods exist for transferring heat: conduction, convection, and radiation.Energy is transferred directly from one atom to another through conduction.

To know more about thermal energy visit:

https://brainly.com/question/11278589

#SPJ4

An induced dipole occurs when a molecule's moving electrons are briefly more concentrated in one place than another, causing the molecule to become temporarily polarized. (4 points)

True
False

Answers

Answer:

False

Explanation:

This is false because what is being described in the statement is the definition of instantaneous dipoles not induced, therefore this is false.

It is a false statement that, an induced dipole occurs when a molecule's moving electrons are briefly more concentrated in one place than another, causing the molecule to become temporarily polarized.

The electron cloud in molecules is never stationary. It moves from one point to another. As such, instantaneous dipoles develop in a molecule. These instantaneous dipoles may induce dipoles in other molecules. This is induced dipole.

Hence, it is false that an induced dipole occurs when a molecule's moving electrons are briefly more concentrated in one place than another, causing the molecule to become temporarily polarized. This is instantaneous dipole.

Learn more: https://brainly.com/question/2673886

A boy and girl are running with the same speed.if the mass of the boy is 20 times that of girl find the kinectic energy

Answers

Answer:

The kinetic energy of the boy is 20 times that of the kinetic energy of the girl.

Explanation:

It is given that,

The mass of the boy is 20 times that of girl.

Let \(m_b\) and \(m_g\) are the mases of boy and the girls.

A boy and girl are running with the same speed.

The formula for the kinetic energy is given by :

\(E=\dfrac{1}{2}mv^2\)

Where m is mass and v is speed

As speed is same for both boy and girl.

Kinetic energy of a girl,

\(K_g=\dfrac{1}{2}m_gv^2\) ...(1)

As \(m_b=20m_g\)

Kinetic energy of a boy,

\(K_b=\dfrac{1}{2}m_bv^2\\\\=\dfrac{1}{2}\times 20m_g\times v^2\ ....(2)\)

From equation (1) and (2) :

\(\dfrac{K_g}{K_b}=\dfrac{\dfrac{1}{2}m_gv^2}{\dfrac{1}{2}m_bv^2}\\\\=\dfrac{\dfrac{1}{2}m_gv^2}{\dfrac{1}{2}\times 20 m_gv^2}\\\\\dfrac{K_g}{K_b}=\dfrac{1}{20}\\\\K_b=20K_g\)

So, the kinetic energy of the boy is 20 times that of the kinetic energy of the girl. Hence, this is the required solution.

which of the following statements about the kinetic-molecular theory of gases is false? 1. the average kinetic energy of a gas molecule is independent of the temperature. 2. collisions between molecules are elastic.

Answers

Kinetic molecular theory states that there is no attractive and repulsive force between the gas molecules. So option (3) is false.

According to the kinetic molecular theory the gases are composed of a large number of particles that behave like hard, spherical objects in a state of constant which is in random motion. This theory states that the energy that an object has because of its motion. The Kinetic Molecular Theory can be explained as the forces between molecules and the energy that they possess. This is explained as a theoretical model which describes the molecular composition of the gas in terms of a large number of submicroscopic particles that includes atoms and molecules. This states that the gas pressure arises due to particles colliding with each other and the walls of the container.

To learn more about Kinetic molecular theory

https://brainly.com/question/134712

#SPJ4

The complete question is,

Which of the following statements about the kinetic-molecular theory of gases is false?

1. the average kinetic energy of a gas molecule is independent of the temperature.

2. collisions between molecules are elastic.

3. Attractive and repulsive forces are present between gas molecule.

Determine whether the following series converges or diverges.if the seriesconverges, find the value it converges to.must show work. answers donot need to be expressed in decimal

Answers

If the limit is less than 1, the series converges; if it is greater than 1, the series diverges; and if it equals 1, the test is inconclusive.

To determine whether the series converges or diverges, we need to examine its terms and apply a convergence test. Without the specific series provided, I am unable to show the step-by-step process. However, I can explain the concept of convergence and provide an example.
A series converge if the sum of its terms approaches a finite value as the number of terms increases. If the sum approaches infinity or does not approach any value, the series diverges.
One commonly used convergence test is the ratio test. It states that if the absolute value of the ratio of consecutive terms approaches a constant value less than 1, then the series converges.

To apply the ratio test, we calculate the limit of the absolute value of the ratio of consecutive terms as n approaches infinity. If the limit is less than 1, the series converges; if it is greater than 1, the series diverges; and if it equals 1, the test is inconclusive.

Learn more about convergence from the following link:

https://brainly.com/question/30114464

#SPJ11

I NEED HELP FAST!!!!
Water is always H2O. When water is in the gas phase, the molecules are
Question 1 options:
1. slow and in an hexagonal pattern
2. not moving and close together
3. fast and far apart
4. flowing at a medium speed


Which phase change occurs when liquid water becomes a gas?
Question 2 options:
1. freezing
2. evaporation
3. melting
4. condensation


Water is a ______ resource because the amount of water on earth never changes.
Question 4 options:
1. unlimited
2. closed
3. open
4. limited

Answers

Answer:

1. Is 3

2. Is evaporation

3. I don't really understand it

Answer:. 1

Explanation:

please help me on this ASAP i really need it plssssssssss

please help me on this ASAP i really need it plssssssssss

Answers

The 10 grams ball will move the fastest and the 900 grams ball will be the slowest.

How does the mass of a ball affect its motion?

According to Newton's Second Law of Motion, the acceleration of an object is directly proportional to the force applied to it and inversely proportional to its mass.

This means that a heavier ball will require a greater force to accelerate it to a given speed than a lighter ball. Conversely, a lighter ball will accelerate more easily than a heavier ball when subjected to the same force.

Learn  more about mass:https://brainly.com/question/19694949


#SPJ1

Is Iron+Oxygen+water= Iron Hydroxide
Is it true

Answers

False, It consists of an oxygen and hydrogen atom held together by a covalent bond.

multiple choice question a solution contains 25.0 g ethanol (c2h5oh; molar mass 46.07 g/mol) in 500. g h2o (molar mass 18.02 g/mol) at 23oc. if the vapor pressure of pure h2o at this temperature is 20.57 torr, what is the vapor pressure of the solution? multiple choice question. 20.1 torr 0.390 torr 21.0 torr 0.979 torr

Answers

To calculate the vapor pressure of the solution, we need to use Raoult's law,

which states that the vapor pressure of a solution is equal to the mole fraction of the solvent times its vapor pressure in the pure state.

The mole fraction of water in the solution can be calculated as follows:

moles of water = mass of water / molar mass of water
moles of water = 500 g / 18.02 g/mol = 27.7 mol

moles of ethanol = mass of ethanol / molar mass of ethanol
moles of ethanol = 25.0 g / 46.07 g/mol = 0.543 mol

total moles of solution = moles of water + moles of ethanol
total moles of solution = 27.7 mol + 0.543 mol = 28.2 mol

mole fraction of water = moles of water / total moles of solution
mole fraction of water = 27.7 mol / 28.2 mol = 0.982

The vapor pressure of pure water at 23°C is given as 20.57 torr. Therefore, the vapor pressure of the solution can be calculated as:

vapor pressure of solution = mole fraction of water x vapor pressure of pure water
vapor pressure of solution = 0.982 x 20.57 torr
vapor pressure of solution = 20.18 torr

Therefore, the vapor pressure of the solution is 20.18 torr. The correct answer is 20.1 torr, which is the closest option given in the multiple-choice question.

learn more about vapor here: brainly.com/question/30820393

#SPJ11

hydrogen bonds between each nucleotide sugar group hold individual dna strands together within the sugar-phosphate backbone of each strand.

Answers

A nucleotide is a basic unit of nucleic acid. Hydrogen bonds between each nucleotide sugar group hold individual DNA strands together within the sugar-phosphate backbone of each strand.

Each nucleotide consists of three parts: a sugar molecule, a phosphate group, and a nitrogenous base.

Nucleotides are the building blocks of DNA and RNA.

The nucleotides that make up DNA are deoxyadenosine, deoxythymidine, deoxycytidine, and deoxyguanosine.

These nucleotides are frequently called deoxyribonucleotides because they have deoxyribose, a sugar, in their structure.

The structure of DNA consists of two strands that run antiparallel to one another and are connected by hydrogen bonds between the nitrogenous bases.

Hydrogen bonds between each nucleotide sugar group hold individual DNA strands together within the sugar-phosphate backbone of each strand.

In the structure of DNA, nitrogenous bases from one strand bind to complementary bases in the opposing strand. The nitrogenous bases form hydrogen bonds in this interaction.

To know more about nucleotide visit:

https://brainly.com/question/16308848

#SPJ11

5. a) Please derive expressions for \alpha_{0}, \alpha_{1} , and \alpha_{2} implicated in the speciation of rm{H}_{2} rm{CO}_{3} into rm{HCO}_{3}^{-} and r

Answers

The expression for α0, α1, and α2 implicated in the speciation of H2CO3 into HCO3- and CO32- are:

H_{2} CO_{3}(aq) \rightleftharpoons HCO_{3} ^{-}(aq)+H^{+}(aq)$ (1) HCO_{3} ^{-}(aq) \rightleftharpoons CO_{3} ^{2-}(aq)+H^{+}(aq)

(2)These reactions can be defined using the acid dissociation constant (Ka) of H2CO3 as follows:

Ka1 = [HCO3-][H+]/[H2CO3]Ka2 = [CO32-][H+]/[HCO3-]According to Brønsted-Lowry theory, H2CO3 can donate two protons and can behave as a diprotic acid.

From these definitions, the acid dissociation constants for H2CO3's first (Ka1) and second (Ka2) dissociation reactions can be expressed as shown below:

Ka1 = α1[ H+][ HCO3-]/[ H2CO3] Ka2 = α2[ H+][ CO32-]/[ HCO3-]where α1 and α

2 are the activity coefficients of the intermediate ions. α0 represents the activity coefficients of H2CO

3. Let's look at each of these coefficients in turn.α0: the activity coefficient of the molecular species, H2CO3α1 the activity coefficient of HCO3- ionα2 the activity coefficient of CO32- ion.

About Acid

An acid is a molecule or ion that can donate a proton, or, alternatively, can form a covalent bond with an electron pair. The first category of acids is the proton donor or Brønsted acid. In the special case of an aqueous solution, the proton donor forms the hydronium ion H₃O⁺ and is known as an Arrhenius acid. PH is the degree of acidity or alkalinity of a solution, expressing the negative logarithm of the concentration of H ions with a base number of 10. Neutral solutions have a PH of 7, acids less than 7, bases greater than 7. In waters that are not polluted, PH is controlled by CO2 ions, Carbonates and Bicarbonates.

Learn More About Acid at https://brainly.com/question/25148363

#SPJ11

Which of the following statements regarding carbon is false? Group of answer choices Carbon has the capacity to form single and double bonds. Carbon has the ability to bond with up to six other atoms. Carbon has a tendency to form covalent bonds. Carbon has the ability to bond together to form extensive branched or unbranched "carbon skeletons."

Answers

Answer: The statement, carbon has the ability to bond with up to six other atoms is false.

Explanation:

Carbon is a group 14 element and it is a non-metal. The atomic number of carbon is 6 and its electronic distribution is 2, 4.

This means that there are 4 valence electrons present in it. Also, in order to attain stability a carbon atom forms only covalent bonds, that is, it shares its valence electrons with its own atoms or atoms of other elements.

Carbon has the capacity to form single and double bonds.

As valency of carbon is four so it can only combine to 4 other atoms vis single bond and it cannot bond with up to six other atoms.

Carbon shows the property of catenation, that is, it forms covalent bonds with its own atoms in a large number. So, carbon has the ability to bond together to form extensive branched or unbranched "carbon skeletons".

Thus, we can conclude that the statement, carbon has the ability to bond with up to six other atoms is false.

Which chemical element hates to be a follower?​

Answers

Answer:

look up hope that helps you

Which chemical element hates to be a follower?

Do you think the saying “faster, better, cheaper” refers more to the work of a scientist or engineer? Explain

Answers

Answer:

engineering

Explanation:

when you think about the advancements in engineering over the years vs the advancements in science, engineering fits the "fast, better, cheaper" a lot more. Cars, for example, are engineered and over the years cars have been getting faster, more reliable/safe, and more affordable.

Science can also be focused on being better/more reliable/efficient, but this is mainly for things like medicine, and not science as a whole. How can "faster, better, cheaper" apply to a biologist, who studies nature?

Name a substance which will undergo changes from solid to liquid to gas between 0c and 100c ​

Answers

Answer:

WATER

Explanation:

Water melting  point 0 c boiling 100c

Classify the following by the sign of ΔE for the system.I: The system expands and the surroundings get hotter. ΔE is (Positive or negative)II: The system contracts and the surroundings get hotter. ΔE is (Positive or negative)

Answers

I: The system expands and the surroundings get hotter. ΔE is positive.
II: The system contracts and the surroundings get hotter. ΔE is negative.


For I, when the system expands and the surroundings get hotter, it means the system is gaining energy from its surroundings. Since energy is entering the system, the change in internal energy (ΔE) is positive.

For II, when the system contracts and the surroundings get hotter, it indicates that the system is losing energy to its surroundings. As energy leaves the system, the change in internal energy (ΔE) becomes negative. In both cases, the sign of ΔE depends on the energy transfer between the system and its surroundings, with a positive sign for energy gain and a negative sign for energy loss.

Learn more about internal energy here:

https://brainly.com/question/28333978

#SPJ11

what are the common features of Mass, Volume, Magnetism, and Melting point?

Answers

Answer: they all are 4 properties of matter

Answer:

Explanation:

Mass is a scalar quantity. It has magnitude. In science, volume is a measure of the amount of three-dimensional space an object fills. It’s usually measured in cubic meters based on the SI or metric system. Volume can be represented by three axes – length, width, and height. In practice, however, volume in chemistry is commonly measured in liters and milliliters.  Magnetism is a force that attracts (pulls closer) or repels (pushes away) objects that have a magnetic material like iron inside them (magnetic objects). In simpler words, it is a property of substances which pull closer or repel other objects. It is a subject in physics.  The melting point of a substance is the temperature at which it changes state from solid to liquid.

Hi, Chemistry is my least liked subject and I need to learn to like it, can someone tutor me please?
Thank you

Answers

Hi! I wouldn’t mind answering any questions or helping explain certain things

Chemistry help!

Zoom in to see better!!​

Chemistry help!Zoom in to see better!!

Answers

Answer:

11.9 g of nitrogen monoxide

Explanation:

We'll begin by calculating the number of mole in 6.75 g of NH₃. This can be obtained as follow:

Mass of NH₃ = 6.75 g

Molar mass of NH₃ = 14 + (3×1)

= 14 + 3

= 17 g/mol

Mole of NH₃ =?

Mole = mass /molar mass

Mole of NH₃ = 6.75 / 17

Mole of NH₃ = 0.397 mole

Next, we shall determine the number of mole of NO produced by the reaction of 0.397 mole of NH₃. This can be obtained as follow:

4NH₃ + 5O₂ —> 4NO + 6H₂O

From the balanced equation above,

4 moles of NH₃ reacted to produce 4 moles of NO.

Therefore, 0.397 mole of NH₃ will also react to produce 0.397 mole of NO.

Finally, we shall determine the mass of 0.397 mole of NO. This can be obtained as follow:

Mole of NO = 0.397 mole

Molar mass of NO = 14 + 16 = 30 g/mol

Mass of NO =?

Mass = mole × molar mass

Mass of NO = 0.397 × 30

Mass of NO = 11.9 g

Thus, the mass of NO produced is 11.9 g

What properties are used to arrange the
elements in the periodic table.

Answers

Answer:

Elements are arranged from left to right and top to bottom in order of  increasing atomic number. As, The modern periodic law tells that the Elements in the modern periodic table are arranged by increasing atomic numbers.

Answer:

See below ~

Explanation:

Properties used to arrange elements

Atomic numberValencyNumber of shellsMelting PointElectronic Configurationetc.

why natural fas is not used as a bottled gas or as a motor fuel?

Answers

Answer:

Natural gas is an odorless, gaseous mixture of hydrocarbons—predominantly made up of methane (CH4). It accounts for about 30% of the energy used in the United States. About 40% of the fuel goes to electric power production and the remaining is split between residential and commercial uses, such as heating and cooking, and industrial uses. Although natural gas is a proven, reliable alternative fuel that has long been used to power natural gas vehicles, only about two-tenths of 1% is used for transportation fuel.

The vast majority of natural gas in the United States is considered a fossil fuel because it is made from sources formed over millions of years by the action of heat and pressure on organic materials. Alternatively, renewable natural gas (RNG), also known as biomethane, is a pipeline-quality vehicle fuel produced from organic materials—such as waste from landfills and livestock—through anaerobic digestion. RNG qualifies as an advanced biofuel under the Renewable Fuel Standard.

Because RNG is chemically identical to fossil-derived conventional natural gas, it can use the existing natural gas distribution system and must be compressed or liquefied for use in vehicles.

CNG and LNG as Alternative Transportation Fuels

Two forms of natural gas are currently used in vehicles: compressed natural gas (CNG) and liquefied natural gas (LNG). Both are domestically produced, relatively low priced, and commercially available. Considered alternative fuels under the Energy Policy Act of 1992, CNG and LNG are sold in units of gasoline or diesel gallon equivalents (GGEs or DGEs) based on the energy content of a gallon of gasoline or diesel fuel.

Compressed Natural Gas

CNG is produced by compressing natural gas to less than 1% of its volume at standard atmospheric pressure. To provide adequate driving range, CNG is stored onboard a vehicle in a compressed gaseous state at a pressure of up to 3,600 pounds per square inch.

CNG is used in light-, medium-, and heavy-duty applications. A CNG-powered vehicle gets about the same fuel economy as a conventional gasoline vehicle on a GGE basis. One GGE equals about 5.66 pounds of CNG.

Liquefied Natural Gas

LNG is natural gas in its liquid form. LNG is produced by purifying natural gas and super-cooling it to -260°F to turn it into a liquid. During the process known as liquefaction, natural gas is cooled below its boiling point, removing most of the extraneous compounds found in the fuel. The remaining natural gas is primarily methane with small amounts of other hydrocarbons.

Because of LNG's relatively high production cost, as well as the need to store it in expensive cryogenic tanks, the fuel's widespread use in commercial applications has been limited. LNG must be kept at cold temperatures and is stored in double-walled, vacuum-insulated pressure vessels. LNG is suitable for trucks that require longer ranges because liquid is denser than gas and, therefore, more energy can be stored by volume. LNG is typically used in medium- and heavy-duty vehicles. One GGE equals about 1.5 gallons of LNG.

Most mechanical processing of food occurs in the _____.

Answers

Answer:

No digestion occurs in the esophagus. After passage through the esophagus, the bolus will enter the stomach and undergo mechanical and chemical digestion. Mechanical digestion in the stomach occurs via peristaltic contractions of the smooth muscle from the fundus towards the contracted pylorus, termed propulsion.

Explanation:

i hope it's help

Determine whether each of the following reactions is spontaneous.

AHsystem = -75.9 kJ, T = 273 K,
ASsystem = 138 JIK

Answers

Answer:

gxibdkkzvsosvjzkxvdkbdsibsisbdkbslabdldvslbskskd

What is a variable? A. Something that must be kept constant in an experiment. B. A value or characteristic that can take different values. C. A statement that explains a phenomena and can be tested. D. An educated guess used in an experiment.

Answers

Answer:

The answer is B, a value or characteristic that can take different values

Explanation:

ex.) 1s + 3

s is the variable

Variables are the varying or unchangeable data or factors in an experimental design. It can be defined as a characteristic that can have different values. Thus, option B is correct.

What is the meaning of variables?

Variables are experimental characteristics that may be consistent or can be changeable. In an experimental design, the variables are used to analyze the cause and effect.

The variables of an experiment can be dependent, independent, or controlled. The varying factors in an experiment to analyze are called independent variables.

The factors that depend and respond to the effect of the independent variables are called dependent variables. These all values are contrasted to the control group with a fixed value.

Therefore, in option B, the variables are the characteristics with the same or different values.

Learn more about variables here:

https://brainly.com/question/13760390

#SPJ2

The decomposition of N2O5 dissolved in carbon tetra chloride occurs followingly at constant temperature. N2O5(solution)⇌2NO2(solution)+1/2 O2(g)
​This reaction is of first order and its rate constant is 5×10^−4 sec^−1? If initial concentration of N2O5 is 0.4 mol litre^−1 then
(i) What will be the initial reaction rate?
(ii) What will be the half-life period of this reaction?
(iii) What time will be taken to complete 75% reaction?

Answers

(i) The initial reaction rate is \(2*10^{-4} mol litre^{-1} sec^{-1.\)

(ii) The half-life period of the reaction is 1386 seconds.

(iii) The time taken to complete 75% of the reaction is approximately 2772 seconds.

We can use the first-order rate equation:

Rate = k[N2O5]

Where:

Rate is the reaction rate,

k is the rate constant,

[N2O5] is the concentration of N2O5.

Given:

Rate constant (k) = \(5*10^{-4} sec^{-1}\)

Initial concentration of N2O5 =\(0.4 mol litre^{-1}\)

(i) To find the initial reaction rate:

Substitute the given values into the rate equation:

Rate = k[N2O5]

Rate = \((5*10^{-4} sec^{-1})(0.4 mol litre^{-1})\)

Rate = \(2*10^{-4} mol litre^{-1} sec^{-1}\)

The initial reaction rate is \(2*10^{-4} mol litre^{-1} sec^{-1}\).

(ii) To find the half-life period:

The half-life of a first-order reaction is given by the equation:

t(1/2) = (0.693 / k)

Substitute the given value of k into the equation:

t(1/2) = \((0.693 / 5*10^{-4} sec^{-1})\)

t(1/2) = 1386 sec

The half-life period of this reaction is 1386 seconds.

(iii) To find the time taken to complete 75% of the reaction:

The time required to complete a certain percentage of a reaction can be found using the equation:

t = (ln(1 / (1 - x)) / k)

Where x is the fraction of the reaction completed (in this case, 75%).

Substitute the given values into the equation:

t =\((ln(1 / (1 - 0.75)) / 5*10^{-4} sec^{-1})\)

t = 2772 sec

The time taken to complete 75% of the reaction is approximately 2772 seconds.

To know more about reaction rate refer here

https://brainly.com/question/13693578#

#SPJ11

WILL GIVE BRAINLIEST!!!

Write word and balanced symbol equations for The reaction of potassium carbonate, K₂CO₃, and sulfuric acid produces potassium sulfate, K₂SO₄, carbon dioxide, CO₂, and water.

Answers

Word equation: Potassium carbonate + sulfuric acid → potassium sulfate + carbon dioxide + water.

Balanced symbol equation:

K₂CO₃ + H₂SO₄ → K₂SO₄ + CO₂ + H₂O.

Word equation: Potassium carbonate + sulfuric acid → potassium sulfate + carbon dioxide + water.

Balanced symbol equation:

K₂CO₃ + H₂SO₄ → K₂SO₄ + CO₂ + H₂O.

In the balanced symbol equation, the numbers in front of each chemical formula indicate the number of molecules or moles involved in the reaction to balance the equation.

For this reaction, we need two molecules of potassium carbonate (K₂CO₃) to react with one molecule of sulfuric acid (H₂SO₄). This results in the formation of two molecules of potassium sulfate (K₂SO₄), one molecule of carbon dioxide (CO₂), and one molecule of water (H₂O).

It is important to note that the subscript numbers are not changed during the balancing process. The coefficients in front of the formulas represent the relative number of molecules or moles involved in the reaction, ensuring that the number of atoms of each element is the same on both sides of the equation.

For more question on equation

https://brainly.com/question/28774454

#SPJ8

How many electron domains does \(N_2\) has?

Answers

6 but i’m not sure someone please correct me if i’m wrong

Explanation:

N2 has 7 electrons. There are two electrons in first shell and five electrons in second shell.

hope this helps you.

Question: What is the coefficient for OH−(aq) when MnO4−(aq) + Fe2+(aq) → Mn2+(aq) + Fe3+(aq) is balanced in basic aqueous solution?

Answers

In the balanced equation for the reaction\(MnO_{4}^-(aq) + Fe_{2} ^+(aq) -- > Mn_{2}^+(aq) + Fe_{3}^+(aq)\) in basic aqueous solution, the coefficient for OH−(aq) is 4.

To balance the given equation in basic aqueous solution, we need to ensure that the number of atoms of each element is equal on both sides of the equation and that the overall charge is balanced. Here's how the equation is balanced:

First, we balance the atoms other than hydrogen and oxygen. The equation becomes:

\(MnO_{4}^-(aq) + 5Fe_{2} ^+(aq)+8H_{2}O(l) -- > Mn_{2}^+(aq) +5 Fe_{3}^+(aq)\)

Next, we balance the oxygen atoms by adding water molecules (H2O):

\(MnO_{4}^-(aq) + 5Fe_{2} ^+(aq)+8H_{2}O(l) -- > Mn_{2}^+(aq) +5 Fe_{3}^+(aq)+4H_{2}O(l)\)

Now, we balance the hydrogen atoms by adding OH−(aq) ions:

\(MnO_{4}^-(aq) + 5Fe_{2} ^+(aq)+8H_{2}O(l) -- > Mn_{2}^+(aq) +5 Fe_{3}^+(aq)+4H_{2}O(l)+4OH^-(aq)\)

Therefore, in the balanced equation, the coefficient for OH−(aq) is 4. This balances the hydrogen atoms and ensures that the equation is balanced in basic aqueous solution.

Learn more about aqueous solution here:

https://brainly.com/question/1382478

#SPJ11

Other Questions
10th grade polynomials, algebra. I'm asking for a friend. (literally) Image below of it. please do part a and b thank youUse the Mean Value Theorem to show that if x > 0, then sinr S. The dimensions of fit include all of the following except ________. a. personorganization b. personsupervisor c. personvalues d. persongroup e. personjob Maggie has a collection of 1,200 Pennies. Of these, 25% are dated before 1980, 35% are dated from 1980-2000.and the rest are dated after 2000How many pennies in Maggie's collection are dated after 2000?A 480 B 720 C 40 D 60 WILL GIVE BRAINLIEST Screen-printing a batch of shirts requires 4 minutes per shirt in addition to 10 minutes of initial set-up time. How long does it take to screen-print a batch of 17 shirts? What is the energy charge for the cell with concentration of atp= 1.000nM , ADP=10.00um, and amp= 3.000uM? Consider the CAPM. The risk-free rate is 6% and the expected return on the market is 18%. What is the expected return on a stock with a beta of 1.3?A) 6%B) 15.6%C) 18%D) 21.6% Find the slope of the following equation. Simplify your answer.5x + 2y = -10 If a teen wants to obtain his/her driver license once they turn 18 the must have a certificate from what alcohol/drug program?. Consider a galvanic cell based on the reaction: Zn(s) Ag (aq) Zn2+ (aq) + Ag(s) The half-reactions are = 0.80 V 2 =-0.76 V Ag+ + e- Ag Zn2+ + 2e- Zn Calculate G for the reaction. WHERE ARE WE GOING? What information do we need to determine Go for the reaction? (Select all that apply.) cell O F 96,485 C/mole n (mol of e) O K (equilibrium constant) What is the result of dividing 2x + 6x + 6x + 2 by x + 1?O 2x + 6x + 2O2x + 4x + 2O 2x + +6x + 12O2x + 4x + 10 Hear is a poemThe Whisper Men:Do you hear the whisper men the whisper men are near if you hear the whisper men then turn away your ear. Do not hear the whisper men whatever else you do, for once you've heard the whisper men They'll turn......and look at you. If you hear the whisper men and you are in their sight. The presence of the whispermen will mean for you 'Good Night' Don't ignore the whisper men they're not just in your head Be fearful of the Whisper men Ignore them.......and your dead. Classify the following microorganisms under Algae, Protozoa, and Fungi.(Spirogyra, paramecium, amoeba, yeast, Agaricus, Trypanosoma, Rhizopus, Penicillium, fucus) GUYS HELP ME WITH THIS WILL MARK BRANLIESTCreate a system of linear equations with no solution. In your final answer, include the system of equations and the graphs of the lines. What is the importance of the carbon and nitrogen cycles to ecosystems?They ensure that matter only moves within a nonliving environment.They are needed to release the energy stored in food.They supply the energy needed for living processes.They provide materials organisms need to build their bodies. (11 - 8)! 2 x 6 What is this answer, I cant get it how are subsistence and commercial farming the similar 678910What is the simplified form of the following expression?7(V2x) - 3(V16x)-3(Vox0 -5(2x)o 2x-6(K)0 -(/2X) - 6(V) Scout is surprised by Walter Cunningham's behavior at dinner. Whatlessons are Calpurnia and Atticus trying to teach her? The vertices of quadrilateral WXYZ are W(-5,5), X(-3, 8), Y(6, 2), and Z(4, -1). What choice is the best description of quadrilateral?A. TrapezoidB. SquareC. rhombous, that is not squareD. rectangle, that is not squarePlease provide explanation. DOn't just say one option.