How many moles of N2 could fit in a 2.00L soda bottle at 23° and 755 Mmhg

Answers

Answer 1

Answer:

convert units --> PV=nRT --> PV/RT=n --> moles to molecules.

(0.993atm*2.00L)/(0.08206*296.15K)=0.08176 mol N2

0.08176 mol*(6.022x10^23 molecules/1 mol)=4.92x10^22 molecules N2

Explanation:


Related Questions

Type the correct answer in the box. Express your answer to three significant figures.
The half-life of carbon-14 is 5,730 years. Dating organic material by looking for C-14 can't be accurately done after
50,000 years.
Suppose a fossilized tree branch originally contained 4.30 grams of C-14. How much C-14 would be left after 50,000 years?
Use the formula N = No (+)*
A tree branch that originally had 4.3 grams of carbon-14 will have
grams after 50,000 years.

Answers

Answer:

0.041 grams of carbon-14 remaining.

Explanation:

The half-life of carbon-14 is the time it takes for half of the original amount of carbon-14 to decay. In this case, the half-life of carbon-14 is 5,730 years. This means that after 5,730 years, half of the original amount of carbon-14 will remain, and half will have decayed.

In this problem, we are given that a fossilized tree branch originally contained 4.30 grams of C-14, and we are asked how much C-14 would be left after 50,000 years. To find this, we need to calculate how many half-lives have occurred over this time period, and then find the resulting amount of C-14.

We can use the formula N = N0 * (1/2)^(t/t1/2) to calculate the amount of C-14 after a given number of half-lives, where N0 is the initial amount of C-14, t is the total time elapsed, and t1/2 is the half-life of the substance.

Plugging in the given values, we get N = 4.30 g * (1/2)^(50000 years / 5730 years/half-life) = 0.041 g.

So, after 50,000 years, the tree branch will have 0.041 grams of carbon-14 remaining.


ALLEN

One of the main terms used in physics to describe the radioactive decay of a specific sample or element over a predetermined amount of time is half-life, also known as half-life period. After 50,000 years, the tree branch will have 0.041 grams of carbon-14 remaining.

What is half-life?

A radioactive material's half-life is typically described as the amount of time it takes for one half of its atoms to decay or change into another substance. Ernest Rutherford made the first discovery of the theory in 1907. It is typically denoted by the letters Ug or t1/2.

Understanding half-lives is crucial because they allow you to determine if a sample of radioactive material is safe to handle. A sample is deemed safe when its radioactivity is below detection thresholds. Ten half-lives later, something occurs.

We can use the formula N = N0 * (1/2)^(t/t1/2)

N = 4.30 g * (1/2)^(50000 years / 5730 years/half-life) = 0.041 g.

To know more about half-life, visit;

https://brainly.com/question/24710827

#SPJ5

Calculate the volume in ml of 0.200 M na2co3 needed to produce 2.00 g of caco3 there is an excess of cacl2
Molar mass of calcium carbonate = 100.09 g/mol

Answers

Answer:

\(V=100mL\)

Explanation:

Hello.

In this case, since the chemical reaction is:

\(Na_2CO_3+CaCl_2\rightarrow CaCO_3+2NaCl\)

We next compute the moles of sodium carbonate from the 2.00 grams of calcium carbonate via their 1:1 mole ratio in the chemical reaction:

\(n_{Na_2CO_3}=2.00gCaCO_3*\frac{1molCaCO_3}{100.09gCaCO_3}*\frac{1molNa_2CO_3}{1molCaCO_3} \\\\n_{Na_2CO_3}=0.0200molNa_2CO_3\)

Thus, by knowing the molarity, we compute the volume:

\(M=\frac{n}{V}\\ \\V=\frac{n}{M}=\frac{0.0200mol}{0.200mol/L}\\ \\V=0.100L*\frac{1000mL}{1L}\\ \\V=100mL\)

Best regards.

The volume in mL of 0.200 M Na₂CO₃ needed to produce 2.00 g of CaCO₃ there is an excess of CaCl₂ is 100mL.

What is molarity?

Molarity is define as no. of moles of solute present in per liter of solvent or solution.

Given chemical reaction is:
Na₂CO₃ + CaCl₂ → CaCO₃ + 2NaCl

From the stoichiometry of the reaction it is clear that:
1 mole of CaCO₃ = produced by 1 mole of Na₂CO₃

Moles of CaCO₃ will be calculated as:

n = W/M, where

W = given mass = 2g

M = molar mass = 100.09g/mole

n = 2/100.09 = 0.0200 moles

0.0200 mole of CaCO₃ = produced by 0.0200 moles of Na₂CO₃

Now we calculate the volume by using molarity as:

V = n/M

V = 0.0200/0.2 = 0.1L = 100mL

Hence, the required volume is 100mL.

To know more about molarity, visit the below link:

https://brainly.com/question/16343005

any science working model idea for science award...​

Answers

The examples of science working model idea for science award are given below. They include solar powered car, water filtration system, wind turbine, etc.

How to explain the example

Here are some ideas for science working models that could be considered for a science award:

Solar-powered car: Build a car that runs on solar power. You can use solar panels to collect energy from the sun and use it to power a small motor. This model can showcase the use of renewable energy sources and their benefits.

Water filtration system: Design a water filtration system that can purify dirty or contaminated water. You can use materials such as sand, gravel, and activated charcoal to create a filter that can remove impurities from water. This model can highlight the importance of access to clean water and the impact of water pollution.

Wind turbine: Create a miniature wind turbine that can generate electricity from wind energy. You can use a small motor and a fan to simulate wind and demonstrate how the turbine can convert the wind's energy into electrical power. This model can show how wind energy can be a viable alternative to traditional energy sources.

Leen more about models on:

https://brainly.com/question/29382846

#SPJ1

Balance the following chemical equations.
Zn + HCI -> H2+ZnCI2

CS2+O2 -> CO2 + SO2

30 POINTS FOR ALL

if its incomplete or wrong ill report you lol

Answers

Answer:

Zn + 2HCl -> H2 + ZnCl2

CS2 + 2O2 -> CO2 + S2O2

Explanation:

The volume of a gas is directly proportional to its temperature (in Kelvin) at constant
pressure. What does this mean?
As one increases, the other will increase at the same rate. The graph will show a
straight line.
As one increases, the other will decrease at the same rate. The graph will show a
straight line.
As one increases, the other will decrease at the same rate. The graph will show a
inverse line.
As one increases, the other will increase at the same rate. The graph will show an
inverse line.

The volume of a gas is directly proportional to its temperature (in Kelvin) at constantpressure. What

Answers

Answer: A

Explanation:

As one increases the other goes in a straight line.  It is called a direct proportionality.  Forms a linear graph.

!!(100 points)!! For each of the following chemical formulas, identify the elements present and the number of atoms of each element present in each molecule of the substance: H2SO4, Ca(NO3)2

Answers

Answer:

H2SO4 Chemical Name

It contains two atoms of hydrogen, one atom of sulphur, and four atoms of oxygen. It has an atomicity of seven.

Calcium Nitrate is made up of three different elements and contains a total of nine atoms. This compound's formula is Ca(NO3)2. There is one calcium atom, two nitrogen atoms, and there are six oxygen atoms in calcium nitrate.

H2SO4:

-Elements present:

Hydrogen (H), Sulfur (S), Oxygen (O)

Number of atoms of each element present in each molecule of the substance:

Hydrogen (H): 2 atoms

Sulfur (S): 1 atom

Oxygen (O): 4 atoms



Ca(NO3)2:

Elements present:

Calcium (Ca), Nitrogen (N), Oxygen (O)

Number of atoms of each element present in each molecule of the substance:

Calcium (Ca): 1 atom

Nitrogen (N): 2 atoms

Oxygen (O): 6 atoms (2 from each NO3 group)

please help!!
62.4 mL of an H2SO3 solution
were titrated with 65.25 mL of a
0.235 M KOH solution to reach the
equivalence point. What is the
molarity of the H2SO3 solution?

please help!!62.4 mL of an H2SO3 solutionwere titrated with 65.25 mL of a0.235 M KOH solution to reach

Answers

The concentration of H₂SO₃ solution is equal to 0.123 M.

What is a neutralization reaction?

A neutralization reaction is described as a reaction in which an acid and base react to form salt and water. When a strong acid will react with a base then the salt which is formed can be neither acidic nor basic.

When H₂SO₃ (a strong acid) reacts with KOH, the resulting salt is K₂SO₃  and water.

H₂SO₃  +  2KOH   →   K₂SO₃  +   2H₂O

Given, the concentration of KOH = 0.235 M

The volume of the KOH = 65.25 ml = 0.06525 L

The number of moles of KOH, n = M × V = 0.235 × 0.06525 = 0.0153 M

The volume of the  H₂SO₃ = 62.4 ml = 0.0624 L

The number of moles of  H₂SO₃, n = 0.0153/2 = 0.00767 mol

The concentration of H₂SO₃ =0.00767/0.0624 = 0.123 M

Therefore, the molarity of  H₂SO₃ is 0.123 M.

Learn more about neutralization reaction, here:

brainly.com/question/20038776

#SPJ1

olecular iodine, I2(g), dissociates into iodine atoms at 625 K with a first-order rate constant of 0.271 s-1. (a) What is the half-life for this reaction? s (b) If you start with 0.048 M I2 at this temperature, how much will remain after 5.37 s assuming that the iodine atoms do not recombine to form I2? M

Answers

Answer:

* \(t_{1/2}=2.56s\)

* \([I_2]=0.011M\)

Explanation:

Hello,

In this case, considering the reaction:

\(I_2(g)\rightarrow 2I\)

Which is first-order with respect to I₂, we can compute the half-life by:

\(t_{1/2}=\frac{ln(2)}{k}=\frac{ln(2)}{0.271s^{-1}}\\ \\t_{1/2}=2.56s\)

Moreover, since the integrated rate law is:

\([I_2]=[I_2]_0exp(-kt)\)

We can compute the concentration of iodine once 5.37 s have passed:

\([I_2]=0.048Mexp(-0.271s^{-1}*5.37s)\\\\\)

\([I_2]=0.011M\)

Best regards.

Gаvе аn example of how energy from the sun gets into your cells

Answers

Answer:

production of vitamin D

what does 2+2 eqaul im really dum

Answers

2+2= 4 basic math!!!
2+2 is like 1+1+1+1 all you have to do is add it all together and it equals 7

explain why d-block and transition metal should not be used interchangeably ?

Answers

Answer:

The d-block and transition metal are not interchangeable terms because the d-block elements are a subset of the transition metal elements. The transition metals are defined as the elements that have partially filled d orbitals, which includes the d-block elements as well as other elements that have partially filled d orbitals in other blocks, such as lanthanides and actinides. Therefore, while all d-block elements are transition metals, not all transition metals are d-block elements.

What is the median reaction of second end point in HCL and NaOH titration

Answers

The median reaction at the second end point in the HCl and NaOH titration is: HCl + NaOH → NaCl + H2O

In a titration between hydrochloric acid (HCl) and sodium hydroxide (NaOH), the reaction involved is the neutralization reaction between an acid and a base. The balanced equation for this reaction is:

HCl + NaOH → NaCl + H2O

In this reaction, one mole of HCl reacts with one mole of NaOH to form one mole of NaCl (sodium chloride) and one mole of water.

During the titration process, the reaction occurs gradually as the base is added to the acid solution.

The first end point of the titration is reached when the moles of HCl and NaOH are stoichiometrically equivalent, meaning they react in a 1:1 ratio. At this point, all the HCl has been neutralized by the NaOH, and no excess of either reagent remains.

However, if the titration is continued beyond the first end point, the reaction between HCl and NaOH can still occur, albeit in a different ratio.

The second end point refers to the point where the moles of NaOH added exceed the stoichiometrically required amount to neutralize the HCl completely. As a result, any excess NaOH added after the second end point reacts with the excess HCl in a 1:1 ratio.

Therefore, the median reaction at the second end point in the HCl and NaOH titration is:

HCl + NaOH → NaCl + H2O

For more such question on  median reaction visit:

https://brainly.com/question/14189499

#SPJ8

In fall, leaves may change from green to yellow or red. Explain in your own words what is happening inside the leaf with regard to plant pigments. ​

Answers

Answer:

The pigment that causes leaves to be green is chlorophyll. ... As chlorophyll goes away, other pigments start to show their colors. This is why leaves turn yellow or red in fall. In fall, plants break down and reabsorb chlorophyll, letting the colors of other pigments show through.

A sample of unknown pressure occupies 0.776L at a temperature of 298K. The sample of gas is then tested under known

conditions and has a pressure of 32.6 kPa and occupies 0.664L at 303K. What was the original pressure of the gas?

A. 27.43 kPa

B. 38.62 kPa

C. 58.73 kPa

D. 84.11 kPa

Answers

Answer:

27.43 kPa (Option A)

Explanation:

We can solve this by the use of the Ideal Gases Law.

P . V = n . R . T

As n and R are constant, we avoid them from the equation so:

P₁ . V₁ / T₁ = P₂ . V₂ / T₂

P₁ . 0776L / 298K = 32.6 kPa . 0.664L / 303K

P₁ . 0776L / 298K = 0.0714 kPa .L/K

P₁ . 0776L = 0.0714 kPa .L/K  . 298K

P₁ = 21.289 kPa.L / 0.776L

P₁ = 27.43 kPa

What are all of the mole ratios of MgCl2 -> Mg+ Cl2

Answers

Answer:

2 moles

In words, 1 mole of Mg reacts with 2 moles of HCl to form 1 mole of MgCl₂ and 1 mole of H₂. The molar ratio of HCl to MgCl₂ is 2:1.

You can identify a metal by carefully determining its density d. An unknown piece of metal with a mass of 29.454 g, is 2.35 cm long, 1.34 cm wide, and 1.05 cm thick. Which of following is the element?
a) Titanium, d = 4.50 g/cm3 b) Zinc, d = 7.14 g/cm3
c) Nickel, d = 8.91 g/cm3 d) Tin, d = 7.23 g/cm3

Answers

Answer:b zinc ,d=7.14g/

Explanation:

pls help i will mark as brainliest​

pls help i will mark as brainliest

Answers

Answer:

ano po ito?? isa po ba itong story

Who was on the grand committee

Answers

Answer:

European Union was on grand committee

Answer:

European Union

Explanation:

hehe

Which symbol in a chemical equation separates the reactants from the products?

Answers

Answer:

The arrow symbol in a chemical equation separates the reactants from products. A chemical reaction is process in which chemical changes leads to the formation of products from reactants.

Explanation:

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

which compoud is propanic acid​

Answers

Answer:

Explanation:

Propionic acid  has chemical formula of  C₃H₆O₂ , and smells somewhat unpleasant (like body odour).

Mangrove trees grow in swampy areas and have strong roots that hold the soil in place. How is this helpful for the environment?


a

They absorb water from the soil.


b

They overtake the environment.


c

They provide wood for humans.


d

They protect the land from eroding

Answers

Mangrove trees' robust roots aid in stabilizing the soil and preventing soil erosion. This is especially crucial in swampy coastal locations, where the soil is frequently loose and prone to wind and wave erosion. Mangrove trees work to stabilize the coastline and stop land erosion by securing the soil in place.

Mangrove trees also aid in removing contaminants from the water, enhancing the quality of the water in coastal areas while serving as an essential home for a variety of wildlife species. Mangrove trees contribute significantly to environmental protection and are an essential component of coastal ecosystems.

Mangrove trees are crucial for environmental preservation because they hold the soil in place and stop erosion in marshy coastal areas. They also provide crucial habitats for numerous wildlife species, stabilize the coastline, and stop the land from being lost to erosion while enhancing water quality by filtering pollutants from the ocean.

Mangrove trees are an essential part of coastal ecosystems overall, and preserving them is essential for preserving a healthy and sustainable environment.

learn more about Mangrove trees here

https://brainly.com/question/19385367

#SPJ1

i need help answering number 1 and number 3 50 points!!

i need help answering number 1 and number 3 50 points!!

Answers

The removal of hydrogen or any other electropositive element, or the addition of oxygen, is said to be the process of oxidation in classical or earlier concepts. An atom or ion gains one or more electrons during the process of reduction.

1. The oxidation half-reaction of copper is:

Cu  → Cu²⁺ + 2e⁻

The reduction half is:

Cu²⁺ + 2e⁻ → Cu

3. An anode in electrochemistry is, in its simplest form, the site of an oxidation reaction. Due to the anode's electrical potential, negative ions or anions usually react there and release electrons. After that, these electrons ascend and enter the drive circuit.

In chemistry, the cathode is referred to as the electrode where reduction takes place. In an electrochemical cell, this is typical. Here, the cathode is negative because the cell's electrical energy supply causes chemical molecules to break down.

To know more about anode, visit;

https://brainly.com/question/17109743

#SPJ1

3. The doctor notices that Janet has long fingernails, and comments that fingernails grow at a rate (or
speed) of 2.50 cm / year. Convert this speed to kilometers / second. Show your work. (6 pts)

Answers

Answer:

7.93 × 10⁻¹³ km/s

Explanation:

Step 1: Given data

Rate of growth of the fingernails (r): 2.50 cm/year

Step 2: Convert "r" from cm/year to km/year

We will use the following conversion factors.

1 m = 100 cm1 km = 1000 m

\(\frac{2.50cm}{year} \times \frac{1m}{100cm} \times \frac{1km}{1000m} = 2.50 \times 10^{-5} km/year\)

Step 3: Convert "r" from km/year to km/s

We will use the following conversion factors.

1 year = 365 day1 day = 24 h1 h = 60 min1 min = 60 s

\(\frac{2.50 \times 10^{-5} km}{year} \times \frac{1year}{365day} \times \frac{1day}{24h} \times \frac{1h}{60min} \times \frac{1min}{60s} = 7.93 \times 10^{-13} km/s\)

2.50 cm/year is equal to 7.93 × 10⁻¹³ kilometers/second.

Explain why the electron configuration of 2-3-1 represents an atom in an excited state.

Answers

Answer:

The excited state electron configuration of an atom indicates the promotion of a valence electron to a higher energy state.

What is the oxidation number of chlorine in KClO3?
Group of answer choices

A. +5

B. +1

C. -5

D. -1

Answers

The oxidation number of chlorine in KClO3 is +5 (option A).

How to calculate oxidation number?

The oxidation number of an element is the hypothetical charge of an atom within a molecule.

The oxidation number of an element like chlorine in a compound like Pottasium chlorate can be calculated as follows:

The oxidation number of the elements in KClO3 is as follows:

K = +1Cl = xO = -2

1 + x - 2(3) = 0

x - 5 = 0

x = +5

Therefore, the oxidation number of chlorine in KClO3 is +5.

Learn more about oxidation number at: https://brainly.com/question/15167411

#SPJ1

Help This is one of the questions

Help This is one of the questions

Answers

City centre has the greatest range

Electromagnetic Waves can propagate (move through);

Answers

Answer:

Electromagnetic waves differ from mechanical waves in that they do not require a medium to propagate. This means that electromagnetic waves can travel not only through air and solid materials, but also through the vacuum of space.

Explanation:

How many moles is 8.42 x 10^22 representative particles of iron (III) oxide?

Answers

Answer:

1 Mole = 602 billion trillion. 602,000,000,000,000,000,000,000; 6.02 X 1023 (this is known as Avogadro's number) ... 1 mole of H2O= about 1/3 of a cup (18 mL). It is helpful in ... x 1023 particles. Note: Particles could refer to atoms, molecules, formula units ... How many moles of Sulfur (S) are in 1.8 x 10 24 atoms of sulfur ?

Explanation:

Please help me do this

Please help me do this

Answers

The total mass of the balloon and its content is 1521.17 g, the number of moles of CO₂ in the balloon is 34.15 mol, and the number of CO₂ molecules in the balloon is 2.06 x 10²⁵ molecules.

a) The molar mass of CO₂ is 44.01 g/mol. To find the total mass of the balloon and its content, we need to add the mass of the balloon (20g) to the mass of the CO₂ inside the balloon.

Mass of CO₂ = number of moles of CO₂ x molar mass of CO₂

Since the balloon is at STP (standard temperature and pressure), we can use the molar volume of a gas at STP (22.4 L/mol) to find the number of moles of CO₂ in the balloon:

Volume of CO₂ = Volume of balloon = 765 L (at STP)

Number of moles of CO₂ = volume of CO₂ / molar volume of a gas at STP

                                          = 765 L / 22.4 L/mol

                                          = 34.15 mol

Mass of CO₂ = 34.15 mol x 44.01 g/mol

                       = 1501.17 g

Total mass of balloon and its content = 20 g + 1501.17 g

                                                               = 1521.17 g

b) Number of moles of CO₂ in the balloon is 34.15 mol

c) To find the number of CO₂ molecules in the balloon, we need to use Avogadro's number (6.02 x 10²³ molecules/mol).

Number of CO₂ molecules = number of moles of CO₂ x Avogadro's number

                                           = 34.15 mol x 6.02 x 10²³ molecules/mol

                                           = 2.06 x 10²⁵ molecules

To know more about the Mass, here

https://brainly.com/question/22104139

#SPJ1

Other Questions
A grilled chicken salad at a popular fast food restaurant contains 640 milligrams (mg) of sodium, which is 27% of the recommended daily amount. What is the total recommended daily amount, in milligrams, of sodium? (Round your answer to one decimal place.) mg Who is Swift using satire in A Modest Proposal? SOMEONE PLEASE HELP MEE A family travels 613.4 miles in 11.5 hours estimate the number of miles they can travel in one hour under what conditions would the following methods be useful teaching techniques: role-playing, debates, simulations, and laboratories? What are the effect of climate change in Europe? Pls help me with this question thank you my daughter is 13 and she had her last period in June,its now november and her period has not came, its only her first year with her menstrual and i'm very worried. The best test from the options below to tap into middle childhood participants ability to retrieve information from long term memory and manipulate it would be the a. troop Test b. Mental Fusion Task c. Visual Decision Span Task d. Decision Making what's the first step of solving 3x+2=17 Explain why a cell is like a city. money management decisions include deciding how much credit to obtain to support your spending and what sources of credit to use. metabolism includes both anabolism and catabolism. in hyperthyroidism, the metabolic rate is increased because . metabolism includes both anabolism and catabolism. in hyperthyroidism, the metabolic rate is increased because . anabolic reactions are increased in muscles and bones catabolic reactions are decreased in muscles and bones the rate of exergonic reactions is increased atrophied tissues (e.g., muscle tissue) compensate for their decreased mass by increasing their synthesis of macromolecules What is the value of the y-coordinate of the ordered pair that reflects (2-12) over the x-axis? Convert 75k to oC(Ill mark you as brainlister) Plsplspls help 22 points and brainly ONLY ANSWER IF YK THE ANSWER TY!! :) A horizontal vise with a movable front apron used to make numerous folds in sheet metal is a ________. A.Brake B.Crimper C.Drive slip D. Pittsburgh lock machineThe number of threads per inch on a screw is the _______.A. Flange B. Pitch C. Tolerance D.Diameter A fixed income security where the borrower, like a government or corporation, agrees topay back the investor/lender with a certain interest rate and duration, is called:debit cardthe gold standarda bearera bond Worth 15 points! (if you want the points and put random words your gonna be reported)Math problem : Jerrys rhombus has a base of 15 inches and a height of 9 inches. Charlenes rhombus has a base and height that are 1/3 the base and height of Jerrys rhombus. Compare the area of Charlenes rhombus to the area of Jerrys rhombus.Question : The area of Charlene's rhombus is _______ of the area of Jerry's rhombus.Jerrys rhombus has an area of 15 x 9. The base of Charlenes rhombus is ________ inches and the height is ________ inches, giving it an area of ________. Which postulate or theorem proves that these two triangles arecongruent? SAS Congruence PostulateO HL Congruence TheoremQ AAS Congruence Theorem ASA Congruence Postulate