How many moles are in 234.4 grams of oxygen

Answer:

This is an outer planet!

Answer:

C-14 have 8 neutrons in the nucleus.

Carbon atoms with 8 neutrons have an atomic mass of 14 (6 protons + 8 neutrons = 14), so this isotope of carbon is named carbon-14.

hope it helps :)

Explanation:

Answer:

its d

Explanation:

edge 21

Answer:put the rabbits mixed

Explanation:

Compounds with the general structural formula RCOOH are known as carboxylic acids.

Carboxylic acids are a group of organic compounds that contain one or more carboxyl groups. In a carboxyl group, a carbon atom is double-bonded to an oxygen atom and single-bonded to a hydroxyl group (-OH). Carboxylic acids have the general structural formula RCOOH where R represents an alkyl group or an aryl group. These compounds are classified as weak acids and can be used as precursors in the production of a variety of other chemicals such as esters, anhydrides, and amides.

Carboxylic acids are widely found in nature, especially in fruits and vegetables. Some of the common examples of carboxylic acids include acetic acid, citric acid, and lactic acid. The acidity of carboxylic acids is due to the presence of the carboxyl group, which can donate a proton to a base. Carboxylic acids are important in biological systems as they are involved in many metabolic processes.

Learn more about carboxylic acids here:

https://brainly.com/question/28558502

#SPJ11

Answer: The percent is 25.263%

Explanation:

Answer:

D. compound

Explanation:

Answer:

compound

Explanation:

study island

we are given the mass of NH4Br as 14.g and the volume of the solution as 150mL

we are require to find the molarity of the solution

we first need to fin the mols of NH4Br in 14.g we can do this using the formula

n = m/M

where n is the molsm m is the mass and M is the molar mass of NH4Br

so;

n = 14.0/97.94

= 0.143 mols

now that we have the mols of NH4Br, we can find the molarity by simply using the formula

C = n/V

where

C = Concentration or molarity

n = number of mols

v = volume of the solution in L

therefore;

C = 0.143/ 0.150

= 0.953 M

therefore b is the correct option

Rebekah reports the volume of sugar solution using metric system as 39.1 mL. Thus, option D is correct.

The metric system has been the measurement system introduced in 1790s. The system has mediated the units for the measurement of volume, mass, length.

The volume has been the space that has been occupied by matter. The volume can be denoted with SI unit L. However, the another accepted unit for volume has been mL.

Thus, the volume of sugar solution has been reported in mL.

The given sugar solution has volume of 1.32 fl. Oz

The volume in mL can be given as:

\(\rm 1\;fl\;Oz=29.6\;mL\\1.32\;fl\;Oz=1.32\;\times\;29.6\;mL\\1.32\;fl\;Oz=39.1\;mL\)

The volume of the sugar solution reported by Rebekah on the metric scale has been 39.1 mL. Thus, option D is correct.

For more information about the metric system, refer to the link:

https://brainly.com/question/25011390

The expect condensation of droplets followed by freezing to occur at this temperature as well. Ice particles can form on the surfaces of Kaolinite of reaction function.

To find the total reaction to drug, we need to integrate the rate of reaction function over the given time interval. The rate of reaction is given by R'(t) = 3/2. To find the total reaction, we need to integrate the rate of reaction function over the given time interval. However, the time interval is not provided in the question. Please provide the time interval so that we can proceed with the calculations. the equilibrium vapor pressure with respect to water (eow) is greater than the equilibrium vapor pressure with respect to ice (coi). The expect condensation of droplets followed by freezing to occur at this temperature as well. Ice particles can form on the surfaces of Kaolinite particles as the air is supersaturated with respect to ice.

Learn more about reaction function here

https://brainly.com/question/15461654

#SPJ11

The cathode rays are also known as electrons. They are a stream of negatively charged particles.

The term cathode rays were used by JJ Thompson to describe a stream of rays that emanate from the cathode in a cathode ray tube. These rays correspond to what we know today as electrons.

The cathode rays;

Learn more about cathode rays: https://brainly.com/question/1825212

Electron beams such as cathode rays travel in a straight line.

Cathode rays are electrons that are observed in vacuum tubes, is streams of electrons are emitted by the negative electrode.

Therefore, cathode rays traveled in straight lines, they were the composition of the material from which they originated, and they carried a negative electrical charge.

Learn more on cathode rays here,

https://brainly.com/question/4441361

The linear differential equation that represents the amount of salt in the tank is A' + A/(175-3t) - 54 = 0. The integrating factor for this equation is 72. The solution can be determined using this integrating factor.

To solve the linear differential equation, we multiply both sides of the equation by the integrating factor, which is 72. This results in the equation 72A' + (72A)/(175-3t) - 54(72) = 0. Simplifying further, we have 72A' + (72A)/(175-3t) - 3888 = 0. By rearranging the equation, we get 72A' + (72A)/(175-3t) = 3888. This equation can be rewritten as (72A)' = 3888. Integrating both sides, we have 72A = 3888t + C, where C is the constant of integration. To find the specific solution, we need initial conditions or additional information provided in the problem statement. A linear differential equation is an equation that involves a linear combination of the function and its derivatives.

Learn more about linear differential equations here:

https://brainly.com/question/30330237

#SPJ11

The effect on the rate of reaction for this SN1 process when doubling the concentration of t-butyl bromide is an increase by a factor of 2, while quadrupling the concentration of methanol will have no impact on the rate.

In the solvolysis of t-butyl bromide in methanol, t-butyl methyl ether is produced through an SN1 reaction. When discussing the rate of an SN1 reaction, it's important to note that it is a two-step process involving the formation of a carbocation intermediate. The rate-determining step (RDS) is the first step, which involves the ionization of t-butyl bromide to form a carbocation and a bromide ion.

The rate of an SN1 reaction is directly proportional to the concentration of the substrate (t-butyl bromide) and independent of the concentration of the nucleophile (methanol). Thus, doubling the concentration of t-butyl bromide will double the rate of reaction, as it increases the availability of the substrate for ionization.

On the other hand, quadrupling the concentration of methanol will not affect the rate of the reaction, as it is not involved in the RDS. Methanol reacts with the carbocation in the second step, which is a fast step and does not determine the overall rate.

For more such questions on t-butyl bromide, click on:

https://brainly.com/question/24244711

#SPJ11

The pairs of compounds that are isomers are: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3, CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3, CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.

Isomers are the molecules which have the same molecular formula but differ in the arrangement of their atoms. The following pairs of compounds are isomers: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3.CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3.CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.In the first pair of compounds, the molecule on the left is n-butane, while the molecule on the right is 2-methylpropane or isobutane. They are isomers because both have the same molecular formula C4H10, but different structures.2. In the second pair of compounds, the molecule on the left is octane, while the molecule on the right is 2-methylheptane.

These compounds have the same molecular formula, C8H18, but different structures.3. In the third pair of compounds, the molecule on the left is 2-methylpentane, while the molecule on the right is 3-methylpentane.

They are isomers because they have the same molecular formula C6H14, but different structures.4.

In the fourth pair of compounds, the molecule on the left is 2,3-dimethylbutane, while the molecule on the right is 2,4-dimethylpentane.

They are isomers because they have the same molecular formula C8H18, but different structures.5. In the fifth pair of compounds, the molecule on the left is isopropyl group, while the molecule on the right is n-propyl group.

They are isomers because they have the same molecular formula C3H7, but different structures.

In conclusion, the pairs of compounds that are isomers are: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3, CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3, CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.

To know more about isomers visit:

brainly.com/question/32508297

#SPJ11

The property of water that allows it to dissolve many substances is its polarity.

What is polarity?

Polarity refers to the distribution of electrical charge in a molecule. A polar molecule has an uneven distribution of electrons, resulting in a partial positive charge on one end of the molecule and a partial negative charge on the other end. This creates a dipole moment in the molecule.

Water molecules are polar, meaning that the electrons in the molecule are not distributed evenly, resulting in a partial positive charge on one end of the molecule and a partial negative charge on the other end.

This polarity allows water molecules to form hydrogen bonds with other polar or charged molecules, such as ions and polar compounds. This type of bonding allows many substances, such as salt and sugar, to dissolve in water.

Additionally, the polarity of water molecules also allows them to interact with nonpolar substances through London Dispersion Forces, which also allows some nonpolar substances to be dissolved in water.

Hence, the polarity of water allows it to dissolve many substances.

To learn more about polarity from the given link:

https://brainly.com/question/8229259

#SPJ4

The amount of concentrated solution needed is (0.286 M)(65 mL) / C M, and the amount of water needed is 65 mL minus the volume of the concentrated solution.

To calculate the molarity of Kool Aid desired, we need to determine the number of moles of Kool Aid powder and sugar in the package. Since the molecular formula for sugar is C12H22O11, we can calculate its molar mass as follows:

Molar mass of C12H22O11 = (12 * 12.01) + (22 * 1.01) + (11 * 16.00)

= 144.12 + 22.22 + 176.00

= 342.34 g/mol

Given that the package contains 4.25 grams of Kool Aid powder, we can calculate the number of moles of Kool Aid powder using its molar mass:

Number of moles of Kool Aid powder = Mass / Molar mass

= 4.25 g / 342.34 g/mol

≈ 0.0124 mol

Similarly, for the sugar, which has a molar mass of 342.34 g/mol, we can calculate the number of moles of sugar using its mass:

Number of moles of sugar = Mass / Molar mass

= 192.00 g / 342.34 g/mol

≈ 0.5612 mol

Now, to calculate the molarity of the desired Kool Aid solution, we need to determine the volume of water. Given that 1.06 quarts is equal to 1 liter, and we have 2.00 quarts of water, we can convert it to liters as follows:

Volume of water = 2.00 quarts * (1.06 liters / 1 quart)

= 2.12 liters

To find the molarity, we use the formula:

Molarity (M) = Number of moles / Volume (in liters)

Molarity of Kool Aid desired = (0.0124 mol + 0.5612 mol) / 2.12 L

≈ 0.286 M

To prepare 65 mL of the desired molarity, we can use dilution calculations. We need to determine the volume of concentrated solution and the volume of water needed.

Let's assume the concentration of the concentrated Kool Aid solution is C M. Using the dilution formula:

(C1)(V1) = (C2)(V2)where C1 is the initial concentration, V1 is the initial volume, C2 is the final concentration, and V2 is the final volume.

Given that C1 = C M and V1 = V mL, and we want to prepare a final volume of 65 mL (V2 = 65 mL) with a final concentration of 0.286 M (C2 = 0.286 M), we can rearrange the formula to solve for the volume of the concentrated solution:

(C M)(V mL) = (0.286 M)(65 mL)

V mL = (0.286 M)(65 mL) / C M

So, the amount of concentrated solution needed is (0.286 M)(65 mL) / C M, and the amount of water needed is 65 mL minus the volume of the concentrated solution.

For more such questions on concentrated visit:

https://brainly.com/question/28564792

#SPJ8

The enthalpy change for the dissolution of KBr in water is -71.56 kJ/mol.

To calculate the enthalpy change for the dissolution of KBr in water, we can use the following formula:

ΔH = -q / n

where ΔH is the enthalpy change, q is the heat absorbed or released by the reaction, and n is the number of moles of KBr dissolved.

First, let's calculate the heat absorbed or released by the reaction using the following formula:

q = m × c × ΔT

where q is the heat, m is the mass of the solution, c is the specific heat capacity of water (4.184 J/g·°C), and ΔT is the temperature change.

m = 11.4 g KBr + 100.0 g water = 111.4 g

ΔT = 24.88°C - 20.34°C = 4.54°C

q = 111.4 g × 4.184 J/g·°C × (-4.54°C) = -20891 J

The negative sign indicates that the reaction releases heat to the surroundings.

Next, let's calculate the number of moles of KBr dissolved:

n = mass / molar mass

molar mass of KBr = 39.10 g/mol (from periodic table)

n = 11.4 g / 39.10 g/mol = 0.2918 mol

Finally, we can calculate the enthalpy change:

ΔH = -q / n = -(-20891 J) / 0.2918 mol = 71560 J/mol

To convert J/mol to kJ/mol, we divide by 1000:

ΔH = 71.56 kJ/mol

Therefore, the enthalpy change for the dissolution of KBr in water is -71.56 kJ/mol.

Learn more about the dissolution

https://brainly.com/question/23851972

#SPJ4

The arrangement of the gases in terms of  deviations from ideal behavior is; chlorine > fluorine > oxygen > Nitrogen.

We know that gases tend to follow the idea gas law. The gases that have ideal behavior tend to show this behavior at high temperatures and low pressure such that the interactions between the gas molecules could be regarded as non existent.

Now; we know that the greater the molar mass of the gas, the greater the gas tends to depart from ideal behavior. As such we would tend to arrange the gases in order of decreasing molar mass.

Learn more about ideal behavior:https://brainly.com/question/9156790

#SPJ1

Answer:

???

Explanation:

Answer:

the sour food changed

Explanation:

because the molecules were able to move fast enough to overcome the attraction between them, it's molecules now move in place

Answer:

The element was one of the alkaline metals, the dull appearance comes from the metal reacting with oxygen and oxidizing its outer surface as alkaline are known for their enormous reaction with oxygen in the air and water.

Another ability of this group of elements is the ability to conduct electricity. And they are also easy to cut with a kitchen knife.

Answer:

5.5 × 10²² formula units Al₂O₃

General Formulas and Concepts:

Chemistry - Stoichiometry

Explanation:

Step 1: Define

9.3 g Al₂O₃

Step 2: Define conversions

Avogadro's Number

Molar Mass of Al - 26.98 g/mol

Molar Mass of O - 16.00 g/mol

Molar Mass of Al₂O₃ - 2(26.98) + 3(16.00) = 101.96 g/mol

Step 3: Convert

\(9.3 \ g \ Al_2O_3(\frac{1 \ mol \ Al_2O_3}{101.96 \ g \ Al_2O_3} )(\frac{6.022 \cdot 10^{23} \ formula \ units \ Al_2O_3}{1 \ mol \ Al_2O_3} )\) = 5.4928 × 10²² formula units Al₂O₃

Step 4: Check

We are given 2 sig figs. Follow sig fig rules.

5.4928 × 10²² formula units Al₂O₃ ≈ 5.5 × 10²² formula units Al₂O₃

Answer:

B. electrons and protons.

Explanation:

In an electrically neutral atom of any element, there are equal number of protons and electrons in the atom.

Protons are the positively charged particles in an atom.

Electrons are the negatively charged particles within the atom.

  When the number of protons and electrons are the same or equal, the atom is neutral.

But when there is an imbalance, an ion results.

I think you forgot to upload the image. Create a new question including the image so that we can see the question.

Answer:

2450000 gram

Explanation:

v= m × ρ= 1 cubic meter × 2.45 gram/cubic centimeter= 1000000 cubic centimeter × 2.45 gram/cubic centimeter= 2450000 gram

Explanation:

v=m over D

mass=20.oog

Density=2.45g

20.00-2.45

ans is 17.46

Based on the given information, it is not possible to determine whether the concentration of the products yields a Ksp of 2.1 x 10^-2. The Ksp value represents the equilibrium constant for the dissolution of a sparingly soluble salt in water. It is determined by the concentrations of the dissociated ions in a saturated solution at equilibrium.

The given value of Ksp = 1.8 x 10^-2 indicates that the equilibrium constant for the reaction has been previously determined. However, without knowing the actual concentrations of the products (Pb^2+ and Cl^-) in the solution, we cannot conclude whether the calculated Ksp of 2.1 x 10^-2 is accurate or not.

To determine the concentration of the products, additional information, such as the solubility of the PbCl2 salt, is needed. By comparing the actual concentrations of the products with the calculated Ksp, it can be determined if the system is at equilibrium or not. If the calculated Ksp matches the experimentally observed concentration values, then it can be concluded that the concentrations of the products yield a Ksp of 2.1 x 10^-2.

In summary, the provided information is insufficient to determine if the concentration of the products yields a Ksp of 2.1 x 10^-2. More details, such as the solubility of PbCl2, are required to make a definitive conclusion.

for such more questions on  concentrations

https://brainly.com/question/28564792

#SPJ8

Answer:

tendinitis.

carpal tunnel syndrome.

osteoarthritis.

rheumatoid arthritis (RA)

fibromyalgia.

bone fractures.