How many liters of oxygen are necessary for the combustion of 425 g of sulfur, assuming that the reaction occurs at STP

Answers

Answer 1

Answer:

V = 296.6 liters of oxygen.

Explanation:

The reaction of combustion of sulfur is:

O₂(g) + S(s) → SO₂(g)        (1)

To find the volume of the oxygen we need to use the Ideal Gas Law:

\( V = \frac{n_{O}RT}{P} \)   (2)

Where:

V: is the volume

\(n_{O}\): is the number of moles of oxygen

R: is the gas constant = 0.082 L*atm/(K*mol)

T: is the temperature = 273 K (at STP)

P: is the pressure = 1 atm (at STP)

So we need to find the number of moles of oxygen that reacts with sulfur:

\(n_{S} = \frac{m}{M}\)

Where:

\(n_{S}\): is the number of moles of sulfur

m: is the mass of sulfur = 425 g

M: is the molar mass of sulfur = 32.065 g/mol                                                                            

\(n_{S}=\frac{m}{M} =\frac{425 g}{32.065 g/mol} = 13.25 moles\)

From reaction (1) we have that 1 mol of O₂ reacts with 1 mol of S, hence the number of moles of oxygen is:

\( n_{S} = n_{O} = 13.25 moles \)  

Finally, the volume of oxygen is (equation (2)):

\(V = \frac{13.25 moles*0.082 L*atm/(K*mol)*273 K}{1 atm} = 296.6 L\)

Therefore, are necessary 296.6 liters of oxygen for the combustion of sulfur.

             

I hope it helps you!


Related Questions

The charge on tin in Sn(S04)2 is​

Answers

Answer: hope this helps

Explanation: you need to solve this first I believe

The sulfate ion has an overall charge of -2, this means that the tin cation must have a charge of +2 so that the charges will cancel out when the charges are transposed when writing the chemical formula of the compound.

write the condensed (noble-gas) electron configuration of iodine. for multi-digit superscripts or coefficients, use each number in succession.

Answers

Iodine, its atomic number is 53. Its complete electron configuration is 1s² 2s² 2p⁶ 3s² 3p⁶ 4s² 3d¹⁰ 4p⁶ 5s² 4d¹⁰ 5p⁵ or [Kr] 5s² 4d¹⁰ 5p⁵.

The electron configuration of an atom is the representation of the arrangement of electrons distributed among the orbital shells and subshells.

The four different types of orbitals, s,p,d, and f have different shapes, and one orbital can hold a maximum of two electrons.

The p, d, and f orbitals have different sublevels, thus can hold more electrons. As stated, the electron configuration of each element is unique to its position on the periodic table.

Learn more about electron configuration here:- https://brainly.com/question/26084288

#SPJ4

Considere la combustión del monóxido de carbono (CO) en oxígeno gaseoso: 2CO(g) + O2(g) → 2CO2(g) Si la reacción se inicia con 3.60 moles de CO, calcule el número de moles de CO2 que se producen si hay suficiente oxígeno para reaccionar con todo el CO.

Answers

Answer:

3.60 moles de CO₂

Explanation:

2CO(g) + O₂(g) → 2CO₂(g)

Para convertir moles de CO en moles de CO₂ debemos usar un factor de conversión con los coeficientes estequiométricos de la reacción, dejando las moles de CO en el denominador y las moles de CO₂ en el numerador:

3.60 mol CO * \(\frac{2molCO_2}{2molCO}\) = 3.60 moles CO₂

A solution is made by mixing 50.0 mL of liquid A with 75.0 mL of liquid B. Which is the solute, and which is the solvent? Is it valid to assume that the volume of the resulting solution will be 125 mL? Explain your answer.

Answers

If two liquid solutions are mixed together, the solute would be the one with the lower volume while the solvent would be the solution with the higher volume.

What are liquid solutes?

The mixing of two liquids requires that one is a solute while the other is a solvent.

Thus, the solution with the higher volume acts as the solvent while the one with the lower volume act as the solute.

For example, a solution made by mixing 25% water with 75% alcohol has water as the solute and alcohol as the solvent.

More on liquid-liquid mixture can be found here: https://brainly.com/question/14112110

#SPJ1

What is the boiling point in °C of a 0.32 molal aqueous solution of NaCl?
BP (water) = 100.00 °C Kb (Water) = 0.512 °C/m

Answers

Answer:

the boiling point of solution at 3 decimal point is 100.329०C Ans.

Explanation:

given data -

molality of Nacl = 0.321 m

molal boiling point elevation constant (Kb) =0.512०C/m

# formula of change of boiling point of sample =

∆ Tb =i × Kb × m

Kb = molal boiling point of elevation constant

m = molality

i = vont's hoff factor.

Nacl is strong electrolyte and its 100% dissociate so the value of i for Nacl is 2

put value in the formula

∆ Tb = 2 × 0.512 ०C/m × 0.321m

= 0.3287

= 0.329०C

∆Tb = T'b - Tb

T'b = boiling point of solution

Tb= boiling point of solvent( water)

0.329०C = T'b - 100०c ( boiling point of water = 100०C)

T'b = 0.329०C + 100०C

= 100.329०C

hope this helps

The solubility product constant of calcium sulfate, CaSO4, is 7.10 x 10-5. Its molar
mass is 136.1 g/mol. How many grams of calcium sulfate can dissolve in 75.0 L of
pure water?

Answers

Therefore, 86.1 grams of calcium sulfate can dissolve in 75.0 L of pure water at equilibrium.

What is the calcium sulfate equilibrium constant?

Only a small amount of calcium sulphate is available. The equilibrium constant, also referred to as the solubility product, is written as Ks for this kind of dissolution process. Ks = 4.9  10  6 for this reaction. K s = 4.9  10  6.

The formula for calcium sulphate's solubility product constant is:

Ksp = [Ca2+][SO42-]

The solubility product constant, Ksp, is equivalent to the product of the molar concentrations of Ca2+ and SO42- at equilibrium:

[Ca2+][SO42-] = Ksp

The following calculation can be used to determine the molar solubility of calcium sulphate:

Ksp = [Ca2+][SO42-] = x²

where x is the molar solubility of calcium sulfate.

Therefore, x = √(Ksp) = √(7.10 x 10⁻⁵) = 8.43 x 10³M

m = n × M

n = V × C

Substituting the given values, we get:

n = 75.0 L × 8.43 x 10⁻³ mol/L = 0.632 mol

m = 0.632 mol × 136.1 g/mol = 86.1 g

To know more about calcium sulfate visit:-

https://brainly.com/question/7962933

#SPJ9

Which of the following is not an example of an inexhaustible resource?
1.) Wind power
2.) Wave and tidal power
3.) Solar energy
4.) Biomass

Answers

Solar energy because solar take more resources then all the options that are on the question Answer is 3

Answer:

I would say 4.) Biomass

Explanation:

This looks like the best possible answer because it is plant based. Worst case scenario we could run out of plants. In comparison, wind will pretty much always be around along with wave/tidal power and solar.

How many significant figures are there in each of the following measured values?
a. 6.002 cm
b. 0.0020 m
c. 10.0500

How many significant figures are there in each of the following measured values?a. 6.002 cmb. 0.0020

Answers

Answer:

6)

a). 5.6 × 10⁵

b) 3.34 × 10⁴

c) 4.12 × 10_⁴

Substance whose smell changes in acidic or basic solutions

Answers

Answer:

Olfactory indicators

Explanation:

The substance whose odour changes in an acidic of basic medium are called olfactory indicators. In an olfactory indicator , smell varies depending on whether it is mixed with an acidic or basic solution.


The survival of aquatic organisms depends on the small
amount of O2 that dissolves in H2O. The diagrams above
represent possible models to explain this phenomenon. Which
diagram provides the better particle representation for the
solubility of O2 in H20, and why?

Answers

Answer:

Explanation:

Diagram 2! Because the polar H2O molecules can induce temporary dipoles on the electron clouds of 02 molecules.

Suppose a student repeats Experiment 1 using strontium instead of magnesium. The student adds 4.93 g of strontium to a crucible, heats the crucible and its contents for several minutes over a Bunsen burner, and records the final mass of the crucible and its contents.

Write the balanced chemical equation for this reaction. Include physical states.
balanced equation:

What mass of product is expected to form in this reaction? Assume all of the strontium reacts.
mass of product:

Answers

The balanced chemical equation for the reaction between strontium and oxygen can be written as follows: 2 Sr (s) + \(O_2\)(g) → 2 SrO (s).

In this equation, solid strontium (Sr) reacts with gaseous oxygen (\(O_2\)) to produce solid strontium oxide (SrO).

To determine the mass of product expected to form in this reaction, we need to consider the molar ratio between strontium and strontium oxide. From the balanced equation, we can see that 2 moles of strontium react to produce 2 moles of strontium oxide.

The molar mass of strontium (Sr) is 87.62 g/mol, and the molar mass of strontium oxide (SrO) is 119.62 g/mol. Since the molar ratio is 1:1 between strontium and strontium oxide, the mass of strontium oxide formed will be equal to the mass of strontium used.

In this case, the student added 4.93 g of strontium to the crucible. Therefore, the expected mass of strontium oxide formed will also be 4.93 g.

It's important to note that this calculation assumes that the reaction proceeds to completion, meaning that all of the strontium reacts with oxygen. In actual laboratory conditions, the yield of the reaction may be less than 100% due to factors such as incomplete reaction, side reactions, or product loss.

For more such questsion on balanced chemical equation visit:

https://brainly.com/question/11904811

#SPJ8

For the following reaction at equilibrium (400 °C), describe the effect on the equilibrium amount of Cl2(g) if additional O2(g) is added to the mixture at constant volume?

For the following reaction at equilibrium (400 C), describe the effect on the equilibrium amount of Cl2(g)

Answers

The addition of \(O_2(g)\) will shift the equilibrium towards the right side of the reaction and will consume \(Cl_2(g)\).

For the given reaction at equilibrium (400 °C), the effect on the equilibrium amount of \(Cl_2(g)\) if additional \(O_2(g)\)) is added to the mixture at constant volume can be determined by the Le Chatelier's principle.Le Chatelier's principle states that if a system in equilibrium is subjected to a stress, the system adjusts itself in such a way that it counteracts the stress and a new equilibrium is established.The given reaction is:\(Cl_2(g)\) + \(O_2(g)\) ⇌ 2ClO(g)When additional \(O_2\) is added to the mixture at constant volume, the concentration of O2(g) increases. According to Le Chatelier's principle, the system will adjust itself to counteract this increase in concentration by decreasing the concentration of \(O_2(g)\). This can be achieved by consuming \(O_2(g)\) to produce more ClO(g).The reaction shifts to the right to counteract the increase in concentration of \(O_2(g)\). As a result, the equilibrium amount of \(Cl_2(g)\) decreases, and the equilibrium amount of ClO(g) increases. Therefore, the addition of \(O_2(g)\) will shift the equilibrium towards the right side of the reaction and will consume \(Cl_2(g)\).Hence, the effect of adding \(O_2\) to the mixture will decrease the amount of \(Cl_2(g)\) at equilibrium while increasing the amount of ClO(g).Summary: If additional \(O_2\) is added to the mixture at constant volume, the concentration of \(O_2(g)\) increases. According to Le Chatelier's principle, the system will adjust itself to counteract this increase in concentration by consuming \(O_2(g)\) to produce more ClO(g). As a result, the equilibrium amount of \(Cl_2(g)\) decreases, and the equilibrium amount of ClO(g) increases. Therefore, the addition of \(O_2(g)\) will shift the equilibrium towards the right side of the reaction and will consume \(Cl_2(g)\).

For more questions on equilibrium

https://brainly.com/question/29398344

#SPJ8

A pressure cooker uses pressure to
A. boil water at a lower temperature than its normal boiling point.
B. heat food more slowly because the pressure is lower.
C. cook food in a bath of steam instead of liquid water.
D. keep water as a liquid at hotter temperatures than its normal boiling point.

Answers

A pressure cοοker uses pressure tο bοil water at a lοwer temperature than its nοrmal bοiling pοint.

Thus οptiοn A is cοrrect.

In a pressure cοοker, dοes the water bοil at a lοwer temperature?

Water bοils at 100°C (212°F) when yοu cοοk in a typical saucepan at atmοspheric pressure (14.7 pοunds per square inch [psi]). A pressure cοοker's inside can experience an additiοnal 15 psi οf pressure, οr almοst 30 psi. Water bοils at 121°C (250°F) at that pressure.

What is the purpοse οf a pressure cοοker?

Pressure cοοkers make it simple tο swiftly create dishes that are slοw-cοοked. They are gοοd fοr tenderising less expensive cuts οf meat and efficient in terms οf electricity use.

To know more about pressure visit:-

brainly.com/question/10840252

#SPJ1

Fructose-1-phosphate can be hydrolyzed into fructose + inorganic phosphate (Pi) with a ΔG° of –16.0 kJ/mol. If ATP can be hydrolyzed into ADP + Pi with a ΔG° of –30.5 kJ/mol, what is the free energy change for the reaction of fructose + ATP → fructose 1-phospate + ADP

Answers

To calculate the free energy change (ΔG°) for the reaction of fructose + ATP → fructose 1-phosphate + ADP, we can use the concept of Gibbs free energy and apply the equation:

ΔG° (overall reaction) = ΔG° (sum of products) - ΔG° (sum of reactants)

Given:
ΔG° for the hydrolysis of fructose-1-phosphate = -16.0 kJ/mol
ΔG° for the hydrolysis of ATP = -30.5 kJ/mol

The reaction we want to calculate the ΔG° for is:

fructose + ATP → fructose 1-phosphate + ADP

From the given information, we can break down the reactants and products:

Sum of reactants:
fructose + ATP

Sum of products:
fructose 1-phosphate + ADP

Now, we can calculate the ΔG° for the overall reaction:

ΔG° (overall reaction) = ΔG° (sum of products) - ΔG° (sum of reactants)
ΔG° (overall reaction) = (-16.0 kJ/mol) + (-30.5 kJ/mol)

ΔG° (overall reaction) = -46.5 kJ/mol

Therefore, the free energy change (ΔG°) for the reaction of fructose + ATP → fructose 1-phosphate + ADP is -46.5 kJ/mol.

The theory of plate tectonics helps explain the location of volcanoes and earthquakes. Which of these also describes the current theory of plate tectonics?


ANSWERS
° it combines elements of continental drift and seafloor spreading.
° it suggests that the lithosphere is divided into pieces, called plates. °
denser ocean crust sinks below less-dense continental crust along subduction zones.
° all of the above.​

Answers

The theory of plate tectonics explains the location of most earthquakes and volcanoes as on the boundaries of tectonic plates, most of the earthquakes or volcanoes happen.

What are plate tectonics?

Plate tectonics is the plates that are present in the earth's crust. These plates are of different types. These plates are always in movement. These plates are divergent, convergent, etc.

Earthquakes, volcanoes, and tectonic plates. The plate tectonics hypothesis states that Earth is a dynamic planet.

The numerous separate plates that make up its surface move and interact with one another, continually modifying and reshaping the Earth's outer layer. Tectonic plate movement causes both earthquakes and volcanoes.

Thus, the ends of the tectonic plates are the places where earthquakes or volcanoes happen.

Name 5 possibilities of a molecular formula when the empirical formula is CH2

Answers

Answer:

Divide the gram molecular mass by the empirical formula mass. Multiply each of the subscripts within the empirical formula by the number calculated in Step 2. Multiplying the subscripts within the empirical formula by this number gives you the molecular formula H2O2.

Explanation:

hope this helps

To find the order of a reaction with respect to one reactant, you will monitor the as the of . is changed.

Answers

The order of reaction is defined as the power to which the concentration of the reactants are raised in the rate equation of the reaction.

The order of reaction can be used to determine how a particular reactant affects the reaction. In order to find the order of a reaction with respect to a particular reactant, the concentration of the reactant is changed while keeping the concentration of other reactants constant. The rate of reaction is then measured and compared with the rate of reaction when the concentration of the reactant is not changed.The order of reaction with respect to a reactant can be determined using the following method:First, select a reactant whose order needs to be determined and change its concentration while keeping the concentration of other reactants constant. For example, if we want to find the order of reaction with respect to reactant A, we will change the concentration of A and keep the concentration of reactant B constant.Second, measure the rate of reaction at different concentrations of the reactant A. The rate of reaction can be measured by any suitable method such as change in color, pH, or by measuring the amount of product formed with time. A graph is plotted with rate of reaction on the y-axis and concentration of reactant A on the x-axis. The graph should be a straight line.Third, if the graph is a straight line passing through the origin, the order of reaction with respect to reactant A is one. If the graph is a straight line but does not pass through the origin, the order of reaction with respect to reactant A is two. If the graph is not a straight line, the order of reaction with respect to reactant A is either zero or fractional.

For such more question on concentration

https://brainly.com/question/17206790

#SPJ8

Use the image to complete the sentences.

At left a grid labeled A of regularly arranged orange balls with small movement lines near each. At right a grid labeled B of regularly arranged orange balls with large movement lines near each.

Two different substances, Substance A and Substance B, are in direct contact with each other and are at different temperatures.

The particles in Substance B are vibrating
the particles in Substance A. This means Substance B is
Substance A and conduction will
.

Use the image to complete the sentences. At left a grid labeled A of regularly arranged orange balls

Answers

Answer:

1. FASTER THAN- #2

2. WARMER THAN #1

3. OCCUR FROM SUBSTANCE B TO SUBSTANCE A- #3

Explanation:

I did the assignment On edg And got it right

Answer:

Use the image to complete the sentences.  

At left a grid labeled A of regularly arranged orange balls with small movement lines near each. At right a grid labeled B of regularly arranged orange balls with large movement lines near each.

Two different substances, Substance A and Substance B, are in direct contact with each other and are at different temperatures.

The particles in Substance B are vibrating

✔ faster than

the particles in Substance A. This means Substance B is

✔ warmer than

Substance A and conduction will

✔ occur from Substance B to Substance A

.

Explanation:

I know im late

One of the many isotopes used in cancer treatment is , with a half-life of 2.70 d. Determine the mass of this isotope that is required to give an activity of 205 C

Answers

I have no idea but and it’s timed so here’s something 13488

The mass of this isotope that is required to give an activity of 205 C is 1.187 mg.

What is isotope?

Isotope is defined as two or more different types of atoms with the same atomic number, but different nucleon values at different positions on the periodic table. Isotopes are forms of an element that have the same number of protons and electrons but differing numbers of neutrons.

Let's first translate the 2.70 day half life into seconds to obtain the following half life:

T(1/2) = 233300 sec

By subtracting the half life from ln(2)? = 2.971x10⁻⁶, determine the decay constant.

Now that we have the decay constant, we can solve for the quantity of isotopes required to produce an activity of 290 Ci (which is equal to 1.073x10¹³ decays per second) using the rate of decay equation. Due to the fact that we are discussing the beginning action, t = 0 for this equation.

-1.073x10³ = -A?e^(-? x 0)

Since we are losing isotopes rather than acquiring them, the left side of the equation is negative.

Fill in the blanks: A = 3.611x10¹⁸ isotopes

Find out how much mass is contained in all of these isotopes now.

(3.611x10¹⁸) x(198u) =  7.150x10²⁰ u

To get the final result, convert to mg at this point:

1.187 mg

Thus, the mass of this isotope that is required to give an activity of 205 C is 1.187 mg.

To learn more about isotope, refer to the link below:

https://brainly.com/question/11680817

#SPJ2

A compound contains only C, H, and N. Combustion of a 40.28 g sample of the compound produces 38.46 g of carbon dioxide, 47.25 g of water, and some nitrogen gas. A separate experiment determines the molecular mass of the compound to be 138.3 g/mol. Determine the empirical formula and molecular formula for the compound.

Answers

Answer:24435

Explanation w49439r chusb

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

PLEASE ANSWER QUICKLY!!

100 NaNO3
90
Solute per 100 g of H₂O (g)
0,80
NH,CI
70 KNO3
60
50
40
30
20
10
0
0 10 20 30 40 50 60 70 80 90 100
Temperature (°C)
KCIO3
60 g KNO3 has
been added to
100 g H₂O at
30 °C. What
type of solution
is this?
A. unsaturated
B. saturated
C. supersaturated

PLEASE ANSWER QUICKLY!!100 NaNO390Solute per 100 g of HO (g)0,80NH,CI70 KNO360504030201000 10 20 30 40

Answers

If 60 grams of the substance are added to 100 g of water, the solution can be categorized as supersaturated.

How saturated is this solution?

The graph shows the number of grams that can be dissolved in 100 grams of water at different temperatures. In general, solubility increases with temperature.

According to the graph, at a temperature of 30°C, it is possible to dissolve a total of 48 to 49 grams of \(KNO_{3}\). This information implies that if we add 60 grams at this temperature not all the substance would be dissolved, and therefore the solution would be supersaturated.

Learn more about solubility in https://brainly.com/question/31493083

#SPJ1

Emile began a 200-kilometer journey though the mountain by going west on straight path . She travels a full 25km in the fitter hour of her trip

Answers

From the given information, the average speed and velocity of the first hour of her trip can be calculated but not for the entire journey. Therefore, option D is correct.

What is the average speed?

The average speed of an object can be defined as the total distance traveled by the object in a particular time interval. The average speed can be defined as a scalar quantity that exhibits magnitude and does not possess direction.

The average speed can be determined from the ratio of the total distance covered by an object to the time to cover that distance.

The average speed of a moving object can be written as follows:

Average speed =  Total distance /Total time

Given the distance traveled by the Emile  = 25 Km

The time taken by Emile = 1 hr

Average speed = 25/1 = 25 Km/h

The velocity of the first hour of her trip the journey can be determined as she covered the whole journey by going west on the straight path.

Learn more about the average speed, here:

brainly.com/question/12322912

#SPJ1

Your question was incomplete, most probably the complete question was,

Emile began a 200-kilometer (km) journey through the mountains by going west on a straight path. She traveled a full 25 km in the first hour of her trip. Using this paragraph, a student would be able to determine

A) Emile's average speed and velocity for the entire journey.

B) Emile's average speed but not her average velocity for the first hour of her journey.

C) Emile's average velocity but not her average speed for the entire journey.

D) Emile's average speed and velocity for the first hour of her journey.

Every spring has an equilibrium position. Which statements describe a spring at its equilibrium position? Check all that apply.

The spring constant is zero.
The elastic potential energy is at a maximum.
The elastic potential energy is zero.
The displacement of the spring is at a maximum.
The net force acting on the spring is zero.

Answers

The statements describe a spring at its equilibrium position is the elastic potential energy is zero, the displacement of the spring is at a maximum and the net force acting on the spring is zero.

What is the equilibrium position?

A body is in equilibrium when the sum of all forces acting on it equals zero. According to Newton's First Law, when resulting from the laws that act on a body that remains in a state of restriction or in motion in its motion, it remains uniformly null.

In this case the only statements that match the definition of equilibrium position are:

The elastic potential energy is zero.The displacement of the spring is at a maximum.The net force acting on the spring is zero.

See more about equilibrium position at brainly.com/question/10374921

#SPJ1

Which of the following statements describe what a normative system is?​

Answers

Explanation:

though the statements were not given let just give you a brief review of normative system.

A normative statement explains what should be base of the subject according to the belief through valued judgement that describes the fairness of the subject on public policy. Therefore, the unemployment rate should be lowered is a valued judgement based on the belief that it will bring economic welfare.

Normative systems, i.e., sets of norms, have two main. tions: a) to evaluate human actions, and b) to guide peop. The guidance and the evaluation based on a normativ. be good or bad.In social psychology three different normative behaviours have been identified: obedience, conformity and compliance.In the context of a normative system like law (or religion or morality), every statement of what one ought to do (or ought not to do) requires justification from a more general or basic statement. Such statements lead upward through the normative hierarchy until one reaches a foundational normative premise.

please rate brainliest if helps and follow

What is the correct reading of the volume in the pictured buret?

A) 26. 400 mL

B)26. 40 mL

C) 25. 60 mL

D) 25. 600 mL

E)26. 4 mL

F)25. 6 mL

Answers

The correct reading of the volume in the pictured burette is 26. 40 mL.

The correct option is B.

What is the correct way of taking volume readings from a burette?

The correct way to take volume readings from a burette is as follows:

Check that the burette is clean, dry, and properly calibrated.Close the stopcock at the bottom of the burette by rotating the handle to the perpendicular position.Fill the burette with the solution you want to measure, using a funnel if necessary. Take care not to introduce any air bubbles.Open the stopcock slightly and allow a small amount of the solution to flow out until the meniscus (the curved surface of the liquid) is at the zero mark on the burette. The meniscus should be read at eye level and should be tangent to the mark.Record the initial burette reading.Open the stopcock and allow the solution to flow into the flask or other container until the desired volume is reached.Record the final burette reading.

Calculate the volume delivered by subtracting the initial burette reading from the final burette reading.

Dispose of the solution remaining in the burette and rinse it thoroughly with water.

Learn more about burette readings at: https://brainly.com/question/28353349

#SPJ1

in the reaction 239/93 Np -> 239/94 Pu+X, what does X represent

Answers

In the reaction 239/93 Np -> 239/94 Pu + X, the symbol "X" represents an electron. Option C is correct.

This reaction involves the radioactive decay of Neptunium-239 (239/93 Np) into Plutonium-239 (239/94 Pu). Specifically, it undergoes beta decay, which involves the emission of an electron.

During beta decay, a neutron in the Neptunium-239 nucleus is converted into a proton, and an electron (also known as a beta particle) is emitted. The electron carries a negative charge (-1) and is represented by the symbol "e^-" or simply "e". It balances the charge and atomic number in the reaction equation.

The balanced equation for the reaction is:

239/93 Np -> 239/94 Pu + 0/-1 e

So, in summary, the symbol "X" in the reaction 239/93 Np -> 239/94 Pu + X represents an electron (e^-) emitted during the beta decay of Neptunium-239.

For more question on electron click on

https://brainly.com/question/26084288

#SPJ11

COMPLETE QUESTION

in the reaction 239/93 Np -> 239/94 Pu+X, what does X represent

A. PROTON

B. POSITRON

C. ELECTRON

D. NEUTRON

A GC analysis of a oil containing the unknown diene produced a chromatogram with 3 distinct peaks. From the determination of peak area, you find that the percent compositions represented by the peaks are: peak A is 26.66 percent, peak B is 60 percent, and peak C is 13.33 percent. If the largest peak in the chromatogram corresponds to the diene, how many moles of diene are in the crude oil

Answers

Answer:

0.011 moles of diene are in the crude oil

Explanation:

The mass of the oil is 2.5g and the M.W. of the diene is 136g/mol

The largest peak is the peak that has the higher percent concentration: That is the peak B with 60% by mass.

Knowing this we can find the mass of the diene using its percentage and with the mass and the molecular weight we can find its moles:

Mass Diene:

2.5g Oil * (60g Diene / 100g Oil) = 1.5g Diene are in the oil

Moles:

1.5g Diene * (1mol / 136g) =

0.011 moles of diene are in the crude oil

Use this data to rank the following solutions in order of increasing pH. In other words, select a ' 1 ' next to the solution that will have the lowest pH, a ' 2 ' next to the solution that will have the next lowest pH, and so on.
Consider the following data on some weak acids and weak bases acid base name formula name formula 3 11.8x10-5 methylamine CH3NH24.4 x 104 hydrofluoric acidH 6.8 x 10 ammoniaNH nitrous acidHNO x 10 Use this data to rank the following solutions in order of increasing pH. In other words, select a '1' next to the solution that will have the lowest pH, a '2' next to the solution that will have the next lowest pH, and so on solution pH Vchoose one 1 (lowest) 0.1 M NaCI 0.1 M NaF 4 (highest) 0.1 M KN02 0.1 M NH4CI choose one

Answers

Answer:

Step-by-Step Explanation:

The principal rules include:

a) Bases contains higher pH compared to acids

b) The stronger acid contains reduced pH.

c) Stronger acid contains higher Ka. Hence, acids possessing higher Ka contain lower pH.

d) Stronger base contains higher Kb. Hence, bases possessing higher Kb contain higher pH.

Combining all these rules and putting them into action; in order of increasing pH, we have:

HF (1); HNO2 (2); NH3 (3); CH3NH2 (4)

For the second part:

a) NaCl occurs to be the salt of both strong acid & strong base. For that reason, it is a neutral salt with a pH of 7.0

b) NaF is a basic salt because, it serves as salt of strong base as seen in NaOH and that of a weak acid(e.g HF).

However, it produces Na^+ & F^- ions when it exist in solution.

where;

F^-  = strong conjugate base for a weak acid HF.

Thus, the Kb of \(F^-\) = \(\dfrac{10^{-14} }{6.8 \times 10^{-4}}\) = \(1.47 \times 10^{-11}\)

Now, the \([OH^-]\) in 0.1 M of NaF solution = \((0.1 \times 1.47 \times 10^{-11} ) 0.5\)

\(= 1.21 \times 10^{-6} \ M\)

\(pOH = -log [OH^-]\)

\(pOH = -log (1.21 \times 10^{-6} )\)

\(pOH = 5.92 \\ \\ pH = 14 - pOH \\ \\ pH = 14 - 5.92 \\ \\ \mathbf{pH = 8.08}\)

c) \(KNO_2\) occurs to be a basic salt because it is a salt of both strong base (KOH) and a weak acid \((HNO_2).\)

yields in solution.

Kb of \(NO^{2-}\) =\(\dfrac{10^{-14}}{(4.5 \times 10^{-4})}\) = \(2.2 \times 10^{-11}\)

Now, the \([OH^-]\) in 0.1 M of \(KNO_2\) solution = \((0.1 \times 2.22 \times 10^{-11})\times 0.5\)

\(= 1.49 \times 10^{-6} \ M\)

\(pOH = -log[OH^-]\)

\(pOH = -log (1.49 \times 10^{-6} )\)

\(pOH = 5.83\\ \\ pH = 14 - pOH \\ \\ pH = 14 - 5.83 \\ \\ \mathbf{pH = 8.17}\)

d)

NH_4Cl occurs to be an acidic salt because it is a salt of both weak base  and a strong acid (HCl)

NH_4Cl yields \(NH_4^+\) and \(Cl^-\) when present in a solution.

Ka of \(NH_4^+\) = \(\dfrac{10^{-14}}{1.8 \times 10^{-5}}\)

\(= 5.56 \times 10^{-10}\)

Now, the \([H^+] = (0.1 \times 5.56 \times 10^{-10}) 0.5\)

\(= 7.45 \times 10^{-6}\)

\(\mathbf{= 5.12}\)

Thus, the order of the pH is:

NH_4Cl (1); NaCl (2); NaF (3); KNO_2 (4)

Which statement is true about air temperature and humidity

Answers

Complete Question:

Which statement is true about air temperature and humidity?

Group of answer choices.

a. the air temperature does not affect how much moisture the air can hold

b. hotter air holds less moisture than colder air.

c. hot air and cold air share the same amount of moist.

d. colder air holds less moisture than hotter air.

Answer:

d. colder air holds less moisture than hotter air

Explanation:

Weather can be defined as the atmospheric conditions of a particular area over a short period of time.

The elements of weather include precipitation, wind, temperature, atmospheric pressure, relative humidity, cloud, and wind speed.

Temperature can be defined as a measure of the degree of coldness or hotness of a physical object (body).

On the other hand, humidity refers to the concentration (amount) of water vapor that is present in the air. It is high when there's a lot of water vapor in the air and low when the level of water vapor is small.

Hence, the true statement about air temperature and humidity is that colder air holds less moisture than hotter air because as the air cools, its molecules move closer together while the molecules move farther apart as the air become hot.

Additionally, at constant humidity, relative humidity is inversely proportional to temperature i.e as the temperature decreases, relative humidity increases.

Answer: colder air holds less moisture than hotter air

Explanation:

Other Questions
Ellen is drawing two polygons. One of the polygons has three more angels than the other. What shapes could she be drawing Read the text on the Tulip-O-Mania topic, and write a summary based solely your own personal understanding of the text. Strictly, use no more than one A4 ... PLSSSSS HELP!!!!!Write the equation of a line that is perpendicular to the given line and that passes through the given point.y- 4 = (x+3); (-7,8)O A. y-8 = -2/5(x-7)OB. y-8 = -2/5(7)O C. y-8 = -2/5(x + 7)O D.y-8 = -2/5(x +7) rotational kinetic energy is analogous to linear kinetic energy with the mass replaced by ________a. the moment of inertiab. the densityc. the torqued. the center of masse. the net mass What is 823+7Needs Help badly (20 points) Let I be the line given by the span of A basis for Lis 5 in R. Find a basis for the orthogonal complement L of L. 8 A charge q is located at the origin (0,0). the electric field at (x,y) is given (in terms of its components) by:__________ How I can answer this question, NO LINKS, if you answer correctly I will give u brainliest! a subway train starts from rest at a station and accelerates at a rate of 1.60m/s21.60m/s2 for 14.0 ss . it runs at constant speed for 70.0 ss and slows down at a rate of 3.50m/s23.50m/s2 until it stops at the next station. Find the total distance covered. Which of the following will result in a shift in the short-run aggregate supply curve to the right?a decrease in the price levelan increase in the price levelan increase in the cost of labora decrease in the cost of production machinery True or False. Index Fossils are formed from organisms that were alive for short period of geologic time, are extinct, had hard parts, and lived across wide geographic area. Which object has a weight of about 22.5 Newtons A pic is given above no trolling or a report is getting thrown right at u 37. The progressive loss of material from a surface by the mechanical action of a fluid on a surface is called which of the following occupations is most likely to know the cost of materials and labor needed to install a large ductwork system for a commercial building? What metal speeds up rusting If each dose of growth product increases the height of the organism, how many phenotypes for height could exist in the population?. how might it be said that a theme of the first passage intersects with a theme of the second passage, with regard to the mississippi river? the original work in physics that eventually led to the development of the atomic bomb was done by: 1. Consider the following situation: "Twenty less than four times a number, n, is eight."1. Write one equation to represent the statement.2. What is the value of n?2. Consider the following situation: "One number is six times larger than another number, n. The sum of the two numbers is ninety-one."1. Write one equation to represent those relationships.2. What is the larger of the two numbers?3. Consider the following situation: "A pet store has r rabbits and fifty birds. The number of birds is fourteen fewer than twice the number of rabbits."1. Write one equation to represent those relationships.2. How many rabbits are in the pet store?4. Consider the following situation: "The length of a rectangle is nine inches shorter than the width, w. The perimeter of the rectangle is one hundred twenty-two inches."1. Write one equation to represent those relationships.2. What are the length and the width of the rectangle?5. Consider the following situation: "A triangle has three angles: Angles A, B, and C. Angle B is eighteen degrees larger than Angle A. Angle C is three times as large as Angle B."1. Write one equation to represent those relationships. Let x = the measure of angle A.2. What is the measure of Angle C? Why are action potentials usually conducted in one direction? a. Ions can flow along the axon in only one direction. b. The brief refractory period prevents reopening of voltagegated Na channels. c. The axon hillock has a higher membrane potential than the terminals of the axon. d. Voltage-gated channels for both Na and K open in only one direction.