How many grams of hydrogen (H2) are needed to react with 92.00 grams of nitrogen (N2)?

Answers

Answer 1
So what u need to understand first, is the balanced chemical reaction. Im not sure but i think this forms ammonia with the following rxn:
N_2 + 3H_2 -> NH_3

So now we know that for every one mole of N2, we need 3 moles of H2.
There are (92g)/(28g/mol)= 3.3 mol N2
So we need 9.9 mol H2
This is going to be about 20 grams if i am correct

Related Questions

What is the millimolar concentration of ethanol (Mw = 46 g/mol) in the bloodstream of a person with a blood alcohol content of 0.08% w/v? (Mw = 46 g/mol)?

Answers

The millimolar concentration of ethanol in the bloodstream of a person with a blood alcohol content of 0.08% w/v is 17.4 mM.

What is the blood alcohol content?

Blood alcohol content (BAC) is a measure of the concentration of alcohol in a person's bloodstream. It is typically expressed as a percentage, either as weight/volume (w/v) or as volume/volume (v/v).

BAC is affected by various factors such as the amount of alcohol consumed, the rate of alcohol metabolism, body weight, gender, and other individual characteristics.

To calculate the millimolar concentration of ethanol in the bloodstream, we first need to convert the blood alcohol content (BAC) from weight/volume percentage to molarity.

Convert the blood alcohol content (BAC) from weight/volume percentage to grams of ethanol per liter of blood:

BAC = 0.08%

w/v =0.08g100mL

= 0.8 g/L

Calculate the molarity (M) of ethanol:

Molarity (M) = Misplaced &

We know the molar mass (Mw) of ethanol is 46 g/mol, and the BAC is 0.8 g/L:

Molarity (M) = 0.8g/L46g/mol

= 0.0174 mol/L

Convert molarity to millimolar concentration:

Millimolar concentration = Molarity (M) × 1000 Millimolar concentration

= 0.0174 mol/L × 1000

= 17.4 mM

Therefore, the millimolar concentration of ethanol in the bloodstream of a person with a blood alcohol content of 0.08% w/v is 17.4 mM.

To learn more about blood alcohol content  from the given link

brainly.com/question/2231540

#SPJ4

Calculate the density of pentane with a mass of 47 grams and a volume of 75 mL.

Answers

Answer:

The answer is

0.63 g/mL

Explanation:

The density of a substance can be found by using the formula

density=massvolume

From the question

mass = 47 g

volume = 75 mL

The density is

density=4775=0.626666666...

We have the final answer as

0.63 g/mL

Hope this helps you

draw a lewis structure for each of the following molecules, and then use the vsepr theory to predict the molecular geometry of each:

a. scl2
b. pi3
c. cl2o
d. nh2cl
e. sicl3br
f. oncl\

Answers

a. The Lewis structure for SCl₂ is S-Cl-Cl with a lone pair on sulfur. The VSEPR theory predicts a bent or V-shaped molecular geometry.

b. The Lewis structure for PI₃ is P-I-I-I with two lone pairs on the central phosphorus atom. The VSEPR theory predicts a trigonal pyramidal molecular geometry.

c. The Lewis structure for Cl₂CO is O=C=Cl with no lone pairs. The VSEPR theory predicts a linear molecular geometry for Cl2CO.

d. The Lewis structure for NH₂Cl is H-N-Cl with two lone pairs on the nitrogen atom. The VSEPR theory predicts a trigonal pyramidal molecular geometry.

e. The Lewis structure for SiCl₃Br is Br-Si-Cl-Cl-Cl with no lone pairs. The VSEPR theory predicts a trigonal pyramidal molecular geometry.

f. The Lewis structure for ONCl is O=N-Cl with no lone pairs. The VSEPR theory predicts a linear molecular geometry.

To draw the Lewis structure, you need to determine the number of valence electrons for each atom in the molecule and then arrange them to form covalent bonds while fulfilling the octet rule (except for hydrogen, which follows the duet rule). Once the Lewis structure is determined, you can use the VSEPR theory to predict the molecular geometry based on the arrangement of electron pairs around the central atom.

In each case, the molecular geometry is determined by the number of bonding and lone pairs of electrons around the central atom. The VSEPR theory provides a model for predicting the shapes of molecules based on the repulsion between electron pairs.

The molecular geometries predicted by the VSEPR theory are as follows:

a. SCl₂: Bent or V-shaped

b. PI₃: Trigonal pyramidal

c. Cl₂CO: Linear

d. NH₂Cl: Trigonal pyramidal

e. SiCl₃Br: Trigonal pyramidal

f. ONCl: Linear

To learn more about molecular geometry, here

https://brainly.com/question/31984103

#SPJ4

draw a lewis structure for each of the following molecules, and then use the vsepr theory to predict
draw a lewis structure for each of the following molecules, and then use the vsepr theory to predict
draw a lewis structure for each of the following molecules, and then use the vsepr theory to predict
draw a lewis structure for each of the following molecules, and then use the vsepr theory to predict
draw a lewis structure for each of the following molecules, and then use the vsepr theory to predict

Which form of energy is harnessed by a windmill that uses wind to turn a turbine to generate electricity? A) gravitational potential energy B) geothermal energy C) kinetic energy D) potential energy

Answers

Answer:

I am 90% sure its kinetic energy

Explanation:

Calculate the [H+], pOH, and [OH-] for the following solutions: SHOW WORK And put Answers for concentration[ ] in scientific notation. ( see video for help)
pH 2.90 (the approximate pH of lemon juice



pH 3.86 (the approximate pH of sauerkraut)


pH 10.81 (the approximate pH of milk of magnesia)



pH 4.11 (the approximate pH of orange juice)



pH 11.61 (the approximate pH of household ammonia)



The pH of human blood ranges from 7.35 to 7.45 with it usually being around 7.40. If the blood pH gets below 7.35 a person goes into acidosis. If the pH gets above 7.45 a person goes into alkalosis. Both acidosis and alkalosis can be fatal. How much more acidic is a person’s blood if it has a pH of 7.3 compared to its preferred 7.4? How much more alkaline is a person’s blood if it has a pH of 7.6 rather than its preferred 7.4?

Answers

Answer:

Explanation:

pH = -log{H+]

{H+} = 10^(-pH)

pOH = 14 - pH

{OH-} = 10^(-pOH)

pH 2.90 (the approximate pH of lemon juice

{H+} = 10^(-2.9)

pOH = 14 - 2.9 = 11.1

{OH-} = 10^(-pOH) = 10^(-11.1)

 

pH 3.86 (the approximate pH of sauerkraut)

{H+} = 10^(-3.86)

pOH = 14 - 3.86 = 10.14

{OH-} = 10^(-pOH)  = 10^(-10.14)

pH 10.81 (the approximate pH of milk of magnesia)

{H+} = 10^(-10.81)

pOH = 14 - 10.81 = 3.19

{OH-} = 10^(-pOH) = 10^(-3.19)

pH 4.11 (the approximate pH of orange juice)

{H+} = 10^(-4.11)

pOH = 14 - 4.11 = 9.89

{OH-} = 10^(-pOH) = 10^(-9.89)

 

pH 11.61 (the approximate pH of household ammonia)

{H+} = 10^(-11.61)

pOH = 14 - 11.61 = 2.39

{OH-} = 10^(-pOH)  = 10^(-2.39)

sodium chloride is a buffer creating an injectable solution that is isotonic. group of answer choices true

Answers

Yes, the statement is True i.e. Sodium chloride is a buffer creating an injectable solution that is isotonic.

A buffer solution, also referred to as a pH buffer or hydrogen ion buffer, is an aqueous mixture of a weak acid and its conjugate base, or vice versa. The pH scarcely changes at all when a small amount of a strong acid or basic is added to it. Buffer solutions are used in a wide range of chemical processes to keep pH values almost constant. Buffering is used by many living systems to regulate pH in the natural world. For instance, the bicarbonate buffering system regulates the pH of blood, and bicarbonate also acts as a buffer in the ocean. Because of a chemical equilibrium between the weak acid HA and its conjugate base A, buffer solutions are resistant to pH change: HA ⇌ H+ + A− According to Le Chatelier's principle, an equilibrium between a weak acid and its conjugate base shifts to the left when hydrogen ions (H+) are supplied. Because of this, despite the supply of strong acid, the concentration of hydrogen ions increases less than anticipated.

To know more about buffer please refer: https://brainly.com/question/22821585

#SPJ4

38
8.F.1.3
Ramon is adding water to his swimming pool. The graph shows
the amount of water in the pool as more water is added.
25
Total gallons of water
(in thousands)
eu
х
20 40 60 80 100 120 140 160 180 200
Number of minutes
1991
What does the y-intercept represent?
193)
A) the total time needed to fill the pool
B) the total amount of water needed to fill the pool
C) the additional gallons of water added per minute
D) the amount of water in the pool before more water was
added

Answers

Answer:

B

Explanation:

i took the test!

Find the volume of a box with a length of 5cm, a width of 5cm and a height of 10cm

Answers

The volume of the rectangular box is 250 cubic centimeters (cm³) or 0.25 liters (L).

To find the volume of a box with a length of 5cm, a width of 5cm and a height of 10cm, we use the formula for the volume of a rectangular box, which is given as;Volume of rectangular box = Length × Width × HeightGiven that the length of the box is 5cm, the width is also 5cm, and the height is 10cm.

Therefore, we substitute the values into the formula above;Volume of rectangular box = 5cm × 5cm × 10cm= 250cm³.

Therefore, the volume of the rectangular box is 250 cubic centimeters (cm³).

We can also represent this volume in liters (L) by converting from cubic centimeters to liters, since 1L is equal to 1000cm³.

Thus, to convert 250cm³ to liters;Volume in liters = Volume in cm³ / 1000cm³/L= 250cm³ / 1000cm³/L= 0.25L.

For more such questions on volume

https://brainly.com/question/30537524

#SPJ8

The decay rate, k, for a particular radioactive element is 3.1%, where time is measured in years. Find the half-life of the element. The half-life is years. (Round to one decimal place as needed.)

Answers

The decay rate, k, for a particular radioactive element is 3.1%, where time is measured in years. The half life of elements is 22.3 years.

Thus, The following equation relates a radioactive substance's half-life (T12) to the decay rate constant, k = ln(2) / T½.  

The decimal representation of the decay rate constant k, which is 3.1%: k = 0.031.

T½ = ln(2) / k

T1+2=ln(2)/0.031 = 22.3 years

The radioactive element has a half-life of about 22.3 years.

Learn more about Radioactive element, refer to the link:

https://brainly.com/question/31865009

#SPJ12

When two amino acid monomers are positioned so that the carboxyl group of one is adjacent to the amino group of the other, they can be joined through a reaction. True or false?.

Answers

When two amino acid monomers are positioned so that the carboxyl group of one is adjacent to the amino group of the other, they can be joined through a reaction.

It is True.

What is amino acid?

Amino acid molecules make up proteins. Proteins and amino acids are essential to life. After proteins have been digested or broken down, amino acids are still present. To maintain the body, the human body makes proteins from amino acids: Prepare food.

Taking a supplement containing essential amino acids is wonderful because you can do so anytime you choose. While some athletes prefer to take it with meals or a protein shake, others prefer to take it on an empty stomach in between meals.

To learn more about amino acid from the given link:

brainly.com/question/14583479

#SPJ4

describe the basic assumptions of the kinetic molecular theory of gases that confirm the ideal behavior of gases.

Answers

The kinetic-molecular principle of gases assumes that perfect gasoline molecules are constantly moving.

have negligible quantity;have negligible intermolecular forces undergo flawlessly elastic collisions have a median kinetic strength proportional to the suitable fuel's absolute temperature.

The gasoline debris has a negligible extent. The gas debris is similarly sized and no longer has intermolecular forces (enchantment or repulsion) with other fuel particles. The gasoline debris flows randomly in settlement with Newton's legal guidelines of motion. The gasoline debris has perfect elastic collisions without energy loss.

Learn more about kinetic molecular theory here:-https://brainly.com/question/134712

#SPJ4

ILL GIVE BRAINLIEST
There are 164 g H3PO3 formed during a
reaction. How many moles of H₂O are
required? (H3PO3: 82 g/mol)
P₂O3 + 3H₂O → 2H3PO3
164 g H3PO3|
164 g H3PO3 → [?] mol H₂O

ILL GIVE BRAINLIESTThere are 164 g H3PO3 formed during areaction. How many moles of HO arerequired? (H3PO3:

Answers

164 g of H₃PO₃ (phosphorus acid) would require 3 moles of H₂O for the reaction.

Given information,

Mass of H₃PO₃ = 164g

Moles of H₃PO₃ = 82 g/mol

The balanced chemical equation:

P₂O₃ + 3H₂O → 2H₃PO₃

For every 2 moles of H₃PO₃ produced, 3 moles of H₂O are required.

The number of moles of H₃PO₃:

Moles of H₃PO₃ = mass of H₃PO₃ / molar mass of H₃PO₃

Moles of H₃PO₃ = 164 g / 82 g/mol

Moles of H₃PO₃ = 2 mol

The number of moles of H₂O:

Moles of H₂O = (3/2) × moles of H₃PO₃

Moles of H₂O = (3/2) × 2 mol

Moles of H₂O = 3 mol

Therefore, 164 g of H₃PO₃ would require 3 moles of H₂O for the reaction.

Learn more about moles, here:

https://brainly.com/question/30885025

#SPJ1

A 112 gram sample of an unknown metal was heated from 0.0C to 20.0C. The sample absorbed 1004 J of energy. What was the specific heat capacity of this metal? Show your work.

Answers

Answer:

The specific heat of the sample unknown metal is approximately 0.45 J/g °C.

General Formulas and Concepts:
Thermodynamics

Specific Heat Formula: q=mcT

m is mass (g)c is specific heat capacity (J/g °C)ΔT is the change in temperature

Explanation:

Step 1: Define

Identify variables.

m = 112 g

ΔT = 20.0 °C

q = 1004 J

Step 2: Solve for c

Substitute in variables [Specific Heat Formula]:                                        1004 J=(112 g)(c)(20.0 C)Simplify:                                                                                                        1004 J=(2240 g C)cIsolate c:                                                                                                        c=0.448214 J/g CRound [Sig Figs]:                                                                                          c0.45 J/g C

∴ specific heat capacity c is equal to around 0.45 J/g °C.

---

Topic: AP Chemistry

Unit: Thermodynamics

draw the structure of the aromatic product from the reaction shown. the starting material is a benzene ring with a hydroxy group on carbon 1 and an n h 2 on carbon 4. this reacts with one equivalent of acetic anhydride, which is an oxygen flanked by two carbonyls, each bonded to a methyl group.

Answers

The structure of the aromatic product is shown below: O=CNC1=CH2C2=C3C4=C(OH)C=C3C=C2.

What is aromatic ?

Aromatic molecules are a type of organic compound that contain carbon atoms connected by bonds known as double bonds. These molecules possess a distinct odor, or smell, and are known as aromatic compounds. They are often found in essential oils, perfumes, and food flavorings.

The reaction of a benzene ring with a hydroxy group on carbon 1 and an NH₂ on carbon 4 with one equivalent of acetic anhydride (which is an oxygen flanked by two carbonyls each bonded to a methyl group) produces an aromatic product. This product will be an amide, and it will have an oxygen double-bonded to a nitrogen, with the nitrogen also single-bonded to the carbon 4 of the benzene ring. The oxygen will also be single-bonded to the carbon 1 of the benzene ring. The two carbonyl groups of the acetic anhydride will each be single-bonded to a different carbon of the benzene ring.

To learn more about aromatic

https://brainly.com/question/30899828

#SPJ4

How many atoms are in 5Cao4?

Answers

Answer:

There are 30 atoms in total

Explanation:

There is 5 carbon, 5 of whatever A is and 4 oxygens but since the whole symbol has been multiplied by 5 there would be 20 oxygen

So 20 + 5 + 5 = 30 atoms

Equipment originally costing $95,000 has accumulated depreciation of $30,000. If the equipment is sold for $55,000, the company should record

Answers

Answer:

loss of $10,000

Explanation:

The gain or loss is determined by comparing the selling price of the equipment with its book value. The book value is calculated by subtracting the accumulated depreciation from the original cost.

Original cost of the equipment: $95,000

Accumulated depreciation: $30,000

Book value = Original cost - Accumulated depreciation

Book value = $95,000 - $30,000

Book value = $65,000

The selling price of the equipment is $55,000.

Now we can determine the gain or loss:

Gain/Loss = Selling price - Book value

Gain/Loss = $55,000 - $65,000

Gain/Loss = -$10,000 (a loss)

Since the company sold the equipment for $55,000, which is less than the book value of $65,000, the company should record a loss on the sale of $10,000.

Therefore, the company should record a loss of $10,000 for the sale of the equipment.

Which of the following have the empirical formula CHO?
Proteins
None of these
Nucleic Acids
Lipids

Answers

Out of the given options, none of the following have the empirical formula CHO.

The empirical formula is the simplest formula for a compound that reflects the ratio of elements present in the compound. It gives the ratio of atoms of different elements in the compound. The empirical formula can be different from the molecular formula.

Lipids are the biomolecules that are composed of carbon, hydrogen, and oxygen (CHO) in a different ratio. They are the esters of fatty acids and glycerol. They are also known as fats or oils. They are the major component of cell membranes. Lipids include fats, phospholipids, and steroids.

Nucleic acids are macromolecules composed of nucleotide units. Nucleotide units consist of a nitrogenous base, a sugar, and a phosphate group. They are the building blocks of DNA and RNA. The empirical formula of nucleic acids is C5H4O2N3P. They contain nitrogen, phosphorus, carbon, oxygen, and hydrogen. They do not have the empirical formula CHO.

Proteins are macromolecules composed of amino acids. They have a complex structure. Proteins are composed of carbon, hydrogen, oxygen, and nitrogen. Some proteins also contain sulfur and phosphorus. Therefore, they do not have the empirical formula CHO. Thus, out of the given options, none of the following have the empirical formula CHO.

To know more about empirical formula visit:

https://brainly.com/question/32125056

#SPJ11

a solution is prepared by mixing 0.15 moles of acetic acid (ch3cooh) with 0.10 moles of sodium acetate (nach3coo) in 1.00 liters of solution. ka for acetic acid is 1.8 x 10-5. what will be the ph of the solution once equilibrium is established?

Answers

The pH of the solution once equilibrium is established will be approximately 4.76.

Acetic acid (CH3COOH) is a weak acid that partially ionizes in water, releasing hydrogen ions (H+). Sodium acetate (NaCH3COO) is the conjugate base of acetic acid. When these two compounds are mixed in water, they undergo a reaction that establishes an equilibrium between the weak acid and its conjugate base.

At equilibrium, the acetic acid will partially dissociate, and the sodium acetate will partially hydrolyze to form acetic acid. This process results in the formation of a buffer solution, which resists changes in pH.

To calculate the pH, we can use the Henderson-Hasselbalch equation:

pH = pKa + log([A-]/[HA])

Where pKa is the negative logarithm of the acid dissociation constant (Ka), [A-] is the concentration of the conjugate base, and [HA] is the concentration of the weak acid.

In this case, the concentration of acetic acid (HA) is 0.15 moles and the concentration of sodium acetate (A-) is 0.10 moles. The Ka for acetic acid is 1.8 x Double exponent: use braces to clarify.

Plugging these values into the Henderson-Hasselbalch equation:

pH = -log(1.8 x Double exponent: use braces to clarify) + log(0.10/0.15)

pH ≈ 4.76

Therefore, the pH of the solution once equilibrium is established will be approximately 4.76.

Learn more about Acetic acid

brainly.com/question/15202177

#SPJ11

Can someone pleaseeeeeeeeeee check my work to see if I did it right?

Can someone pleaseeeeeeeeeee check my work to see if I did it right?

Answers

Answer:

Its right!

Explanation:

Oxygen's atomic number is 8. This means that an oxygen atom has
*
2 poin
8 neutrons in its nucleus
a total of 8 protons and neutrons
8 protons in its nucleus
a total of 8 neutrons and electrons

Answers

Answer:

8 protons in its nucleus

8 protons in its nucleus

What happens to most of the Energy that an organism gets from consuming food?

Help please​

What happens to most of the Energy that an organism gets from consuming food? Help please

Answers

it’s the second answer. “it gets used for metabolic process & released as heat” i think.

Answer:

When energy enters a trophic level, some of it is stored as biomass (as part of organisms' bodies). This is the energy that's available to the next trophic level, since only energy stored as biomass can get eaten.Explanation:

how to classify chemical reactions

Answers

Answer:

Classification

Explanation:

One of the easiest way is to group them in one of four basic types: single displacement - an element replaces another element in a compound. A + BC AC + B.

5. Ba(NO2)2 + H2SO4 = BaSO4 +2HNO2 what is the chemical reaction?

1. Single Displacement
2. Double Displacement
3. Synthesis
4. Decompostion

Answers

Answer:

2

Explanation:

A sealed container holds ideal oxygen molecules (O2) at a temperature of 255 K. If the pressure is increased by 44.0%, what is the average translational kinetic energy of an oxygen molecule

Answers

The average kinetic energy of an oxygen molecule is K.E(avg) = 6.11×10^(-21) J.

According to the kinetic theory of gases, the average kinetic energy of a gas molecule is linearly proportional to the temperature of the gas. It is independent of the pressure of the gas.

The kinetic theory of gases is an easy, historically great classical version of the thermodynamic conduct of gases, with which many essential standards of thermodynamics had been established.

The model, referred to as the kinetic concept of gases, assumes that the molecules are very small relative to the gap among molecules. The molecules are in constant, random motion and frequently collide with every different and with the walls of any field.

Learn more about the kinetic theory of gases here https://brainly.com/question/11067389

#SPJ4

Please help How many moles of a gas sample are in 14.0 L container at 269 K and 358 kPa? The gas constant is 8.31 L kPa/ mol K Round you answer to one decimal place and enter the number only with no units.

Please help How many moles of a gas sample are in 14.0 L container at 269 K and 358 kPa? The gas constant

Answers

We are going to assume that the gas mentioned behaves like an ideal gas. The equation that describes the behavior of an ideal gas is as follows:

PV=nRT

Where,

P is the pressure of the gas, 358kPa

V is the volume of the gas, 14.0L

R is the gas constant, 8.31 L kPa/mol K

T is the temperature of the gas, 269K

Now, we will clear the number of moles, n.

n=PVRT

We replace the known data:

n=358kPa×14.0L8.31L.kPamol.K×269Kn=358×14.08.31×269moln=2.24mol

Answer: In the sample of gas there are 2.24 moles

Question
Specify reagents suitable for converting 3-ethyl-2-pentene to 3-ethyl-3-pentanol: A
Conc. H 2
​ SO 4
​ /Heat
B
Conc. H 2
​ SO 4
​ /Cool
C
Dil H 2
​ SO 4
​ /Heat
D
Dil H 2
​ SO 4
​ /Cool
Hard

Answers

Suitable reagents for converting 3-ethyl-2-pentene to 3-ethyl-3-pentanol is Dilute H₂​SO₄/Heat, option (C) is correct.

The dilute H₂​SO₄ acts as a catalyst to promote the hydration of the double bond in 3-ethyl-2-pentene, forming an alcohol. The heat helps to drive the reaction forward by increasing the kinetic energy of the reactant molecules.

Conc. H₂​SO₄/Heat would lead to the elimination of a water molecule, resulting in the formation of a different alkene product. Conc. H₂​SO₄/Cool, would not promote the hydration reaction. Dil. H₂​SO₄/Cool, would also not promote the hydration reaction and would likely require a different catalyst to convert the alkene to the desired alcohol, option (C) is correct.

To learn more about dilute follow the link:

https://brainly.com/question/15467084

#SPJ4

The complete question is :

"Specify reagents suitable for converting 3-ethyl-2-pentene to 3-ethyl-3-pentanol:

A) Conc. H₂​SO₄​/Heat

B) Conc. H₂​SO₄​/Cool

C) Dil H₂​SO₄​/Heat

D) Dil H₂​SO₄/CoolHard"

How do you find the volume of solution when mass of solute and volume of solvent is given?

Answers

C = m V . The unit of concentration is typically given as g/mL because the solute mass is frequently given in grammes and the volume is frequently given in milliliters. However, there are a tone of other mass and volume unit combinations that are possible.

How do you determine a solution's volume?

Given that a solution consists of both a solute and a solvent, its total volume is equal to the sum of the volumes of both the solute and the solvent it contains.

A solution's concentration is an indicator of how much solute has dissolved in a specific volume of solvent or solution. When there is a significant amount of dissolved solute in a solution, it is said to be concentrated. When a dissolved solute is present in a solution, it is said to be diluted.

To know more about solvent visit:

https://brainly.com/question/1122671

#SPJ4

if the experiment was started with a wet flask, would the experimental value of the enthalpy of vaporization be higher, lower, or the same as the actual value? explain.

Answers

If the experiment was started with a wet flask, the experimental value of the enthalpy of vaporization would likely be lower than the actual value.

The enthalpy of vaporization, also known as the heat of vaporization, is the amount of heat energy required to change a substance from a liquid to a gas at a constant temperature. In a wet flask, some of the heat energy supplied to the substance will be absorbed by the water on the flask and will not be used to vaporize the substance. This means that it will take more heat energy to vaporize the substance than the amount recorded in the experiment, leading to a lower experimental value of the enthalpy of vaporization. Therefore, starting the experiment with a wet flask can introduce measurement errors and lower the accuracy of the experimental value of the enthalpy of vaporization. It is important to carefully control all variables and avoid any potential sources of error in experiments like this.

Learn more about vaporization here:

https://brainly.com/question/12625048

#SPJ4


The valence electrons found in metallic bonds are different from other bonds
because

A. their valance electrons are free-roaming
B.they allow conductivity of electricity
C.their valence electrons are immobile
D. They’re able to share electrons with other atoms

Answers

Answer:

their valence electrons are free roaming

Arrange the elements in increasing order of reactivity : iron, gold, zinc, copper​

Answers

Answer:

Iron, Copper, Zinc, and Gold

Explanation:

in Table of elements

Iron was no. 26

Copper no. 29

Zinc no. 30

Gold no. 79

Other Questions
A train traveled 300 miles at a constant speed. It took 5 hours. What is the constant of proportionality that describes the train's speed? In order to carefully control conditions and confirm or disconfirm a hypothesis about the causes of behavior, one must What is the Suffix of legible compute u v, where u = 2 i 317j 24k and v = u u . 6. slope y-intercept equation 6 5. 1 2 1 1-6-5-4-3-2 HB in what ways are poverty, social class, and social inequality social constructions and why does it matter? sign location for masculine gender-based signs (father, boy) are usually placed on the upper half of your face, while sign location for feminine gender-based signs (mother, girl) are usually placed on the lower half of your face. in what location are gender-neutral signs (cousin) often placed? Multiply 11.9 22.1. 2.6299 2,629.9 262.99 26.299 Hello please help I will give brainliest if you help thanks! Migration in birds A) allows these organisms to live in favorable climates and use more resources. B) is triggered by external stimuli such as day length. C) is closely linked to reproductive cycles. D) All of the choices are correct. "racism is not found in child's mind-it is a creation of complex adult" explain the statement in 150 words Who painted the image above? the place within a replication bubble where replication is actually occurring is called a _____. The scale of a map is 1 cm = 70km. What is the actual distance between two towns that are 4 cm apart on the map? 1. How might the sympathetic nervous system respondto an elevated body temperature?A. VasoconstrictionB. Releasing glucagonC. Releasing insulinD. Vasodilation what restaurants are open on thanksgiving 2021 near me if p(x)=x3 xp(x)=x3 x and q(x)=x3 x2 x 1q(x)=x3 x2 x 1, what is p(x)q(x)p(x)q(x) modulo pp? the societal health measure showing the greatest disparity between rich and poor countries is 36+ c = -56 solve the equation Why is effective communication particularly important in health care? Select all that apply.(A)Patients will have good outcomes.(B)Doctors understand patients symptoms.(C)Nurses are able to carry out doctors instructions.(D)Errors are avoided.(E)It saves time and money.(F)It puts patients at ease.(G)Patients get better.