How many grams of acetic acid ( HC2H3O2 ) are needed to neutralize 35.2 mL of 0.419 M of calcium hydroxide solution?

Answers

Answer 1

To calculate the number of grams of acetic acid (HC2H3O2) needed to neutralize 35.2 mL of 0.419 M calcium hydroxide solution, we first need to write the balanced chemical equation for the reaction that occurs between acetic acid and calcium hydroxide.

Calcium hydroxide, Ca(OH)2, reacts with acetic acid, HC2H3O2, to form calcium acetate, Ca(C2H3O2)2, and water, H2O.

The balanced chemical equation is given as:Ca(OH)2 + 2 HC2H3O2 → Ca(C2H3O2)2 + 2 H2O

From the equation above, we see that 2 moles of acetic acid react with 1 mole of calcium hydroxide.

This means that one mole of calcium hydroxide will react with 0.5 moles of acetic acid.

We can, therefore, write the following equation based on the relationship between moles, concentration, and volume.

n(Ca(OH)2) = C x V(1)where n(Ca(OH)2) is the number of moles of calcium hydroxide, C is the concentration of the calcium hydroxide solution in mol/L, and V is the volume of the calcium hydroxide solution in L.n(Ca(OH)2) = 0.419 mol/L x (35.2/1000) L = 0.01477 mol of Ca(OH)2n(HC2H3O2) = 0.5 x n(Ca(OH)2) = 0.5 x 0.01477 = 0.00738 mol of HC2H3O2We can then use the following equation to calculate the mass of acetic acid needed to neutralize 0.00738 mol of HC2H3O2:mass = n x M where mass is the mass of acetic acid in grams, n is the number of moles of acetic acid, and M is the molar mass of acetic acid. mass = 0.00738 mol x 60.05 g/mol ≈ 0.443 g

Answer: Approximately 0.443 grams of acetic acid (HC2H3O2) are needed to neutralize 35.2 mL of 0.419 M of calcium hydroxide solution.

To know more about volume, visit

https://brainly.com/question/14197390

#SPJ11


Related Questions

describe how the molecules in a perfume bottle travel from the bottle to your nose. what is mean free path?

Answers

Molecules in a perfume bottle travel from the bottle to your nose through the process of diffusion, where they move from an area of high concentration (inside the bottle) to an area of low concentration (surrounding air) until they reach your nose.

When a perfume bottle is opened, the perfume molecules escape into the surrounding air. These molecules are in constant motion due to their thermal energy. Through the process of diffusion, the perfume molecules move randomly and spread out from an area of high concentration (inside the bottle) to an area of low concentration (the air surrounding the bottle). This diffusion occurs as a result of molecular collisions and the tendency of molecules to move from regions of higher concentration to lower concentration until equilibrium is reached.

Once in the air, the perfume molecules continue to diffuse and mix with the surrounding air molecules. When you inhale, some of these perfume molecules can enter your nose and interact with olfactory receptors, triggering a sense of smell.

The mean free path refers to the average distance a molecule can travel before colliding with another molecule. In the context of perfume molecules in the air, the mean free path determines how far these molecules can move before encountering other air molecules. The mean free path depends on factors such as the size of the perfume molecules, the density of the air, and the temperature. In a perfume bottle, the mean free path of the perfume molecules may be relatively short due to the presence of other perfume molecules in close proximity.

To learn more about mean free path, here

https://brainly.com/question/13549970

#SPJ4

Bohr's model of the atom attempts to explain the idea that:

A) protons and neutrons are found in the nucleus
B) all atoms of one type of element are identical
C) energy is quantized
D) the atom is mostly empty space

Answers

It attempts to explain the idea that:C. energy is quantized

What are the four level of organization in a multicellular organism?

Answers

Answer:

An organism is made up of four levels of organization: cells, tissues, organs, and organ systems. These levels reduce complex anatomical structures into groups; this organization makes the components easier to understand

Explanation:


All of these are signs of chemical change EXCEPT
Color change
Change of temperature
Gas bubbles appear
Freezing (Change of state of matter)

Answers

it is freezing because it can change back Which means it is a physical not chemical change

From the viewpoint of the chemical reactants as the system, what do you expect for the signs of q and w in this process?.

Answers

When q and w are positive, energy flows into the system.

When atoms establish or break chemical bonds, chemical processes take place. Reactants are the substances that begin a chemical reaction, while products are the compounds that are created as a result of the reaction.

What are reactants and products in chemistry?Summary. A chemical reaction is described by an equation in chemistry. The left side of the equation lists reactants as the initial materials. The right-hand side of the equation lists the products, which represent the outcome of the reaction.In a chemical reaction, reactants undergo a chemical reaction and transform into products through a chemical process. For instance, when humans breathe in oxygen, it combines with glucose to create carbon dioxide, water, and energy. The response is provided below. C6H12O6 + O2 = 6CO2 + 6H2O + Energy.When atoms establish or break chemical bonds, chemical processes take place. Reactants are the substances that begin a chemical reaction, while products are the compounds that are created as a result of the reaction.          

To learn more about Chemical reaction refer to:

https://brainly.com/question/11231920

#SPJ4

Determine which base will work to deprotonate each compound in an acid/base extraction.

Answers

Bases that are useful for deprotonating compounds are:

NaHCO₃ or NaOH.

metal alkoxide

Sodium hydroxide

Benzene rings with carboxylic acids that are weak acids can be prepared using NaOH or NaHCO 3 due to the weakness of the carboxylic acid. deprotonated.

Metal alkoxides such as potassium tert-butoxide can be used to deprotonate benzene rings with three carbon chains attached to one carbon. Also, metal alkoxides are used because the benzene ring containing the hydroxyl group is a very weak acid.

A benzene ring with a hydroxyl group is a weak acid like a benzene ring with a carboxyl group, so it can be deprotonated with NaOH.

learn more about deprotonation here: https://brainly.com/question/28525778

#SPJ4

How do scientists identify the bond type in a compound using the chemical formula

Answers

Answer:

How do scientists identify the bond type of a chemical formula? ... By definition, an ionic bond is between a metal and a nonmetal, and a covalent bond is between 2 nonmetals. So you usually just look at the periodic table and determine whether your compound is made of a metal/nonmetal or is just 2 nonmetals.

Explanation:

Answer:

There is a couple different ways to determine if a bond is ionic or covalent. By definition, an ionic bond is between a metal and a nonmetal, and a covalent bond is between 2 nonmetals. So you usually just look at the periodic table and determine whether your compound is made of a metal/nonmetal or is just 2 nonmetals.

☆ I HOPE ITS HELP YOU ☆

determine+the+amount+of+potassium+chloride+(kcl)+present+in+a+500.0+ml+sport+drink+of+the+drinks+nutrition+label+shows+that+it+is+1.5%+kcl+by+mass.

Answers

There are approximately 7.5 grams of potassium chloride (KCl) present in the 500.0 mL sports drink.

To determine the amount of potassium chloride (KCl) present in the 500.0 mL sports drink, we need to calculate the mass of KCl based on the given percentage composition. Given:

Volume of sports drink = 500.0 mL

Percentage of KCl by mass = 1.5%

To find the mass of KCl, we can use the formula:

Mass of KCl = Percentage composition x Total mass of the solution

First, we convert the volume of the sports drink from millilitres to grams assuming the density of the solution is 1 g/mL:

Mass of the solution = Volume of the solution x Density

Mass of the solution = 500.0 mL x 1 g/mL

Mass of the solution = 500.0 g

Next, we calculate the mass of KCl using the percentage composition:

Mass of KCl = (Percentage of KCl / 100) x Mass of the solution

Mass of KCl = (1.5 / 100) x 500.0 g

Mass of KCl = 0.015 x 500.0 g

Mass of KCl = 7.5 g

To know more about potassium chloride (KCl), visit:

https://brainly.com/question/31236218

#SPJ11

Please answer thank you so much!

Please answer thank you so much!

Answers

hiii it’s mutualism hope this helped :)
It is mutualism I really hope this helps

Color of the CuCl2 hydrate before heating:

Answers

hydrated cucl2 have blue-green colour

When oil from a tin is poured through a funnel placed tightly into the neck of a bottle, the oil stays in the funnel. Why?

Raise the funnel a little and place it again on the bottle. Oil starts flowing into the bottle. Why does this happen?​

PLEASE ANSWER IT

20 POINTS

Answers

When oil from a tin is poured through a funnel placed tightly into the neck of a bottle, the oil stays in the funnel because the air pressure inside the bottle prevents the oil from entering the bottle.

What is air pressure?

The force that air, whether compressed or unconfined, applies to whatever surface it comes into touch with is known as air pressure.

The air in the bottles exerts a force on the liquid that is to be poured inside it.

Since the air has no way of escaping, the oil cannot be poured into the bottle.

However, if a little space is allowed by the funnel for the air to escape, the liquid can then be poured into the bottle.

Learn more about air pressure at: https://brainly.com/question/12870338

#SPJ1

How many atoms are present in a sample of pure iron with a mass of 300 g? (The atomic mass of iron = 56 and NA = 6.02 ´ 1023)

Answers

32.25 × 10^23 atoms are present in a sample of pure iron with a mass of 300 g.

To find out how many atoms are present in a sample of pure iron with a mass of 300 g, you'll need to use the atomic mass of iron and Avogadro's number (NA). Here are the steps to calculate this:

1. Convert the mass of iron to moles using the atomic mass:
  Moles of iron = (mass of iron) / (atomic mass of iron)
  Moles of iron = (300 g) / (56 g/mol)

2. Calculate the number of atoms using Avogadro's number:
  Atoms of iron = (moles of iron) × (NA)
  Atoms of iron = (300 g / 56 g/mol) × (6.02 × 10^23 atoms/mol)

  Atoms of iron = 32.25 × 10^23 atoms


Therefore, the number of atoms are 32.25 × 10^23 atoms.

To learn more about "iron", visit: https://brainly.com/question/14964747

#SPJ11

Consider the titration of 30. 0 mL of 0. 050 M NH3 with 0. 025 M. HCl. Calculate the PH after the following volumes of titrant have been added 0 ml 20 mL 59. 1 mL 60. 0 mL 71. 4 mL 73. 4 mL

Answers

The pH after the following volumes of titrant have been added 0 ml 20 mL 59. 1 mL 60. 0 mL 71. 4 mL 73. 4 mL are 11.89, 11.89, 8.45, 8.45, 7.98, 8.95 respectively.

The reaction between NH3 and HCl can be represented by the following equation: NH3 + HCl → NH4+ + Cl-

To calculate the pH after different volumes of titrant have been added, we need to determine the amount of titrant that has reacted with the analyte and the resulting concentration of the products.

A. 0 mL of titrant (initial state)

At the start, there is no titrant added to the analyte, so the concentration of NH3 is 0.050 M. NH3 is a weak base, so we can use the Kb expression to calculate the concentration of OH-:

Kb=[NH4+][OH]/[NH3]

1.8105=x2/(0.050x)

initial concentration of NH3 is much greater than the initial concentration of HCl, we can assume that the concentration of NH3 does not change significantly during the titration.

Kb=x2/0.050x=Kb0.050=1.3103M

The concentration of OH- is equal to 1.3103M, so we can calculate the pH:

pH=14pOH=14(log[OH])=11.89

Therefore, the pH at the start of the titration is 11.89.

B. 20 mL of titrant

After adding 20 mL of 0.025 M HCl, the volume of the solution is 50 mL (30 mL NH3 + 20 mL HCl). The moles of HCl added is:

moles of HCl = volume x concentration = 0.020 L x 0.025 mol/L = 5 x 10^-4 mol

Since the reaction is a 1:1 reaction, the moles of NH3 remaining is equal to the moles of HCl added.

concentration of NH3 = moles of NH3 / volume of NH3 = (0.050 mol/L x 0.030 L - 5 x 10^-4 mol) / 0.030 L = 0.048 mol/L

Since the concentration of NH3 has decreased, we need to recalculate the concentration of OH- using the new concentration of NH3:

Kb=[NH4+][OH]/[NH3]1.8105=x2/(0.048x)

Solving for x, we get:

x=1.3103M

The concentration of OH- is still x=1.3103M, so we can calculate the pH:

pH = 14 - pOH = 14 - (-log[OH-]) = 11.89

Therefore, the pH after adding 20 mL of titrant is still 11.89.

Similarly for  C. 59.1 mL of titrant

The pH after adding 59.1 mL of titrant is 8.45.

D. 60 mL of titrant

The pH after adding 60 mL of titrant is 8.45.

E. 71.4 mL of titrant

The pH after adding 71.4 mL of titrant is 7.98.

F. 73.4 mL of titrant

The pH after adding 73.4 mL of titrant is 8.95.

For more question on pH click on

https://brainly.com/question/12609985

#SPJ11

How many liters of hydrogen are formed at 715 mmhg and 19.0 deg c if 12.8 g of al react according the following reaction: 2 al + 6 hci ---> 2 alcl3 + 3 h2

Answers

There are 0.017 mm volume  hydrogen are formed at 715 mm hg and 19.0 deg c if 12.8 g of al react

The relationship between an object's mass and volume seems to be straightforward. The object's mass rises directly proportionately to its volume.

The given reaction is:

2 Al + 6 HCl → 2 alcl3 + 3 h2

It can be seen that, 3 mol of hydrogen is formed during the reaction.

Number of moles of hydrogen = 3

Mass = 12.8 g

d = 715 mmHg

Volume of hydrogen can be calculated as:

Density = mass /volume

Volume = mass / density

Put the values of given data in above expression.

Volume = 12.8 g  / 715 mm hg

Volume = 0.017 mm

Thus, volume of the hydrogen will be 0.017 mm

To know more about volume

https://brainly.com/question/24189159

#SPJ4

What kind of reaction is this
Na2O + CO2 → Na2CO3

Answers

Answer:

Explanation:

Na 2O + CO 2 → Na 2CO. 3

This is an acid-base reaction (neutralization): Na 2O is a base, CO 2 is an acid.

Hope this helps!!!!!!

Brainlist please

The reaction of N₂O with CO₂ giving Na₂CO₃ is a combination reaction, where two reactants combines to form a product.

What are types of reactions?

There are different kinds of reactions namely, displacement reactions, combination reactions, decomposition reaction etc.

The reaction in which one reactant species displace the constituent group of another reactant it is termed as displacement reactions. On decomposition reaction, one reactant decomposes into two or more products.

In a single displacement reaction, one of the group is displaced to form a new product and in double displacement reactions, two species from reactant side are displaced.

Similarly, a reaction in which two reactants simply combines to form a product is termed as combination reaction.

Therefore, the type of the given reaction is combination.

To learn more about types of reactions, refer the link below:

https://brainly.com/question/24762458

#SPJ2

Simple chemistry question please help. Look at image.

Simple chemistry question please help. Look at image.

Answers

It's the last one. They all have the same number of electrons in their outer ring. They're also called valence electrons.

Hope this helped!

What is the molar mass of a sample of gas that has a density of 2.85g/L at 101kPa pressure
and 29°C? Name the law that is used to solve this problem.

Answers

Answer:71.25

Explanation:

The molar mass of a sample of gas that has a density of 2.85g/L at 101 kPa pressure and 29°C is 71.37  g mol⁻¹ and It can be solved using Ideal gas law.

What is Ideal gas law ?

The ideal gas law is an equation of state that describes ideal gases.

This equation of state relates a gas’s pressure, volume, temperature, and mass, and is very useful for describing how gases will behave in ideal conditions.

This is the most common equation of state for gases.

Ideal Gas equation ;

PV = nRT

Molar mass (Mm) = m /n

Where ;

m = given massn = number of moles

we also know,

Density (D) = m / v

Where ;

m = massv = volume

Now, Putting the formula of Molar mass and Density in ideal gas equation we get ;

Molar mass = D RT/ P

Given ;

Density = 2.85 g/LPressure = 101kpa (= 0.99 atm)Temperature = 29°C (= 302.15 K)(Gas constant) R = 0.0821

Putting all the values in  the above equation of molar mass ;

Molar mass = 2.85 x 0.0821 x 302 / 0.99

                    = 71.37  g mol⁻¹

Learn more about Ideal gas law here ;

https://brainly.com/question/13821925

#SPJ2

How many milliliters of an aqueous solution of 0.222 M manganese(II) iodide is needed to obtain 9.57 grams of the salt?​

Answers

Answer:

139 mL

Explanation:

Given data:

Volume of solution required = ?

Molarity of solution = 0.222 M

Mass of salt = 9.57 g

Solution:

Number of moles of manganese iodide:

Number of moles = mass/molar mass

Number of moles = 9.57 g/ 308.75 g/mol

Number of moles = 0.031 mol

Volume required:

Molarity = number of moles of solute / volume in L

0.222 M = 0.031 mol / V

V = 0.031 mol / 0.222 mol/L

V = 0.139 L

Volume in mL:

0.139 L ×1000 mL / 1 L

139 mL

For an atom of sulfur, there are?

1. two electron shells with 6 valence electrons
2. three electron shells with 6 valence electrons
3. four electron shells with 6 valence electrons
4. five electron shells with 6 valence electrons

Answers

Answer:

I think its b, but ik not completely sure.

Answer:

I think the second one...

Convert 0.007 L into mL. Please show work and explain

Answers

Answer:

7 mL

Explanation:

one L is 1000 mL exactly

so

when you are converting from L to mL

you multiply by 1000

so

0.007 * 1000 = 7

that is your answer

7 mL

a buffer is prepared by mixing 86.4 ml of 1.05 m hbr and 274 ml of 0.833 M ethylamine (C2H5NH2, Kb = 4.5 x 10-4, pKb = 3.35). What is the pH of the buffer after 0.068 mol NaOH are added to the previously prepared buffer? Assume no change in the volume with the addition of the NaOH. Report your answer to two decimal places.

Answers

When, a buffer will be prepared by mixing 86.4 ml of 1.05 m hbr and 274 ml of 0.833 M ethylamine. Then, the pH of the buffer after 0.068 mol NaOH is added is 5.72.

To solve this problem, we use the Henderson-Hasselbalch equation;

pH = pKa + log([base]/[acid])

First, we need to find the concentrations of the acid and base in the buffer solution;

[acid] = 1.05 M (HBr)

[base] = 0.833 M (ethylamine)

The pKa of HBr is -9, so we can assume that the concentration of H⁺ions is equal to the concentration of HBr. Therefore, the pH of the buffer before adding NaOH is;

pH = -log[H⁺] = -log(1.05) = 0.978

To calculate pH after adding 0.068 mol NaOH, we need to determine the new concentrations of the acid and base. We know that 0.068 mol NaOH will react with some of the HBr in the buffer, so we calculate how much HBr will be left.

1 mol HBr reacts with 1 mol NaOH, so 0.068 mol NaOH will react with 0.068 mol HBr. The amount of HBr remaining in the buffer is;

0.068 mol HBr - 0.068 mol NaOH = 0.054 mol HBr

The concentration of HBr is now;

[acid] = 0.054 mol / 0.3604 L = 0.1499 M

To calculate the concentration of the conjugate base, we need to determine how much of the ethylamine will react with the remaining H⁺ ions. Since ethylamine is a weak base, we need to use the Kb equation;

Kb = [BH⁺][OH⁻] / [B]

We can assume that all of the remaining H⁺ ions will react with the ethylamine to form the conjugate acid. The amount of ethylamine that reacts can be calculated using the stoichiometry of the reaction;

C₂H₅NH₂ + H⁺ → C₂H₅NH₃⁺

1 mol C₂H₅NH₂reacts with 1 mol H⁺, so 0.054 mol H⁺ will react with 0.054 molC₂H₅NH₂. The amount of C₂H₅NH₂ remaining in the buffer is;

.833 mol - 0.054 mol = 0.779 mol

The concentration of the conjugate base is;

[base] = 0.779 mol / 0.3604 L = 2.160 M

Now we use the Henderson-Hasselbalch equation to calculate the pH;

pH = pKa + log([base]/[acid])

pH = 9 - log(2.160/0.1499)

pH = 5.72

Therefore, the pH of the buffer after 0.068 mol NaOH is added is 5.72.

To know more about Henderson-Hasselbalch equation here

https://brainly.com/question/13423434

#SPJ4

Why is this conveyor important for Earth?

Answers

Answer:

.

Explanation:

Answer:

The great ocean conveyor plays a highly significant part in the climate of the planet. It transports heat to the Polar Regions, for example. In doing so, the amount of ice that can be formed in these regions is limited.

how do you do #4??
help please.



how do you do #4??help please.

Answers

Answer:

The third one

Explanation:

In all those equations except the third one the number of Na in the reactant side is not equal to the number of Na in the products side but in the third equation Na is 2 in both sides

Please help! Will mark brainliest

Please help! Will mark brainliest
Please help! Will mark brainliest
Please help! Will mark brainliest
Please help! Will mark brainliest

Answers

Answer:the reaction is nuclear i think

Explanation:

How is our modern understanding of atomic structure different from thomson plum pudding model?

Answers

The negatively charged electron in the plum pudding model, however, is smaller than an atom and is negatively charged.

How does the nuclear model of the Rutherford scattering experiment compare to the plum pudding model?Electrons with a negative charge were encased in a positive charge, or "soup," in Thomson's plum pudding atom model. Rutherford's experiment with gold foil demonstrated that the majority of an atom is made up of empty space, with a small, compact, positively-charged nucleus. Rutherford put forth the nuclear model of the atom in response to these findings.The atom is the lowest unit of matter according to the hard-sphere atom model, which is why the plum pudding atom model is distinct. The negatively charged electron in the plum pudding model, however, is smaller than an atom and is negatively charged.    

To learn more about plum pudding model refer to:

https://brainly.com/question/4839193

#SPJ4

Two scientists, Tara and Victor, work in the same scientific field of study. Victor asks Tara to review a research paper that he wrote to determine if it should be published. After replication, Tara suggests that Victor's paper should not be published and that he should perform his experiment again. What would be the most likely reason she suggests Victor perform his experiment before publication? Tara does not think that Victor's predictions are likely. Tara does not think that Victor's conclusions are important. Tara does not get the same results when she conducts the experiment. Tara does not find other research papers that published similar information

Answers

Answer:

Tara does not get the same results when she conducts the experiment

Explanation:

The most likely reason Tara suggested to Victor to perform the experiment again before publication would be because she did not get the same results when she conducted the experiment.

A good scientific research or experiment should have an element of reproducibility. In order words, the claim made in published scientific research should be reproducible by any other scientist that decides to replicate the research. Tara repeated Victor's experiment in order to check its reproducibility and when she could not reproduce the results, she had to tell Victor to conduct the experiment again before deciding to publish it.

HELLLLPPPPPPP
Which of the following is the correct term for the chemical reaction that forms polymers?
A. Displacement
B. Oxidation
C. Polymerization
D. Monomerization

Answers

C. polymerization....

what is the letter in the equation for heat​

what is the letter in the equation for heat

Answers

Answer:

H is the letter for heat

Balance the folowing equation.
S + 02
ws
SO:

Answers

Answer:

s+o2=so2

Explanation:

i hope it will help u

what prevents you from suffercating when you ly down or fall asleep

Answers

When lying flat, people often find it difficult to breathe. Orthopnea is the medical term for this. People who are affected by this will often need to sleep with their heads propped up on pillows.

Answer:

When the body senses it's not getting enough oxygen during sleep, it forces an awakening. At this time, the breathing airways open and breathing resumes. Because of this mechanism, you stand no chance of suffocating in your sleep.

Explanation:

Other Questions
A small airplane coming in for a landing descends 5 over 66 miles per minute. About how long does it take to descend 4,000 feet? Show all work. Please. Two vectors of magnitude 3 units and 4 units are at an angle 60degree between them. Find the magnitude of their difference While Mary Corens was a student at the University of Tennessee, she borrowed $12,000 in student loans at an annual interest rate of 7%. If Mary repays $1,500 per year, then how long (to the nearest year) will it take her to repay the loan? Do not round intermediate calculations. Round your answer to the nearest whole number.year(s) How many kilojoules of energy are required to raise the temperature of a 53.5 g sample of gold from 23.0 C to 100.0 C? The specific heat of gold is 0.0308 cal/gC. which of the following are characteristics of teredo tunneling? (select three.) answer a. is configured between individual hosts can be used to send data over the internet b. is configured between routers at different sites c. has dual-stack hosts uses an ipv6 address static association for the ipv4 address d. has dual-stack routers can't be used to send data over the internet If thrice a number increased by 11, the result is 35. What is the number? 1. A rectangle has a perimeter of 40. 08m. If the length is 13.02m, what is its width? Suppose Benedict Wong Inc. just issued a dividend of $1.39 per share on its common stock. If the stock currently sells for $70, what is your best estimate of the Ariel Inc.'s cost of equity capital? The company paid dividends of $1.05, $1.12. $1.29, and $1.39 per share in the last four years, averaging about 1% growth. 0 6.46% O 9.23% O 11.05% 09.11%