How many grams are in 93.1 moles of selenium

Answer:

Power, P = 300 W

Explanation:

We have,

Force acting on the box to take it is 300 N

It is moved to a distance of 10 m in 10 seconds

It is required to find the power required to move the box. The rate at which work is done is called power required by an object. It can be given by the formula as follows :

\(P=\dfrac{W}{t}\\\\P=\dfrac{Fd}{t}\\\\P=\dfrac{300\times 10}{10}\\\\P=300\ W\)

So, the power required is 300 W.

Mass of substance is 39.78kg

Density = mass / volume

Given,

Density of the substance is 1.53g/cm³

Volume of the substance is 26 L = 26000cm³

we have to find out mass by this two terms

Density = mass / volume

1.53. = mass / 26000

mass = 26000 × 1.53

= 39780gm = 39.78kg

Therefore the mass of the given substance is 39.78kg.

Learn more about Density here:

https://brainly.com/question/1354972

#SPJ9

To solve such this we must know the concept of redox reaction. Therefore, the given reaction is redox reaction as one element is getting oxidized and other is getting reduced.

Chemical reaction is a process in which two or more than two molecules collide in right orientation and energy to form a new chemical compound. The mass of the overall reaction should be conserved. There are so many types of chemical reaction reaction like combination reaction, double displacement reaction.

Redox reaction is a chemical reaction where oxidation and reduction takes place simultaneously. Oxidation is loss of electrons and reduction is gain of electrons. The electron transfer from oxidant to reductant.

CH\(_4\) + 2 O\(_2\) \(\rightarrow\) CO\(_2\) + 2 H\(_2\)O

The oxidation state of C in CH\(_4\) is -4 while in CO\(_2\)  it is +4. So, carbon is getting oxidized. The oxidation state of oxygen in O\(_2\) is 0 while in  H\(_2\)O it is -2, so oxygen is getting reduced. So, this reaction is a redox reaction.

Therefore, the given reaction is redox reaction.

Learn more about the chemical reactions, here:

brainly.com/question/3461108

#SPJ1

In the given reaction, carbon oxidizes from 0 oxidation state to +4 state whereas, oxygen reduces from 0 to -2. Hence, one species is oxidized and another species is reduced, thus, it is a redox reaction.

A redox reaction a type of reaction in which one species is oxidized and another species is reduced. In oxidation an element forms its higher oxidation state whereas in reduction it reduces to lower oxidation state.

In the given reaction, carbon is in zero oxidation state zero and the it forms +4 oxidation state in CO₂. Similarly, oxygen is in zero charge at its molecular state O₂ which is changed to -2 state in CO₂.

Therefore, both oxidation and reduction takes place in this reaction and it is a redox reaction.

To find more on redox reaction, refer here:

https://brainly.com/question/13293425

#SPJ1

The mass of the compound is calculated by freezing point depression formula which is ΔTf=Kf×W₂×1000/M₂×W₁ which is equal to 3125 g.

Compound is defined as a chemical substance made up of identical molecules containing atoms from more than one type of chemical element.

Molecule consisting atoms of only one element is not called compound.It is transformed into new substances during chemical reactions. There are four major types of compounds depending on chemical bonding present in them.

Freezing point depression is calculated by the formula, ΔTf=Kf×W₂×1000/M₂×W₁ .Therefore,W₁=5.12×75×1000/0.48×256=3125 g.

Thus, mass of compound is 3125 g.

Learn more about compound,here:

https://brainly.com/question/13516179

#SPJ1

The correct answer is that thermal energy is moving from your feet to your socks. The battery-heated socks work by using the heat generated by your body to warm your feet in cold weather.

The body produces heat, which is converted into thermal energy, and moves from your feet to the socks.

In order to warm your feet and make them more comfortable in cold weather, the socks use thermal energy. The thermal energy is only transferred in one direction, from your feet to the socks.

No more energy is produced because the battery-heated socks utilise your body's thermal energy to keep your feet warm.

To learn more about thermal energy visit:

https://brainly.com/question/19666326

#SPJ1

Answer:

a) 3,3-dimethyl-2-butanol

b) Attached below

c) Yes, this compound is optically active because it has one chiral carbon. Highlighted as Red below.

d) Structures attached below.

e) Isomers shown below.

Answer:

Most positive = rubidium

Most negative = fluorine

Explanation:

Electron affinity of an element is the energy released when an electron is attached to a neural atom to form an ion in its gaseous state.

X + e⁻ → X⁻

Electron affinity is similar to electronegativity which is the tendency at which an atom accepts an ion towards itself.

Electron affinity increases across the period and decreases down the group in the periodic table.

In the above option,

Fluorine has the highest electron affinity

Rubidium has the lowest electron affinity

Tellurium and then finally Phosphorus

Helium in this case would have the lowest electron affinity because it has filled orbital and does not require any electron to attain stability. Technically, Helium has the lowest or is expected to have the lowest electron affinity which is close to zero according to quantum mechanics.

Most positive = rubidium

Most negative = fluorine.

You can check periodic table for their exact values

Answer:

69.94% iron by mass.

Explanation:

The assumption that accounts for the great compressibility of gases compared to liquids and solids is assumption 1: Gases are made up of molecules which are relatively far apart. Option A)

The assumption that accounts for the great compressibility of gases compared to liquids and solids is assumption 1: Gases are made up of molecules which are relatively far apart.

In gases, the molecules are widely spaced and have significant gaps between them. This allows gases to be easily compressed under pressure. When external pressure is applied to a gas, the molecules can be brought closer together, reducing the volume occupied by the gas. The gaps between the molecules provide room for compression, allowing gases to occupy a smaller volume.

In contrast, liquids and solids have molecules or particles that are closely packed together. The intermolecular forces in liquids and solids are stronger, limiting their compressibility. The molecules or particles are already in close proximity, leaving little room for further compression.

Therefore, the assumption that gases consist of molecules that are relatively far apart accounts for their greater compressibility compared to liquids and solids. Hence Option A) is correct.

For more question on molecules

https://brainly.com/question/24191825

#SPJ8

Mass of the pure silver deposited on a metal object made into the cathode of the cell is calculated to be 0.0217 gm.

The process of using electrodeposition to coat an object in a layer of metal is called electroplating .

As we know that, Q = I * t

=0.270 * 72

= 19.44 C

Here Q is quantity of electricity , I is current in amperes = 0.270 A (given)

t is time in seconds (72.0 sec)

As 96500 Coulomb of electricity electrolyzes 1 mole of Ag

then,19.44 C of electricity deposits,

=1/96500 * 19.44

= 0.000201 moles of Ag

Mass of Ag is = number of moles * molar mass

= 0.000201 * 108

= 0.0217 gm

Thus, mass of pure silver deposited on a metal object made into the cathode of the cell is  0.0217 gm.

To know more about electroplating, refer

https://brainly.com/question/16266707

#SPJ4

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

The theoretical yield of the reaction can be calculated using the stoichiometric ratios from the balanced chemical equation.

1CaCO3 -> 1CaO + 1CO2

The theoretical yield of CaO is equal to the amount of CaCO3 used in the reaction.

The percent yield can then be calculated as follows:

Percent yield = (actual yield / theoretical yield) x 100

Percent yield = (13.1 g CaO / 24.8 g CaCO3) x 100

Percent yield = 52.9 %

Therefore, the percent yield of the reaction is 52.9%.

Answer:

When conducting a chemistry lab experiment using chalk (calcium carbonate) in vinegar (acetic acid), there are several limitations and precautions to be aware of:

Limitations of chalk in vinegar chemistry experiment:

Reaction rate: The reaction between chalk and vinegar is relatively slow, which may require a longer observation period or higher concentration of vinegar to observe significant changes within a reasonable time frame.

Solubility: Chalk may not dissolve completely in vinegar, resulting in incomplete reaction or difficulty in obtaining accurate results.

Product formation: The reaction between chalk and vinegar produces carbon dioxide gas, water, and calcium acetate. The carbon dioxide gas may escape into the atmosphere, leading to loss of product and inaccurate measurements.

pH: Chalk is a basic substance, and the reaction with vinegar, which is acidic, may result in neutralization, leading to a decrease in the overall acidity of the reaction mixture.

Precautions to take in chalk in vinegar chemistry experiment:

Ventilation: The reaction between chalk and vinegar produces carbon dioxide gas, which can displace air and potentially cause asphyxiation in a closed or poorly ventilated area. Conduct the experiment in a well-ventilated area or under a fume hood to ensure adequate air circulation.

Eye and skin protection: Vinegar is an acid and can cause skin and eye irritation. Wear appropriate personal protective equipment (PPE), such as gloves and goggles, to protect yourself from contact with vinegar or any other chemicals used in the experiment.

Chemical handling: Handle the chemicals, including chalk and vinegar, with care, following proper lab safety protocols. Avoid ingestion, inhalation, or direct contact with the chemicals, and dispose of them properly according to local regulations.

Accuracy in measurements: Use calibrated and accurate measuring tools, such as graduated cylinders or burettes, to measure the amount of chalk, vinegar, and other reagents accurately. This will ensure the reliability and accuracy of the experimental results.

Observations: Make careful and detailed observations during the experiment, noting any changes in appearance, gas evolution, or other relevant observations. Take measurements at appropriate intervals and record the data accurately for analysis and interpretation.

It is important to follow good laboratory practices, including proper chemical handling, accurate measurements, and cautious observations, to ensure safe and reliable results in a chalk in vinegar chemistry lab experiment. Consult with a qualified instructor or supervisor for specific guidelines and precautions related to your experiment.

The carbohydrate molecule would have more atoms than the glucose molecule.

We need to know what is a monomer and what is a polymer. It is important to note that the polymer is made from the agglomeration of the small units of the compound that combine together.

We ought to know that glucose is a monomer and that carbohydrate is the polymer. The monomer is composed of a few atoms but there are many more atoms in the polymer as the atoms join together. This is because the carbohydrate is made up of many atoms much more than glucose.

Learn more about polymer:https://brainly.com/question/17354715

#SPJ1

Answer:

there is no shift in the state

Explanation:

The correct answer is - There is no shift in the state.

Reason -

If K > Q, a reaction will proceed forward, converting reactants into products.  If K < Q, the reaction will proceed in the reverse direction, converting products into reactants.  If Q = K then the system is already at equilibrium.

where Q, is the reaction Quotient

According to the chart, the combination that would result in the lowest body temperature and highest risk of developing hypothermia would be option E: wind speed of 25 mph and a temperature of 35 °F. At this combination, the "feels like" temperature is -22 °F, which is well below the threshold for hypothermia. It is important to note that this chart only calculates the "feels like" temperature and other factors such as clothing, humidity, and overall health can also affect a person's risk of developing hypothermia

Answer:

The answer is D

Explanation:

Non metals are:

Hydrogen (H)

Sulphur (S)

Phosphorus (P)

Carbon (C)

Fluorine (F)

Oxygen (O)

Nitrogen (N)

Chlorine (Cl)

Bromine (Br)

Helium (He)

Argon (Ar)

Iodine (I)

Neon (Ne)

Krypton (Kr)

Radon (Rn)

Selenium (Se)

Xenon (Xe)

Explanation:  C) the air temp. at the top is lower

Answer:

a) compound b) element) c) mixture

Explanation:

a) has only the same shapes which has multiple elements connected together through bonds

b) has only elements which are single and not connected

c) has a mix of elements and compounds

Answer:

so so

Explanation:

this your question?? <_>

Answer:

[Ar] 3d¹⁰ 4s² 4p³

Explanation:

so...... ur welcome

Answer:

to become a noble gas element P will have 2 electrons in it's outer most energy level if it has one energy level

and eight in the last energy level if more than one

Answer:

Explanation:The compound copper(II) Iodide is a strong electrolyte. Write the reaction when copper(ll) Iodide is put into water: The compound iron(III) sulfate is a strong electrolyte. Write the reaction when Iron(III) sulfate is put into water: Write the net ionic equation for the precipitation of iron (III) sulfide from aqueous solution: Write the net ionic equation for the following molecular equation. HI is a strong electrolyte. HF is a weak electrolyte. KF(aq) + HI(aq) arrow KI(aq) + HF(aq) Use H^+ for the hydronium ion. Write the net ionic equation for the following molecular equation. Fe(s) + Pb(NO3)2(aq) arrow Fe(NO3)2(aq) + Pb(s)

The enthalpy change of the reaction C(diamond) → C(graphite) is -2.9 kJ.

The given information is ΔHrxn for the reaction C(diamond) → C(graphite) can be calculated with the given equations:Equations:  C(diamond) + O2(g) → CO2(g) ΔH = −395.4 kJ  2 CO2(g) → 2 CO(g) + O2(g) ΔH = 566.0 kJ  C(graphite) + O2(g) → CO2(g) ΔH = −393.5 kJ  2 CO(g) → C(graphite) + CO2(g) ΔH = −172.5 kJThe required reaction can be obtained by adding the equations (1) and (4), as follows:C(diamond) + O2(g) + 2CO(g) → C(graphite) + 3CO2(g)Addition of the two equations (1) and (4) results in a reaction whose products are C(graphite) and CO2.

To get the final equation that involves only the required reactants and products, the equation (2) should be added, which consumes CO2 and produces O2, as shown below:C(diamond) + O2(g) → CO2(g)  ΔH = −395.4 kJ [eq. (1)]  2 CO(g) → C(graphite) + CO2(g)  ΔH = −172.5 kJ [eq. (4)]  2 CO2(g) → 2 CO(g) + O2(g)  ΔH = 566.0 kJ [eq. (2)]  C(diamond) + O2(g) + 2CO(g) → C(graphite) + 3CO2(g)  ΔHrxn=ΣΔHf(products)−ΣΔHf(reactants)  ΔHrxn=[(3 mol CO2)(-393.5 kJ/mol) + (1 mol C(graphite))(0 kJ/mol)] − [(1 mol C(diamond))(0 kJ/mol) + (1 mol O2)(0 kJ/mol) + (2 mol CO(g))(−172.5 kJ/mol)] − [(2 mol CO2)(566.0 kJ/mol)]  ΔHrxn=−2.9 kJ.

for such more questions on reaction

https://brainly.com/question/11231920

#SPJ8

The net ionic equation for the reaction between potassium sulfide and magnesium iodide is S2- + Mg2+ -> MgS, as the potassium and iodide ions are spectator ions and do not participate in the reaction.

To determine the net ionic equation for the reaction between potassium sulfide (K2S) and magnesium iodide (MgI2), we first need to identify the ions present in each compound and then determine the products formed when they react.

Potassium sulfide (K2S) dissociates into two potassium ions (K+) and one sulfide ion (S2-):

K2S -> 2K+ + S2-

Magnesium iodide (MgI2) dissociates into one magnesium ion (Mg2+) and two iodide ions (I-):

MgI2 -> Mg2+ + 2I-

Now, we need to determine the possible products when these ions combine. Since potassium (K+) has a +1 charge and iodide (I-) has a -1 charge, they can combine to form potassium iodide (KI):

K+ + I- -> KI

Similarly, magnesium (Mg2+) and sulfide (S2-) can combine to form magnesium sulfide (MgS):

Mg2+ + S2- -> MgS

Now, we can write the complete ionic equation by representing all the ions present before and after the reaction:

2K+ + S2- + Mg2+ + 2I- -> 2KI + MgS

To obtain the net ionic equation, we remove the spectator ions, which are the ions that appear on both sides of the equation and do not participate in the actual reaction. In this case, the spectator ions are the potassium ions (K+) and the iodide ions (I-).

Thus, the net ionic equation for the reaction between potassium sulfide and magnesium iodide is:

S2- + Mg2+ -> MgS

For more such questions on  ionic equation visit:

https://brainly.com/question/25604204

#SPJ8

Answer: 7 g

Explanation: 42/6=7

Answer:

Maximum safe operating temperature = 450 °C

Explanation:

First, the volume of the cylindrical vessel is determined using the formula:

v = πr²h

Radius, r, of stainless steel vessel = width or diameter / 2

r = 39.0 cm / 2 = 19.5 cm

height of vessel = 46.8 cm

volume of cylinder = 22/7 × 19.5² × 46.8 = 55929.343 cm³ = 0.05593 m³

Using the ideal gas equation to calculate the maximum safe temperature

PV = nRT

pressure, P = 5.30 MPa = 5.30 × 10⁶ Pa

R = 8.314 J/mol.K

n = mass of gas/ molar mass of gas

molar mass of SF₆ = 146 g/mol

mass of Sf₆ = 7.20 kg = 7200 g

n = 7200/146 = 49.315 moles

T = PV/nR

T = (5.30 × 10⁶ × 0.05593) / (49.315 × 8.314)

T = 722.98 K

T in °C = 714.98 - 273.15 = 449.83 °C

Therefore, maximum safe operating temperature = 450 °C

Convex lenses refract light inward toward a focal point. Light rays progress through the edges of a convex lens and are bent most.

convex lenses are across in the middle. Rays of light that pass through the lens are conducted closer together (they converge). A convex lens is a meet lens. When parallel rays of light pass through a convex lens the refracted rays cross at one point called the principal focus.

. A convex lens is a connecting lens. When parallel rays of light pass through a convex lens the refracted rays merge at one point called the principal focus.

So we can conclude that Convex Lens. Concave Lens; It is known as a converging lens as light rays, when passed through this lens, tends to bend towards each other. It is known as a Convex Lens

Learn more about Convex Lens here: https://brainly.com/question/28039799

#SPJ1

The temperature increase from 20 °C to 46 °C indicates that the reaction between zinc and copper sulfate solution is exothermic, with heat being released into the surroundings.

In the given reaction between zinc and copper sulfate solution, the temperature change can provide insights into the type of heat change occurring during the reaction. Based on the provided information, the initial temperature of the copper sulfate solution was 20 °C, and the final temperature of the mixture after the reaction was 46 °C.

The temperature increase observed in this reaction indicates an exothermic heat change. An exothermic reaction releases heat energy into the surroundings, resulting in a temperature rise. In this case, the reaction between zinc and copper sulfate solution is exothermic because the final temperature is higher than the initial temperature.

During the reaction, zinc displaces copper from copper sulfate to form zinc sulfate and copper metal. This displacement reaction is known as a single displacement or redox reaction. Zinc is more reactive than copper and therefore replaces copper in the compound.

The formation of new chemical bonds during the reaction releases energy in the form of heat. This energy is transferred to the surroundings, leading to an increase in temperature. The heat released is greater than the heat absorbed, resulting in a net increase in temperature.

The exothermic nature of this reaction can be explained by the difference in bond energies between the reactants and products. The breaking of bonds in the reactants requires energy input, while the formation of new bonds in the products releases energy.

In this case, the energy released during the formation of zinc sulfate and copper metal is greater than the energy required to break the bonds in copper sulfate and zinc.

For more such question on temperature visit:

https://brainly.com/question/4735135

#SPJ8