How many atoms of different elements are found in the formulae of the compounds of copper nitrate Cu(No3)2​

Answers

Answer 1
Copper Nitrate contains:
- 1 Copper Atom
- 2 Nitrogen Atoms
- 6 Oxygen Atoms

Related Questions

5. What measures how stressful exercise is on your body?
O A. Frequency
O B. Duration
O C. Volume
D. Intensity

Answers

Answer: D. Intensity

Explanation: Intensity is correct, because if you originally were working on a treadmill with a speed of 8, that is how much intensity your putting your body on. And if you put the speed for a treadmill at 11 to increase your exercise, you are increasing the speed you have to run, making it more intense. The more intense you make your workout or training, the more stressful exercise you are doing.

Hope this helps,

:)

If the atmospheric pressure in the laboratory is 1.2 atm, how many moles of gas were in each syringe? v:4.2temp:-149 c

Answers

Answer

moles of each syringe = 4.957x10^-4 moles

Explanation

Given:

Pressure = 1.2 atm

Volume = 4.2 mL

Temperature = -149 C

Required: Moles of gas

Solution:

The equation to use is:-

pV = nRT

where p is the pressure = 1.2 atm

V is the volume = 4.2 mL = 0.0042 L

n is the moles (the unknown)

R is the constant = 0.0820 L.atm.K-1.mol-1

T is the temperature = - 149 C = 124 K

Now we can re-arrange the equation and solve n

n = pV/RT

n = (1.2 atm x 0.0042 L)/(0.0820 L.atm.K-1.mol-1 x 124 K)

n = 4.957x10^-4 moles

The pOH of a solution is 6.0. Which statement is correct?
Use pOH = -log[OH-] and PH+pOH = 14.
The pH of the solution is 20.0.
O The concentration of OH ions is 1.0 x 108 M.
The concentration of OH ions is 1.0 x 106 M.
O The pH of the solution is 8.0.
A

Answers

At pOH value  of 6.0 the pH value of the following solution is 8.0 and the concentration of [H+ ] ion is 108

In this question we will apply the formula

      pH +pOH = 14 . . . . . . . . . . . . .(1)

where pH = concentration of [H+ ] ion

pOH = concentration of [OH ] ion

As per the question

pOH =6.0

Putting the value of pOH in equation (1) we get the value of pH

              pH + 6.0 =14

             pH = 14 -6.0

             pH  = 8.0

 The value of pH if the pOH value is 6.0 is 8.0

To find the concentration of H+ ion we will use the following formula

This is calculated by the formula

                                 [H+} = 10pH

where we will write the values of pH

Hence the concentration of [H+} ion is 108

Therefore at  pOH of 6.0 the pH value of the following solution is 8.0 and the concentration of [H+ ] ion is 108

Read more about pH

https://brainly.com/question/11300720

The complete question is -

What is the pH value and concentration of [H+ ] ion of the following if the pOH value of the solution is 6.0 ?

The boiling point at 1.00 atm of an aqueous solution of CaCl2 is 105.3 °C. What is the concentration of CaCl2
in the solution? Kb (H2O) = 0.512 °C/m. Assume an ideal van't Hoff factor for CaCl2.

Answers

d.2.93m.CaCl2 is present in the solution with a 2.93m concentration.

The boiling point of a solution is directly related to its concentration. The boiling point elevation of a solution, ΔTb, is equal to the product of the van't Hoff factor (i) and the molality of the solution (m).The quantity of moles of solute per kilogramme of solvent is known as molality.

Therefore, we can solve for the molality of the solution using the following equation:

ΔTb

=im105.3C=im

m=105.3Ci

Assuming an ideal van't Hoff factor for CaCl2 (i = 2), the molality of the solution is:

m=105.3C2m=52.65m=52.65mol/kg

The concentration of CaCl2 in the solution is then:

C=mKbC=52.65mol/kg0.512C/mC=2.93mol/kg

Therefore,The concentration of CaCl2 in the solution is  2.93m.

learn more about boiling point refer:brainly.com/question/24168079

#SPJ1

complete question:The boiling point at 1.00 atm of an aqueous solution of CaCl2 is 105.3 °C. What is the concentration of CaCl2 in the solution? Kb (H2O) = 0.512 °C/m. Assume an ideal van't Hoff factor for CaCl2.

a.3.45m

b.4.40m

c.8.79m

d.2.93m

if you have four quarters, five dimes, and nine pennines, what is the average value of the coins?

Answers

8.83cents

Explanation:

(25×4)+(5×10)+(9×1)

=>159 cents

Now,

159(4+5+9)

=>15918

=>8.83

Hence, the average value of coins is 8.83cents

In using the Haber process in the formation of ammonia, what mass of hydrogen is needed to produce 51.0 grams of ammonia? 3 H₂(g) + N2 (g) → 2 NH3(g).

Answers

The mass of hydrogen needed to produce 51.0 grams of ammonia is  ≈ 9.07 grams.

To determine the mass of hydrogen required to produce 51.0 grams of ammonia (NH3) using the Haber process, we need to calculate the stoichiometric ratio between hydrogen and ammonia.

From the balanced chemical equation:

3 H₂(g) + N₂(g) → 2 NH₃(g)

We can see that for every 3 moles of hydrogen (H₂), we obtain 2 moles of ammonia (NH₃).

First, we need to convert the given mass of ammonia (51.0 grams) to moles. The molar mass of NH₃ is 17.03 g/mol.

Number of moles of NH₃ = Mass / Molar mass

                     = 51.0 g / 17.03 g/mol

                     ≈ 2.995 moles

Next, using the stoichiometric ratio, we can calculate the moles of hydrogen required.

Moles of H₂ = (Moles of NH₃ × Coefficient of H₂) / Coefficient of NH₃

           = (2.995 moles × 3) / 2

           ≈ 4.493 moles

Finally, we can convert the moles of hydrogen to mass using the molar mass of hydrogen (2.02 g/mol).

Mass of H₂ = Moles × Molar mass

          = 4.493 moles × 2.02 g/mol

          ≈ 9.07 grams

Therefore, approximately 9.07 grams of hydrogen is needed to produce 51.0 grams of ammonia in the Haber process.

Know more about the mass of hydrogen here:
https://brainly.com/question/14083730

#SPJ8

A substance that allows heat, light, sound, or an electric charge to run through it is called a/n

Answers

A conductor allows heat, light, sound, or an electric charge to run through it.

place the following substances in Order of decreasing boiling point H20 N2 CO

Answers

Answer:

-195.8º < -191.5º < 100º

Explanation:

Water, or H20, starts boiling at 100ºC.

Nitrogen, or N2, starts boiling at -195.8ºC.

Carbon monoxide, or C0, starts boiling at -191.5ºC.

When we place these in order from decreasing boiling point:

-195.8º goes first, then -191.5º, and 100º goes last.

Answer:

therefore, N2, CO, H20

Decreasing boiling point

Explanation:

the bond existing in H2O is hydrogen bond

bond existing in N2 is covalent bond, force existing is dipole-dipole-interaction

bond existing in CO is covalent bond , force existing between is induced -dipole- induced dipole-interaction

hydrogen bond is the strongest , followed by dipole-dipole-interaction and induced -dipole- induced dipole-interaction

the stronger the bond , the higher the boiling point

therefore, N2, CO, H20

-------------------------------------->

Decreasing boiling point

If the energy of a photon is 3.34×1020 J, what is the wavelength of that light?

Answers

Answer:

thats what I know please check if it's correct
If the energy of a photon is [tex]3.34[/tex][tex]10^{-20}[/tex] J, what is the wavelength of that light?

How many moles of ions are contained in 1.27 L of a 1.75 M solution of Mg(NO3)2? Please answer in mol and round to the second decimal place.

Answers

There are 2.223 moles of ions contained in 1.27 L of a 1.75 M solution of Mg(NO3)2.

HOW TO CALCULATE NUMBER OF MOLES:The number of moles of an ion can be calculated by multiplying the molarity by the volume of the solution. That is:

No. of moles = molarity × volume

According to this question, 1.27 L is contained in a 1.75 M solution of Mg(NO3)2. The number of moles is calculated as follows:

no. of moles = 1.75M × 1.27L

no. of moles = 2.223mol

Therefore, there are 2.223 moles of ions contained in 1.27 L of a 1.75 M solution of Mg(NO3)2.

Learn more about molarity at: https://brainly.com/question/12127540

Why doesn't the red line showing the IR spectrum emitted from the earth's surface match the blue line showing the expected IR spectrum from a 300˚C object?

-Some of the light emitted is used to heat building.
-Molecules in the atmosphere such as CO2 and H2O absorb the radiation.
-Contrails from airplanes absorb the radiation cause the dip at 14 micrometers.
-IR radiation at 14 micrometers is not actually emitted by the earth's surface.

Answers

The red line showing the IR spectrum emitted from the earth's surface does not match the blue line showing the expected IR spectrum from a 300˚C object because:

Molecules in the atmosphere such as CO₂ and H₂O absorb the radiation; option B.

What is IR spectroscopy?

IR spectroscopy studies Infrared (IR) light in the electromagnetic spectrum.

Sensors are used by thermal detection systems, also known as infrared detection systems, to detect radiation in the infrared region of the electromagnetic spectrum.

In order to create an electronic signal, an infrared camera must first detect the thermal energy or heat, that the scene being seen emits. After processing this signal, an image is created.

Learn more about IR spectroscopy at: https://brainly.com/question/29493769

#SPJ1

Question 14
point)
Helium gas is contained in a tank with a pressure of 14.4 MPa. If the temperature
inside the tank is 24.6 °C and the volume of the tank is 19.4 L, determine the mass,
in grams, of the helium in the tank.

Answers

So we gonna use the equation PV=mRT/M


P=14.4MPa
T=24.6degree c= 24.6+273=297.6K
V=19.4L


Converting MPa=9.869atm
14.4mpa=x

X=9.869x14.4MPa

X=142.1136atm
X=142atm


PV=mRT/M

142atmx19.4L=mx0.8206Latm/K/molx297.6K/
4g/mol

M=142atmx19.4Lx4g/mol/0.8206atm/k/molx297.6K

M=142x19.4x4g/0.8206x297.6

M=11019.2/244.21056

M=45.12

M=45g

By which method the following mixture can be separated?(i)mixture of colours (ii) Minerals oil.​

Answers

Answer:

mixture of colours answer

7.0 x 10 -3 mol of I2 in 100.00ml of solution

Answers

To determine the concentration of the I2 solution, we need to calculate the molarity (M) using the given information. Molarity is defined as moles of solute per liter of solution.

Given:
- Moles of I2: 7.0 x 10^(-3) mol
- Volume of solution: 100.00 mL (which is equal to 0.1000 L)

Molarity (M) = Moles of solute / Volume of solution in liters

Molarity = (7.0 x 10^(-3) mol) / (0.1000 L)

Molarity = 0.070 M

Therefore, the concentration of the I2 solution is 0.070 M.

The amount of carbon dioxide in the air is increasing in a large city due to the growing number of vehicles. The mayor wants to plant more trees. Do you agree with the mayor's suggestions?

Answers

The amount of carbon dioxide in the air is increasing in a large city due to the growing number of vehicles. The mayor wants to plant more trees.  I totally agree with the mayor's suggestions.

Growing number of vehicles contributes towards carbon emissions into the atmosphere. Driving a car with gasoline as its fuel produces three carbon emissions. All of the emissions that take place across a company's value chain and are not covered by scope 2.

These emissions aren't caused by the business or the things it makes. Carbon emissions from operating a gasoline-powered vehicle are significant. Scope 3 applies since the product, not the company's machines, is what causes the emissions. There are three types of carbon emissions: 'Scope 1' or 'Direct Emissions' Direct GHG is produced at sources where the fuel is burned there and then. Examples of scope 1 emissions are personal automobiles and gas stoves. Planting more trees will result in minimizing the harmful effect of these gases upon the environment.

Learn more about carbon emissions here

https://brainly.com/question/29891924

#SPJ1

The resistance of bacterial endospores to heat, harsh chemicals, and radiation has several implications, including all EXCEPT which of the following? a.Endospores can be seen in Gram-stained smears.
b.Preservation of foods by canning or by irradiation can prevent foodborne illness.
c.Endospores could be used to test the efficacy of sterilization procedures.
d.Endospores will not survive passage through the stomach.

Answers

The resistance of bacterial endospores to heat, harsh chemicals, and radiation has several implications, including all except endospores can be seen in Gram-stained smears. The correct option is a.

What are endospores?

An endospore is a bacterium that can withstand unfavorable environmental circumstances because it is dormant. Most of the spore's chemical and enzymatic resistance is provided by the outer proteinaceous covering.

Endospores have a hard outer layer comprised of the protein keratin, which makes them resistant to heat and chemicals.

Therefore, the correct option is a. Endospores can be seen in Gram-stained smears.

To learn more about endospores, visit here:

https://brainly.com/question/30358821

#SPJ1

What is the molar concentration of Zn2+ ions in a solution, if the electrode potential value is 59mV less than the standard electrode potential value at 298 K?

Answers

Molar concentration of Zn2+ions in a solution is 3.481 mol/lit

The electrode potential value is 59mV

Temperature=298k

What is electrode potential?

It is a force of galvanic cell. basically it is the difference between an electrolyte and electrode.

equation formed- Zn → Zn2+ + 2e

              from Nernst equation-

E=E cell - 0.059 log [Zn2+]

[zn2+]=3.481 mol/lit

hence, Molar concentration of Zn2+ions in a solution is 3.481 mol/lit

Learn more about electrode potential here:

https://brainly.com/question/15417662

#SPJ10

Chlorofluorocarbons are ?

A. colorless, odorless gases that prevent red blood cells from carrying oxygen to the body

B. man-made chemicals containing chlorine and fluorine that cause
ozone molecules to break down

C. chemicals produced in factories that are used to prevent air
pollution

D. molecules containing chlorine and fluorine that block UV radiation
from reaching the Earth

Answers

D. molecules containing chlorine and fluorine that block UV radiation from reaching the Earth.

Chlorofluorocarbons (CFCs) are synthetic compounds that contain chlorine, fluorine, and carbon. They were widely used in the past as refrigerants, propellants in aerosol products, and foam-blowing agents. CFCs have been found to have a detrimental effect on the Earth's ozone layer when released into the atmosphere. They can reach the stratosphere, where they undergo a chemical reaction facilitated by ultraviolet (UV) radiation, resulting in the release of chlorine atoms. These chlorine atoms then participate in a destructive cycle that breaks down ozone molecules, leading to ozone depletion. Due to their harmful impact on the ozone layer, the production and use of CFCs have been phased out or regulated under international agreements like the Montreal Protocol to protect the Earth's ozone layer.

Chlorofluorocarbons (CFCs) are man-made chemicals containing chlorine and fluorine that cause ozone molecules to break down. Thus, option B is the answer.

Chlorofluorocarbons are non-toxic, synthetic compounds that contain atoms of Chlorine, Fluorine and Carbon. They are commonly used in the manufacture of aerosol sprays and are also used as solvents and refrigerants. CFCs were first introduced in 1928 by General Motors Company for its refrigerators.

While CFCs are very safe to use in most applications and are stable in the lower atmosphere, these chemicals when released to the upper atmosphere can cause significant reactions. CFCs when released into the upper atmosphere can lead to the destruction of the ozone molecules followed by the release of the UV radiation into the atmosphere.

Thus, CFCs are man-made chemicals which cause ozone molecules to break down.

Learn more Chlorofluorocarbons, here:

https://brainly.com/question/1393491

Why does the solubility of many substances increase with temperature? (Remember what an increase in temperature means on a microscopic scale.)

Answers

The solubility of many substances increases with temperature, there are exceptions. Some substances exhibit a decrease in solubility with temperature due to specific interactions or changes in solute-solvent interactions at higher temperatures.

The increase in solubility of many substances with temperature can be attributed to the effect of temperature on the kinetic energy and intermolecular interactions of molecules.

On a microscopic scale, an increase in temperature corresponds to an increase in the kinetic energy of molecules. As the kinetic energy increases, the molecules move more rapidly and collide with each other and with the solvent molecules more frequently and with greater force.

These increased collisions and kinetic energy result in enhanced molecular interactions and overcome the forces holding the solute particles together. This increased energy disrupts the intermolecular forces within the solute, allowing the solvent molecules to surround and interact more effectively with the solute particles, leading to greater solubility.

Additionally, an increase in temperature can cause solvent molecules to move more freely, reducing their cohesion and allowing them to interact more readily with solute particles.

for more questions on  solubility

https://brainly.com/question/24057916

#SPJ8

What is the pH of an aqueous solution with a hydrogen ion concentration of [H+]=3.1×10−9 M?

Answers

the pH of the aqueous solution is 8.51 with a hydrogen ion concentration of [H+]=3.1×109M

The pH of the aqueous solution can be calculated using the formula:

pH = -log[H+]

where [H+] is the hydrogen ion concentration of the solution.

Substituting the given value, we get:

pH = -log(3.1×109)

pH = 8.51

An aqueous solution is one in which water serves as the solvent. It is utilised in a variety of applications, including analytical chemistry, biochemistry, and industrial chemistry. It is the most prevalent kind of solution used in chemical reactions. Water serves as both the solvent and the solute in an aqueous solution, where the solute is often a solid, liquid, or gas. Due to its high polarity and capacity to make hydrogen bonds with other molecules, water is an excellent solvent that can dissolve a variety of materials, including polar molecules and ionic compounds. Acid-base reactions, redox reactions, and precipitation reactions are just a few of the numerous chemical processes that take place in aqueous solutions. A variety of variables can have an impact on an aqueous solution's characteristics.

Learn more about aqueous solution here:

https://brainly.com/question/26856926

#SPJ1

What are the large plates that move? O gigantic plates O tectonic plates O volcanic plates O rock plates​

Answers

Answer:

Tectonic plates

Explanation:

Tectonic plates are large plates that moves. There are different types of plate motion as a result of mantle convection.

A tectonic plate is better as referred to as the lithospheric plate. It is made up of a part of the upper mantle and the overlying crust. Together, they move over the fluid asthenosphere below. The mantle below drives the lithosphere above.

Does anyone know Chemistry

Answers

Answer:

so so

Explanation:

this your question?? <_>

What does it mean to interpret data?

Answers

Answer:

Data interpretation is the process of reviewing data through some predefined processes which will help assign some meaning to the data and arrive at a relevant conclusion. It involves taking the result of data analysis, making inferences on the relations studied, and using them to conclude

Explanation:

hope this helps! :)

Every neutral atom of a given element has the same number of what two subatomic particles?
A. Protons and neutrons
B. Protons and electrons

Answers

Answer:

B. Protons and Electrons

Explanation:

Protons have a positive charge and electrons have a negative charge. When an element contains the same number of both of those particles the charges will cancel out leaving the atom with a neutral charge, as neutrons already have a neutral charge.

1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5​

Answers

1. The IUPAC name of N is nitrogen.

2. Nitrogen dioxide

3.The IUPAC name of O is oxygen

4.The IUPAC name of OH is hydroxyl.

The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.

IUPAC names for the given compounds are:1.1. N: Nitrogen

The IUPAC name of N is nitrogen.

It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide

Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.

The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen

Explanation: The IUPAC name of O is oxygen.

It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.

X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.

Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.

It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.

for more question on electronic configuration

https://brainly.com/question/26084288

#SPJ8

Note: The complete question is given below

Provide the IUPAC names for the following compounds:

CH3CH2CH(CH3)CH2CH2CH2CH3

C6H5CH(CH3)2

H2NCH2CH2CH2CH2CH2NH2

CH3CH2CH2CH2CH2OH

CH3CH2CH2CHOHCH3

3
1 point
The formula for acetic acid is HC H302
What is the percent composition of carbon in acetic acid?
molar mass of the element you need to find a percentage of
molar mass of the entire substance
40.0%
20.0%
33.3
41.4%
Previous

31 pointThe formula for acetic acid is HC H302What is the percent composition of carbon in acetic acid?molar

Answers

Not sure but I think the last one

Select all that apply. When the products of a reaction have more energy than the reactants: The reaction is endothermic. The reaction is exothermic. The reactants gave up energy.

Answers

Answer:

the reaction is exothermic

Explanation:

heat will be produced from the reaction

Answer:

The reaction exothermic

Reactants gave up energy ;) Have a good day

A beaker weighed 53.10g. To the isolated beaker was added 5.348g of iron pellets and 56.1g of hydrochloride acid. What was the total mass of the beaker and the products after reaction?

Answers

114.5 g is the total mass of the beaker .

Total mass of beaker=53.10g+5.348g+ 56.1g

Total mass=114.5 g

Mass is used in physics to specific inertia, a fundamental function of all remember. basically, it's far a mass of rely's resistance to changing its course or pace in response to the software of a force.

The exchange that an applied force produces is smaller the extra mass a body has. The kilogram, the unit of mass within the international machine of gadgets, corresponds to 6.62607015 1034 joule seconds using Planck's consistent (SI). One joule is produced by way of multiplying one kilogram by means of one rectangular meter per 2d.

The kilogram is decided by genuine measurements of Planck's regular on account that the second one and the meter have formerly been described in phrases of other bodily constants.

To know more about  mass visit : brainly.com/question/5661976

#SPJ9


What volume is occupied by 12 moles of nitrogen molecules at
standard temperature and pressure?
a 371.1 liter
B 440.8 liter
C 221.4 liter
d 268.8 liter

Answers

Answer:

V = 268.8 L

Explanation:

Given data:

Number of moles of nitrogen = 12 mol

Temperature = 273 K

Pressure = 1atm

Volume occupy = ?

Solution:

The given problem will be solve by using general gas equation,

PV = nRT

P= Pressure

V = volume

n = number of moles

R = general gas constant = 0.0821 atm.L/ mol.K  

T = temperature in kelvin

1 atm × V = 12 mol ×0.0821 atm.L/ mol.K   × 273 K

V = 268.95 atm.L / 1 atm

V = 268.8 L

Which of these four elements is the most reactive
1: Na
2: Al
3: Rb
4: In

Answers

Answer:

1: Na

Explanation:

Out of the four elements, the most reactive element is sodium (Na).

Sodium is a highly reactive metal because it has only one valence electron in its outermost shell, which is relatively far from the positively charged nucleus. This makes it easy for sodium to lose its outermost electron and form a positively charged ion, which is why it readily reacts with other elements.

Aluminum (Al), rubidium (Rb), and indium (In) are also reactive metals, but they are less reactive than sodium.

Other Questions
How do immigration restrictions harmonize with American idea of freedom? help me with this question credit cards date back to prior to world war ii. just after world war ii. the early 1950s. the late 1950s. baez has hit 31.25 of the time he is at bat for the last 7 games. If he has 10 hits how many total does he have. An investor has 80% of her portfolio in a stocks fund and 20% in a market-index fund. The mean monthly return rate of the market-index fund is 1.5%, with standard deviation 0.9%. The stocks fund has the mean monthly return rate of 2.2%, with standard deviation 1.2%. The correlation between the two funds is 0.13. What is the mean and standard deviation of her portfolio Quick which answer choice is it???? Interactive Grammar Tutorial: Telling time Learning engine ActivityDUE August 13th 10:00 AMInstructionsQuestionsDiagnosticFill in the missing words or phrases.1. La clase es a las (8:15)2. Son las de la noche (11:20)3. La fiesta es a las (9:30)4. Es el . (12:00)5. Son las de la maana. (7:40)6. El programa "Terror!" es a la (12:00)7. Son las de la tarde. (2:10)8. El programa es a la en punto. (1:00)9. Son las de la tarde. (3:50)10. Son las . (8:05) How did the Miranda rights happen? Muhammad remembers everything that has ever happened in his life since he was 5 years old. Unfortunately, having every memory cueing another memory makes life difficult for muhammad. His experience is called. what is the difference between a pointer to a constant and a constant pointer? quzlet A child slides down a playground slide. If the slide is 3 m high and the child weighs 300 N, how much potential energy does the child have at the top of the slide There are 13 books on a shelf. 7 of these books are new. The rest of them are used. A system of shared beliefs and rituals based on sacred thought is the definition of _____. 25) Find the measure of the side MN.A) 17.1B) 18.1C) 19.1 X =In the diagram below, ZHDA and ZADR are supplementary.(7x-3)(2r-6)HDWhat is the value of r?R 8-64-8-What is the domain of function m?co-2-86- 4xHELPP based on the miller test (1973), which of the following is one of the requirements that must be met in order to consider a work obscene? quizlet What is marginal cost Brainly?. Using the programming language of your choice, implement the Binary Search algorithm for a target value = 9 on the Array A: [9, 11, 70, 25, 20, 0, 36, 24]. What is the primary condition to implement a Binary Search Algorithm? Explain the growth rate of the algorithm Chromium has a BCC crystal structure, an atomic radius of 0.125 nm, and an atomic weight of 52.00 g/mol. Compute its theoretical density.