How many atoms are represented by one formula unit of aluminum chromate, Al2(CrO4)3

Answers

Answer 1

Answer:

17 atoms

Explanation:

If what we want is to calculate the number of atoms. We must take into account the subscripts of the formula. We can rewrite the formula  taking into account the "ones" implicit in the formula, therefore we will have:

\(Al_2(Cr_1O_4)_3 \)

Now we have a "3" outside the parenthesis. Therefore, we must multiply this 3 by the number of atoms within the parentheses:

-) Oxygen atoms: 4 x 3 = 12 atoms

-) Chromium atoms: 1 x 3 = 3 atoms.

If we take into account we have 2 aluminum atoms, in total, we will have:

-) 12 oxygen atoms

-) 3 chromium atoms

-) 2 aluminum atoms

12 + 3 + 2 = 17 atoms

In total, we will have 17 atoms.

See figure 1

I hope it helps!

How Many Atoms Are Represented By One Formula Unit Of Aluminum Chromate, Al2(CrO4)3

Related Questions

Which of these safety features aims to keep nuclear radiation contained

Answers

The safety feature aimed at keeping nuclear radiation contained is steel-reinforced concrete.

What is nuclear power plant?

A nuclear power plant is a building with reactors that contain controlled nuclear reactions to produce energy.

Nuclear power plants are able to generate warm water by using atomic properties of matter  (i.e.,m the process of nuclear fission), which is in turn converted into steam to move turbines.

The walls of nuclear power reactors are composed of steel-reinforced concrete in order to avoid radiation release.

In conclusion, the safety standard property that maintains nuclear radiation contained is steel-reinforced concrete.

Learn more about nuclear power plants here:

https://brainly.com/question/24295936

#SPJ1

c) Discuss precision and Accuracy as they relate to types of errors.
what is the answer

Answers

Precision relates to the consistency and reproducibility of measurements, while accuracy reflects how close measurements are to the true value.

Precision and accuracy are two important concepts in the context of errors in measurements. While they both pertain to the quality of data, they refer to different aspects.

Precision refers to the degree of consistency or reproducibility in a series of measurements. It reflects the scatter or spread of data points around the average value. If the measurements have low scatter and are tightly clustered, they are considered precise. On the other hand, if the measurements have a high scatter and are widely dispersed, they are considered imprecise.

Accuracy, on the other hand, refers to the closeness of measurements to the true or target value. It represents how well the measured values align with the actual value. Accuracy is achieved when measurements have a small systematic or constant error, which is the difference between the average measured value and the true value.

Errors in measurements can be classified into two types: random errors and systematic errors.

Random errors are associated with the inherent limitations of measurement instruments or fluctuations in the measurement process. They lead to imprecise data and affect the precision of measurements. Random errors can be reduced by repeating measurements and calculating the average to minimize the effect of individual errors.

Systematic errors, on the other hand, are caused by consistent biases or inaccuracies in the measurement process. They affect the accuracy of measurements and lead to a deviation from the true value. Systematic errors can arise from factors such as instrumental calibration issues, environmental conditions, or experimental techniques. These errors need to be identified and minimized to improve the accuracy of measurements.

In summary, precision refers to the degree of consistency or reproducibility of measurements, while accuracy refers to the closeness of measurements to the true value. Random errors affect precision, while systematic errors affect accuracy. To ensure high-quality measurements, both precision and accuracy need to be considered and appropriate techniques should be employed to minimize errors.

Know more about Precision here:
https://brainly.com/question/30461151

#SPJ8

Calculate the boiling point of a 0.33 m solution of a solute in benzene.
(Kb = 2.53°C /m).

Answers

The boiling point of the solution is 80.93°C.

What is the boiling point?

We know that the boiling point has to do with the temperature at which the pressure inside the system is the same as the atmospheric pressure. Now we know that the boiling point of the pure benzene is 80.1 °C.

Also;

ΔT = K m i

ΔT = boiling point elevation

K = boiling point constant

m = molality

i = Van Hoff factor

ΔT = 2.53°C /m * 0.33 m * 1

ΔT =  0.83°C

Boiling point of the solution =  0.83°C + 80.1 °C

= 80.93°C

Learn more about boiling point:https://brainly.com/question/2153588

#SPJ1

When heated, calcium carbonate, CaCO3(s) , decomposes to calcium oxide, CaO(s) , and carbon dioxide, CO2 . Using relevant data from your book's appendices, calculate the heat evolved or consumed when 15.0 g of calcium carbonate are decomposed. answer: kJ

Answers

As per the standard data, the heat evolved during one mole of calcium carbonate decomposes is 177.8 KJ. Thus 15 g or 0.15 moles of calcium carbonate when decomposed will produce 26.67 KJ of heat.

What is reaction enthalpy?

Reaction enthalpy of a substance is the heat evolved or absorbed during a reaction. Reaction enthalpy is negative for an exothermic reaction and positive for an endothermic reaction.

Molar mass of calcium carbonate = 100 g.

no.of moles in 15 g = 15 /100 = 0.15 moles.

One mole or 100 g of calcium carbonate decompose to evolve 177.8 KJ according to the scientific record.

Thus, heat evolved by the decomposition of 0.15 moles is 0.15 × 177.8 KJ = 26.67 KJ.

Hence, the heat evolved during the decomposition of 15 g of calcium carbonate is 26.67 KJ.

To find more on reaction enthalpy, refer here:

https://brainly.com/question/1657608

#SPJ1

You add 9.6g of iron to 23.60mL of water and observe that the volume of iron and water together is 24.82mL. Calculate the density of iron…. Express in Value & Units

Answers

Answer:

7.87g/mL

Explanation:

density is mass/volume...

you add 9.6g of iron. that is the mass

the water increases by 1.22ml, that is the volume

9.6g/1.22ml = 7.87g/mL

2,3,7,9-tetramethyl-5-(1-metilbutil)decano

Answers

The IUPAC name for 2,3,7,9-tetramethyl-5-(1-methylbutyl)decanoic acid is 2,3,7,9-tetramethyl-5-(1-methylbutyl)decanoic acid. It is a carboxylic acid with a molecular formula of C20H40O2 and a molecular mass of 312.54 g/mol. The compound has a melting point range of 70-75°C.

2,3,7,9-tetramethyl-5-(1-methylbutyl)decanoic acid contains a carboxyl group (-COOH), which is the functional group responsible for its acidic properties and solubility in water. The presence of the carboxyl group makes the compound more polar than similar molecules, enhancing its water solubility. Carboxylic acids are also known for their reactivity with bases and ability to undergo esterification reactions.

In summary, 2,3,7,9-tetramethyl-5-(1-methylbutyl)decanoic acid is a carboxylic acid with a unique molecular structure. Its IUPAC name describes the positions and nature of the substituent groups. The presence of the carboxyl group contributes to its polarity, water solubility, acidity, and reactivity with bases and esterification reactions. The compound's characteristics are significant in understanding its properties and potential applications in various chemical reactions and processes.

for such more questions on  compound

https://brainly.com/question/29108029

#SPJ8

A reaction vessel contains 0.0200 M N2, 0.0600 M H2, and 0.0100 M NH3. With the aid of calculations, predict whether ammonia, NH3, will be formed or dissociate when the mixture goes to equilibrium at 400°C. Kc for the reaction is 0.500 at 400°C. Reaction: N2 (g) + 3H2 (g) 2NH3 (9) (5)​

Answers

NH3 will dissociate into N2 and H2.

Given the equation of the reaction; N2 (g) + 3H2 (g) -----> 2NH3(g)

We can calculate the reaction quotient as follows;

Q = [NH3]^2/[N2] [H2]^3

From the question;

[NH3] = 0.0100 M

[N2] = 0.0200 M

[H2] = 0.0600 M

Substituting values;

Q = [0.0100 M]^2/[0.0200 M] [0.0600 M]^3

Q = 23.1

Since Q > Kc, NH3 will dissociate into N2 and H2.

Learn more: https://brainly.com/question/10038290

WILL MARK BRAINLIEST!!

A chemical reaction produces formaldehyde, with a chemical formula of CH2O. Carbon is in Group 4A, oxygen is in Group 6A, and hydrogen is in Group 1A on the periodic table. In one to two sentences, describe the bonds in a molecule of formaldehyde in terms of valence electrons.​

Answers

The formaldehyde has the molecular formula HCHO. Two C-H bonds have been present in the structure, while there has been the presence of one C=O bond.

Carbon belongs to group 4A and has been consisted of four valence electrons. In order to complete its octet, carbon gets covalently bonded with the hydrogen of the 1A group consisting of 1 valence electron.

The covalent bond between carbon and hydrogen results in the complete octet of the hydrogen, however, carbon has 2 valence electrons to be bonded to complete the octet.

The oxygen has been belonging to group 6A and has been consisted of 6 valence electrons. In order to complete the octet,  oxygen required 2 valence electrons. The carbon bonds with the oxygen with the double bond completing the octet of the oxygen and carbon.

For more information about bonds in formaldehyde, refer to the link:

https://brainly.com/question/4905584

Answer:

The bonds in a molecule of formaldehyde are that there is 2 C-H bonds and one C-O bond present. Since carbon is in group 4A meaning it has 4 valence electron, Hydrogen has 1 valence electron, and oxygen has 6 valence electron. Carbon and Hydrogen valance electrons can complete carbons octet. The other two valence electron of carbon and the six valence electron of oxygen can complete oxygens octet.

Explanation:

From looking at the solubility chart, which of the following is a gas?

From looking at the solubility chart, which of the following is a gas?
From looking at the solubility chart, which of the following is a gas?

Answers

The solubilty of gases in liquids decreases when the temperature increases.

The solubility of solids (for most compounds) in liquids increases when the temperature increases.

According to the graph the only compound that decreases the solubility when the temperature increases is Ce2(So4)3

How many moles of nitrogen gas will occupy a volume of 347 mL at 6700 kPa and 27 degrees Celsius

Answers

1) List the known and unknown quantities.

Volume: 347 mL.

Pressure: 6700 kPa.

Temperature: 27 ºC.

Ideal gas constant: 8.314 L * kPa * K^(-1) * mol^(-1).

Moles: unknown.

2) Set the equation.

Ideal gas equation

\(PV=nRT\)

3) Convert units.

3.1- Convert the volume.

1L = 1000 mL

\(L=347\text{ }mL*\frac{1\text{ }L}{1000\text{ }mL}=0.347\text{ }L\)

3.2- Convert the temperature

\(K=ºC+273.15\)\(K=27+273.15=300.15\text{ }K\)

4) Plug in the known quantities (ideal gas equation) and solve for n (moles).

\((6700\text{ }kPa)(0.347\text{ }L)=n*(8.314\text{ }L*kPa*K^{-1}*mol^{-1})(300.15\text{ }K)\)\(n=\frac{(6700\text{ }kPa)(0.347L)}{(8.314\text{ }L*kPa*K^{-1}*mol^{-1})(300.15\text{ }K)}\)\(n=0.9317\text{ }mol\)

There would be 0.9317 mol N2.

Determine the cell notation for the redox reaction given below.

Sn(s) + 2H+(aq) ⟶ Sn2+(aq) + H2(g)

a. H+(aq) | H2(g) | Pt ∥ Sn(s) | Sn2+(aq)
b. H2(g) | H+(aq) | Pt ∥ Sn2+(aq) | Sn(s)
c. Sn2+(aq) | Sn(s) ∥ H2(g) | H+(aq) | Pt
d. Sn(s) | Sn2+(aq) ∥ H+(aq) | H2(g) | Pt
e. Sn(s) | H2(g) ∥ Sn2+(aq) | H+(aq) | Pt

Answers

Answer:

The correct answer is d. Sn(s) | Sn²⁺(aq) ∥ H⁺(aq) | H₂(g) | Pt

Explanation:

The half reactions are:

2H⁺(aq) + 2 e- ⟶ H₂(g) (reduction)

Sn(s) ⟶ Sn²⁺(aq) + 2 e-  (oxidation)

In the cell notation, there are two electrodes in which are separated the reduction reaction from the oxidation reaction. In the left electrode occurs the oxidation reaction (anode) while in the right electrode occurs the reduction reaction (cathode). The general form of the cell notation is the following:

anode reaction∥ cathode reaction

where the two bars ( ∥ ) represent the physical barrier between the electrodes. A single bar ( | ) is used to represent a phase separation.  

In this redox reaction, the half reaction of the anode is Sn(s) ⟶ Sn²⁺(aq) + 2 e-; whereas the half reaction of the cathode is 2H⁺(aq) + 2 e- ⟶ H₂(g).

The componens are written in order according to the half reaction. Since Sn²⁺ and H⁺ ions are in solution, a platinum electrode is used and represented as Pt. Thus, the cell notation is:

Sn(s) | Sn²⁺(aq) ∥ H⁺(aq) | H₂(g) | Pt

does living organism capable of both process

Answers

Yes because it can produce unlike nonliving organism

A family pool holds 10,000 gallons of water.
How many liters is this?

Answers

Answer:

45460.9

Explanation:

Answer:

37854.12

Explanation:

for every 1 US gallon there is 3.78541 liters. So if there is 10,000 gallons, you would multiply 3.78541 by 10,000.

how the Sun is responsible for most of the energy on Earth by explaining it's connection to photosynthesis and fossil fuels.

Answers

Answer:

The sun provides most of the energy on earth because it is the earth's (and the solar system's) greatest source of heat and light.

Explanation:

The process of photosynthesis in plants uses the energy from the sun and converts that energy to be used for plants.
The burning of fossil fuels produces greenhouse gases which trap the heat in our earth's atmosphere (causing global warming).

what is the concentration of a nitric acid solution if 10.0 ml of the solution is neutralized by 3.6 ml of 0.2 m naoh?

Answers

Answer:

The concentration of the nitric acid (HNO3) solution is 72 M.

Explanation:

To determine the concentration of the nitric acid solution, we can use the concept of stoichiometry and the equation of the neutralization reaction between nitric acid (HNO3) and sodium hydroxide (NaOH):

HNO3 + NaOH → NaNO3 + H2O

The balanced equation shows that the molar ratio between HNO3 and NaOH is 1:1. This means that 1 mole of HNO3 reacts with 1 mole of NaOH.

Given:

Volume of HNO3 solution = 10.0 ml

Volume of NaOH solution = 3.6 ml

Molarity of NaOH solution = 0.2 M

To find the concentration of the HNO3 solution, we need to calculate the number of moles of NaOH used in the neutralization reaction:

moles of NaOH = volume of NaOH solution * molarity of NaOH solution

= 3.6 ml * 0.2 M

= 0.72 mmol (millimoles)

Since the molar ratio between HNO3 and NaOH is 1:1, the number of moles of HNO3 in the solution is also 0.72 mmol.

Now, we can calculate the concentration of the HNO3 solution using the formula:

concentration (in M) = moles of solute / volume of solution (in L)

concentration = 0.72 mmol / 0.010 L

= 72 mmol/L

= 72 M

Therefore, the concentration of the nitric acid (HNO3) solution is 72 M.

how does resistance change with temperature? is there more resistance or less resistance at higher temperatures?

Answers

The resistance has a linear relationship with temperature because it increases as temperatures increases.

What is temperature?

Temperature refers to the activity (motion or thermal energy) in the atoms that form molecules.

The resistance of an electric conductor increases as the temperature increases since the thermal energy of subatomic electrons also increases.

In conclusion, the resistance has a linear relationship with temperature because it increases as temperatures increases.

Learn more about resistance here:

https://brainly.com/question/1834200

#SPJ1

How many grams of water would be formed from 96.0 g NH3 in a reaction represented by the balanced equation below. 4 NH3(g) + 3 O₂(g) → 2 N₂(g) + 6 H₂O(l)​

Answers

Answer:

4 NH3(0) + 3 O2(g) → 2 N2(g) + 6H20() ... How many grams of water would be formed from 96.0 g NH3 in a reaction represented by the balanced equation below.

Missing: 6 ‎H₂O( ‎l)​

Explanation:

Calculate the mass percent of H in C3H8O3.
%

Answers

Answer:

because of it being that you have inferno dragon plsss

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

the radius of magnesium atom is 0.160nm. the radius of a magnesium ion is 7.2x 10^-11m. explain the difference in size between the magnesium atom and magnesium ion

Answers

Answer:

during reaction magnesium lises ions.

Explanation:

magnesium reacts by losing two ions which makes it smaller in size.

CuBr2 percent composition

Answers

The percent composition of CuBr₂ is approximately 28.46% of Cu and 71.54% of Br.

To determine the percent composition of CuBr₂ (copper(II) bromide), we need to calculate the mass of each element in the compound and then divide it by the molar mass of the entire compound.

The molar mass of CuBr₂ can be calculated by adding up the atomic masses of copper (Cu) and bromine (Br) in the compound. The atomic masses of Cu and Br are approximately 63.55 g/mol and 79.90 g/mol, respectively.

Molar mass of CuBr₂ = (63.55 g/mol) + 2(79.90 g/mol) = 223.35 g/mol

Now, let's calculate the percent composition of each element in CuBr₂:

Percent composition of copper (Cu):

Mass of Cu = (63.55 g/mol) / 223.35 g/mol × 100% ≈ 28.46%

Percent composition of bromine (Br):

Mass of Br = 2(79.90 g/mol) / 223.35 g/mol × 100% ≈ 71.54%

Therefore, the percent composition of CuBr₂ is approximately:

- Copper (Cu): 28.46%

- Bromine (Br): 71.54%

These values represent the relative mass percentages of copper and bromine in the compound CuBr₂.

for more such questions on composition

https://brainly.com/question/28250237

#SPJ8

Gallium has two naturally occurring isotopes: Ga-69 with a mass of 68.9256 amu and a natural abundance of 60.11 % and Ga-71 . Use the atomic mass of gallium from the periodic table to find the mass of Ga-71 .

Answers

The atomic mass of an element can be determined from its isotopic masses. The mass of the isotope of gallium Ga-71 is 71.06 amu.

What is isotope?

Isotopes are elements with same atomic number and different mass numbers. Isotopes have similar chemical and physical properties.

The atomic mass of an element from the masses of its isotopes can be calculated using the equation given below:

Atomic mass =  mass of isotope 1 × % abundance/100 +  mass of isotope 2× % abundance/100

Here, the percentage abundance of Ga-69 is 60.11%. Thus percentage abundance of Ga-71 is 100 - 60.11 = 39.81 %. The atomic mass of gallium is 69.723 u.

Thus the mass of Ga-71 is calculated as follows:

69.723 = (68.9256 × 60.11 /100) + (m2 × 39.81/100)

mass of Ga-71= m2 = [ 69.723 - (68.9256 × 60.11 /100) ] / 39.81

                        = 71.06 amu.

Hence the mass of the isotope of gallium Ga-71 is 71.06 amu.

To find more about isotopes, refer the link below:

https://brainly.com/question/11680817

#SPJ5

an object has a mass of 14g and a volume 3.5 mL. what is the density of the object ?

Answers

Given :

Mass of object , M = 14 g .

Volume of object , V = 3.5 mL .

To Find :

The density of the object .

Solution :

Density of an object is given by :

\(Density=\dfrac{Mass}{Volume}\\\\\rho=\dfrac{M}{V}\\\\\rho=\dfrac{14}{3.5}\ g/mL\\\\\rho=4\ g/mL\)

Therefore , the density is 4 g/mL .

Hence , this is the required solution .

What’s the balanced equation of sodium bicarbonate reacting with citric acid?

Answers

Answer:

The reaction of citric acid and sodium bicarbonate is written as H_3C_6H_5O_7(aq) + 3 NaHCO_3(aq)

Explanation:

For an investigation a student poured a blue solution of CuSO4 into a beaker. The student placed a shiny silver colored strip of zinc metal in the solution and observed the changes, The student inferred that a chemical reaction occurred. What evidence supports this inference?

For an investigation a student poured a blue solution of CuSO4 into a beaker. The student placed a shiny

Answers

Answer:

It is the second answer; A dark solid formed on the zinc.

Explanation:

This is the correct answer because when a solid is formed it is called a precipitate, which is commonly known as a chemical reaction.

The evidence that supports the student's inference is a dark solid formed on the zinc.

Chemical reaction of zinc metal with CuSO4

When zinc is added to copper sulphate (CuSO4) solution, due to more reactivity of zinc, copper is replaced by zinc and forms zinc sulphate precipate.

Thus, the student is correct, there will be a chemical reatcion between the zinc and  copper sulphate (CuSO4) solution, producing a dark solid substance.

Learn more about chemical reaction here: https://brainly.com/question/26018275

#SPJ2

A. How many moles of O₂ would 13.0 mol of Al2O3 produce?

Answers

19.5 moles of oxygen will be produced by 13 moles of Al₂O₃.

What is a mole?

The mole is an amount unit similar to familiar units like pair, dozen, gross, etc. It provides a specific measure of the number of atoms or molecules in a bulk sample of matter.

A mole is defined as the amount of substance containing the same number of atoms, molecules, ions, etc. as the number of atoms in a sample of pure 12C weighing exactly 12 g.

Given,

Moles of Al₂O₃ = 13 moles

From the reaction -

                                           2 Al₂O₃ ⇒ 4Al + 3O₂

2 moles of Al₂O₃ produces 3 moles of O₂

1 mole of Al₂O₃ produces 3 ÷ 2 moles of O₂

1 mole of Al₂O₃ = 1.5 mole of O₂

So, 13 moles of Al₂O₃ = 1.5 × 13 moles of O₂

                                    = 19.5 moles of O₂.

Therefore, 19.5 moles of oxygen will be produced by 13 moles of Al₂O₃.

Learn more about Moles, here:

https://brainly.com/question/20486415

#SPJ1

You have two containers at 0°C and 1 atm. One has 22.4 L of hydrogen gas, and the other has 22.4 L of oxygen gas.
Which statement is true?
-))
A)
Both containers contain 6.022x1023 molecules of gas.
B)
B)
The hydrogen gas container has more molecules than the oxygen gas
container
The oxygen gas container has more molecules than the hydrogen gas
container
D)
Both containers have the same number of molecules.

Answers

Answer:

D

Explanation:

According to Avogadro's law, equal volumes of different gases at the same temperature and pressure have equal number of molecules.

It cannot however be a because according to ideal gas equation the number of moles in each container is 0.999moles which translates to 6.019*10^23 molecules

Answer:

Both containers have the same number of molecules.

Explanation:

would you prefer to live your dream forever or sacrifice you living your dream to let everyone else live their dream forever (brainliest)

Answers

I would perfer to prefer to live my dream forever because I wouldn't let someone be stuck with my dream forever because I would rather tourture my self other than to toutour everybody else.

I would rather let everyone else live their dream, because living a dream forever after a certain point would get boring, no matter how fun it seems. Additionally, just because I sacrifice me having my dream doesn't mean I wouldn't be able to enjoy life. It just means that I wouldn't be able to live out my best scenario.

Place the events of a fight or flight situation in the correct order.

Question 3 options:

You spring into action

Your heart and lungs prepare to fight or run

You see the bear

Your brain sends signals to you adrenal and pituitary glands

Answers

Answer:

you see le bear

you brain sends signals

your heart and lungs receive said signals

spring to action

how do you fight off ADHD medication

Answers

Answer:A medication break can ease side effects. A lack of appetite, weight loss, sleep troubles, headaches, and stomach pain are common side effects of ADHD medication.

Explanation: It may boost your child’s growth. Some ADHD medications can slow a child’s growth in height, especially during the first 2 years of taking it. While height delays are temporary and kids typically catch up later, going off medication may lead to fewer growth delays.

It won’t hurt your child. Taking a child off ADHD medication may cause their ADHD symptoms to reappear. But it won’t make them sick or cause other side effects.

Other Questions
question 6 options: take the reaction: nh3 o2 no h2o. in an experiment, 3.25 g of nh3 are allowed to react with 3.50 g of o2. which reactant is the limiting reagent? you may either write the formula or the name of the limiting reactant. if 2000 is placed into a bank account that pays 3% interest compound into how much will be in the account after 2 years? individuals who buy second homes usually spend less for them than they do for their first homes why is this the case? c im x hi ca ch ngha t bn (3/48a)+(3/412)= 23.4, what does A mean??? Consider the following four formulas: so2, b2h6, co, c4h2o2. which of these formulas could be only an empirical formula? A pair of sneakers cost $40 and there is a 30% markup rate. Find the selling price of the sneakers What do I need to take my CDL permit test in Florida? pardita is preparing for a speech at her high school reunion. what type of outline will she most likely use when delivering her speech? Name the chapter whence this extract has been taken what is the actual heading of runway 36 at oshkosh/wittman regional (osh) airport? HELP ASAPWhich thesis statement should be included to effectively introduce the clalm?O.A. As brain science continues to research how technology affects people, it will become clearer that technology harms opersonal growth.O B. Social media is the only reason that young people copy the ever-changing fashion trends of others and struggle to developpersonal confidence in their own choices.O C. Looking for immediate feedback generated from clothing choices or social media can hinder a person's ability to buildpersonal confidence and have a sense of self-worth.O D. Social media should be used as a platform to express individuality.OE. Young people need to put away their phones and choose to participate in other activities that keep them away fromtechnology. I REALLY NEED HELP!!! PLEEEEEASEA landscaper needs to fill a path measuring 2 feet by 8 feet with patio stones.The patio stones are each 1 foot by 2 feet, so the landscaper calculates that shewill need 8 of them.Before arranging the patio stones, the landscaper wants to look at all her options.She can not cut or overlap the stones, and they all must fit inside the path areawithout any gaps. Two possible arrangements of the stones are shown below.How many different arrangements are there in total? does an identical cylinder with the same pressure of hydrogen contain more molecules than a cylinder of oxygen because hydrogen molescules are smaller Find a function whose graph is a parabola with vertex (4,-5) and that passes through the point (2, 3). Which set of integers is in order from greatest to least?-6,-12,1,4,7-12,-6,1,4,77,4,1,-6,-127,4,1,-12,-6 The volume of a particular rectangular box is given by the equation V = 50x-2x'. The height and length ofthe box are shown on the diagram below. Find the width of the box in terms of x. Recall that V =L-W-Hfor a rectangular box.Dimensions on diagram:2x(height)x+5(length)?(width) Yet answered marked out of 1.00 p flag question a key difference between campaign finance rules for congressional races as opposed to presidential races is Solve the equation. x67=5 The first step is to___ on both sides of the equation. The second step is to___ on both sides of the equation. x=____ Which technique of creating emphasis is in primary use in this painting? The artist primarily used to create emphasis in this painting.