how is 14differ from 0.14

Answers

Answer 1
Because 14=1and0.14=0.0001

1) According to the exponent's law, any exponent whose base is 1, that yields 1. For example

14=113=11π=1 etc.

2) The same does not happen to 0.1

0.1=1104=110000=0.0001

Since 0.1 is a fraction, we'll raise to the 4th power 1 and 10 simultaneously, as a ratio.

3) So the answer is

Because 14=1and0.14=0.0001


Related Questions

What is the solution to 6x2 –14x ≥ –4?

Answers

Answer:

2.85714285714

Step-by-step explanation:

6x2 –14x ≥ –4

36 -14x ≥ -4

-14x ≥ -36-4

-14x ≥ -40

x ≥ -40/14

x 2.85714285714

A

Step-by-step explanation:

did math

the function h ( x ) = 1 x 6 can be expressed in the form f ( g ( x ) ) , where g ( x ) = ( x 6 ) , and f ( x ) is defined as: f ( x ) = incorrect

Answers

The function h(x) = 1/x^6 can be written as f(g(x)), where g(x) = (x^6) and f(x) = 1/x.

What is a function?

A function is a relationship or expression involving one or more variables.  It has a set of inputs and outputs.  Each input has only one output.  The function is the description of how the inputs relate to the output.

This means that we are representing h(x) as the composition of two functions, g(x) and f(x), such that the output of g(x) is plugged into f(x) to give us h(x).

In this case, g(x) = (x^6) takes in x and returns x^6, while f(x) = 1/x takes in x^6 and returns 1/(x^6).

When we plug the output of g(x) into f(x), we get h(x) = 1/(x^6).

So, in essence, we have expressed h(x) = 1/x^6 as f(g(x)), where g(x) = (x^6) and f(x) = 1/x.

Hence, The function h(x) = 1/x^6 can be written as f(g(x)), where g(x) = (x^6) and f(x) = 1/x.

To learn more about the function visit,

https://brainly.com/question/11624077

#SPJ1

Question 4: Consider rolling a fair six-sided die once with the two possible events, (4 points) Event A: roll an even number Event B: roll a number less than or equal to 3 .

Answers

The Probabilities are as follows

P(A) = 3/6 = 1/2

P(B) = 3/6 = 1/2

P(A and B) = 1/6

P(A or B) = 5/6

How did we arrive at the values?

Sample Space (S) of the whole experiment: {1, 2, 3, 4, 5, 6}

Sample Space of Event A: {2, 4, 6}

Sample Space of Event B: {1, 2, 3}

A Venn diagram indicating two circles labeled A and B, and the overlap between the two circles labeled A and B]

Probabilities:

P(A) = |Event A| / |Sample Space| = 3/6 = 1/2

P(B) = |Event B| / |Sample Space| = 3/6 = 1/2

P(A and B) = |Event A and Event B| / |Sample Space| = 1/6

P(A or B) = 1 - P(Neither A nor B) = 1 - (6 - |Event A| - |Event B|) / |Sample Space| = 1 - (6 - 3 - 3) / 6 = 1 - (6 - 6) / 6 = 1/6 = 5/6

learn more about probability: https://brainly.com/question/24756209

#SPJ1

The complete question goes thus:

Consider rolling a fair six-sided die once with the two possible events, Event A: roll an even number Event B: roll a number less than or equal to 3 • State the Sample Space of the whole experiment: State the Sample Space of the Event A: State the Sample Space of the Event B: Draw a Venn diagram: . Find the following probability: P(A)= P(B)= P (A and B) = P (A or B) =

l

TRUE/FALSE. If B = PDP^T where P^T=P^-1 and D is a diagonal matrix, then B is a symmetric matrix.

Answers

The statement is true. If a matrix B can be expressed as B = PDP^T, where P is an invertible matrix and D is a diagonal matrix, then B is a symmetric matrix.

This can be proven as follows:
First, let's take the transpose of B:

B^T = (PDP^T)^T = (P^T)^TD^T P^T

Since D is a diagonal matrix, its transpose is equal to itself:

D^T = D

Therefore, we can substitute D^T with D in the above equation:

B^T = PDP^T = B

Since B is equal to its transpose, it is a symmetric matrix.

In other words, if a matrix B can be diagonalized by an orthogonal matrix P, which means that P^T=P^-1, then B is a symmetric matrix. This is because orthogonal matrices preserve the dot product and the symmetry of a matrix. The diagonal matrix D represents the eigenvalues of B, which can be either positive, negative, or zero. Therefore, if all the eigenvalues of B are non-negative, then B is positive definite, and if they are non-positive, then B is negative definite. If some eigenvalues are positive and some are negative, then B is indefinite.

Learn more about invertible matrix here:

https://brainly.com/question/30754589

#SPJ11

3) Let (x) = x^2 + x + 1
A) [2 pts.] Is (x) a function? Explain your reasoning.
B) [2 pts.] Find the value of (3). Explain your result.
C) [2 pts.] Find the value(s) of x for which (x) = 3. Explain your result.

Answers

This means that each input will result in one output, and (x) will satisfy the definition of a function. The value of (3) is 13. The solutions of (x) = 3 are x = -2 and x = 1.

A)  It is an example of a quadratic function and will have one y-value for each x-value that is input. This means that each input will result in one output, and (x) will satisfy the definition of a function.

B)The value of (3) can be found by substituting 3 for x in the expression.(3) = (3)^2 + 3 + 1= 9 + 3 + 1= 13Therefore, the value of (3) is 13.

C) Find the value(s) of x for which (x) = 3. Explain your result.We can solve the quadratic equation x² + x + 1 = 3 by subtracting 3 from both sides of the equation to obtain x² + x - 2 = 0. After that, we can factor the quadratic equation (x + 2)(x - 1) = 0, which can be used to find the values of x that satisfy the equation. x + 2 = 0 or x - 1 = 0 x = -2 or x = 1. Therefore, the solutions of (x) = 3 are x = -2 and x = 1.

Learn more about function :

https://brainly.com/question/29633660

#SPJ11

Edgardo inherited a rectangular piece of lot from his parents measuring 140 m by 120 m. Duribg the pandemic, he purchased the adjacent square lot whose sides measure 140 m. What is the total land area of Edgardo's property?

Answers

The total land area of Edgardo's property is 36,400 square meters.

The area is a measure of the amount of two-dimensional space that a flat surface or shape occupies. It is a fundamental concept in geometry and is expressed in square units, such as square meters (m²), square feet (ft²), or square centimeters (cm²).

Edgardo's original rectangular lot has an area of:

140 m x 120 m = 16,800 m²

The square lot he purchased has an area of:

140 m x 140 m = 19,600 m²

To find the total land area of Edgardo's property, we add the areas of the two lots:

16,800 m² + 19,600 m² = 36,400 m²

Therefore, the property owned by Edgardo has a total land size of 36,400 square meters.

To know more about an area follow

https://brainly.com/question/29190992

#SPJ1

Find the number if 3.5% of its 21

Answers

Answer:

To find 3.5% of 21, we can convert 3.5% to a decimal by dividing by 100:

3.5% = 3.5/100 = 0.035

Then, we can multiply 0.035 by 21 to find the answer:

0.035 * 21 = 0.735

Therefore, 3.5% of 21 is 0.735.

0.735

because o.31 percent of 21 is 0.735

help pleaseeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeee

help pleaseeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeeee

Answers

im 90% sure it’s H (pls mark as brainliest

Answer:  choice F) m/26 = 12

=======================================================

Work Shown:

mpg = miles per gallon

mpg = miles/gallon

To find the mpg, we divide the number of miles driven over the number of gallons of gas used. For instance, if we can drive 100 miles on 5 gallons of gas, then we get 100/5 = 20 mpg

In this problem, we don't know how many miles we can travel. So m is the placeholder for that number. We know that we use 12 gallons of gas. So we have

mpg = miles/gallon

mpg = m/12

We're told Shannon gets 26 mpg, which allows us to say m/12 = 26

--------------------

Unfortunately m/12 = 26 doesn't match any of the answers. But we can do a bit of algebra to transform things.

Start off multiplying both sides by 12

m/12 = 26

12*(m/12) = 12*26

m = 12*26

Then divide both sides by 26

m = 12*26

m/26 = 12*26/26

m/26 = 12

which matches with choice F

Translate the following sentence into an equation. The quotient of a number and -2, less 10, is -18. Giving brainliest

Answers

Answer:

x/2-10=18

Step-by-step explanation:

An equation is formed of two equal expressions. The given statement The quotient of a number and -2, less 10, is -18 can be written as an equation as (x/-2)-10=-18.

What is an equation?

An equation is formed when two equal expressions are equated together with the help of an equal sign '='.

Let the number be represented by x. Therefore, the given statement can be written as,

(x/-2)-10=-18

Hence, the given statement The quotient of a number and -2, less 10, is -18 can be written as an equation as (x/-2)-10=-18.

Learn more about Equation:

https://brainly.com/question/2263981

#SPJ2

what is the answer to 4w^4+w^4+3w^2-2w^2

Answers

Answer: 5w⁴ + w²

Step-by-step explanation: Pic is attached. Hope this helps. Sorry for bad handwriting, Im writing with a mouse.

what is the answer to 4w^4+w^4+3w^2-2w^2

3 2/3 divided by 3/4

Answers

Answer:

449




Points A, B and C lie on a circle, centre O.
Angle AOC = 142°.
Find the value of y.

Points A, B and C lie on a circle, centre O.Angle AOC = 142.Find the value of y.

Answers

The value of the angle y within the quadrilateral OABC inscribed the circle is 142°.

Let suppose that quadrilateral OABC is a parallelogram. Then, the following conditions must be fulfilled:

OABC ABOC AOCABC

In addition, if we have a rhombus we have the additional condition as A, B and C lie on the circle:

OAABBCOC (4)

If we know that AOC=142, then the value of ABC=y=142.

Based on all these finding, we conclude that the value of the angle y within the quadrilateral OABC inscribed the circle is 142°.

To learn more on parallelograms, we kindly invite to check this verified question: https://brainly.com/question/555469

The original Ferris wheel was built in 1893 by Pittsburgh, Pennsylvania, bridge builder George W. Ferris. The Ferris wheel was originally built for the 1893 World’s Fair in Chicago, but was also later reconstructed for the 1904 World’s Fair in St. Louis. It had a maximum height of 264 feet and a wheel diameter of 250 feet. Find an equation for the wheel if the center of the wheel is on the y-axis

Answers

Answer:

x2+(y139)2=1252

Ashley is the oldest of four siblings whose ages are consecutive even integers. If the sum of their ages is 100, find Ashley's age.

Answers

Answer:

28 years

Step-by-step explanation:

Given conditions:Ashley is the oldest sibling There are four siblings Sum of their ages are consecutive even integers Sum of their ages is 100

To Find :Ashley's age.

Solution :

Let,

One of the siblings age be = x

So, the other siblings ages are = x+2, x+4 and x+6

Since,

Ashley is the oldest sibling so his age is x + 6

∴ By the problem,

=> x + (x+2) + (x+4) + (x+6) = 100

(Now adding up the like terms we get)

=> 4x + 12 = 100

(Transposing the like terms to same sides)

=> 4x = 100 - 12

(Subtracting the like terms)

=> 4x = 88

(Dividing both sides by 4)

=> x = 22

Now,

We got the age of the youngest one that is 22 years

As,

Ashley is the oldest sibling so his age is

= 22 + 6 = 28 years

Hence,

The age of Ashley is 28 years (Ans)

Answer:

28 years old

Step-by-step explanation:

100/4 = 25

The ages are consecutive even numbers,

so add 1 to and subtract 1 from 25.

Add 3 to and subtract 3 from 25.

Ages: 22, 24, 26, 28

Ashley is the oldest: 28 years old

Do a dot plot for the data set:
3, 7, 6, 5, 3, 6, 5, 3, 7, 3, 6

Answers

Answer: So pretty much what you do is you put a dot on the positive 3 then move over one and put another on the 7 and you just keep doing that with all of them

Step-by-step explanation:

find the domain of each function
f(x)=(x+5)/x

Answers

FOR THE GIVEN FUNCTION WE WILL HAVE TO CHECK DENOMINATOR PART BECAUSE IT IS THE ONE WITH THE GREATER EFFECT ON MAKING THE FUNCTION UNDEFINED.

THE FUNCTION WILL BE UNDEFINED ONLY IF x=0

THIS BRINGS US TO A CONCLUSION OF SAYING THE DOMAIN IS ALL REAL NUMBERS BUT X IS NOT EQUAL TO 0

PLEASE GEOMETRY HELP WILL MARK BRAINLIEST!!!

PLEASE GEOMETRY HELP WILL MARK BRAINLIEST!!!

Answers

Answer:

3240°

Explanation:

The formula for calculating the sum of the interior angles of a polygon is (n-2)x180 where n refers to the number of sides. Because we know that the polygon has 20 sides, the equation would be (20-2)x180. The answer would be 3240°.

The bases of a trapezoid lie on the lines y=2X +7 and y= 2X -5. Write the equation that contains the midsegment of the trapezoid

Answers

Given:

The bases of a trapezoid lie on the lines

y=2x+7

y=2x5

To find:

The equation that contains the midsegment of the trapezoid.

Solution:

The slope intercept form of a line is

y=mx+b

Where, m is slope and b is y-intercept.

On comparing y=2x+7 with slope intercept form, we get

m1=2,b1=7

On comparing y=2x5 with slope intercept form, we get

m2=2,b2=5

The slope of parallel lines are equal and midsegment of a trapezoid is parallel to the bases. So, the slope of the bases line and the midsegment line are equal.

m=m1=m2=2

The y-intercept of one base is 7 and y-intercept of second base is -5. The y-intercept of the midsegment is equal to the average of y-intersects of the bases.

b=b1+b22

b=752

b=22

b=1

So, the y-intercept of the required line is 1.

Putting m=2 and b=1 in slope intercept form, we get

y=2x+1

Therefore, the equation of line that contains the midsegment of the trapezoid is y=2x+1.

An equilateral triangle has a median drawn from one angle to the opposite side. What is the measure of each angle formed by the place where the median meets the vertex?

(Step by step pls)

Worth 20 points

Answers

The measure of each angle formed by the place where the median meets the vertex is 30 degrees

How to determine the angle?

The median of an equilateral triangle divides the side and the angle into equal parts.

If the angle at the vertex is, the new angle would be

Angle = x/2

The angle at the vertex of an equilateral triangle is 60.

So, we have:

Angle = 60/2

Evaluate

Angle = 30

Hence, the measure of each angle formed by the place where the median meets the vertex is 30 degrees

Read more about triangle median at:

https://brainly.com/question/2288141

#SPJ1

Veronica wants to check her work after evaluating Negative 108 divided by (negative 6). What steps can she follow to verify her answer?
Divide her answer by –6 and see if the result is –108.
Divide her answer by –108 and see if the result is –6.
Multiply her answer by –6 and see if the result is –108.
Multiply her answer by –108 and see if the result is –6.

Answers

Multiply her answer by -6 and see if the result is -108!

Answer: It's C; Multiply her answer by -6 and see if the result is -108

Step-by-step explanation:

Best one gets brainly :D

Best one gets brainly :D

Answers

Answer:

The first and the second equation is flipped... meaning you have to switch their places

Step-by-step explanation:

I think I did this before so good luck...

3х + 2y = 23
1/2х — у = 4

3 + 2y = 231/2 = 4

Answers

Answer:3x+2y=23

Step-by-step explanation:

Tammy put six balls in a hat. Each ball is a different color, but all are the same size, shape and weight. Tammy asked Steve to pull a ball out of the hat and replace it 100 times. He pulled out a red one 16 times, a blue one 13 times, a green one 19 times, a yellow one 15 times, an orange one 17 times, and a purple one 20 times.

Based on experimental probability, what is the chance he will pull out a purple ball on the 101st try?

A, 1 chance in 5
B, 1 chance in 10
C, 1 chance in 20
D, 1 chance in 100

Tammy put six balls in a hat. Each ball is a different color, but all are the same size, shape and weight.

Answers

The probability of pulling out a purple ball on the 101st try is 1/5.

The answer is A, 1 chance in 5.

What is the probability?

The probability of any given event is given by the formula below:

Probability = the number of expected outcomes / the number of possible outcomes

The given data is as follows:

There are six balls in a hat. Each ball is a different color, but all are the same size, shape, and weight.

the number of expected outcomes (purple ball) = 20

the number of possible outcomes = 16 + 13 + 19 + 15 + 17 + 20

the number of possible outcomes = 100

The experimental probability of pulling out a purple ball is:

P(purple) = 20/100 = 1/5

Learn more about probability at: https://brainly.com/question/24756209

#SPJ1

Convert the following formula into CNF. Write your answers in set notation, using ! as negation. For example, the formula: (QVPVR)^(-PVQ) would be written: {{0,P,R}, {!P,0}} i. (1 mark) PAQVR) ii. (1 mark) -(PVQ) AR iii. (1 mark) PH-Q iv. (2 marks) -(S+ (-PVQV-R)) v. (2 marks) ( RS) V-QV-P)

Answers

The CNF representation in set notation is: {{P, A, Q, V}, {P, A, Q, R}}

The CNF representation in set notation is:{{P, V, Q}, {A}, {R}}

The CNF representation in set notation is:{{!P, H}, {Q}}

The CNF representation in set notation is:{{!S, P}, {!S, V}, {!S, Q}, {!S, V}, {!S, -R}}

The CNF representation in set notation is:{{R, S, -Q}, {R, S, -V}, {R, S, -P}}

To convert the formula (PAQVR) into CNF, we can break it down as follows:

Distribute the disjunction over the conjunction.

PAQVR = (PAQV) ∧ (PAQR)

Convert each clause into sets.

(PAQV) = {{P, A, Q, V}}

(PAQR) = {{P, A, Q, R}}

Combine the clauses using conjunction.

{{P, A, Q, V}} ∧ {{P, A, Q, R}}

The CNF representation in set notation is:

{{P, A, Q, V}, {P, A, Q, R}}

To convert the formula (-(PVQ) AR) into CNF, we can break it down as follows:

Remove the implication.

(-(PVQ) AR) = (!(-(PVQ)) ∨ A) ∧ R

Apply De Morgan's Law and distribute the disjunction over the conjunction.

(!(-(PVQ)) ∨ A) ∧ R = ((PVQ) ∨ A) ∧ R

Convert each clause into sets.

(PVQ) = {{P, V, Q}}

A = {{A}}

R = {{R}}

Combine the clauses using conjunction.

{{P, V, Q}, {A}} ∧ {{R}}

The CNF representation in set notation is:

{{P, V, Q}, {A}, {R}}

To convert the formula (PH-Q) into CNF, we can break it down as follows:

Convert the implication into disjunction and negation.

(PH-Q) = (!P ∨ H) ∨ Q

Convert each clause into sets.

!P = {{!P}}

H = {{H}}

Q = {{Q}}

Combine the clauses using conjunction.

{{!P, H}, {Q}}

The CNF representation in set notation is:

{{!P, H}, {Q}}

To convert the formula (-(S+ (-PVQV-R)) into CNF, we can break it down as follows:

Remove the double negation.

-(S+ (-PVQV-R)) = (!S ∨ (PVQV-R))

Distribute the disjunction over the conjunction.

(!S ∨ (PVQV-R)) = ((!S ∨ P) ∧ (!S ∨ V) ∧ (!S ∨ Q) ∧ (!S ∨ V) ∧ (!S ∨ -R))

Convert each clause into sets.

!S = {{!S}}

P = {{P}}

V = {{V}}

Q = {{Q}}

-R = {{-R}}

Combine the clauses using conjunction.

{{!S, P}, {!S, V}, {!S, Q}, {!S, V}, {!S, -R}}

The CNF representation in set notation is:

{{!S, P}, {!S, V}, {!S, Q}, {!S, V}, {!S, -R}}

To convert the formula ((RS) V-QV-P) into CNF, we can break it down as follows:

Distribute the disjunction over the conjunction.

((RS) V-QV-P) = ((RS ∨ -Q) ∧ (RS ∨ -V) ∧ (RS ∨ -P))

Convert each clause into sets.

RS = {{R, S}}

-Q = {{-Q}}

-V = {{-V}}

-P = {{-P}}

Combine the clauses using conjunction.

{{R, S, -Q}, {R, S, -V}, {R, S, -P}}

The CNF representation in set notation is:

{{R, S, -Q}, {R, S, -V}, {R, S, -P}}

Learn more about Conjuction:https://brainly.com/question/8094735

#SPJ11

Jill has been weaving baskets to sell at local craft shows. At the last show, she sold each basket for $25 and sold out of them. Since they sold so well, Jill has decided to increase the price of a basket to $32. By what percent is the price changing? **STEP BY STEP EXPLANATION PLEASE AND THANK YOU!!**

Answers

Answer:

28%

Step-by-step explanation:

32-25=7

7/25=0.28

0.28x100=28

28%

Please help I’ll give brainliest!!

Please help Ill give brainliest!!

Answers

Answer:

The real solutions are:

x = -5, -3, 4, 8

after being nominated for an mtv music award, the probability of winning is 25%. if ariana grande has been nominated for five awards, what is the chance that she will win at least one award? how many awards should she expect to win? what is the standard deviation associated with this probability?

Answers

The probability of winning at least one award is 1 - 0.2373 = 0.7627 or 76.27%.

If the probability of winning an MTV music award after being nominated is 25%, the probability of not winning is 75%. Thus, the probability of not winning any of the five awards is (0.75)^5 = 0.2373.

As for how many awards Ariana Grande should expect to win, we can use the expected value formula: E(x) = n * p, where n is the number of trials (in this case, 5) and p is the probability of success (0.25). Therefore, E(x) = 5 * 0.25 = 1.25. So, Ariana Grande can expect to win about 1 award.

Finally, to calculate the standard deviation associated with this probability, we can use the formula: σ = sqrt(n * p * (1-p)). Plugging in the values, we get σ = sqrt(5 * 0.25 * 0.75) = 0.866. Therefore, the standard deviation associated with this probability is approximately 0.866.

To learn more about probability click here

brainly.com/question/30034780

#SPJ11

under the good samaritan law, you can not be held liable for trying to help someone at a traffic collision if you helped in good faith. state of true or false
a. true
b. false

Answers

Answer: true

Step-by-step explanation:

The good Samaritan law allows you to help people and not be liable for trying to do so.

Prove, using the definition of the derivative, that if f(x) = cos (x), then f'(x) = -sinx.

Answers

The derivative of a function represents the rate of change of the function with respect to its variable. This rate of change is described as the slope of the tangent line to the curve of the function at a specific point. The derivative of the cosine function can be found by applying the limit definition of the derivative to the cosine function.

f(x)=cos(x)thenf(x)=sin(x).

Let's proceed with the proof.  Definition of the Derivative: The derivative of a function f(x) at x is defined as the limit as h approaches zero of the difference quotient f(x+h)f(x)/h if this limit exists. Using this definition, we can find the derivative of the cosine function as follows:

f(x)=cos(x)f(x+h)=cos(x+h)

Now, we can substitute these expressions into the difference quotient: f(x)=limh0[cos(x+h)cos(x)]/h

We can then simplify the expression by using the trigonometric identity for the difference of two angles:

cos(ab)=cos(a)cos(b)+sin(a)sin(b)

Applying this identity to the numerator of the difference quotient, we obtain:

f(x)=limh0[cos(x)cos(h)sin(x)sin(h)cos(x)]/h

We can then factor out a cos(x) term from the numerator:

f(x)=limh0[cos(x)(cos(h)1)sin(x)sin(h)]/h

We can then apply the limit laws to separate the limit into two limits:

f(x)=limh0cos(x)[limh0(cos(h)1)/h]limh0sin(x)[limh0sin(h)/h]

The first limit can be evaluated using L'Hopital's rule:

limh0(cos(h)1)/h=limh0sin(h)/1=0

Therefore, the first limit becomes zero:

f(x)=limh0sin(x)[limh0sin(h)/h]

Applying L'Hopital's rule to the second limit, we obtain:

limh0sin(h)/h=limh0cos(h)/1=1

Therefore, the second limit becomes 1:

f(x)=sin(x)

Thus, we have proved that if f(x)=cos(x),thenf(x)=sin(x).

To know more about expressions visit :

https://brainly.com/question/28170201

#SPJ11

A family bought a total of 16 adult and child tickets to a magic show. Adult tickets are $10.50 each andchild tickets are $7.50 each. The family paid a total of $141.How many of adult tickets, x, and child tickets, y, did they buy?(Only enter the numerical answer.)adult ticketschild tickets

Answers

number of adult ticket = x

number of child ticket = y

Total number of ticket = 16

undefined

Other Questions
at this frequency, when the voltage across the resistor is maximum, what is the voltage across the capacitor? Fiona moved to the city five years ago. she has noticed that her expenses have been slowly going up even though she has stayed in the same apartment and has not changed anything about her lifestyle. what is the most likely cause of this cost increase? a. debt b. inflation c. insurance d. investment Point A (7,4) is translated to A' (16,-9) which rule describes the translation? ________ is credited with leading the change to abstraction in modern art. What is the role of corporate competition between Jollibee andMcDonalds in pushing scientific advancement and innovation in thefield of food services industry? Social learning theory takes into account the influence of reinforcement on behavior. Please select the best answer from the choices provided T F For any given interest rate, the shorter the time period before the receipt a dollar, the lower is its present value. TRUE/False the manipulated variable in this experiment is the a) type of antacidb) amount of antacid usedc) time it takes for the reaction to occurd) temperature at which the reaction occurs Maya likes to take a lot of notes in class, but she's not always sure how to structure what she writes. She's tried different methods of taking notes, but they've all been too difficult for her. What type of notes would you recommend Maya use if she doesn't like to conform to a strict structure?A. concept map methodB. outline methodC. free-form methodD. concept map and outline combination How did men and women play different roles in the society of the plains tribes?Describe their different responsibilities. What does x an y represent X - + 3 = 15 -4someone help me confused 4 cards are drawn at random from a standard deck. find the probability that all the cards are hearts. find the probability that all the cards are face cards. note: face cards are kings, queens, and jacks. find the probability that all the cards are even. (consider aces to be 1, jacks to be 11, queens to be 12, and kings to be 13) The objective of __________ research is to gather preliminary information that will help define the problem and suggest hypotheses. A light-rail train going from one station to the next on a straight section of track accelerates from rest at 1.1 m/s2 for 20 s. it then proceeds at constant speed for 1100 m before slowing down at 2.2 m/s2 until it stops at the station. what is the distance between the stations? Place the following events in sequence, from left to right: A) Treaty of Guadalupe Hidalgo; B) Battle of the Alamo; C) Texas becomes a U.S. state 1)A, C, B2)C, B, A3)B, A, C4)B, C, A Part Which of the following statements about the interactions between the circulatory and respiratory systems is/are true? Select all that apply. During exercise, the heart pumps faster and the demand for oxygen decreases. Blood flows from the right side of the heart to the body, then to the left side of the heart and then to to lungs. The ability of oxygen to be carried in the blood is largely mediated by the presence of the protein hemoglobin. The interactions between alveoli and capillaries allow for gas exchange to occur. a. How do people living on a coastal region adapt to erosion? Which of the following is NOT one of the Five Pillars of Islam?Muslim may not eat or drink from sunrise to sunset during Ramadan.Muslims must pray five times a day.Muslims must be generous to the poor.Muslims must truly believe that there is no God but Muhammad. For scope limitations that have a material but not pervasive effect on the financial statements, auditors should issue a report that includes modifications to the ______ sections.