How does the earth's surface change
after certain weather conditions ????

Answers

Answer 1

Answer:

shoot idek bro I just want dem points


Related Questions

The molar solubility of a slightly soluble ionic compound M2X3 is 2.8 x 10-6 M. Determine the value of Ksp.

Answers

Answer:

1.9 × 10⁻²⁶

Explanation:

Step 1: Write the solution reaction for M₂X₃

M₂X₃(s) ⇄ 2 M³⁺(aq) + 3 X²⁻(aq)

Step 2: Make an ICE chart

We can relate the molar solubility (S) with the solubility product constant (Ksp) using an ICE chart.

        M₂X₃(s) ⇄ 2 M³⁺(aq) + 3 X²⁻(aq)

I                              0               0

C                          +2S             +3S

E                            2S               3S

The solubility product constant is:

Ksp = [M³⁺]² × [X²⁻]³ = (2S)² × (3S)³ = 108 S⁵ = 108 (2.8 × 10⁻⁶)⁵ = 1.9 × 10⁻²⁶

The value of Ksp when there is the slightly soluble ionic compound so it should be 1.9 × 10⁻²⁶.

Calculation of the value of ksp:

Since the solution reaction for M₂X₃ should be

M₂X₃(s) ⇄ 2 M³⁺(aq) + 3 X²⁻(aq)

Now make an ICE chart

So it can be like

       M₂X₃(s) ⇄ 2 M³⁺(aq) + 3 X²⁻(aq)

I                              0               0

C                          +2S             +3S

E                            2S               3S

Now The solubility product constant is:

Ksp = [M³⁺]² × [X²⁻]³

= (2S)² × (3S)³ = 108 S⁵

= 108 (2.8 × 10⁻⁶)⁵

= 1.9 × 10⁻²⁶

hence, The value of Ksp when there is the slightly soluble ionic compound so it should be 1.9 × 10⁻²⁶.

Learn more about molar here: https://brainly.com/question/19004694

7. What is the volume of the
composite
solid?
4 in.
3 in.
3 in.

7. What is the volume of thecompositesolid?4 in.3 in.3 in.

Answers

Answer:

The volume of Component 1 is 36 cubic inches.

Explanation:

To calculate the volume of a composite solid, we need to determine the individual volumes of the different components and then add them together.

In this case, the composite solid consists of multiple components with the following dimensions:

Component 1:

Length: 4 inches

Width: 3 inches

Height: 3 inches

To find the volume of Component 1, we multiply the length, width, and height together:

Volume of Component 1 = Length x Width x Height = 4 in x 3 in x 3 in = 36 cubic inches

Therefore, the volume of Component 1 is 36 cubic inches.

Please provide the dimensions of the remaining components of the composite solid, and I will calculate the total volume by summing up the individual volumes.

What is the job of cellular respiration?

Answers

Answer:

to break down sugar in the presence of oxygen to release energy in the form of ATP

Explanation: i just finished this chapter of the class

The rotational spectrum of 79BrºF shows a series of equidistant lines spaced 0-714 33 cm - apart. Calculate the rotational constant B, and hence the moment of inertia and bond length of the molecule. Determine the wavenumber of the J = 9+= 10 transition, and find which transition gives rise to the most intense spectral line at room temperature (say 300 K).
and calculate the number of revolutions per second which the Brf molecule undergoes when in (a) the J = 0 state, (b) the J = 1 state, and (c) the J = 10 state. Hint: Use E = {lwin conjunction with Eqs (2.10) and (2.13), but remember that here w is in radians per second.[its Q season 2 from fundamentals of molcular spectruscopy . banwell.c.n]​

Answers

In the J = 0 state, the BrF molecule does not undergo any revolutions per second. In the J = 1 state, it undergoes approximately 0.498 revolutions per second, and in the J = 10 state, it undergoes approximately 15.71 revolutions per second.

To calculate the rotational constant B, we can use the formula:

B = 1 / (2 * π * Δν)

Where:

B = rotational constant

Δν = spacing between consecutive lines in the rotational spectrum

Given that the spacing between consecutive lines is 0.71433 cm^(-1), we can substitute this value into the formula:

B = 1 / (2 * π * 0.71433 cm^(-1))

B ≈ 0.079 cm^(-1)

The moment of inertia (I) of the molecule can be calculated using the formula:

I = h / (8 * π^2 * B)

Where:

h = Planck's constant

Given that the value of Planck's constant (h) is approximately 6.626 x 10^(-34) J·s, we can substitute the values into the formula:

I = (6.626 x 10^(-34) J·s) / (8 * π^2 * 0.079 cm^(-1))

I ≈ 2.11 x 10^(-46) kg·m^2

The bond length (r) of the molecule can be determined using the formula:

r = sqrt((h / (4 * π^2 * μ * B)) - r_e^2)

Where:

μ = reduced mass of the molecule

r_e = equilibrium bond length

To calculate the wavenumber (ν) of the J = 9+ to J = 10 transition, we can use the formula:

ν = 2 * B * (J + 1)

Substituting J = 9 into the formula, we get:

ν = 2 * 0.079 cm^(-1) * (9 + 1)

ν ≈ 1.58 cm^(-1)

To determine the most intense spectral line at room temperature (300 K), we can use the Boltzmann distribution law. The intensity (I) of a spectral line is proportional to the population of the corresponding rotational level:

I ∝ exp(-E / (k * T))

Where:

E = energy difference between the levels

k = Boltzmann constant

T = temperature in Kelvin

At room temperature (300 K), the population distribution decreases rapidly with increasing energy difference. Therefore, the transition with the lowest energy difference will have the most intense spectral line. In this case, the transition from J = 0 to J = 1 will have the most intense spectral line.

To calculate the number of revolutions per second, we can use the formula:

ω = 2 * π * B * J

Where:

ω = angular frequency (in radians per second)

J = rotational quantum number

For J = 0:

ω = 2 * π * 0.079 cm^(-1) * 0 = 0 rad/s

For J = 1:

ω = 2 * π * 0.079 cm^(-1) * 1 ≈ 0.498 rad/s

For J = 10:

ω = 2 * π * 0.079 cm^(-1) * 10 ≈ 15.71 rad/s

For more such questiosn on  BrF molecule visit;

https://brainly.com/question/30624940

#SPJ8

A student is building an electrical circuit. Which material should she choose for the wires, and why?
A. A noble gas such as krypton, because its atoms are far apart and it is nearly inert
B. A nonmetal such as carbon, because its atoms have tightly bound electrons
C. A metalloid such as germanium, because only some of its atoms have mobile electrons
D. A metal such as copper, because its atoms have very mobile electrons​

Answers

Answer:

d

Explanation:

Answer:

d

Explanation:

need it for resources(duh)​

need it for resources(duh)

Answers

Answer: Trail 2

Explanation: Because it has a pressure of 1 atm

trial 2 since it has lower pressure

There are two stable isotopes of chlorine: chlorine -35 and chlorine-37. Given that the average atomic mass of a chlorine atom is 35.45 amu, which if the following statements is true? A. chlorine contains almost exclusively Cl-37 with very little Cl-35 B. Chlorine contains more Cl-35 than Cl-37 C. Chlorine contains roughly equal amounts of Cl-35 and Cl-37 D. Chlorine contains more Cl-37 than Cl-35

Answers

Given that the average atomic mass of a chlorine atom is 35.45 amu, then the true statement would be that Chlorine contains roughly equal amounts of Cl-35 and Cl-37. The correct answer is C.

The average atomic mass of an element is the weighted average of the masses of its naturally occurring isotopes. In the case of chlorine, the atomic mass of the two stable isotopes (chlorine-35 and chlorine-37) is close to each other.

Chlorine-35 has an atomic mass of 34.97 amu and makes up about 75% of naturally occurring chlorine atoms, while chlorine-37 has an atomic mass of 36.97 amu and makes up about 25% of naturally occurring chlorine atoms.

The average atomic mass of chlorine can be calculated using the following formula:

average atomic mass = (fractional abundance of isotope 1 x mass of isotope 1) + (fractional abundance of isotope 2 x mass of isotope 2)

average atomic mass = (0.75 x 34.97 amu) + (0.25 x 36.97 amu)

average atomic mass = 26.23 amu + 9.24 amu

average atomic mass = 35.47 amu

This is very close to the reported average atomic mass of chlorine (35.45 amu), which confirms that chlorine contains roughly equal amounts of Cl-35 and Cl-37.

To learn more about atomic mass unit (amu) visit: https://brainly.com/question/29793336

#SPJ4

1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5​

Answers

1. The IUPAC name of N is nitrogen.

2. Nitrogen dioxide

3.The IUPAC name of O is oxygen

4.The IUPAC name of OH is hydroxyl.

The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.

IUPAC names for the given compounds are:1.1. N: Nitrogen

The IUPAC name of N is nitrogen.

It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide

Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.

The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen

Explanation: The IUPAC name of O is oxygen.

It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.

X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.

Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.

It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.

for more question on electronic configuration

https://brainly.com/question/26084288

#SPJ8

Note: The complete question is given below

Provide the IUPAC names for the following compounds:

CH3CH2CH(CH3)CH2CH2CH2CH3

C6H5CH(CH3)2

H2NCH2CH2CH2CH2CH2NH2

CH3CH2CH2CH2CH2OH

CH3CH2CH2CHOHCH3

Predict the ground-state electron configuration of each ion. Use the abbreviated noble gas notation.
Cu²+
Co³ +

I got answers of:

Cu - [Ar]4s^2 3d^7 ; [Ar]3d^7 ; [Ar]3d^10 ; [Ar]4s^1 3d^10

Co - [Ar]4s^2 3d^4 ; [Ar]3d^4

And these were all wrong, please help

Answers

The electron configuration of Cu²+ ion  - 1s22s22p63s23p63d9

The electron configuration of Co³ + ion - 1s22s22p63s23p63d6

What is the electron configuration?

When we are talking about the electron configuration, we are talking about the way that the electron is arranged around the nucleus of the atom. We know that electrons in the atom can be arranged in energy levels in the atom of the element.

We are asked to write here the electron configuration of the copper II ion and that of the cobalt III ion. In either case, we have to know that electrons have been removed from the neutral atom. In the first case, there are two electrons that have been removed while in the second case, there are three electrons that have been removed.

Thus in writing the electron configuration of the specie we have to take into account the number of the electrons that have been lost due to ion formation. Recall that the ground state is the lowest energy state of the chemical specie.

Learn more about electron configuration:https://brainly.com/question/14283892

#SPJ1

the table below gives the atomic number of elements w x and y and z.The the letters do not represent the actual symbols of the elements .
W. X Y. Z
9. 10. 11. 12
which one of the element is less reactive explain .

Answers

Element w is less reactive than elements x, y, and z. The element with the lower atomic number is typically less reactive.

Element w has an atomic number of 9, element x has an atomic number of 10, element y has an atomic number of 11, and element z has an atomic number of 12. Based on this information, we can conclude that element w is less reactive than elements x, y, and z.

This is because the reactivity of an element is largely determined by the number of valence electrons it has. Valence electrons are the electrons in the outermost shell of an atom that are involved in chemical reactions. Elements with fewer valence electrons are less reactive because they are more stable. Element w has only one valence electron, while elements x, y, and z have two, three, and four valence electrons, respectively.

In general, elements with a full outermost shell of electrons, such as the noble gases, are the least reactive because they are highly stable. Elements that are close to having a full outermost shell, such as element w, are also relatively stable and less reactive. On the other hand, elements with only a few valence electrons, such as the alkali metals, are highly reactive because they are trying to gain or lose electrons in order to achieve a full outermost shell.

Overall, the reactivity of an element is determined by its electronic structure, with elements having fewer valence electrons generally being less reactive than those with more. In the case of the elements w, x, y, and z, we can see that element w has the fewest valence electrons and is therefore the least reactive.

For more such questions on Element

https://brainly.com/question/28376204

#SPJ11

HELP ME PLEASE
Which is true about the relationship between the grain size of the sediment and the permeability of the sediment?

A. As the grain size of the sediment increases, the permeability increases.

B. The size of the sediment is not responsible for the permeability of the sediment.

C. As the grain size of the sediment increases, the permeability decreases.

D. As the grain size of the sediment decreases, the permeability increases.

Answers

Answer:

i think A is the correct answer

1.How is sunlight different from light produced by a light blub or by a fluorescent light blub?

2.What are some examples of light sources that you have seen where the light emitted was a color other than white?

3.What are some examples you have seen where white light was split into different colors?

Answers

Answer:

lemme slurp them juices out of that p*ssy. You must taste sweet.

Explanation:

Mr. Smith and Mr. Bellows are challenging the 6th grade boys to a tug-of-war contest. They pull
on the rope with 250 N of force to the west, while the boys can only pull with 240 N to the east.
What is the net force at this point?
10 N to the east
10 N to the west
490 N
The forces are balanced

Answers

It’s 10 N to the west
250 N is stronger than 240 N. If the force is stronger going West it would be West. If it’s stronger East then it will go East, it all depends on the most N of force that determines which way it’ll go.

Define atomic notation and give an example.​

Answers

Standard nuclear notation shows the chemical symbol, the mass number and the atomic number of the isotope. Example: the isotopes of carbon. The element is determined by the atomic number 6. Carbon-12 is the common isotope, with carbon-13 as another stable isotope which makes up about 1%.

Answer:

The process of showing number of protons and neutrons in an atom is known as atomic notation. Example: the isotopes of carbon, e.t.c

Explanation:

The number of protons in neucleus of an atom is called the atomic number, represented symbolically as Z, and it is a unique characteristic of an element. However, in written documents the number of protons (also Zand the atomic number are shown as a subscripted prefix of the elemental symbol)

could chuck could chuck wood chuck?

Answers

Chuck could chuck wood if chuck would chuck

Which seasons in Atlanta GA have worst AQI

Answers

In Atlanta, GA, certain seasons are associated with poorer air quality due to various factors such as weather conditions, human activities, and geographical location.

Typically, the seasons with the worst AQI in Atlanta, GA, are summer and early fall. This is primarily due to the combination of high temperatures, stagnant air masses, and increased pollution from various sources.

During the summer months, Atlanta experiences hot and humid weather, which can contribute to the formation of ground-level ozone. Ozone is a harmful pollutant that is created when pollutants from vehicles, power plants, and industrial activities react with sunlight and heat. High levels of ozone can cause respiratory issues and other health problems.

In addition to ozone, Atlanta also experiences increased levels of particulate matter (PM) during the summer and early fall. PM refers to tiny particles suspended in the air, which can come from sources such as vehicle exhaust, industrial emissions, and wildfires.

These particles can be inhaled into the lungs and can have detrimental effects on respiratory health.

It's important to note that air quality can vary from year to year and is influenced by various factors. Local regulations, weather patterns, and changes in pollutant emissions can all impact the AQI during different seasons.

Monitoring air quality reports and taking necessary precautions such as reducing outdoor activities during times of poor air quality can help individuals stay informed and protect their health.

For more such question on air quality visit:

https://brainly.com/question/21173066

#SPJ8

Question 5 In the Haber reaction, patented by German chemist Fritz Haber in 1908, dinitrogen gas combines with dihydrogen gas to produce gaseous ammonia. This reaction is now the first step taken to make most of the world's fertilizer. Suppose a chemical engineer studying a new catalyst for the Haber reaction finds that liters per second of dinitrogen are consumed when the reaction is run at and the dinitrogen is supplied at . Calculate the rate at which ammonia is being produced. Give your answer in kilograms per second. Round your answer to significant digits. Clears your work. Undoes your last action. Provides information about entering answers.

Answers

Answer:

0.41kg/s

Explanation:

Question 5 In the Haber reaction, patented by German chemist Fritz Haber in 1908, dinitrogen gas combines with dihydrogen gas to produce gaseous ammonia. This reaction is now the first step taken to make most of the world's fertilizer. Suppose a chemical engineer studying a new catalyst for the Haber reaction finds that 505. liters per second of dinitrogen are consumed when the reaction is run at 172 °C and the dinitrogen is supplied at 0.88 atm. Calculate the rate at which ammonia is being produced. Give your answer in kilograms per second. Round your answer to 2 significant digits. Clears your work. Undoes your last action. Provides information about entering answers.

Step 1: Convert 172 °C to Kelvin

We will use the following expression.

K = °C + 273.15

K = 172°C + 273.15 = 445 K

Step 2: Calculate the moles of N₂ consumed every second

We will use the ideal gas equation.

P × V = n × R × T

n = P × V/R × T

n = 0.88 atm × 505. L/(0.0821 atm.L/mol.K) × 445 K = 12 mol

Step 3: Calculate the rate of production of ammonia

Let's consider the balanced equation for the synthesis of ammonia.

N₂ + 3 H₂ ⇒ 2 NH₃

The molar ratio of N₂ to NH₃ is 1:2. The rate of production of ammonia is:

12 mol N₂/s × 2 mol NH₃/1 mol N₂ = 24 mol NH₃/s

Step 4: Convert the rate from mol/s to kg/s

We will use the following conversion factors:

The molar mass of NH₃ is 17.03 g/mol.1 kg = 1000 g

24mols×17.03g1mol×1kg1000g=0.41kg/s

thank you for the answer​

thank you for the answer

Answers

Answer:

this for u

Explanation:

hope it helps ☺️

thank you for the answer
thank you for the answer
thank you for the answer
thank you for the answer

CHALLENGE The circles below represent of the large circle, and multiply it by 30. That Earth and the moon. Measure the diameter would be the correct distance from Earth to the moon at this scale. Draw the two circles in the space provided. Use the correct distance you found.● = Earth ●=moon ​

CHALLENGE The circles below represent of the large circle, and multiply it by 30. That Earth and the

Answers

To draw the two circles, we would need to draw a smaller circle with a diameter of 2,532.5 miles (representing the moon) and a larger circle with a diameter of 75,974.4 miles (representing the Earth) that is 30 times larger than the smaller circle.

What is the explanation for the above response?

If we assume that the larger circle represents the Earth, then the diameter of the Earth would be 30 times the diameter of the smaller circle representing the moon. Let's say that the diameter of the smaller circle is x. Then the diameter of the larger circle (Earth) would be 30 times x or 30x.

To find the correct distance from Earth to the moon at this scale, we need to know the actual distance from Earth to the moon, which is approximately 238,855 miles or 384,400 kilometers. If we divide this distance by the scale factor of 30, we get:

238,855 miles / 30 = 7,961.8 miles

Therefore, the diameter of the smaller circle (moon) would be approximately 7,961.8 miles / π = 2,532.5 miles (rounded to one decimal place). And the diameter of the larger circle (Earth) would be 30 times that or 75,974.4 miles

So, to draw the two circles, we would need to draw a smaller circle with a diameter of 2,532.5 miles (representing the moon) and a larger circle with a diameter of 75,974.4 miles (representing the Earth) that is 30 times larger than the smaller circle.

Learn more about Earth at:

https://brainly.com/question/19581790

#SPJ1

What is the source of the forces that cause this plate movement

What is the source of the forces that cause this plate movement

Answers

Convection currents in the mantle, I got it right on a p e x

Please help!
Suppose you need to perform single molecule detection. You have a CCD that can give detectable signal with 10000 electrons in a well if all 532 wells in the column of the CCD array are summed. Assuming you have F2 optics for collection, throughput to the CCD is 70%, the quantum efficiency of the CCD is 0.90 for the wavelengths you are looking at (detector have their own quantum efficiencies), the dye molecule you are detecting has a quantum efficiency of 0.80 and fluorescence lifetime of 25 ns, how long would you need to collect data in order to obtain a signal that is detectable? Assume the laser you are using gives you amble photons for the experiment.

If you have a 25 micron spot size, what concentration of molecule do you need in solution to ensure you will see a single molecule in ~ 5 percent of your experiments?

Throughput to the CCD is how much light you get to the CCD after reflection and other loses due to optical components.

Answers

A charge-coupled device (CCD) is a component that receives an electrical charge and transmits it to the following area.

What is single molecule technique?A charge-coupled device (CCD) is a component that receives an electrical charge and transmits it to the following area.An electrical charge can be received and transferred via a charge-coupled device (CCD) to another area where it can be altered, such as transforming it to an electronic value.High-powered telescopes and CCD device image sensor cameras can be utilized in astronomy.Once the Earth's rotation synchronizes with the telescope, the imaging system can focus for a number of hours on a single location in space.

To learn more about CCD refer

https://brainly.com/question/13047592

#SPJ4

Which of the following characteristics was NOT included in Dmitri Mendeleev's periodic table?O distribution of elements determined by electron configurationO heavier elements placed in rows closer to the bottom of the tableO elements arranged by increasing atomic massO elements placed in columns based on chemical properties

Answers

Mendeleev's periodic table includes all the elements that were known at the time.

The rows of the table, were called periods and each period contained eight elements that increased in atomic mass from left to right.

The columns of the table, called groups, contained elements with similar properties.

The special this about this table was, the gaps for predicted elements were left.

In this question, we are given with four statements and are asked to determine, which of the following statement is not true regarding Dmitri Mendeleev's periodic table.

distribution of elements determined by electron configurationheavier elements placed in rows closer to the bottom of the tableelements arranged by increasing atomic masselements placed in columns based on chemical properties

Out of these four options, option number 1 is correct as the statement distribution of elements determined by electron configuration is not true regarding Mendeleev's periodic table.

To know more about  Mendeleev's periodic table:

brainly.com/question/11974961

#SPJ4

A block of aluminum occupies a volume of 13.8 mL and weighs 43.3 g.
What is its density? Give answer with one decimal.

Answers

Answer:

3.1g/mL

Explanation:

density = mass/volume

= 43.3/ 13.8

= 3.1g/mL

L
Apply Concepts
6. Look at the illustration. What causes
the phase change of water shown in
the illustration? How do you know?
Chapter 1,1anson 3 Check What are solids, liquids, and gases?

Answers

The phase change of water is water particle to evaporate forming water vapor

When water changes state in the water cycle and the total number of water particles remain the same and the changes of state include melting, sublimation, evaporation, freezing, condensation and deposition and heating the water in the first beaker causes the water particles to evaporate and forming water vapor and the particle are far apart and on a molecular level the intermolecular forces between the water molecule are decreasing and the heat is providing enough for the water molecule to overcome these attractive forces and all changes involve either an increase or decrease of intermolecular forces

Know more about phase change

https://brainly.com/question/2128466

#SPJ4

Help me out

On another planet, the isotopes of titanium have the given natural abundances.

Help me out On another planet, the isotopes of titanium have the given natural abundances.

Answers

The average atomic mass of titanium on the given planet is approximately 46.68164 atomic mass units (u). The average atomic mass may vary depending on the specific isotopic composition of titanium found on different celestial bodies or regions.

To calculate the average atomic mass of titanium on the given planet, we need to consider the natural abundances and masses of each isotope of titanium.

The average atomic mass is calculated by multiplying the natural abundance of each isotope by its respective mass and summing them up.

Let's perform the calculation step by step:

Step 1: Multiply the abundance of each isotope by its mass:

(73.700% * 45.95263 u) + (15.000% * 47.94795 u) + (11.300% * 49.94479 u)

Step 2: Calculate the individual contributions from each isotope:

= (0.737 * 45.95263) + (0.150 * 47.94795) + (0.113 * 49.94479)

Step 3: Add up the individual contributions:

= 33.84765431 + 7.1921925 + 5.64179347

Step 4: Sum up the contributions:

= 46.68164 u

Therefore, the average atomic mass of titanium on the given planet is approximately 46.68164 atomic mass units (u).

It's important to note that the calculation assumes the provided natural abundances are accurate and representative of the titanium isotopes on that planet.

for more questions on atomic mass

https://brainly.com/question/30390726

#SPJ8

Part D There is a structure for CH2CHCHCH2CHCH3 with a double bond between the first (from left to right) and the second carbons and a chlorine atom attached to the third and the fifth carbon. Spell out the full name of the compound.

Answers

Answer:

3,5-dichlorohex-1-ene

Explanation:

The compound is; H2C=CH-C(Cl)H-CH2-C(Cl)H-CH3. We can rightly call this compound by the name, 3,5-dichlorohex-1-ene.

We arrived at this name by first counting the longest parent carbon chain, that gives hexane. The compound has a double bond at the 1-position. Also, there are two substituent chlorine atoms at positions 3 and 5 in the structure, hence the name given.

a 425 ml sample of a gas is collected over water at 730 torr and 23 C degrees. What would the volume of the "dry" gas be at STP?

Answers

Answer:

so I can do it tomorrow

Explanation:

3(+7-(#679''78()

wag nyo na po pansinin yung nasa taas bwahahahaha

The constant pressure molar heat capacity of argon, C_{p,m}C

p,m



, is


20.79\text{ J K}^{-1}\text{ mol}^{-1}20.79 J K

−1

mol

−1

at 298\text{ K}298 K. What


will be the value of the constant volume molar heat capacity of argon,


C_{V,m}C

V,m



, at this temperature?

Answers

Answer:

Constant-volume molar heat capacity of argon is 12.47 J K ⁻¹mol⁻¹

Explanation:

Argon is a monoatomic gas that behaves as an ideal gas at 298K.

Using the first law of thermodinamics you can obtain:

Work, Q, for constant pressure molar heat capacity,CP:

CP = (5/2)R

For constant-volume molar heat capacity,CV:

CV = (3/2)R

That means:

2CP/5 = 2CV/3

3/5 = CV / CP

As CP of Argon is 20.79 J K ⁻¹mol⁻¹, CV will be:

3/5 = CV / CP

3/5 = CV / 20.79 J K ⁻¹mol⁻¹

12.47 J K ⁻¹mol⁻¹ = CV

Constant-volume molar heat capacity of argon is 12.47 J K ⁻¹mol⁻¹

Calculate the percent composition by mass of each element in LiClO3.

Answers

The percent composition of each element's mass in LiClO3 is as follows:

Percent Composition of Li =7.68%,

Percent Composition of Cl = 33.7%,

Percent Composition of O =53.1%.

Briefing:

It is necessary to know the molar masses of the constituent parts. We have:

Molar Mass Li = 6.94 grams per mole

Molar Mass Cl = 30.45 grams per mole

Molar Mass O = 16 grams per mole

Molar Mass LiClO3 = 90.39 grams per mole

Percent Composition of Li:

Utilizing the molar masses of Li and the specified compound:

%Li=6.94gmol90.39gmol×100

%Li =7.68%

Percent Composition of Cl:

Using the molar mass of Cl and the molar mass of the given compound

%Cl=30.45gmol90.39gmol×100

%Cl = 33.7%

Percent Composition of O:

Utilizing the molar masses of O and the specified compound:

%O=3×16gmol90.39gmol×100

%O =53.1%

To know more about Percent composition visit:

https://brainly.com/question/17505281

#SPJ9

How much NaAlO2 (sodium aluminate) is required to produce 2.59 kg of Na3AlF6?

Answers

839 g is the mass of sodium aluminate that is required to produce 2.59 kg of  Na₃AlF₆.

A body's mass is an inherent quality. Prior to the discoveries of the atom as well as particle physics, it was widely considered to be tied to the amount of material in a physical body.

It was discovered that, despite having the same quantity of matter in theory, different atoms and elementary particles have varied masses. There are various conceptions of mass in contemporary physics that are theoretically different but physically equivalent.

Moles of Na₃AlF₆ = 2150 × 1/209.94    

Moles of Na₃AlF₆ = 10.24 mol Na₃AlF₆

The molar ratio is 1 mol NaAlO₂:1 mol Na₃AlF₆

Moles of NaAlO₂ = 10.24 × 1/1 = 10.24 mol NaAlO₂

Mass of NaAlO₂ = 10.24 × 81.97          

Mass of NaAlO₂ = 839 g

To know more about mass, here:

https://brainly.com/question/19694949

#SPJ1

Other Questions
What benefits have been observed in children that learn to play music? consider the substitution reaction that takes place when (r)-3-bromo-3-methylhexane is treated with methanol.which of the following would be true? Is death a topic or theme?. placed an order for office supplies costing $2,000. supplier intends to deliver later in the month. purchased equipment that cost $30,000; paid $10,000 cash and signed a promissory note to pay $20,000 in one month. negotiated and signed a one-year bank loan, and then deposited $5,000 cash in the companys checking account. hired a new finance manager on the last day of the month. received an investment of $10,000 cash from the companys owners in exchange for issuing common shares. supplies [ordered in (a)] were received, along with a bill for $2,000. Given the following information, choose the brand that is the better buy. Brand A: $1. 25 for 10 ounces Brand B: $1. 47 for 12 ounces Brand C: $1. 68 for 14 ounces Brand D: $1. 84 for 16 ounces a. Brand A b. Brand B c. Brand C d. Brand D Please select the best answer from the choices provided A B C D. The key to political parties succeeding in the government is that they must be able to do what? A compromise C. control taxes 4/10x -2x + 6/5 = 4/5 Which of the following may not characterize an oligopoly?A. A few firmsB. No market powerC. High barriers to entryD. Substantial control over priceAnswer: B. No market power I need help with cumulative frequency pleaseee!! In the passage, how are the narrators and their parents points of view towards the tree different?AThe narrator and their parents are distracted by different aspects of the property, not the tree.BThe narrator is indifferent toward the tree while their parents are overwhelmed by it.CThe narrator is amazed by the tree but their parents quietly reflect on it.DThe narrator cannot convince their parents of the trees importance. Pea plant clones are given different amounts of water for a three week period.The first pea plant receives 400 mL each day. The second pea plant receives 200mL each day. The third pea plant receives 100mL each day. The fourth pea plantdoes not receive any extra water; the plant only receives natural ways ofreceiving water. The height of the pea plants is recorded daily. Identify theindependent variable. *i need to know a number internal controls ramona's clothing is a retail store specializing in women's clothing. the store has established a liberal return policy for the holiday season in order to encourage gift purchases. any item purchased during november and december may be returned through january 31, with a receipt, for cash or exchange. if the customer does not have a receipt, cash will still be refunded for any item under $75. if the item is more than $75, a check is mailed to the customer. whenever an item is returned, a store clerk completes a return slip, which the customer signs. the return slip is placed in a special box. the store manager visits the return counter approximately once every two hours to authorize the return slips. clerks are instructed to place the returned merchandise on the proper rack on the selling floor as soon as possible. this year, returns at ramona's have reached an all-time high. there are a large number of returns under $75 without receipts. a. how can sales clerks employed at ramona's clothing use the store's return policy to steal money from the cash register? b. what internal control weaknesses do you see in the return policy that make cash thefts easier? c. would issuing a store credit in place of a cash refund for all merchandise returned without a receipt reduce the possibility of theft? classify the following as either advantages or disadvantages of issuing a store credit in place of cash. a clerk could only issue a phony store credit rather than taking money from the cash register. the store would lose less revenue if customers had to choose other store merchandise instead of getting a cash refund. issuing only a store credit for returns without a receipt is a stricter return policy that may affect gift-givers' purchase decisions. The introspective technique developed by _____ requires one to be _____ conscious. After how many hours were there 4 inches of snow on the ground? Write a description about a person who has made a strong impression on you. Please, please, please help, it can be about anything, it doesn't really matter. I give Brainliest too, just help me please. Find the difference. Write your answer in simplest form.7/10 - 1/4 19/203/718/40but i choose 9/20 is that correct? Placing a Gram positive bacterial cell in a hypotonic environment will most likelyA. swell and lyse the cell.B. shrink and shrivel the cell.C. swell but not lyse the cell.D. have no effect on the cell which of the statements are true about the series an, where an [infinity]n=1 a?Statement A: If the ratio test is inconclusive, that means that the series [infinity]n=1 a diverges.Statement B: If lim n->[infinity] |a+1/a| is in the interval [-1, 1], then the series [infinity]n=1 a converges. while assisting a customer over the phone to connect a laptop to a new wireless router, the user suddenly reports it is connected. upon further inquiry into how the connection occurred, the user stated they pushed a circular button. analyze the situation and determine which button the user pressed, and how it functions. (select all that apply.) the use of cookies and tracking software is controversial because companies can collect information about consumers without their explicit permission.