Heres our final question.

1. Are all forms of conflict harmful to the organization? Why do you think so?

Answers

Answer 1

Answer:

Not all conflicts are harmful to an organization

Explanation:

Not all conflicts in an organization are harmful to that organization.

Conflicts can be good for an organization. Even though conflicts may always seem difficult, they could bring about growth and changes which are good for all organizations.

Conflict may have positive or negative results when they occur. How these conflicts are approached is what determines the result.

Positive conflict can be constructive, it births new ideas, gives opportunities for creativity and skills expansion and can solve continuous problems.


Related Questions

what describes the correct relationship between pressure and volume for a gas sample at constant temperature

Answers

Boyle's law states that, at a certain temperature, a gas's pressure and volume are inversely related, meaning that as the volume falls, the pressure rises and vice versa.

According to Boyle's law, is the pressure of a gas inversely proportional to its volume?

According to Boyle's law, the volume of the container has an inverse relationship to the gas's pressure. In other words, a big volume container will have low pressure, and a low volume container will have high pressure. Breathing is a biological example of how this law operates.

Does Boyles law V have an inverse proportion?

According to Boyle's law, a gas's pressure and volume are inversely proportional. When the temperature stays the same, pressure rises as volume rises and vice versa.

To know more about temperature visit:-

https://brainly.com/question/15354399

#SPJ1

What is the IUPAC-name for this thing? ​

What is the IUPAC-name for this thing?

Answers

The IUPAC name for the compound given in the question is 2,3-dibromo-5-methylheptane

How do i determine the IUPAC name for the compound?

The IUPAC name for compound can be obtained by using the following steps:

Locate the longest continuous carbon chain. In this case it is carbon 7. Hence, the parent name is heptaneIdentify the substituent groups attached. In this case the substituent groups attached are: Br and CH₃ Give the substituents the best possible low count. In this case, there are two Br groups located at carbon 2 and 3 while the CH₃ is located at carbon 5Combine the above to obtain the IUPAC name for the compound.

Thus, the IUPAC name for the compound is: 2,3-dibromo-5-methylheptane

Learn more about IUPAC name:

https://brainly.com/question/23881815

#SPJ1

The Sun has been shining on this swimming pool all day. The water is much warmer than it was in the morning. Describe what is happening to the water in terms of temperature, particle speed, and kinetic energy.

Answers

Answer:

The waters' temp increased

Explanation:

The temperature of the water in the swimming pool has increased due to the heat from the Sun. As a result, the particles in the water are moving faster and have a higher kinetic energy than in the morning.

if there are more products than reactants, does that mean there is an increase in the forward or backward reaction? And if there are more reactants that products, is there an increase in the forward or backward reaction?

Answers

Answer:

If there are more products than reactants, that means the reaction has shifted towards the left, which is the backward direction. If there are more reactants than products, that means the reaction has shifted towards the right, which is the forward direction.

What is Bond dissociation enthalpy?​

Answers

Answer:

The bond-dissociation energy is one measure of the strength of a chemical bond A−B. It can be defined as the standard enthalpy change when A−B is cleaved by homolysis to give fragments A and B, which are usually radical species

how many grams of NH3 formed from complete reaction of 4.5 moles of H2

Answers

The mass of the amonia that can be produced in the reaction is 51 g of ammonia.

What is the reaction equation?

We know that a reaction equation has to do with the ay in which there is the combination of the reactants and the products in the reaction. We know also that it is possible to be able to obtain the parameters in the reaction by the use of the stoichiometry of the reaction.

We would have to write down the reaction equation so that we can be able to apply the principles of stoichiometry as we try to solve the problems that have t do with the reaction equation in the problem.

The reaction equation can be written as; N2+3H2>2NH3. In the reaction equation it is clear that;

3 moles of hydrogen produced 2 moles of ammonia

4.5 moles of hydrogen would produce 4.5 * 2/3

= 3 moles

Mass of the ammonia = 3 moles * 17 g/mol

= 51 g of ammonia

Learn more about stoichiometry:https://brainly.com/question/9743981

#SPJ1

Calculate the pH when 90.0 mL of 0.200 M HBr is mixed with 30.0 mL of 0.400 M CH₃NH₂ (Kb = 4.4 × 10⁻⁴).

Answers

The pH of the solution is 10.82.

To solve this problem, we need to determine the concentration of the hydronium ion (H3O+) in the solution. This can be done using the following steps:

Write the balanced chemical equation for the reaction between HBr and CH₃NH₂.

HBr + CH₃NH₂ → CH₃NH₃⁺ + Br⁻

Write the expression for the base dissociation constant (Kb) for CH₃NH₂.

Kb = [CH₃NH₃⁺][OH⁻]/[CH₃NH₂]

Calculate the concentration of hydroxide ions (OH⁻) in the solution using the Kb value and the concentration of CH₃NH₂.

Kb = [CH₃NH₃⁺][OH⁻]/[CH₃NH₂]

4.4 × 10⁻⁴ = x² / (0.400 M)

x = 6.63 × 10⁻³ M

[OH⁻] = 6.63 × 10⁻³ M

Calculate the concentration of H3O+ using the equilibrium constant for the reaction between HBr and H2O.

HBr+H2O=H3O++Br

Bracket argument to \\ must be a dimension

Calculate the pH using the concentration of H3O+.

pH=log[H3O+]pH=log(1.511011)

pH = 10.82

For more question on pH click on

https://brainly.com/question/172153

#SPJ11

If 0.332 mol of zinc reacts with excess lead(IV) sulfate, how many grams of zinc sulfate will be produced in the reaction?

Answers

Answer:

53.6 g

Explanation:

Step 1: Write the balanced equation

2 Zn + Pb(SO₄)₂ ⇒ 2 ZnSO₄ + Pb

Step 2: Calculate the moles of ZnSO₄ produced from 0.332 moles of Zn

The molar ratio of Zn to ZnSO₄ is 2:2. The moles of ZnSO₄ produced are 2/2 × 0.0332 mol = 0.0332 mol.

Step 3: Calculate the mass corresponding to 0.332 moles of ZnSO₄

The molar mass of ZnSO₄ is 161.44 g/mol.

0.332 mol × 161.44 g/mol = 53.6 g

what is the strength of alloys and what is the solubility of alloys please answer this simple question within 12 hours will mark brainliest for sure

Answers

Answer:Features very high tensile strength and toughness. Titanium alloys are light in weight, have superior corrosion resistance properties and can withstand extreme temperatures. ... Titanium alloys are heat-treated to increase their strength in terms of fracture toughness, fatigue strength and high temperature strength.35 grams is the sollubility.

Explanation:

Complexes containing metals with d10 electron configurations are typically colorless because ________. Complexes containing metals with d10 electron configurations are typically colorless because ________. d electrons must be emitted by the complex in order for it to appear colored there are no d electrons to form bonds to ligands a complex must be charged to be colored there is no d electron that can be promoted via the absorption of visible light the empty d orbitals absorb all of the visible wavelengths

Answers

Answer:

there is no d electron that can be promoted via the absorption of visible light

Explanation:

One of the properties of transition elements is the possession of incompletely filled d orbitals. This property accounts for their unique colours.

The colours of transition metal compounds stem from d-d transition of electrons due to the presence of vacant d orbitals of appropriate energy to which electrons could be promoted.

For elements whose atoms have a d10 configuration, such vacant orbitals does not exist hence their compounds are not colored.

Sometimes, the colour of transition metal compounds stem from ligand to metal charge transfer(LMCT) for instance in KMnO4.

What is the volume in liters occupied by 3.25 moles of an ideal gas at a temperature of 18.00? R= 0.08205 L.atm/K.mol P= 1.13 atm

Answers

Considering the ideal gas law, the volume occupied by 3.25 moles of an ideal gas at a temperature of 18.00°C is 686.71 L.

Definition of ideal gas law

An ideal gas is the behavior of those gases whose molecules do not interact with each other and move randomly. Under normal conditions and under standard conditions, most gases exhibit ideal gas behavior.

An ideal gas is characterized by three state variables: absolute pressure (P), volume (V), and absolute temperature (T), related by a simple formula called the ideal gas law:

P×V = n×R×T

Where:

P is the gas pressure.V is the volume that occupies.T is its temperature.R is the ideal gas constant. The universal constant of ideal gases R has the same value for all gaseous substances. n is the number of moles of the gas.

Volume in this case

In this case, you know:

P= 1.13 atmV= ?T= 18 C= 291 K (being 0 C= 273 K)R= 0.8205 L.atm/K.moln= 3.25 mol

Replacing in the ideal gas law:

1.13 atm×V = 3.25 mol× 0.8205 L.atm/K.mol× 291 K

Solving:

V = (3.25 mol× 0.8205 L.atm/K.mol× 291 K)÷ 1.13 atm

V= 686.71 L

Finally, the volume is 686.71 L.

Learn more about ideal gas law:

https://brainly.com/question/4147359

#SPJ1

What would
happen to the
vultures if the
gazelle
decreased?

Answers

the vultures would eventually decrease also because the vultures feed off the dead gazelles

Answer:  If the gazelle population starts to decrease this could lead to some vultures not having enough food to eat

Explanation: This explains the obvious outcome of what would happen.

                     Hope you do well with what your doing :)

                                 Mark as Brainliest please :)

what is the thing aroud the nucisel

Answers

Answer:

Electrons

Explanation:

Assuming you are talking about the nucleus of an atom, the particles surrounding the nucleus are electrons.

Atoms consist of three subatomic particles: protons, neutrons, and electrons. Protons and neutrons are located within the nucleus, whereas the electrons exist outside of it.

What did James Cameron use on his 2nd visit to this famous ship to look inside?

Answers

Answer:

beneath the surface of the Pacific Ocean comes from samples and video collected by an unmanned lander,

what process formed slate

Answers

Answer:

Explanation:

Slate is a fine-grained, foliated metamorphic rock that is created by the alteration of shale or mudstone by low-grade regional metamorphism. It is popular for a wide variety of uses such as roofing, flooring, and flagging because of its durability and attractive appearance.

Answer:

Deep within the Earth's crust rocks can be put under huge pressures and temperatures are very high. These conditions can cause the minerals in the rock to change. This process is called metamorphism. Limestone can change into marble, shale and mudstones into slate, and igneous rocks like granite can turn into gneiss.

Explanation:

Slate is a fine-grained, foliated metamorphic rock that is created by the alteration of shale or mudstone by low-grade regional metamorphism. It is popular for a wide variety of uses such as roofing, flooring, and flagging because of its durability and attractive appearance.

Why is it important to have only one independent variable and to control the
other variables when performing science experiments

Answers

Scientists cannot pinpoint the changes or variations in the results to a single source when more than one variable is altered during an experiment. The outcomes can be attributed to the independent variable directly by examining and modifying each variable separately.

You can evaluate the outcomes of your experiment to determine how much one adjustment impacted the outcome by testing just one variable at a time. You won't be able to identify the variable that caused the outcome if you're testing two variables simultaneously. A controlled variable is one that is kept constant with the goal of not affecting how an experiment turns out. Controlling any factors that can affect an experiment's outcomes allows us to be certain that the altered variable is what caused our results.

Learn more about variables here-

https://brainly.com/question/17344045

#SPJ9

A student combined two solutions of clear liquids in a test tube, after one minute a solid substance appeared in the test tube. Based on their observations, can the students correctly conclude that a chemical reaction occurred?

Answers

Yes, the student can correctly conclude that a chemical reaction occurred based on their observations of the two clear liquids combining to form a solid substance in the test tube.

Balance each of the following chemical equations.
A) Mg(s)+Br2(l)→MgBr2(s)
Express your answer as a chemical equation. Identify all of the phases in your answer.
B) P4(s)+O2(g)→P4O10(s)
Express your answer as a chemical equation. Identify all of the phases in your answer.
C) Ba(OH)2(aq)+HNO3(aq)→Ba(NO3)2(aq)+H2O(l)
Express your answer as a chemical equation. Identify all of the phases in your answer.
D) Cr2O3(s)+C(s)→Cr(s)+CO(g)
Express your answer as a chemical equation. Identify all of the phases in your answer.

Answers

Answer:

Explanation:

The question states that the chemical equations should be balanced and the phases should also be indicated. The abbreviations of the phases have been indicated in the question with

i) (s) meaning the compound is in solid

ii) (aq) meaning the compound is in aqueous form

iii) (l) meaning the compound is in liquid

iv) (g) meaning the compound is in gaseous form

Balanced chemical equation is that in which the number of individual atoms on the reactant side is equivalent to the number of the same individual atoms on the product side.

Only the answer (the balanced chemical equations) will be written below.

A) This reaction is balanced

Mg(s) + Br₂(l) ⇒ MgBr₂(s)

B) P₄(s) + 5O₂(g) ⇒ P₄O₁₀ (s)

C) Ba(OH)₂(aq) + 2HNO₃(aq) ⇒ Ba(NO₃)₂(aq) + 2H₂O

D) Cr₂O₃(s) + 3C(s) ⇒ 2Cr(s) + 3CO(g)

Stephan’s mother cuts a twig from a rose bush and plants it in the soil. After a few days, Stephan observes a new plant growing. Which characteristic does the growth of the new plant depict?

Answers

The growth of the new plant depicts the asexual reproduction characteristic. The characteristic that describes the growth of the new plant in Stephan's mother cutting a twig from a rose bush and planting it in the soil is asexual reproduction.

Asexual reproduction is the mode of reproduction by which organisms generate offspring that are identical to the parent's without the fusion of gametes. Asexual reproduction is a type of reproduction in which the offspring is produced from a single parent.

The offspring created are clones of the parent plant, meaning they are identical to the parent.The new plant in Stephan’s mother cutting a twig from a rose bush and planting it in the soil depicts the process of asexual reproduction, which is the ability of a plant to reproduce without seeds. In asexual reproduction, plants can reproduce vegetatively by cloning themselves using their roots, bulbs, or stems.

Know more about    characteristic  here:

https://brainly.com/question/28790299

#SPJ8

Guysss how to explain nuclear chemistry? And define nuclear chemistry ?

Answers

Answer:

How do amoeba respire.

Define Diffusion.

Which example represents a point source of pollution?
O acid rain caused by exhaust from vehicles

O chemical runoff from lawns

O oil and gasoline discharged from cars

heated water released from a power plant

Answers

Answer:

It is pollution that comes from many places, all at once. The United States Environmental Protection Agency (EPA) defines point source pollution as any contaminant that enters the environment from an easily identified and confined place. Examples include smokestacks, discharge pipes, and drainage ditches

According to Coulomb's law, what will happen to the electric force between two identical negative charges as they move closer together?

Answers

Answer:

According to Coulomb’s law, the electric force between two identical negative charges is inversely proportional to the square of the distance between them. This means that as the distance between the two charges decreases, the electric force between them will increase. Since the charges are both negative, they will repel each other, so as they move closer together, the repulsive force between them will become stronger.

Explanation:

In general,for a gas at a constant volume?

Answers

Answer:

The pressure of a gas is directly proportional to its Kelvin temperature if the volume is kept constant. At constant volume and temperature, the total pressure exerted by a mixture of gases is equal to the sum of the partial pressures of the component gases.

Explanation:

Someone help!! Hurry

Someone help!! Hurry

Answers

Answer:

1. Circulatory

2. Respiratory

3. Skeletal

4. Muscular

5. Digestive

Answer:

he /she is right thats correct

Explanation:

toim diong it

Balance the equations by putting the necessary coefficients in the blanks. Normally we do not write 1s when balancing, but for this particular question you need to include them for full credit. __Na3N___ Na +__ N2 ___H3PO4 + __ KOH __K3PO4 + __ H2O __ N2 +__ H2 __ NH3 __H2O2 __ O2 + __ H2O __ Zn + __ HCl __ ZnCl2 + __H2 __ C2H6 + __ O2 __ CO2 + __H2O __ CuCl2 + __H2S __ CuS + __HCl

Balance the equations by putting the necessary coefficients in the blanks. Normally we do not write 1s

Answers

Balancing a chemical equation is the process of ensuring that the number of atoms of each element in the reactants is equal to the number of atoms of that same element in the products.

Balance the chemical eqations given in the problem?

Na3N → 3 Na + ½ N2H3PO4 + 3 KOH → K3PO4 + 3 H2ON2 + 3 H2 → 2 NH3H2O2 → O2 + 2 H2OZn + 2 HCl → ZnCl2 + H2C2H6 + 7/2 O2 → 2 CO2 + 3 H2OCuCl2 + H2S → CuS + 2 HCl

Chemical equations are used to describe the reactants and products in a chemical reaction. These equations are written using chemical formulas and symbols, indicating the types and numbers of atoms or molecules involved in the reaction. However, these equations must be balanced to obey the law of conservation of mass, which states that the total mass of the reactants must equal the total mass.

To learn more about chemical equation, visit: https://brainly.com/question/29886207

#SPJ1

A sample of carbon monoxide initially at 79.0 °C was heated to 158 °C. If the volume of the carbon monoxide sample is 990.4 mL at 158 °C , what was its volume at 79.0 °C?

Answers

Answer:

V₁ = 808.9mL

Explanation:

Based on Charles's law, the volume of a sample of gas is directely proportional to its absolute temperature. The formula is:

V1T1=V2T2

Where V is volume and T is absolute temperature of 1, initial state and 2, final state of the gas.

The initial state is:

V₁ = Our incognite

T₁ = 79°C + 273.15 = 352.15K

Final state is:

V₂ = 990.4mL

T₂ = 158°C + 273.15 = 431.15K

Replacing:

V1352.15K=990.4mL431.15K

V₁ = 808.9mL

Considering the Charles's Law,  the volume at 79 °C is 808.86 mL.

Charles's Law consists of the relationship that exists between the volume and the temperature of a certain quantity of ideal gas, which is maintained at a constant pressure.

This law says that for a given sum of gas at a constant pressure, as the temperature increases, the volume of the gas increases and as the temperature decreases, the volume of the gas decreases because the temperature is directly related to the energy of the movement they have the gas molecules.

In summary, Charles's law is a law that says that when the amount of gas and pressure are kept constant, the quotient that exists between the volume and the temperature will always have the same value:

VT=k

Studying two different states, an initial state 1 and a final state 2, it is satisfied:

V1T1=V2T2

In this case, you know:

V1= ?T1=79 C= 352 K (being 0 C= 273 K)V2= 990.4 mLT2= 158 C= 431 K

Replacing in Charles's law:

V1352K=990.4mL431K

Solving:

V1=990.4mL431Kx352K

V1=808.86 mL

Finally, the volume at 79 °C is 808.86 mL.

Learn more:

https://brainly.com/question/4147359?referrer=searchResultshttps://brainly.com/question/11442294

Calculate the free energy of formation of NaBr(s) given the following information: NaBr(s) → Na(s) + 1/2Br2(l), ∆G° = 349 kJ/mol

Answers

The given question is incomplete, the complete question is:

Calculate the free energy of formation of NaBr(s) given the following information: NaBr(s) → Na(s) + 1/2Br2(l), ΔG° = 349 kJ/mol

A) –309 kJ/mol

B) –329 kJ/mol

C) None of the above

D) –349 kJ/mol

E) –369 kJ/mol

Answer:

The correct answer is option D, that is, -349 kJ/mol.

Explanation:

Based on the given information, the reaction is:  

NaBr (s) ⇔ Na (s) + 1/2 Br₂ (l), the ΔG° of the reaction given is 349 kJ per mole. In the given question, it is clearly mentioned that there is a need to determine the free energy of the formation of NaBr. Thus, there is a need to keep Na (s) and Br₂ (l) at the reactant side and NaBr (s) at the product side.  

Therefore, there is a need to reverse the reaction and change the sign on ΔG.  

Now the reaction will become,  

Na (s) + 1/2 Br₂ (l) ⇔ NaBr (s), and the ΔG° will now become -349 kJ per mole. Hence, -349 kJ per mole is the free energy of the formation of NaBr (s).  

a. Identify the structures shown in the diagram. b. Identify the information that is contained within these structures. c. Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person. d. Explain why the structures are in pairs.

Answers

The answer responses to  the structures shown in the diagram are:

A. chromosomes

C. They would be the same.

B. They are in pairs because each one comes from a different parent.

What is the structure about?

The chromosomes are in pairs because humans have a diploid number of chromosomes, meaning they have two sets of chromosomes, one inherited from each parent.

The nucleus is important in eukaryotic cells and has many important parts that help the cell work properly. There are some parts inside cells called the nuclear membrane, nucleoplasm, nucleolus, and chromatin. Chromatin is made up of DNA and other proteins.

Every part of a person's body has the same genes, but the way they are organized can be different in different types of cells. The chromosomes in our skin cells might not be the same as the chromosomes in our muscle cells, even if they come from the same person.

Learn more about  nucleus from

https://brainly.com/question/9376695

#SPJ1

Identify the structures shown.

A. chromosomes

B. mitochondria

C. nuclei

D. vacuoles

C

Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person.

A. There would be longer.

B. They would be shorter.

C. They would be the same.

D. They would be different.

Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person.

A. There would be longer.

B. They would be shorter.

C. They would be the same.

D. They would be different.

Explain why the structures are in pairs.

A. They aren't in pairs.

B. They are in pairs because each one comes from a different parent.

C. This cell is making a copy of itself.

D. The cell always has 2 copies in case 1 is damaged.

Give the electron configuration using the crystal field theory of the following complexes and show your configuration in the the crystal field diagram (N.B calculate the oxidation number of metals 1st).
1. [Co(NH3)5Cl]Br2
2. Na3[Fe(CN)6]​

Answers

The oxidation number of the cobalt is +2 while the oxidation number of iron is +3.

What is the crystal field theory?

According to the crystal filed theory, the ligands serve as point charges and when they are introduced to the symmetrical octahedral crystal field, the field splits and the there is a barry center with electrons that are above and below the barry center depending on their energy.

Hence, we can see that cobalt II ion is a d7 specie with electron configuration; 1s22s22p63s23p63d7. The iron III ion is a d5 specie having electron configuration1s22s22p63s23p63d5. The oxidation number of the cobalt is +2 while the oxidation number of iron is +3.

The crystal field diagram of each of the ions is shown in the image attached.

Learn more about crystal field theory :https://brainly.com/question/23840749

#SPJ1

Give the electron configuration using the crystal field theory of the following complexes and show your

What is the oxidation state of N in NaNOz?

What is the oxidation state of N in NaNOz?

Answers

The oxidation state of nitrogen (N) in NaNO3 is +5. option B

To determine the oxidation state of nitrogen (N) in sodium nitrate (NaNO3), we need to assign oxidation numbers to each element in the compound.

In NaNO3, we know that the sodium ion (Na+) has a +1 oxidation state because it is an alkali metal. Oxygen (O) typically has an oxidation state of -2 in compounds, and there are three oxygen atoms in NaNO3. Since the compound is neutral, the sum of the oxidation states must be zero.

Let's assume that the oxidation state of nitrogen is x. Therefore, we can set up the equation:

(+1) + x + (-2) * 3 = 0

Simplifying the equation:

+1 + x - 6 = 0

x - 5 = 0

x = +5

Therefore, the oxidation state of nitrogen (N) in NaNO3 is +5.

The oxidation state of an element indicates the number of electrons it has gained or lost in a compound. In this case, the nitrogen atom in NaNO3 has gained five electrons to achieve a stable oxidation state of +5.

It is important to note that oxidation states are formal charges and do not necessarily represent the actual distribution of electrons in a compound. They are assigned based on a set of rules and can be useful in understanding the reactivity and behavior of elements in chemical reactions.

Option B

For more such questions on oxidation state visit:

https://brainly.com/question/25551544

#SPJ8

Other Questions
Calculate $0^5 + (-1)^4$. we will eventually see using the theory of taylor series that can be computed using an infinite series: which convergence test shows that the series does in fact converge? The variance of a portfolio of risky securities Multiple Choice is the weighted sum of the securities' variances and covariances. is the sum of the securities' variances. is a weighted sum of the securities' variances. is the sum of the securities' covariances. None of the options are correct. Alek is taking an inventory of styles of compression bandages for work. Here is the data he has collected. a landscaper is designing a park in the shape of a kite with a fountain in the center, F. AK = 28 ft, PF=48 ft and F=32 ft. He wants to install a walkway around the border of the park. The inside edge of the walkway will be edged with brick. The bricks are purchased in linear feet. How many linear feet of bricks should he purchaase? 4. (10 Points) Name five different considerations for selecting construction materials and methods and provide a short explanation for each of them. Strawberries can reproduce by means of runners, which are stems that grow horizontally along the ground. At a point where a runner touches the grounds a new plant can develop. Why are the new plants genetically identical to the parent plant?Question 14 options:The nuclei traveled to the new plant through the runnerThe new plant was produced asexuallyOther strawberry plants in the area fertilized the runnerAll new cells came from the mutated parent cells What do state laws typically require when reporting abuse and neglect of children? What issues may the one face when handling the health records of these patients?What exception does required reporting fall under in the HIPAA Privacy regulations?Does the fact that a facility reports personally identifiable information about a patient through the required reporting process need to be included in the notice of privacy practices?Do required reporting disclosures have to be included in the accounting of disclosures? If so, what are the options to do so? If not, what law or regulation provides this exception?Is patient authorization needed when a facility reports information required by state or federal law? Is the information received by the state a public record in most cases? solve for unknown in 2x^3+6x^2-20x=0 3. Answer the followings.a) What is a business?b) What is a public sector?c) What are public goods? Give examples.d) What are merit goods? Give examples.e) What are public services? Give examples.f) Give examples of private sector organizations.g) Give examples of the public sector organizations. List synonyms with a positive and negative connotation for each of the words below. An example is listed for you. EX: Woman Neg: broad Pos: lady 1. Child 2. Home 3. Lawyer 4. Policeman 5. Rich 6. Poor 7. Boss 8. Car 1 The way in which federal and state governments respond to public opinion is based on _____. Please helpWhich of the following best describes a group of similar cells working on a specific task?Choose 1 answer:(Choice A)AOrgan level(Choice B)BOrgan system level(Choice C)CCell level(Choice D)DTissue level pour up drankfinish it hhugill j. a., system for stripping and rectifying a fluid mixture, international patent no. 19 wo 03/011418 a1, 2003. What is the area of Figure ABCD?A trapezoid ABCD is drawn with length of parallel sides AB and CD equal to 13 inches and 17 inches, respectively. The length of one of the non-parallel sides BC is 8 inches. Side BC is perpendicular to DC. A perpendicular line drawn from A to side CD meets CD at E.(1 point)104 square inches120 square inches136 square inches168 square inchesplease help me 10 brainlies to the first one to answerbtw you need 2 answers to give brainlies At constant pressure which of these systems do work on the surroundings? Check all that apply.a. A(g) + B(g) C (g)b. 2A (g) + B(g) C (g)c. A (g) + B(g) 3C (g)d. A(s) + B(g) 2C(g) Determine which equations you would use to solve the following problem: Calculate the amount of heat needed to change 20.0 g of ice at -10.0C to water at 89.0C. What is the function of the glomerulus and the bowmans capsule ? Which statement about water is not correct? A A water molecule consists of three atoms covalently bonded together. B The water supply is treated with chlorine to kill the bacteria in it. C Water changes the colour of cobalt chloride paper from blue to pink. D Water has a low melting point because covalent bonds are weak.