Here is an equation 2(x + 9) = -15. What are three different equations that have the same solution as that equation? Show or explain how you found them Please

Answers

Answer 1

Answer: 1) 2x+18=-15

2) -33+18

Step-by-step explanation: 1) multiply the outer number by the numbers inside the parentheses : 2 times x would = 2 because x is not by itself so it would be X=1x and you are multiplying 2x1 which = 2 and add the variable x so it would be 2×, and same with 18, you multiply 9x2 which =18 and thats how i got 2x+18 doesnt matter if i havent found the x yet because we already know what it equals to which is -15... 2) X=16.5 so to check we do 2×-16.5 which = -33 and add 18 it = -15

(IM NOT SURE ABOUT THE THRID ONE )

Here Is An Equation 2(x + 9) = -15. What Are Three Different Equations That Have The Same Solution As

Related Questions

Louise is planning to renovate her house. She intends to spend no more than $30 000. She has
$20 000 to invest in an account that pay 4.28% compounded monthly. How long will it take
Louise to meet her goal? Show your work. Round your answer to the nearest tenth of a year.

Answers

Answer:

Step-by-step explanation:

To determine how long it will take for Louise to reach her goal of $30,000, we can use the formula for compound interest:

A = P * (1 + r/n)^(nt)

where:

A is the amount of money Louise will have after "t" years,

P is the initial investment of $20,000,

r is the annual interest rate of 4.28%,

n is the number of times the interest is compounded per year (12 times per year), and

t is the number of years.

We can rearrange this formula to solve for t:

t = (log(A/P)) / (log(1 + r/n))

Plugging in the values:

t = (log(30000/20000)) / (log(1 + (0.0428/12)))

t = 5.97 years

Rounding to the nearest tenth of a year, Louise will need to wait 6.0 years in order to reach her goal of $30,000.

marla earns an annual salary of $28,000 at her new job. She received a 3% salary increase every year. Find Marla’s total earnings over the course of her first five years working at her job.

Answers

ANSWER:

$148,655.8

STEP-BY-STEP EXPLANATION:

Given:

Original salary = $28,000

Increase per year = 3%

The sum of all the earnings would be the sum of the original salary, the salary after 1 year, the salary after 2 years, the salary after 3 years and the salary after 4 years.

The salary in each year is calculated by multiplying the original salary by the increase raised after n years, just like this:

sn=28000(1+3%)nsn=28000(1+0.03)nsn=28000(1.03)n

Therefore, the total earnings would be as follows:

t=28000+28000(1.03)1+28000(1.03)2+28000(1.03)3+28000(1.03)4t=28000+28840+29705.2+30596.4+31514.2t=148655.8

Therefore, the earnings in the first 5 years of MARla is $148,655.8

In a kite ABCD, AB=AD and BC=DC. If <A = 80 degree and <C = 40 degree. Find <B and <D.​

Answers

Answer:

80627383(393939(37262683939

_____________are the most powerful computers at any given time, but are built especially for assignments that require arithmetic speed.

Answers

Supercomputers are the most powerful computers at any given time, but are built especially for assignments that require arithmetic speed.

The supercomputers, which are the most advanced and high-performance computers available, are specifically constructed to handle assignments that demand rapid arithmetic processing.

These machines are optimized for executing complex mathematical operations and simulations, enabling them to tackle problems that require immense computational power.

By harnessing parallel processing, massive memory capacities, and specialized architectures, supercomputers excel in solving scientific, engineering, and research challenges that necessitate exceptional arithmetic speed.

Their capabilities contribute to advancements in various fields, including weather forecasting, molecular modeling, astrophysics, and cryptography.

For more questions like Supercomputers click the link below:

https://brainly.com/question/30227199

#SPJ11

a basketball player makes 80% of her free throws. what is the standard deviation of the successes from 100 free throws?

Answers

Since 80 out of 100 free throws were successful, the standard deviation of the success rate would be 8, and the standard deviation of a binomial distribution is the square root of (p*q)/n, where p is the probability of success, q is the probability of failure (1-p), and n is the total number of trials.

Standard deviation is calculated as follows:

p*q/n = 0.8*0.2/100 = 0.0016 = 0.04 = 8

Since 80% of 100 equals 80 successful free throws, the standard deviation of the successes from 100 free throws would be 8. The dispersion in a set of data is measured by standard deviation. A binomial distribution's standard deviation is equal to the square root of (p*q)/n, where p is the success probability, q is the failure probability (1-p), and n is the number of trials. Since the success rate in this instance is 80%, p = 0.8, q = 0.2, and n = 100. The standard deviation is then equal to the square root of (p*q/n): (0.8*0.2/100) = (0.0016) = (0.04), which equals 8. Therefore, the standard deviation of the successes from 100 free throws for a basketball player who makes 80% of them would be 8.

Learn more about probability here

https://brainly.com/question/11234923

#SPJ4

Solve for x. PLZ HELP ASAP!!!

Solve for x. PLZ HELP ASAP!!!

Answers

X is a vertical angle to the angle marked as 100 degrees.

Vertical angles are the same so x = 100 degrees

Answer: 100 degrees

A traditional children’s riddle concerns a farmer who
is traveling with a sack of rye, a goose, and a mischievous dog.
The farmer comes to a river that he must cross from east to west. A
boat is ava

Answers

The riddle mentioned in the question is about a farmer who is traveling along with a sack of rye, a goose, and a mischievous dog.

He comes to a river that he must cross from east to west, and there is a boat available to do so.  Therefore, the farmer takes the goose back to the east side and leaves it there. He then takes the sack of rye across the river, drops it off with the dog, and goes back to the east side to pick up the goose. In this manner, all of the farmer's possessions can be safely transported across the river without any of them being lost to the dog or the goose.This riddle is a classic example of a type of logical puzzle known as a "transport problem."

The goal of a transport problem is to determine how to transport one or more objects from one location to another while satisfying certain constraints, such as the size of the transport vehicle or the safety of the objects being transported.

To know more about riddle visit:

brainly.com/question/10914267

#SPJ11

what is perpindulular?

Answers

Answer:

Perpindicular is when two lines cross to form a 90 degree angle

Step-by-step explanation:

PLS HELP ASAP


Rory earned an 84% on his test. He answered 21 questions correctly. How many total questions were on the test? Round to the nearest tenth if necessary.

Answers

Answer:

mmjnzsdkjsnfjsn jkxxvcd

Step-by-step explanation:

,mcnb m,cfv bmn vjmkn cvfjk

In a restaurant there are
8 starter dishes
15 main dishes
9 dessert dishes
Jane is going to choose one of the following combinations for her meal.
a starter dish and a main dish
or a main dish and a dessert dish
or a starter dish, a main dish and a dessert dish
How many different ways are there for her to choose the meal?

Answers

Answer:

there are 276 + 276 + 5680 = 6232 different ways for Jane to choose her meal.

Step-by-step explanation:

First, we need to find the number of different combinations of a starter dish and a main dish. This is simply the number of combinations of 2 items from 8 starters and 15 main dishes, which can be calculated using the formula for combinations:

C(8 + 15, 2) = C(23, 2) = (23 * 22) / (2 * 1) = 276

Similarly, the number of different combinations of a main dish and a dessert dish is:

C(15 + 9, 2) = C(24, 2) = (24 * 23) / (2 * 1) = 276

Finally, the number of different combinations of a starter dish, a main dish, and a dessert dish is:

C(8 + 15 + 9, 3) = C(32, 3) = (32 * 31 * 30) / (3 * 2 * 1) = 5680

In total, there are 276 + 276 + 5680 = 6232 different ways for Jane to choose her meal.

which term of the A.P 21,42,63,84.......is 210​

Answers

Answer:

T₁₀

Step-by-step explanation:

We know the first term is 21, which is a

We work out the difference by taking 21 away from 42 which equals 21.

We then use the general formula:

Tₓ = a + (x-1)(d)

We need to find the term which equals 210

210 = 21 + (x - 1)(21)

210 = 21 - 21 + 21x

210 = 21x

x = 10

Hence it is the 10 term when the thing equals 210.

Phil buys a notepad from the school store for 75 cents he pays with 1 dollar how many different ways can Phil get money back

Answers

The number of ways that there is for Phil to get his money back is of:

Four ways.

How can Phil get his money back?

The amount that Phil paid is of:

$1.

The total cost of the product is of:

$0.75.

Hence the change that Phil has to receive is of:

1 - 0.75 = $0.25.

The types of coins are given as follows:

$0.05 coin.$0.1 coin.$0.25 coin.

With only five cent coins, there is one outcome, which is given by:

25/5 = 5 five cent coins.

With five and ten cent coins, there are two outcomes.

One ten cent coin and 15/5 = 3 five cent coins.Two ten cent coins and 5/5 = one five cent coin.

The fourth and final way for Phil to get his money back is with a single quarter, that is, a single $0.25 coin.

More can be learned about types of coins at https://brainly.com/question/24342899

#SPJ1

what is $20.00 take away $4.60

Answers

$20.00 take away $4.60 is equal to $15.40.


ABCD is rhombous wi4h M(<ADC)=135 find m(<BAD) and m(<ADC)​

ABCD is rhombous wi4h M(&lt;ADC)=135 find m(&lt;BAD) and m(&lt;ADC)

Answers

In the given figure of Rhombus, Angle ∠BAD is 0°. In summary: angle ∠ABC = 135°

angle ∠ADC = 135°

angle ∠BAD = 0°

What is rhombus?

A rhombus is a quadrilateral (four-sided) geometric shape with equal-length sides. Since it has two sets of opposite equal acute angles and opposite equal obtuse angles, it is also known as a diamond form. In other words, the opposite angles and the neighbouring sides of a rhombus are congruent. A rhombus has two equal-length diagonals that are right angles to one another. A rhombus's area is equal to the product of its diagonal lengths.

by the question.

In a rhombus, opposite angles are equal, so we know that:

angle ∠ABC = angle ∠ADC (opposite angles of rhombus)

angle ∠BCD = angle ∠BAD (opposite angles of rhombus)

We are given that angle ∠ADC is 135°. Therefore, angle ∠ABC is also 135°.

To find angle ∠BAD, we can use the fact that the angles of a quadrilateral sum to 360°. Since we know three of the angles (∠ABC, ∠BCD, and ∠ADC), we can find the fourth angle (∠BAD) by subtracting their sum from 360°:

∠BAD = 360° - (∠ABC + ∠BCD + ∠ADC)

= 360° - (135° + 90° + 135°)

= 360° - 360°

= 0°

To learn more about rhombus on:

brainly.com/question/27870968

#SPJ1

How many sides does a pentagon have?
A. 2
B. 5
C. 6
D. 7

Answers

The geometric form known as a pentagon has five sides and five angles.

What is pentagon?The geometric form known as a pentagon has five sides and five angles. Penta here means five, and gon means angle. One of the several kinds of polygons is the pentagon. A regular pentagon's internal angles add up to 540 degrees.Any five-sided polygon or 5-gon is referred to as a pentagon in geometry. In a straightforward pentagon, the interior angles add up to 540°. A pentagon might be straightforward or self-intersect. A pentagram is a regular pentagon that self-intersects.A pentagon is a 2D polygon with five sides and five angles. The term "pentagon" is created by combining the Greek words "penta" (which means "five") and "gon," which means "angles."

To learn more about pentagon refer to:

https://brainly.com/question/25917702

#SPJ4

(q5) Which of the following is the area of the surface obtained by rotating the curve
, about the x-axis?

(q5) Which of the following is the area of the surface obtained by rotating the curve , about the x-axis?

Answers

The given curve is y = x³ − 2x and it has to be rotated about the x-axis to find the area of the surface. The formula to find the surface area of a curve obtained by rotating about the x-axis is given by:A=2πaby1+(dydx)2dxDifferentiating the curve with respect to x, we get:y=x32xdydx=3x22Now, squaring it, we get:(dydx)2=9x412x2+41+(dydx)2=1+9x412x2+4=9x412x2+5Putting the values in the formula, we get:A=2πaby1+(dydx)2dx=2π12(x32x)9x412x2+5dxSimplifying it further, we get:A=2π12(x32x)(3x21)2+4dx=2π12(x32x)9x46x2+5dxNow, substituting $9x^4 - 6x^2 + 5 = t^2$, we get:(18x312x)dx=tdt(3x22)dx=tdt3When $x = -1$, $t = \sqrt{20}$ and when $x = 2$, $t = 5\sqrt{5}$Substituting the values in the formula, we get:A=2π2055t227dt=28π27[t3]2055=28π27[1255202055+220]=28π27[12051820]=56π27[305920]=56π27[305185]=56π27125=2245π/3Therefore, the area of the surface obtained by rotating the curve $y = x^3 - 2x$ about the x-axis is $\boxed{224\sqrt{5}\pi/3}$.

For more questions on: surface area

https://brainly.com/question/16519513

#SPJ8

The total area of the regions between the curves is 1.134π square units

Calculating the total area of the regions between the curves

From the question, we have the following parameters that can be used in our computation:

x = ∛y

We have the interval to be

0 ≤ y ≤ 1

The area of the regions between the curves is then calculated using

A=2πbaf(x)1+(dy/dx)2dx

From x = ∛y, we have

y = x³

Differentiate

dy/dx = 3x²

So, the area becomes

A=2π01x31+(3x2)2dx

Expand

\(A =2\pi \int\limits^1_0 {x^3 * \sqrt{1 + 9x^4 } \, dx\)

Integrate

\limits is allowed only on operators

Expand

A=2π[(9(1)4+1)3254(9(0)4+1)3254]

This gives

A = 2π * 0.5671

Evaluate the products

A = 1.1342π

Approximate

A = 1.134π

Hence, the total area of the regions between the curves is 1.134π square units

Read more about area at

brainly.com/question/15122151

#SPJ1

help me plz I need it? I'm very desperate

help me plz I need it? I'm very desperate

Answers

Answer:

Is it 5/8

Step-by-step explanation:

Because there are 7 shapes in total and are 5 blue shapes so the probablit that a blue shape is to get picked is 5 out of 7

Step-by-step explanation:

1st draw

Probability of drawing a blue card = ⅝

2nd draw

Probability of drawing another blue card = 4/8= ½

(Remember a blue card has already been drawn)

Probability of drawing two blue cards = ⅝ × ½

= 5/16

Number that belongs in the green box = 5

Pls mark my answer as brainliest

a hexagon is graphed ona coordinate grid then translated 7 units to the right and 9 units down. if one of the vertices of the origanal hexgon is located at (-6,6), what is the ordered pair of this vertex of the new hexagon after the translation

Answers

If the graph is translated 7 units to the right and 9 units down , then ordered pair after the translation is (1,-3) .

in the question ,

it is given that

the the hexagon on the coordinate plane is Translated

7 units to the right and

9 units down .

So , on moving the point (-6,6) , 7 units to the right

7 is added to the x coordinate .

hence point is (-6+7,6) = (1,6)

on translating (1,6) , 9 units down

we subtract 6 from the y-coordinate .

the point is (1,6-9) = (1,-3) .

Therefore , If the graph is translated 7 units to the right and 9 units down , then ordered pair after the translation is (1,-3) .

Learn more about Translation here

https://brainly.com/question/10169402

#SPJ1

Find the perimeter of DEF, if DEF~CBF. The perimeter of CBF= 27, DF =6, and FC =8.

Answers

We can conclude that the perimeter of DEF is 20.25.

Given that DEF~CBF, DF = 6, and FC = 8.

We are supposed to find the perimeter of DEF.

To solve this question, we need to know that when two triangles are similar, the ratio of their corresponding sides are in proportion.

Using this information, we can say that the ratio of the perimeters of two similar triangles is equal to the ratio of their corresponding sides.

Therefore, we can use the following proportion to find the perimeter of DEF and CBF:

Perimeter of DEF/Perimeter of

CBF=DF/FC

= 6/8

= 3/4

Let P be the perimeter of DEF.

Using the above proportion, we can write:

Perimeter of DEF = (DF/FC) × Perimeter of CBF

= (3/4) × 27

= 20.25

To know more about perimeters visit:

https://brainly.com/question/7486523

#SPJ11

Given the joint density function of random variables x and y as: fxy(x,y) = u(x).u(y).x.e-x(y+1), (1, x ≥ 0 10, x < 0³ where u(x) = (1, x ≥ 0 10, x < 0³ and u(y)

a. Find the marginal density functions f(x) and fy(y).
b. Find the conditional density function fy(ylx).
c. Determine whether or not the random variables x and y are statistically independent. Verify your answer.

Answers

a. The marginal density function f(x) is 0.

b. The marginal density function f(y) is f(y) = u(y)/(y+1).

c. Variabel x and y are not statistically independent.

a. To find the marginal density functions f(x) and f(y), we integrate the joint density function fxy(x, y) over the respective variables:

For f(x):

f(x) = ∫fxy(x, y) dy

= ∫u(x).u(y).x.e^(-x(y+1)) dy

= x.e^(-x) ∫u(x) dy (since u(y) = 1 for all y)

= x.e^(-x) [y] (from 1 to ∞) (since ∫u(x) dy = y for y ≥ 1)

= x.e^(-x) ∞

= 0

Therefore, the marginal density function f(x) is 0.

For f(y):

f(y) = ∫fxy(x, y) dx

= ∫u(x).u(y).x.e^(-x(y+1)) dx

= u(y) ∫x.e^(-x(y+1)) dx (since u(x) = 1 for all x)

= u(y) [(-x)e^(-x(y+1)) - ∫(-e^(-x(y+1))) dx] (by integration by parts)

= u(y) [(-x)e^(-x(y+1)) + (1/y+1)e^(-x(y+1))] (from 0 to ∞)

= u(y) (0 - 0 + (1/y+1)e^(-∞(y+1)) - (1/y+1)e^(-0(y+1)))

= u(y) (0 + 0 - 0 + 1/(y+1))

Therefore, the marginal density function f(y) is f(y) = u(y)/(y+1).

b. To find the conditional density function fy(ylx), we use the formula for conditional density:

fy(ylx) = fxy(x, y)/f(x)

Since f(x) = 0 (as found in part a), the conditional density function fy(ylx) is undefined.

c. To determine whether x and y are statistically independent, we check if the joint density function factors into the product of the marginal density functions:

If fxy(x, y) = f(x) * f(y), then x and y are statistically independent.

In this case, f(x) = 0 and f(y) = u(y)/(y+1). Since fxy(x, y) does not factor into the product of f(x) and f(y), x and y are not statistically independent.

Note: The condition u(x) = 1 for x ≥ 0 and u(x) = 0 for x < 0 is unusual and seems to have an error in the given question. Typically, the unit step function (u(x)) is defined as u(x) = 1 for x ≥ 0 and u(x) = 0 for x < 0.

To learn more about marginal density function from the given link

brainly.com/question/15109814

#SPJ11

felicias bill at the restaurant was $19.She left a tip of %20. what was the tip amount rounded to the nearest 10?What was the total bill?​

Answers

20 o más de la población lo necesitan es muy recomendable

example: determine a basis and the dimension of the subspace s in v4 over z2 consisting of vectors: (0 0 0 0) (1 1 0 0) (1 0 1 0) (0 0 0 1) (0 1 1 0) (1 1 0 1) (1 0 1 1) (0 1 1 1)

Answers

The basis of the subspace S in V4 over Z2 consists of the vectors: (1 1 0 0), (0 1 1 0), (1 0 1 1). The dimension of the subspace S is 3.

To determine a basis for the subspace S, we need to find a set of vectors that are linearly independent and span the subspace. The given vectors in the subspace S are: (0 0 0 0), (1 1 0 0), (1 0 1 0), (0 0 0 1), (0 1 1 0), (1 1 0 1), (1 0 1 1), (0 1 1 1).

We can observe that the first vector (0 0 0 0) is the zero vector, which is not useful for spanning the subspace. However, the other seven vectors are linearly independent and span the subspace S. By removing the redundant vectors and keeping only the linearly independent ones, we obtain the basis for S: (1 1 0 0), (0 1 1 0), (1 0 1 1).

The dimension of a subspace is defined as the number of vectors in its basis. In this case, the basis for S consists of three vectors, so the dimension of S is 3.

Therefore, the basis of the subspace S is {(1 1 0 0), (0 1 1 0), (1 0 1 1)}, and the dimension of S is 3.

To learn more about subspace  click here

brainly.com/question/26727539

#SPJ11

I only have a few minutes. Help? 40 points

I only have a few minutes. Help? 40 points

Answers

Step-by-step explanation:

<R and <T are vertical angles.

<U and. <Z are corresponding angles.

<S and <Z are alternate exterior angles.

<T and <W are alternate interior angles.

Hope it will help :)

Jamal uses the line of best fit y = 700x + 38,000 to predict his annual salary, y, after x years.

What is the y-intercept of the line of best fit and what is the meaning of the y-intercept?

Answers

The y intercept should be 38,000

y=mx+b

B, the last variable is the y-intercept.

The y-intercept is n intercept is a point on the y-axis, through which the slope of the line passes and the y-intercept of the given equation is 38,000.

What is a y-intercept?

In Maths, an intercept is a point on the y-axis, through which the slope of the line passes. It is the y-coordinate of a point where a straight line or a curve intersects the y-axis. This is represented when we write the equation for a line, y = mx+c, where m is slope and c is the y-intercept.

The given equation is y=700x+38,000 to predict his annual salary, y, after x years.

In the given equation, y-intercept is 38,000.

Therefore, the y-intercept is n intercept is a point on the y-axis, through which the slope of the line passes and the y-intercept of the given equation is 38,000.

To learn more about the y-intercept visit:

brainly.com/question/14180189.

#SPJ2

Which is equivalent to -9.4c + 6 + c – 5.9?
A. -8.4c – 0.1
B. -8.4c + 0.1
C. 10.4c + 0.1
D. -10.4c + 0.1

Answers

Answer:

B

Step-by-step explanation:

reorganize to combine like terms

-9.4c+c   or   c-9.4c  (they are the same)  = -8.4c

6-5.9=0.1

-8.4c+0.1

Answer:

c

Step-by-step explanation:

brcause i have did it

5) Explain in your own words what is meant by the son of a mention Include a practical example of a differential equation used to model wito your specific engineering course நmata) b) Solve the following first order differential equation using the integrating factor method. dy cos(t) + sin(t) y = 3cos (t) sin(t) - 2 dx [10 marks) c) Explain the following MATLAB code shown and sketch the output plot from program 19 marks) 01 t=0 02 while t<10 03 if (t<5) 04 y=3*(1-exp(-)): 05 else if (t>=5) 06 y=3*exp(-t+5); 07 end 08 end 09 t = t + 0.05 10 pause (0.002) + Figure Q4 Q4 Total

Answers

The output of this code will be a signal that starts at zero and gradually increases to three. After five seconds, the signal starts decreasing to zero, with an exponential decay rate. The output plot will look like a ramp that rises linearly and falls exponentially after five seconds.

The term "son of a mention" is not familiar in mathematics. The correct term might be "son of a gun" or "son of a function."A differential equation used to model your specific engineering course is called an engineering differential equation. Such equations are used to predict, control, and monitor various physical processes, ranging from the dynamics of mechanical systems to the motion of fluids and gases, and electrical and electronic circuits. It's essential to know the form of the differential equations, the initial and boundary conditions, and the physical meaning of the parameters to use them effectively in modeling physical systems.

The following MATLAB code represents a simple for loop with a nested if-else statement and a plotting command. The code generates a signal with two segments: a rising ramp from zero to three and a falling ramp from three to zero. The signal has a total duration of 10 seconds, a sampling interval of 0.05 seconds, and a plotting delay of 0.002 seconds.

01 t=0 02 while t<10 03

if

(t<5) 04 y=3*(1-exp(-t)); 05 else if

(t>=5) 06 y=3*exp(-t+5); 07 ends 08 end 09

t = t + 0.05 10 pauses (0.002)

The output of this code will be a signal that starts at zero and gradually increases to three. After five seconds, the signal starts decreasing to zero, with an exponential decay rate. The output plot will look like a ramp that rises linearly and falls exponentially after five seconds.

To Know more about MATLAB code visit:

brainly.com/question/12950689

#SPJ11

Linear programming models have three important properties. They are:
a. optimality, additivity and sensitivity
b. proportionality, additivity, and divisibility
c. optimality, linearity and divisibility
d. divisibility, linearity and nonnegativity

Answers

The three important properties of linear programming models are (B) proportionality, additivity, and divisibility, as they allow for the efficient optimization of a linear objective function subject to linear constraints.

Proportionality means that the objective function and constraints are directly proportional to the decision variables, allowing for easy scaling and comparison of solutions.

Additivity means that the objective function and constraints can be expressed as a sum of individual contributions from each decision variable, enabling efficient computation and analysis.

Divisibility means that the decision variables can take on fractional values, allowing for a wide range of feasible solutions and facilitating sensitivity analysis.

Together, these properties make linear programming a powerful tool for solving optimization problems in a variety of fields, from logistics and manufacturing to finance and resource allocation.

Option B holds true.

Learn more about linear programming models: https://brainly.com/question/24065112

#SPJ11

Let A(t) be the function t+1t​−1. Find the following: A(8)=A(−5)=​ A(31​)= A(−71​)= In each box, enter your answer as an integer or reduced fraction. Enter DNE for Does Not Exist, or oo for Infinity.

Answers

A(8) = 9/7A(-5) = -1/3A(3/1) = 2A(-71/1) = -5/36

Function: A(t) = (t+1)/(t-1)For the given function A(t), the following values are to be calculated: A(8), A(-5), A(3/1), and A(-71/1)A(8):We need to substitute t=8 in the function. A(8) = (8+1)/(8-1) = 9/7Therefore, A(8) = 9/7A(-5):We need to substitute t=-5 in the function. A(-5) = (-5+1)/(-5-1) = -1/3Therefore, A(-5) = -1/3A(3/1):We need to substitute t=3/1 in the function. A(3/1) = (3/1+1)/(3/1-1) = (4)/(2/1) = 4*1/2 = 2Therefore, A(3/1) = 2A(-71/1):We need to substitute t=-71/1 in the function. A(-71/1) = (-71/1+1)/(-71/1-1) = (-70/1)/(-72/1) = (-5/36)Therefore, A(-71/1) = -5/36Therefore, the respective answers for the given values of the function A(t) are as follows: A(8) = 9/7A(-5) = -1/3A(3/1) = 2A(-71/1) = -5/36

Learn more about Function

brainly.com/question/21145944

#SPJ11

can a normal approximation be used for a sampling distribution of sample means from a population with μ=67μ=67 and σ=12σ=12, when n=36?
A. Yes, because the sample size is less than 30.
B. No, because the standard deviation is too small.
C. No, because the sample size is less than 30.
D. Yes, because the mean is greater than 30.

Answers

Yes, a normal approximation can be used for a sampling distribution of sample means from a population with μ=67 and σ=12, when n=36 because the mean is greater than 30. So, the correct option is option D. Yes, because the mean is greater than 30.

The normal approximation can be used for a sampling distribution of sample means when the sample size is greater than or equal to 30 and the population standard deviation is known.

The normal approximation can be used in this case because the Central Limit Theorem states that for sufficiently large sample sizes (n≥30), the sampling distribution of sample means will approximate a normal distribution regardless of the shape of the population distribution.

In this case, the sample size is 36 which is greater than 30 and the population standard deviation is known and is equal to 12. Therefore, we can use the normal approximation. The fact that the population mean is 67 is not relevant to whether or not the normal approximation can be used.

Know more about approximation here:

https://brainly.com/question/31203583

#SPJ11

What is the equation of the line through (1, 6) and (0, 2)?

Y=4x - 2

Y= -4x - 2

Y= -4x + 2

Y= -4x + 2

Answers

Answer: Y = 4x + 2

(It would be either the third or fourth choice since they are the same, one of them must be mistaken)

Step-by-step explanation:

Given information

(x₁, y₁) = (1, 6)

(x₂, y₂) = (0, 2)

Find the slope through the formula

Slope = y2  y1x2  x1

Slope = 2  60  1

Slope = 41

Slope = 4

Substitute values into the linear form

Equation: y = mx + b

Point (0, 2)

y = mx + b

(2) = (4) (0) + b

2 = 0 + b

b = 2 - 0

b = 2

Therefore, the equation is y=4x+2

Hope this helps!! :)

Please let me know if you have any questions

Answer:

y = 4x+2

Step-by-step explanation:

The first step is to find the slope

m = ( y2-y1)/(x2-x1)

m = ( 2-6)/(0-1)

    = -4/-1

   = 4

The slope intercept form of the equation is

y = mx+b  where m is the slope and b is the y intercept

y = 4x+b

The y intercept is where x is equal to 0

The y intercept is 2

y = 4x+2

Other Questions
how did tropical cyclone cheneso impact on people/environment Read about Parker, and then answer the question.Parker is writing an argumentative essay about collecting stamps.Which best supports his claim that collecting stamps is a worthwhile hobby?My favorite stamp is one that came from Japan in the 1950s. It shows a colorful painted fan.I started collecting stamps when my grandfather showed me his collection.Stamps have been used for hundreds of years throughout the world.Collecting stamps is like collecting little pieces of artwork, but it is much less expensive and takes much less room. The actual GDP is computed to be equal to $54,200 billion using the expenditure approach. Compute for the statistical discrepancy if the computed GDP using the income approach is 20% higher than the aforementioned.A. $1,084 BillionB. $-1,084 BillionC. $10,840 BillionD. $-10,840 Billion the nurse is gathering data from a pregnant client about physiological risk factors. the nurse would be sure to obtain which priority data? If m12=3x-4 and m10=2x+2, find the value of x.Please show work. the nurse arrives at the start of a shift on the labor unit to find a census of four patients in active labor. which laboring patient should the nurse attend to first? sumary of Genome Editing with Cas9 in Adult Mice Corrects a Disease Mutation and Phenotype by Yin et al. consider a portfolio that offers an expected rate of return of 12% and a standard deviation of 30%. t-bills offer a risk-free 5% rate of return. what is the maximum level of risk aversion for which the risky portfolio is still preferred to t-bills? (do not round intermediate calculations. round your answer to 2 decimal places.) According to his "Acceptance Speech for the Nobel Peace Prize," what motivated Wiesel to speak out for the oppressed and victimized? 4 divided by 5 equals 12 divided by how much Eventually, What formal meeting was set up with the help of the Sons Of Liberty? Which of the following should typically be ignored because spending has already been made and cannot be changed?a. variable costsb. sunk costsc. marginal costsd. average marginal costs What is the solution to the system of equations? the wave of protestant revivals in the early 1800s that was characterized by large and dynamic sermons is referred to as ______. The ______ of forecasting is a process of gaining consensus from a group of experts. A. salesforce estimate method. B. consulting method. C. Delphi method Consider the following regression model, Y_i= _0 + _1X_i + e_i, where the variance of the error term is var(e_i) = ^2(X_1)^2. Note that ^2 is an unknown constant. Further, assume that the model satisfies all of the assumptions of the Gauss-Markov Theorem except for heteroscedasticity. a) Formulate a Weighted Least Square (WLS) regression for this model that provides the BLUE of the model coefficients. (30 marks) b) Demonstrate that the error term of your transformed model is homoskedastic. (30 marks) c) How do the estimated coefficients of your transformed model transform into estimates of your original model? (40 marks) TRUE/FALSE benchmarking is actually just a formalized approach to determining best practices by companies in the same industry and in other industries. how is the blue ringed ouctapus different from the other animals in this section Discussion Board After initial prenatal screening, you are told that you are at risk for delivering a child with Down Syndrome. You are sent to the genetic counselor and they inform you of your options for further testing State your reasons for proceeding with testing or not testing regardless of whether or not you decide to test, what genetic tests could be done. Which test would you choose and why? The table represents a function.X f(x)-4 -2-1 53 45 -8What is f(5)?-8-1 18