Help






Math





Will




Give



Brainlist





:))

HelpMathWillGive Brainlist:))

Answers

Answer 1

Answer:

$156

Step-by-step explanation:

(9600 + 5376 )/ (8 * 12) = 156

Answer 2

Answer:

$156

Step-by-step explanation:

interest for 8 years = $5376

convert 8 years to months

1 year = 12 month

8 years = 8*12

=96 months

monthly

now monthly interest = $5376/96

=$56

now find amount that he has to pay monthly

=$9600/96

=$100

monthly payment with interest = $100 + $56

=$156


Related Questions

fill in the table using this function rule. y=6x-36

Answers

Answer is in the attachment

There was no table so I created one

From the equation I can see at 0, y = -36

From there I used positive numbers from 0 and substituted them into the equation for a y solution.
 fill in the table using this function rule. y=6x-36

A uniformly distributed random variable has minimum and maximum values of 20 and 60, respectively.
a. Draw the density function.
b. Determine P(35 < X < 45).
c. Draw the density function including the calculation of the probability in part (b).

Answers

a. The density function of a uniformly distributed random variable is a rectangle with height 1/(maximum value - minimum value) and width equal to the range of the variable. In this case, the height is 1/(60 - 20) = 1/40 and the width is 60 - 20 = 40. Therefore, the density function is:

```
|
|
|
|
| ___________
| | |
| | |
|_____|___________|
20 35 60
```

b. To find P(35 < X < 45), we need to find the area of the rectangle between x = 35 and x = 45. The height of the rectangle is 1/40 and the width is 45 - 35 = 10. Therefore, the area is:

P(35 < X < 45) = (1/40) * 10 = 1/4

c. Here is the density function with the shaded area representing the probability from part (b):

```
|
|
|
|
| ___________
| | |
| | |
|_____|___________|
20 35 60

|
|
|
|
| ___________
| | |
| | |
|_____|___________|
35 45
```

The shaded area represents the probability P(35 < X < 45), which is 1/4.

please help me, someone!

please help me, someone!

Answers

Answer:

76.275

Step-by-step explanation:

First - the entire circles area is 78.54. \(\pi r^{2}\) with r being 5

6 triangles of that size could fit in that circle.

A=3\(\sqrt{3}\)/(2) * a2

The area of that would equal 64.95

78.54-64.95 = 13.59

then divide that number by 6

which is 2.265.

Take that number from the original 78.54

78.54-2.265 = 76.275

Jordan has been saving for a new bicycle. It costs $115. If the sales tax rate is 6%, how much will she need to save in order to afford the bike?

Answers

Answer:

$121.90

Step-by-step explanation:

Cost $115 x .06% = 6.9

115+6.9 = 121.90

josh , James and John share sweets in ratio 1:2:4 . Josh has 9 sweets less than John . how many sweets does John have ?​

Answers

Answer:

12

Step-by-step explanation:

1:2:4

let josh=1x

james=2x

john=4x

josh has nine sweets less than john

4x-1x=9

3x=9

x=3

john's sweet=4x

4(3)=12

14) Andre went hiking by his house, The first trail he hiked took him 4.5 miles away from his
house. The second trail he hiked took him 2.4 miles closer to his house. The third trail
took him 1.7 miles further away from his house. After Andre hiked the three trails, how
far from his house was he?

Answers

Answer : 3.8 miles
Step by step explanation :
The calculation is the following :
4.5 miles of the first hike minus 2.4 miles of the second hike
4.5 - 2.4 = 2.1
Then you have to add those 2.1 miles the 1.7 miles of the third and last hike
2.1 + 1.7 = 3.8 miles

Discuss an example that uses the Central Limit Theorem. This would focus on loading - such as an elevator. How much weight can your example hold to be safe? Do you know of a situation where the maximum weight was exceeded and the structure failed? How does probability and statistics relate to your example?

Answers

An example that uses the Central Limit Theorem is the loading capacity of an elevator. The maximum weight a safe elevator can hold can be determined using probability and statistics.

The Central Limit Theorem states that the distribution of the sum (or average) of a large number of independent and identically distributed random variables will approximate a normal distribution, regardless of the shape of the original distribution.

In the case of an elevator's loading capacity, the weights of passengers can be considered as random variables. The Central Limit Theorem allows us to approximate the distribution of the total weight of passengers in the elevator. By knowing the mean weight and standard deviation of passengers, we can calculate the probability of the total weight exceeding the safe limit.

For example, suppose the mean weight of passengers is 70 kg with a standard deviation of 10 kg. If the safe weight limit for the elevator is 1000 kg, we can use probability and statistics to determine the likelihood of exceeding this limit.

Using the Central Limit Theorem, we can approximate the distribution of the total weight of passengers as a normal distribution. From there, we can calculate the probability that the total weight exceeds the safe limit.

If the maximum weight limit is exceeded and the structure fails, it could result in a dangerous situation, potentially causing injury or property damage. Thus, it is crucial to ensure that elevators are properly designed and maintained to handle the expected loading conditions.

Probability and statistics play a significant role in analyzing and managing risks associated with elevator loading capacities. By understanding the distributions of passenger weights and applying statistical techniques, engineers can determine safe weight limits and mitigate the risk of exceeding those limits, ensuring the safety of elevator users.

To learn more about Central Limit Theorem, click here: brainly.com/question/898534

#SPJ11

Mr. Jones sells apples at the farmers’ market. In a container, he has 4 different types of apples. The probability of randomly selecting a Golden Delicious apple is , a Fuji apple is , and a McIntosh apple is . The rest of the apples in the container are Galas. What is the likelihood of a customer selecting a Gala apple?
is it unlikely
likely
certain
impossible
I WILL MAKE BRAINELST

Answers

Answer:

This question cannot be answered with the information given

Step-by-step explanation:

You did not include the possibilities of each apple being selected.

I will follow this question and answer it when there's more details.

Which statement is correct?
N
H
#
w
T
А.
ATNW - AHCL
В.
ANWT ACHL
C
ANWT 2 ALCH
D
AWTNAHCL

Which statement is correct?NH#wT.ATNW - AHCL.ANWT ACHLCANWT 2 ALCHDAWTNAHCL

Answers

Answer:

b

Step-by-step explanation:

n hc l

a n w t

yan lng po Ang Alam k

Evaluate the function f(x)=8x+7 at the given values of the
independent variable and simplify. in other words replace x with a.
b. and c. and simplify
a. f(-9)=
b. f(x+9)
c. f(-x)

Answers

a. f(-9) = -65
b. f(x+9) = 8x + 79
c. f(-x) = -8x + 7

The function f(x) = 8x + 7 represents a linear equation. To evaluate this function, we need to substitute the given values of the independent variable (x) into the function and simplify the expression.

a. To evaluate f(-9), we substitute -9 for x in the function:

f(-9) = 8(-9) + 7

Now we simplify the expression:

f(-9) = -72 + 7

f(-9) = -65

Therefore, f(-9) = -65.

b. To evaluate f(x+9), we substitute (x+9) for x in the function:

f(x+9) = 8(x+9) + 7

Now we simplify the expression:

f(x+9) = 8x + 72 + 7

f(x+9) = 8x + 79

Therefore, f(x+9) = 8x + 79.

c. To evaluate f(-x), we substitute (-x) for x in the function:

f(-x) = 8(-x) + 7

Now we simplify the expression:

f(-x) = -8x + 7

Therefore, f(-x) = -8x + 7.

In summary:
a. f(-9) = -65
b. f(x+9) = 8x + 79
c. f(-x) = -8x + 7

Know more about linear equation here:

https://brainly.com/question/32634451

#SPJ11

1. Two players are playing a game that is given in a tree form below: a) Find all SPNE. 0 4 S CT CTC 5 5 N 2 a h 0 3 H S 3 0 2 h 3 3

Answers

To find all subgame perfect Nash equilibria (SPNE), we need to analyze each decision node in the game tree and determine the best response for each player at that node.

Starting from the final round (bottom of the tree) and working our way up:

At the node labeled "N", Player 1 has two options: "H" and "S". Player 2 has only one option: "h". The payoffs associated with each combination of choices are as follows:

(H, h): Player 1 gets a payoff of 3, Player 2 gets a payoff of 0.

(S, h): Player 1 gets a payoff of 2, Player 2 gets a payoff of 3.

Since Player 1's payoff is higher when choosing "H" rather than "S" and Player 2's payoff is higher when choosing "h" rather than "H", the subgame perfect Nash equilibrium for this node is (H, h).

Moving up to the next round, we have a decision node labeled "a". Player 1 has two options: "C" and "T". Player 2 has only one option: "h". The payoffs associated with each combination of choices are as follows:

(C, h): Player 1 gets a payoff of 4, Player 2 gets a payoff of 0.

(T, h): Player 1 gets a payoff of 5, Player 2 gets a payoff of 5.

Since Player 1's payoff is higher when choosing "T" rather than "C" and Player 2's payoff is higher when choosing "h" rather than "C", the subgame perfect Nash equilibrium for this node is (T, h).

Finally, at the topmost decision node labeled "S", Player 1 has only one option: "S". Player 2 has two options: "C" and "T". The payoffs associated with each combination of choices are as follows:

(S, C): Player 1 gets a payoff of 0, Player 2 gets a payoff of 2.

(S, T): Player 1 gets a payoff of 3, Player 2 gets a payoff of 3.

Since Player 1's payoff is higher when choosing "S" rather than "N" and Player 2's payoff is higher when choosing "C" rather than "T", the subgame perfect Nash equilibrium for this node is (S, C).

In summary, the subgame perfect Nash equilibria for this game are (H, h), (T, h), and (S, C).

Learn more about Nash Equilibrium here -: brainly.com/question/29398344

#SPJ11


What is the slope intercept ?

PLEASE HELP ME

What is the slope intercept ?PLEASE HELP ME

Answers

y=-3/2 -3 is the slope intercept

What is the location of point G, which partitions the directed line segment from D to F into a 5:4 ratio

Answers

Point G is two, which divides the directed line segment from D to F into a 5:4 ratio at that place.

What are straight-line equations?

The general equation for every straight line is y = mx + c, where m is the gradient (or degree of steepness) of the line and c is the y-intercept (the point in which the line crosses the y-axis).

The variables x and y are related to coordinates on the line in the linear equation y = mx + c.

The formula y = mx + c yields a result for y when we enter a value for x.

As y depends on the value of x, it follows that x is an independent variable and y is a dependent variable.

According to our question-

From negative five to positive ten is a number line.

Points D and F are at -2 and +7, respectively.

The distance between point D and F is,

=9

If Point G divides the directed line segment from D to F into a 5: 4 ratio, then,

=2

Hence, The directed line segment from D to F is divided into a 5:4 ratio at point G by the number 2.

learn more about straight-line equations click here:

brainly.com/question/25969846

#SPJ4

In the relationship y=3x, if x is reduced by 1/3, how will y change? Responses It will triple.

Answers

If x is reduced by 1/3, 3x will be reduced by 1/3 x 3 = 1

Because y = 3x, y will also be reduced by 1.

The figures below are similar.

4 cm
8 cm


What is the ratio of the circumference of the smaller circle to the circumference of the larger circle?

Write your answer as the ratio of two whole numbers separated by a colon (for example

The figures below are similar.4 cm8 cmWhat is the ratio of the circumference of the smaller circle to

Answers

Answer:

The answer is 1:2

Step-by-step explanation:

For small circle

r = 4

2πr = 2 × 3.14 × 4 = 25.12

For big circle

r = 8

2πr = 2 × 3.14 × 8 = 50.24

Now,

if we divide both answers we get,

25.12 ÷ 50.24 = 1/2 = 1:2

−3(8k+5)=3(9−k)
what is k?

Answers

Answer:

-2

Step-by-step explanation:

Step-by-step explanation:

THE ANSWER IS: -2:)))))))))))

Find the slope of the lines graphed below.
Giving brainliest to whoever answers all correct.

Find the slope of the lines graphed below. Giving brainliest to whoever answers all correct.

Answers

Answer:

1.slope is 2

2.slope is -3/5

3.slope is 1

4.vertical line slope 0 undefined

5.x=-5

6.horizontal line slope 0 undefined

Step-by-step explanation:

Answer:

1) 2 2) -3/5 3) 1 4) Undefined 5) -5 6) 0

Step-by-step explanation:

Help please help me

Help please help me

Answers

Answer:Hi

Step-by-step explanation:  

100 POINTS AND BRAINLIEST!! PRE CALC!

The trigonometric relation cos (π/3 + x) + cos (π/3 - x) is equivalent to:

a. cos 2x
b. cos x
c. sin x
d. 1/2 cos x

Please explain your answer :)

Answers

Answer:

b

Step-by-step explanation:

use cos(r + s ) = cosrcoss - sinrsins to expand.

cos pi/3 cosx - sin pi/3 sinx + cos pi/3 cosx + sin pi/3 sinx

the two in bold cancel out.

cospi/3 cosx + cospi/3 cosx

pi = 180° in trigonometry.

cos 180/3 cosx + cos 180/3 cosx

1/2 cosx + 1/2 cosx

= cos x

cos(A+B)+cos(A-B)=2cosAcosB

Hence

cos(π/3+x)+cos(π/3-x)2cosπ/3(cosx)2(1/2)(cosx)cosx

PLEASE HELP ME WITH THISSS

PLEASE HELP ME WITH THISSS

Answers

The number of plastic tubing needed to fit around the edge of the pool is 423.3 ft².

What is the difference between the areas?

The number of plastic tubing needed to fit around the area is calculated from the difference between the area of the rectangle and area of the circular pool.

Area of the circular pool is calculated as;

A = πr²

where;

r is the radius

A = π (15 ft / 2)²

A = 176.7 ft²

The area of the rectangle is calculated as follows;

A = length x breadth

A = 20 ft x 30 ft

A = 600 ft²

The number of plastic tubing needed to fit around the edge of the pool is calculated as;

The difference in the area = 600 ft² - 176.7 ft² = 423.3 ft²

Learn more about area of circular pool here: brainly.com/question/18205358

#SPJ1

b. if a is a 35 matrix and t is a transformation defined by t(x)ax, then the domain of t is .

Answers

For the matrix the true statement is given by option d. Both A and B are false.

Let's analyze each statement of the matrix as follow,

A) If A is a 3 times 5 matrix and T is a transformation defined by T(x) = Ax, then the domain of T is R⁵.

This statement is false.

The domain of the transformation T is not R⁵.

The domain of T is determined by the dimensionality of the vectors x that can be input into the transformation.

Here, the matrix A is a 3 times 5 matrix, which means the transformation T(x) = Ax can only accept vectors x that have 5 elements.

Therefore, the domain of T is R⁵, but rather a subspace of R⁵.

B) If A is a 3 times 2 matrix, then the transformation x right arrow Ax cannot be onto.

This statement is also false.

The transformation x → Ax can still be onto (surjective) even if A is a 3 times 2 matrix.

The surjectivity of a transformation depends on the rank of the matrix A and the dimensionality of the vector space it maps to.

It is possible for a 3 times 2 matrix to have a rank of 2,

and if the codomain is a vector space of dimension 3 or higher, then the transformation can be onto.

Therefore, as per the matrix both statements are false, the correct answer is d. Both A and B are false.

Learn more about matrix here

brainly.com/question/29132693

#SPJ4

The above question is incomplete, the complete question is:

Which of the following best characterizes the following statements:

A) If A is a 3 times 5 matrix and T is a transformation defined by T(x) = Ax, then the domain of T is R^5

B) If A is a 3 times 2 matrix, then the transformation x right arrow Ax cannot be onto

a. Only A is true

b. Only B is true

c. Both A and B are true

d. Both A and B are false

Brady has been
approved for a home loan on a property he has under contract. The purchase
price is $150,000, and he is required to have $5,250 as a down payment. Which
of the following loan types is Brady most likely getting?




a. Conventional loan




b. ARM loan




c. FHA loan




d. VA loan




e. Fixed loan

Answers

The type of loan that Brady most likely getting  is option (a) conventional loan

Conventional loans are typically not guaranteed or insured by the government and often require a higher down payment compared to government-backed loans such as FHA or VA loans. The down payment requirement of $5,250, which is 3.5% of the purchase price, is lower than the typical down payment requirement for a conventional loan, which is usually around 5% to 20% of the purchase price.

ARM (Adjustable Rate Mortgage) loans have interest rates that can change over time, which can make them riskier for borrowers. FHA (Federal Housing Administration) loans are government-backed loans that typically require a lower down payment than conventional loans, but they also require mortgage insurance premiums.

VA (Veterans Affairs) loans are available only to veterans and offer favorable terms such as no down payment requirement, but not everyone is eligible for them. Fixed-rate loans have a fixed interest rate for the life of the loan, but the down payment amount does not indicate the loan type.

Therefore, the correct option is (a) Conventional loan

Learn more about Conventional loan here

brainly.com/question/28847943

#SPJ4

PLEASE HELP I will mark brailist

PLEASE HELP I will mark brailist

Answers

Answer:

72m^2

Step-by-step explanation:

Conevert the lengths into what they really are

Length of Patio:12

width of patio:6

Soooo.....

multiply

12x6=72

Help please!

A.


B.


C.


D.

Help please!A.B.C.D.

Answers

Answer:

it is b

Step-by-step explanation:

bc it is the one thing that i had right to start with

What happens when there is no outliner on a line plot

Answers

Answer:

the slope is smaller

Step-by-step explanation:


(sin(\theta )+cos(\theta )-tan(\theta ))/(sec(\theta )+csc(\theta )-cot(\theta )) given that tan\theta =-(4)/(3) in quadrant II

Answers

We have to find the value of  `(sinθ+cosθ−tanθ)/(secθ+cscθ−cotθ)`

Let's find all trigonometric ratios:

We can say that:

\($$\tan \theta= \frac{opp}{adj}= \frac{-4}{3}$$$$\text\)

{Using the Pythagorean Theorem we can find the hypotenuse }

\($$$$\text{Hypotenuse = } \sqrt{(-4)^2+(3)^2}\)

\(= \sqrt{16+9}\)

= \(\sqrt{25}\)

=\(5$$$$\)

Substituting the values of sinθ, cosθ and tanθ in `

\(= \frac{\frac{3}{5} + \frac{-4}{5} - \frac{-4}{3}}{\frac{-4}{5} + \frac{5}{3} - \frac{-3}{4}}$$$$\)

\(=\frac{\frac{9}{15} + \frac{-12}{15} + \frac{20}{15}}{\frac{-16}{20} + \frac{25}{12} + \frac{3}{4}}$$$$\)

\(=\frac{\frac{17}{15}}{\frac{-14}{15}}$$$$\)

\(=-\frac{17}{14}$$\)

Therefore, \(`(sinθ+cosθ−tanθ)/(secθ+cscθ−cotθ)\)` is equal to

`-17/14` when `tanθ=−43` (Quadrant II).

To know more about Pythagorean visit:

https://brainly.com/question/28032950

#SPJ11

Select all of the equations that have graphs with the same y-intercept (starting amount).

Select all of the equations that have graphs with the same y-intercept (starting amount).

Answers

Answer: y=3x-8, y=5x-8, and y=2x-8

Step-by-step explanation:

These equations are all lines in slope-intercept form (y=mx+b where b is the y-intercept). y=3x-8, y=5x-8, and y=2x-8 all have -8 as the b value. Therefore, these equations have the same y-intercept.

a dataset on 91 roller coasters lists the duration of the ride in seconds in addition to the drop height in feet for some of the coasters. one​ coaster, the​ tower of​ terror, is unusual for having a large drop but a short ride. after setting it​ aside, a regression to predict duration from drop for the remaining 90 coasters has r​29.4%. complete parts a through c.a) What are the variable and units in this regression? The predictor variable is ___ in units of ___ and the response variable is ___ in units of ___ b) What units does the slope have? Feet, Seconds per foot, Seconds, Feet per second. c) Is the slope probably positive or probably negative? Explain. The slope is probably ____ because ___

Answers

(a) The predictor variable is Fall in feet and the response variable is Duration in seconds.

(b) The slope is in seconds per foot.

(c) The slope may be negative, as greater drop heights generally result in longer travel times.

(a) The predictor variable in this regression is Drop, which represents the drop height of the roller coaster, in feet, in feet. The response variable is Duration, which represents the duration of the trip, in seconds, in seconds.

(b) The units of slope in this regression are seconds per foot. This means that for each unit of increase in descent height in feet, the travel time will increase or decrease the value of the slope, measured in seconds per foot.

(c) The slope can be negative, as greater drop heights generally result in longer ride times, and the Tower of Terror roller coaster, which was exceptionally short despite its large drop height, has were removed from the analysis.

Therefore, the remaining 90 roller coasters in the dataset likely exhibit a negative relationship between drop height and time, meaning that as drop height increases, ride time decreases .

The Low R-value squared 29.4% means that the relationship between roller coaster drop and ride time in the data set is highly variable, but the negative slope indicates a general downward trend.

Learn more about Slope:

https://brainly.com/question/3605446

#SPJ4

Luis is 0.25 meters shorter than Harry, if Luis is 1.7 meters tall determine Harry’s height.​

Answers

Answer:  1.95

Step-by-step explanation:

Luis is Harry's height minus 0.25m, which means Harry is Luis' height plus 0.25m.

Luis + 0.25 = Harry

1.7 + 0.25 = 1.95 m

What is a pair of overlapping triangles?



△EDB and △DEC
△ADE and △FCB
△BDE and △EDA

What is a pair of overlapping triangles?EDB and DECADE and FCBBDE and EDA

Answers

Answer: Triangle EDB and Triangle DEC

Explanation: You can see the overlapping if you look very careful. You can see a little triangle formed of DFE.
Other Questions
NO LINKS! What are the definitions of initial horizontal velocity and initial vertical velocity? Please help! This like is my 10th time asking this question because many people have been scamming me. PLZ HELP!Find the value of cos theta, if sin theta =1/2; 0degrees less than and equal to theta less than and equal to 90 degrees.a) -1/2b) 3/2c) srt3/2d) -2/3 (a) circle one arrow that represents transcription on the template pathway. identify the molecule that would be absent if enzyme yuc is nonfunctional. If the function y = e^7x is vertically compressed by a factor of 8, reflected across the x-axis and then shifted down 5 units, what is the resulting function? Write your answer in the form y = ce^ax + b Loren made a scale map of his football field to prepare for the big game. The lengthof the football field on his map was 3 in. In reality the football field is 100 yards long.What is the scale factor? checking parameters before theyre used to make sure theyre valid is referred to as: as rains falls on the surface of the ocean, the salinity of the surface water decreases. what happens to the density of the surface water? (ignore temperature as a factor here.) multiple choice question. there is no change. it increases. it decreases. b. In problem 2A , suppose Group A instead went 4 miles west and then turned 45 north of west and traveled 3 miles. Which group would be closer to the lodge? Explain your reasoning. i need help please... Ill love u forever if u help me with this ASAP PLZZZZZ ;) a newborn is admitted to the nursery following vaginal delivery to a mother with active vaginal herpes. list at least five (5) nursing measures that should be implemented at this time. find the length of CA The US government declared the whole US a military zone during WWII. Why was this such a big deal? What happened bc of this declaration? compare and contrast the two biggest canadian provinces: the central provinces of quebec and ontario. pay special attention to their culture and history. When you pass a car while driving, you are relying on your _____ to tell you how far away the car is, and when you are getting near enough to pass safely. The sum of a number a and negative 12 is 6. Solve the equation. p=q+3e make e the subject of the formula Unlike a phonograph record that has a constant angular speed, a CD scans information at a constant linear speed (130 cm/s). Does the CD rotate at a constant or varying angular speed if you can get 3 pints of raspberries for $12.00 how many pints can you get per dollar vivid dreams occur during this recurring sleep stage, also known as paradoxical sleep.True or false