The molar mass of the unknown gas is 17.75 g/mol
From Graham's law of diffusion, we understood that the rate of diffusion of a gas is inversely proportional to the square root of the molar mass of the gas as shown below:R ∝ \(\frac{1}{\sqrt{M}}\)
Expanding further, we have
\(\frac{R_{1} }{R_{2} } = \sqrt{\frac{M_{2}}{M_{1}} }\)
Where
R₁ and R₂ are the rate of diffusion of the individual gas
M₁ and M₂ are the molar masses of the individual gas.
With the above information in mind, we can obtain the molar mass of the unknown gas as follow:
Let R₁ be the rate of the unknown gas
Let R₂ be rate of Cl₂ gas
Let M₁ be the molar mass of the unknown gas
Let M₂ be the molar mass of the Cl₂ gas
From the question given above, we were obtained the following:
Rate of the unknown gas = 2 times the rate of Cl₂ i.e
R₁ = 2R₂Molar mass of Cl₂ (M₂) = 2 × 35.5 = 71 g/mol
Molar mass of the unknown gas (M₁) =?\(\frac{R_{1} }{R_{2} } = \sqrt{\frac{M_{2}}{M_{1}} }\\\\\\\frac{2R_{2}}{R_{2} } = \sqrt{\frac{7 1}{M_{1}} }\\\\2 = \sqrt{\frac{7 1}{M_{1}} }\)
Square both sides\(2^{2} = \frac{71}{M_{1}} \\\\4 = \frac{71}{M_{1}}\)
Cross multiply4 × M₁ = 71
Divide both side by 4\(M_{1} = \frac{71}{4}\)
M₁ = 17.75 g/molTherefore, the molar mass of the unknown gas is 17.75 g/mol
Learn more: https://brainly.com/question/10408961
copper reacts with oxygen to form two oxides x and y. on analysis 1.535g of x yielded 1.365g of copper and 1.450g of y yielded 1.160g of copper (I) determine the chemical formula for x and y (ii) calculate the mass cooper which can react with 0.5g of oxygen to yield x and y (iii) which of the laws of chemical combination is illustrated by the result above?
The chemical formula for x and y is Cu₂O and CuO. The mass cooper which can react with 0.5g of oxygen to yield x and y is 2.745 g.
What is chemical formula ?A chemical formula is a phrase that lists the constituent parts of a compound together with their relative quantities. No subscript is used if there is just one atom of a certain kind. A subscript is added to the symbol of an atom if it contains two or more of a certain type of atom.
1. 1.535 g of X → 1.365 g of Copper
1.535 – 1.365 = 0.170g of Oxygen
Atomic weight of Cu = 63.5,
Atomic weight of Oxygen = 16
For Cu 1.365 g / 63.5 = 0.02 mol
For Oxygen 0.170 g / 16 = 0.01 mol
X = Cu₂O
1.450 g of Y → 1.160 g of Cu
1.450 – 1.160 = 0.290 g of Oxygen
For Cu = 1.160 g / 63.5 = 0.018 mol
For Oxygen = 0.290 g / 16 = 0.018 mol
Y = CuO
2. The total mass of Oxygen = 0,170 g + 0,290 g
= 0.460 g
Total mass of Cu = 1.160 g + 1. 365 g
= 2.525 g
0.460 g of Oxygen → 2.525 g of Cu
0.500 g of Oxygen → (2.525 x 0.5) / 0.460
= 2.745 g of Cu
Thus, The law of multiple proportions was formulated by John Dalton in 1804.
To learn more about the chemical formula, follow the link;
https://brainly.com/question/29031056
#SPJ9
which of the following substances would you predict to have the lowest boiling point? a) hcl b) ch3ch2oh c) ch3cl d) hoch2ch2oh e) ch3ch2ch2ch3
Based on the given substances, I predict that substance E (CH3CH2CH2CH3) would have the lowest boiling point.
1. Identify the types of intermolecular forces present in each substance:
a) HCl - dipole-dipole interaction
b) CH3CH2OH - hydrogen bonding
c) CH3Cl - dipole-dipole interaction
d) HOCH2CH2OH - hydrogen bonding
e) CH3CH2CH2CH3 - London dispersion forces
2. Rank the intermolecular forces by strength:
Hydrogen bonding > dipole-dipole interaction > London dispersion forces
3. Since boiling point is directly related to the strength of intermolecular forces, a substance with weaker intermolecular forces will have a lower boiling point.
4. Substance E (CH3CH2CH2CH3) has the weakest intermolecular forces (London dispersion forces) among the given options, and therefore, it is predicted to have the lowest boiling point.
For more question on boiling point click on
https://brainly.com/question/29233996
#SPJ11
What will be formed when 2,2,3-trimethylcyclohexanone reacts with hydroxylamine?
Answer:
Following are the solution to this equation:
Explanation:
In the given-question, an attachment file of the choices was missing, which can be attached in the question and its solution can be defined as follows:
In the given question "Option (iii)" is correct, which is defined in the attachment file.
When 2,2,3-trimethylcyclohexanone reacts with hydroxylamine it will produce the 2,2,3-trimethylcyclohexanoxime.
Question in picture
Question in picture
The correct answer is a sphybridisation in z coordinate.So to form sphybridisation we need a s orbital and a p orbital .
In genomics, hybridization is the process by which two complementary single-stranded DNA or RNA molecules bond together to form a double-stranded molecule.The bonding is determined by the correct base pairing between the two single-stranded molecules. When one s and one p orbital in the same main shell of an atom combine to form two new equivalent orbitals, this is referred to as sphybridization.
The newly formed orbitals are known as sphybridized orbitals. It forms linear molecules with a 180° angle. Atomic orbitals include both s and p orbitals. These orbitals represent the most likely region in which we can find an electron of that atom. The primary distinction between s and p orbitals is that s orbitals are spherical in shape, whereas p orbitals are dumvell-shaped.So to form sp hybridisation we need a s orbital and a p orbital .
Learn more about hybridisation here :-
https://brainly.com/question/14140731
#SPJ9
Part A
How many moles of chlorine gas are needed to make 0.6 moles of sodium chloride?
Given the reaction: 2Na + Cl2 + 2NaCl
O 1.2
O 0.6
0 3.6
O 0.3
not enough information
Submit
Request Answer
Answer:
\(n_{Cl_2}=0.3molCl_2\)
Explanation:
Hello there!
In this case, according to the given chemical reaction whereas the sodium chloride is in a 2:1 mole ratio with chlorine, the required moles of the later are computed as shown below:
\(n_{Cl_2}=0.6molNaCl*\frac{1molCl_2}{2molNaCl}\)
So we cancel out the moles of NaCl to obtain:
\(n_{Cl_2}=0.3molCl_2\)
Best regards!
What is the resource population of the weebugs?
Insects from the genus Cimex known as bed bugs feast on blood, typically at night and skin rashes.
Thus, Their bites can have a variety of negative health repercussions, such as skin rashes, emotional effects, and allergy symptoms.
The effects of bed bug bites on the skin might range from little redness to obvious blisters. Itching is typically prevalent, and symptoms might take anywhere from minutes to days to manifest.
Some people might experience fatigue or a fever. Usually, impacted bodily parts are those that are exposed. There is no known contagious disease that their bites can spread.Vasculitis and regions of dead skin are unusual complications.
Thus, Insects from the genus Cimex known as bed bugs feast on blood, typically at night and skin rashes.
Learn more about Weedbugs, refer to the link:
https://brainly.com/question/21683913
#SPJ1
Balance the following reaction _Na+_O2=Na2O
If Maria winks exactly 5 times every minute while she’s awake and she sleeps exactly 8 hours a day how many times does Maria Wink in a day?
Answer:
192
Explanation:
24-8=16
16x60=960
960/5=192
How many moles of carbon tetrabromide are present in 5. 27x10`22 molecules of the compound
Answer: 0.094 mole
Explanation: same answer for any molecule, actually.
6.02214076*10^23 per mole
5.7*10^22 = 0.094 mole
Please help me with this on the picture
Answer:
Umm … can you make it horizontal Please
Explanation:
An arctic weather balloon is filled with 38.5 L of helium gas inside a prep shed. The temperature inside the shed is 8. °C. The balloon is then taken outside, where the temperature is -41. °C. Calculate the new volume of the balloon. You may assume the pressure on the balloon stays constant at exactly 1 atm. Be sure your answer has the correct number of significant digits.
Answer: The new volume of the balloon is 197.31 L.
Explanation:
Given: \(V_{1}\) = 38.5 L, \(T_{1} = 8^{o}C\)
\(V_{2}\) = ?, \(T_{2} = 41^{o}C\)
According to Charles law, at constant pressure the volume of a gas is directly proportional to temperature.
Formula used to calculate the new volume is as follows.
\(\frac{V_{1}}{T_{1}} = \frac{V_{2}}{T_{2}}\)
Substitute the values into above formula as follows.
\(\frac{V_{1}}{T_{1}} = \frac{V_{2}}{T_{2}}\\\frac{38.5 L}{8^{o}C} = \frac{V_{2}}{41^{o}C}\\V_{2} = \frac{38.5 L \times 41^{o}C}{8^{o}C}\\= 197.31 L\)
Thus, we can conclude that the new volume of the balloon is 197.31 L.
What is the name of the compound O7I9
Answer:
question not clear can u rewrite
What do you do while drawing a conclusion?
O A. Find a connection between variables
O B. Make a hypothesis
O C. Record observations
D. Make up new data if you need to
Answer:
A. Find a connection between variables
Explanation:
In the scientific method, the first step is to make an observation. To observe means to carefully monitor phenomena with a view to draw general patterns from specific occurrences.
The second step is to draw up a hypothesis; this is a tentative explanation for the observation.
The next step is to perform an experiment to determine the effect of change in one more variables on another variable. The experiment will confirm or disprove the hypothesis.
The last step is to draw a conclusion. In drawing up a conclusion, a scientist finally establishes the relationship between two variables and finds the connection between them.
46 g of glycerin were dissolved in 100 g of water. What is the freezing point of this solution?
Additional information:
М(С3Н5(ОН)3) = 92 g/mol;
Тf(Н2О) = 273.15 К;
Кf = 1.86 kg⋅К/mol.
Based on the formula to determine the freezing point depression of the solvent, the freezing point of the solution is 263.85 K.
What is the freezing point of a substance?
The freezing point of a substance is the temperature at which the liquid changes to solid without any further decrease in temperature occurring during the process.
The addition of solute substances in liquids usually lowers the freezing point of the liquid solvent.
The formula to determine the freezing point depression of solvent is given below:
ΔT = i * Kf * mwhere'
ΔT is the change in freezing point,i is the van't Hoff factor,Kf is the freezing point depression constant, andm is the molality of the solution.The molality of the given solution = moles of solute/kg of solvent
moles of solute = 46/92
mass of solvent = 100 g or 0.1 kg
Molality of solution = (46/92) / 0.1
Molality of solution = 5
for glycerine, i = 1
ΔT = ΔT = 1 * 1.86 * 5
ΔT = 9.3
The freezing point of the solution = 273.15 - 9.3
The freezing point of the solution = 263.85 K
Learn more about freezing point depression at: https://brainly.com/question/30093044
#SPJ1
How do trenches form? say it with your own words
Answer:
trenches are a feature of convergent plate boundaries, where two or more tectonic plates meet. At many convergent plate boundaries, dense lithosphere melts or slides beneath less-dense lithosphere in a process called subduction, creating a trench.
Explanation:
Answer:
When one tectonic plate slides beneath another a trench is formed.
Explanation:
Hope this helps you
Crown me as brainliest:)
How many Moles of NO can be made from 30.0 g of NH3?
4 NH3 + 5 O2 → 6 H2O + 4 NO
1.761 moles NO will be made from 30g of NH3.
Finding the moles of a Substance using StoichiometryThe balanced reaction is:
4 NH₃(g) + 5 O₂(g) → 4 NO (g) + 6 H₂O
By stoichiometry of the reaction, we have
4 moles of NH₃5 moles of O₂ 4 moles of NO 6 moles H₂ORecall that
Number of moles = Mass/ Molar Mass
We first Find the number of moles in 30g of NH3 ,
Number of moles=30/17.031 g/mol=1.761moles
Now we can say if by stoichiometry
IF 4 moles of NH3 produces 4 moles of NO,
then 1.761 moles of aNH3 will produce = ( 1.761 moles NH3 x 4 moles of NO)/ 4 moles of NH3
= 1.761 moles NO
Therefore, 1.761 moles NO will be made from 30g of NH3.
Learn more about stoichiometry calculations here : https://brainly.com/question/6865807
HELP PLEASE ILL GIVE 25 pointsWhich of the following practices could help reduce erosion of water banks? a. buffer strips b. natural fertilizers and pesticides c. decrease in fossil fuel emissions d. all of the above Please select the best answer from the choices provided A B C D
Answer:
A. Buffer strips
Explanation:
The practice that could help reduce erosion of water banks is buffer strips.
What is erosion?Erosion is the action of surface processes that removes soil, rock or dissolved material from one location on the Earth's crust, and then transports it to another location where it is deposited.
One of the practices that could be used to reduce the effect of erosion is buffer strips.
What buffer strips do is slow and filter storm runoff while helping to hold soil in place.
Learn more on buffer strips here; https://brainly.com/question/26872640
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
2. (6 pts) In a reaction, 235 mL of 1.50 M HCl solution reacts completely with an excess amount of
aluminum. If the hydrogen gas is collected over water in a container with a volume of 3.60 L and at a
temperature of 25.0 °C, calculate the pressure in the container. The vapor pressure of water is 23.78
mmHg (Table 6.4, page 232).
2Al(s) + 6HCl(aq) + 3H2(g) + 2AlCl3(aq)
Answer:
\(P=1.23atm\)
Explanation:
Hello.
In this case, since the total pressure in the container includes the pressures of both hydrogen and water:
\(P=P_{H_2}+P_{H_2O}\)
For the reacting solution of HCl, based on the 6:3 mole ratio with hydrogen in the chemical reaction, we can next compute the yielded moles o hydrogen:
\(n_{H_2}=0.235L*1.50\frac{molHCl}{L}*\frac{3molH_2}{6molHCl} =0.176molH_2\)
Then, by using the ideal gas equation we compute the pressure of hydrogen for the collected 3.60 L at 25.0 °C (298.15 K):
\(P_{H_2}=\frac{n_{H_2}RT}{V} =\frac{0.176mol*0.082\frac{atm*L}{mol*K}*298.15K}{3.60L}=1.20atm\)
Finally, since the vapor pressure of water in at is 0.03129, the total pressure is then:
\(P=1.20atm+0.03129atm\\\\P=1.23atm\)
Best regards!
The pH at the Half-equivalence point of a weak base - strong acid tritation is:
A. Equal to pka
B. Equal to pKb
C. Less than 7.0
D. Equal to 7.0
E. Greater than 7.0
Answer:
Less than 7
Explanation:
during the titration of strong acid and weak base, the weak base is usually kept in the flask and strong acid is kept in the burette. So when we add strong acid slowly drop by drop, slowly the pH level of solution starts to decrease and at equivalence point the acid overpowers the base as a strong acid was taken over a weak base.
Conversions
If you traded (converted)
15 Skittles for M&Ms,
how many M&Ms do you
have?
Conversion Factor
6 Skittles 4 Cookies
1 Cookies = 2 M&Ms
If you traded (converted) 15 Skittles for M&Ms, you will have 20 M&Ms
How to convert 15 Skittles to cookiesWe'll begin by converting 15 Skittles to cookies. This can be obtained as follow:
6 Skittles = 4 Cookies
Therefore,
15 Skittles = (15 Skittles × 4 cookies) / 6 skittles
15 Skittles = 10 cookies
How to convert 10 cookies to M&MsWe can convert 10 cookies to M&Ms as follow:
1 Cookies = 2 M&Ms
Therefore,
10 cookies = (10 cookies × 2 M&Ms) / 1 Cookies
10 cookies = 20 M&Ms
Thus, 15 Skittles is equivalent to 20 M&Ms
Learn more about conversion:
https://brainly.com/question/11268872
#SPJ1
A compound with formula RuCl3⋅5H2O
is dissolved in water, forming a solution that is approximately the same color as the solid. Immediately after forming the solution, the addition of excess AgNO3(aq)
forms 2 mol
of solid AgCl
per mole of complex.
Part A
Write the formula for the compound, showing which ligands are likely to be present in the coordination sphere.
Express your answer as a chemical formula.
The chemical formula for the compound is [RuCl₃(H₂O)₂]Cl•3H₂O.
The compound with formula RuCl₃⋅5H₂O is a coordination complex that contains a central ruthenium ion coordinated to ligands such as water molecules (H₂O) and chloride ions (Cl⁻). The number 5 in the formula indicates that the complex contains 5 water molecules, which are likely coordinated to the ruthenium ion.
When this compound is dissolved in water, it forms a solution that is approximately the same color as the solid, indicating that the coordination sphere remains intact in solution. Addition of excess AgNO₃(aq) to this solution causes a precipitation reaction to occur, where 2 moles of solid AgCl are formed per mole of the complex. This indicates that the chloride ions in the coordination sphere are displaced by the Ag⁺ ions from the AgNO₃(aq), forming solid AgCl.
The formula for the complex is [RuCl₃(H₂O)₂]Cl•3H₂O, which indicates that the ruthenium ion is coordinated to two water molecules and three chloride ions, and that the compound also contains one chloride ion outside the coordination sphere, and 3 water molecules as part of the crystal structure.
To know more about chemical formula here
https://brainly.com/question/32018188
#SPJ1
What mass of NaCl is needed to produce a 26.4 mol/L with a 1.7 L volume?
we would need 2625.13 grams (or 2.62513 kilograms) of NaCl.
To calculate the mass of NaCl required to produce a 26.4 mol/L solution with a 1.7 L volume, we need to use the formula that relates the mass of solute, moles of solute, and molarity:Molarity (M) = moles of solute / liters of solution Rearranging this formula, we get:moles of solute = Molarity (M) x liters of solutionWe can use this formula to find the moles of NaCl needed:moles of NaCl = 26.4 mol/L x 1.7 L = 44.88 molNow, we can use the molar mass of NaCl to convert from moles to grams. The molar mass of NaCl is 58.44 g/mol:mass of NaCl = moles of NaCl x molar mass of NaClmass of NaCl = 44.88 mol x 58.44 g/mol = 2625.13 gTo produce a 26.4 mol/L solution with a 1.7 L volume.
for more question on NaCl
https://brainly.com/question/23269908
#SPJ8
Is ginger ale good for gas pains?
Answer:
Search it up. It says it on this link:
Please help I only need this one to finish!
Answer:
2CO(g) + O2(g) ⇌ 2CO2(g)
Increasing the concentration of CO - ↓ ↓ ↑
Increasing the concentration of CO2 - ↑ ↑ ↓
Explanation:
The given reaction is
2CO(g) + O2(g) ⇌ 2CO2(g)
a) When the concentration of CO is increased, the stress is relieved as the reaction that consumes the added CO occurs more rapidly than its reverse reaction, for example., the forward reaction rate increases. The equilibrium will shift in favor of the product. However, the concentration of reactants (CO and O2) decreases and product concentration (CO2) increases.
b) When the concentration of CO2 is increased, the stress is relieved as the reaction that consumes the added CO2 occurs more rapidly than its reverse reaction, for example., the rate of backward reaction increases. The equilibrium will shift in favor of the reactant. Therefore, the concentration of reactants (CO and O2) increases, and the product concentration (CO2) decreases.
Hope this helps!
What is the temperature of 2.60 mol of gas at a pressure of 102.63 atm and a volume of 341 mL
Answer:
164.04 K
Explanation:
PV = n RT R = gas constant = .082057 L-atm/(mol-K)
T will be in K
102.63 (.341) = 2.60 * .082057 * K
K = 164.04 K
0.2g of sand in two-third in liter of ethanol . What is the concentration in g per dm cube
The mass concentration of sand in the ethanol solution is 0.299 g/dm³.
What is the concentration in grams per dm³?To find the concentration in grams per cubic decimeter (g/dm³), we first need to convert the volume from liters to cubic decimeters (dm³). Since 1 liter is equal to 1 cubic decimeter, we can directly convert the volume.
Given:
Mass of sand = 0.2 g
Volume of ethanol = two-thirds liter
Converting volume to dm³:
1 liter = 1 cubic decimeter
two-thirds liter = (2/3) cubic decimeter = 0.67 dm³ (rounded to two decimal places)
Now we can calculate the concentration in g/dm³ by dividing the mass of sand by the volume in dm³:
Concentration = Mass / Volume
Concentration = 0.2 g / 0.67 dm³
Concentration ≈ 0.299 g/dm³ (rounded to three decimal places)
Learn more about mass concentration at: https://brainly.com/question/23437000
#SPJ1
Which one of the following compounds is insoluble in water?
A) Ba(OH)2
B) Ca3(PO4)2
C) NH4S04
D) Rb2CO3
Answer:
Ca3(PO4)2
Explanation:
Ca3(PO4)2 or calcium phosphate is insoluble in water.
Calculate the moles of Iron (Fe) in 3.8 x 10^{21} atoms of Iron. Please show your work
Answer: 6.31×10⁻³ moles Fe
Explanation:
To calculate moles when given atoms, we need to use Avogadro's number.
Avogadro's number: 6.022×10²³ atoms/mol
\((3.8*10^2^1 atoms)*\frac{mol}{6.022*10^2^3 atoms} =6.31*10^-^3 mols\)
The atoms cancel out, and we are left with moles. There are 6.31×10⁻³ moles Fe.
Given: H2 + O 2 → H2O1
the reaction occurs at ST.P a) Balance the chemical equation. (1 pts) b) Calculate the number of moles of the reactants needed to obtain 45 liner of H2O (2 pt) 4) Deduce the volume of the reactants (2 pts)
a) The balanced chemical equation for the reaction is: 2H₂ + O₂ → 2H₂O
b) the number of moles of O₂ required is approximately 1.004 moles.
c) approximately 45 liters of H₂ and 22.5 liters of O₂ are needed to obtain 45 liters of H₂O.
a) Balancing the chemical equation:
The balanced chemical equation for the reaction is: 2H₂ + O₂ → 2H₂O
b) Calculating the number of moles of the reactants needed to obtain 45 liters of H₂O:
From the balanced equation, we can see that for every 2 moles of H₂O produced, we need 2 moles of H₂ and 1 mole of O₂. Since the stoichiometry is based on moles, we need to convert the given volume of H2O into moles.
To convert volume to moles, we need to use the ideal gas law, PV = nRT. At standard temperature and pressure (STP), the molar volume of an ideal gas is 22.4 liters.
Given that we have 45 liters of H2O, we can calculate the number of moles as follows:
moles of H₂O = (volume of H₂O) / (molar volume at STP)
= 45 liters / 22.4 liters/mol
≈ 2.008 moles of H₂O
Since the stoichiometry of the reaction is 2 moles of H₂O for every 2 moles of H₂, we need an equal number of moles of H₂. Therefore, the number of moles of H₂ required is also approximately 2.008 moles.
For O₂, since the stoichiometry is 1 mole of O₂ for every 2 moles of H₂O, we need half the number of moles of H₂O. Thus, the number of moles of O₂required is approximately 1.004 moles.
c) the volume of the reactants:
Since the stoichiometry of the balanced equation is 2 moles of H₂for every 1 mole of O₂ and 2 moles of H₂O, we can deduce the volume of the reactants based on their molar volumes at STP.
For 2.008 moles of H₂, the volume can be calculated as follows:
volume of H₂= (moles of H₂) * (molar volume at STP)
= 2.008 moles * 22.4 liters/mol
≈ 45 liters of H₂
For 1.004 moles of O₂, the volume can be calculated similarly:
volume of O₂= (moles of O₂) * (molar volume at STP)
= 1.004 moles * 22.4 liters/mol
≈ 22.5 liters of O₂
Therefore, approximately 45 liters of H₂and 22.5 liters of O₂ are needed to obtain 45 liters of H₂O
for more questions on chemical
https://brainly.com/question/29886197
#SPJ8